diff --git a/__MACOSX/img/webp/._.DS_Store b/__MACOSX/img/webp/._.DS_Store new file mode 100644 index 0000000..a5b28df Binary files /dev/null and b/__MACOSX/img/webp/._.DS_Store differ diff --git a/content.html b/content.html new file mode 100644 index 0000000..2528d86 --- /dev/null +++ b/content.html @@ -0,0 +1,394 @@ + + + + + + + + + + + + + + + About + + + + + + + + + + + +
+
+
+
+
+
+

Example + of a
+ content page +

+

Lorem ipsum dolor sit amet, consetetur sadipscing + elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, sed diam + voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea + takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, consetetur sadipscing + elitr, sed diam nonumy eirmod tempor invidunt ut + labore et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et + ea rebum. Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor + invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. +

+
+
+
+
+
+ abstract image +
+
+
+
+
+

01. Dolor istam est

+

At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore + et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea + rebum. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita + kasd gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat.

+
+
+

tl;dr

+

+ Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit + amet +

+
+
+ +
+
+

02. Lorem ipsum

+

At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore + et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea + rebum. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita + kasd gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat.

+
+
+

tl;dr

+

+ Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit + amet +

+
+
+
+
+

03. Dolor sitam est +

+

At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore + et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea + rebum. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita + kasd gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat.

+
+
+

tl;dr

+

+ Et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea takimata sanctus est + Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet +

+
+
+
+
+

04. Eirmod tempor invidunt

+

Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem ipsum dolor sit + amet. Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut + labore et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et + ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita kasd gubergren, no sea takimata sanctus + est Lorem ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut + labore et dolore magna aliquyam erat.

+
+
+

tl;dr

+

+ Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit + amet +

+
+
+
+
+

05. Lorem ipsum

+

At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore + et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea + rebum. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita + kasd gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. + Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam + erat.

+
+
+

tl;dr

+

+ Eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea takimata sanctus est + Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet +

+
+
+ + +
+
+
+
+
+

*At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea takimata + sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam + nonumy eirmod tempor invidunt ut labore + et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. + Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd + gubergren, no sea takimata sanctus est Lorem + ipsum dolor sit amet. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. + Consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam + erat.

+
+
+
+
+ +
+ + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/css/theme.css b/css/theme.css new file mode 100644 index 0000000..8699348 --- /dev/null +++ b/css/theme.css @@ -0,0 +1,10040 @@ +/*! + * Bootstrap v5.2.1 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +:root { + --bs-blue: #1717e5; + --bs-indigo: #6610f2; + --bs-purple: #6f42c1; + --bs-pink: #d63384; + --bs-red: #dc3545; + --bs-orange: #fd7e14; + --bs-yellow: #ffc107; + --bs-green: #198754; + --bs-teal: #20c997; + --bs-cyan: #0dcaf0; + --bs-white: #fff; + --bs-gray: #8a8a8e; + --bs-gray-dark: #343a40; + --bs-gray-100: #f8f9fa; + --bs-gray-200: #e9ecef; + --bs-gray-300: #dee2e6; + --bs-gray-400: #ced4da; + --bs-gray-500: #adb5bd; + --bs-gray-600: #8a8a8e; + --bs-gray-700: #495057; + --bs-gray-800: #343a40; + --bs-gray-900: #202020; + --bs-primary: #1717e5; + --bs-secondary: #8a8a8e; + --bs-success: #198754; + --bs-info: #0dcaf0; + --bs-warning: #ffc107; + --bs-danger: #dc3545; + --bs-light: #f8f9fa; + --bs-dark: #202020; + --bs-primary-rgb: 23, 23, 229; + --bs-secondary-rgb: 138, 138, 142; + --bs-success-rgb: 25, 135, 84; + --bs-info-rgb: 13, 202, 240; + --bs-warning-rgb: 255, 193, 7; + --bs-danger-rgb: 220, 53, 69; + --bs-light-rgb: 248, 249, 250; + --bs-dark-rgb: 32, 32, 32; + --bs-white-rgb: 255, 255, 255; + --bs-black-rgb: 17, 17, 17; + --bs-body-color-rgb: 32, 32, 32; + --bs-body-bg-rgb: 255, 255, 255; + --bs-font-sans-serif: "Inter", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0)); + --bs-body-font-family: var(--bs-font-sans-serif); + --bs-body-font-size: 1.2rem; + --bs-body-font-weight: 400; + --bs-body-line-height: 1.5; + --bs-body-color: #202020; + --bs-body-bg: #fff; + --bs-border-width: 1px; + --bs-border-style: solid; + --bs-border-color: #dee2e6; + --bs-border-color-translucent: rgba(17, 17, 17, 0.175); + --bs-border-radius: 0.375rem; + --bs-border-radius-sm: 0.25rem; + --bs-border-radius-lg: 0.5rem; + --bs-border-radius-xl: 1rem; + --bs-border-radius-2xl: 2rem; + --bs-border-radius-pill: 50rem; + --bs-link-color: #1717e5; + --bs-link-hover-color: #1212b7; + --bs-code-color: #d63384; + --bs-highlight-bg: #fff3cd; } + +*, +*::before, +*::after { + box-sizing: border-box; } + +@media (prefers-reduced-motion: no-preference) { + :root { + scroll-behavior: smooth; } } + +body { + margin: 0; + font-family: var(--bs-body-font-family); + font-size: var(--bs-body-font-size); + font-weight: var(--bs-body-font-weight); + line-height: var(--bs-body-line-height); + color: var(--bs-body-color); + text-align: var(--bs-body-text-align); + background-color: var(--bs-body-bg); + -webkit-text-size-adjust: 100%; + -webkit-tap-highlight-color: rgba(17, 17, 17, 0); } + +hr { + margin: 1rem 0; + color: inherit; + border: 0; + border-top: 1px solid; + opacity: 0.25; } + +h1, .h1, h2, .h2, h3, .h3, h4, .h4, h5, .h5, h6, .h6 { + margin-top: 0; + margin-bottom: 0.5rem; + font-weight: 500; + line-height: 1.2; } + +h1, .h1 { + font-size: calc(1.425rem + 2.1vw); } + @media (min-width: 1200px) { + h1, .h1 { + font-size: 3rem; } } + +h2, .h2 { + font-size: calc(1.365rem + 1.38vw); } + @media (min-width: 1200px) { + h2, .h2 { + font-size: 2.4rem; } } + +h3, .h3 { + font-size: calc(1.335rem + 1.02vw); } + @media (min-width: 1200px) { + h3, .h3 { + font-size: 2.1rem; } } + +h4, .h4 { + font-size: calc(1.305rem + 0.66vw); } + @media (min-width: 1200px) { + h4, .h4 { + font-size: 1.8rem; } } + +h5, .h5 { + font-size: calc(1.275rem + 0.3vw); } + @media (min-width: 1200px) { + h5, .h5 { + font-size: 1.5rem; } } + +h6, .h6 { + font-size: 1.2rem; } + +p { + margin-top: 0; + margin-bottom: 1rem; } + +abbr[title] { + text-decoration: underline dotted; + cursor: help; + text-decoration-skip-ink: none; } + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; } + +ol, +ul { + padding-left: 2rem; } + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; } + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; } + +dt { + font-weight: 700; } + +dd { + margin-bottom: .5rem; + margin-left: 0; } + +blockquote { + margin: 0 0 1rem; } + +b, +strong { + font-weight: bolder; } + +small, .small { + font-size: 0.875em; } + +mark, .mark { + padding: 0.1875em; + background-color: var(--bs-highlight-bg); } + +sub, +sup { + position: relative; + font-size: 0.75em; + line-height: 0; + vertical-align: baseline; } + +sub { + bottom: -.25em; } + +sup { + top: -.5em; } + +a { + color: var(--bs-link-color); + text-decoration: underline; } + a:hover { + color: var(--bs-link-hover-color); } + +a:not([href]):not([class]), a:not([href]):not([class]):hover { + color: inherit; + text-decoration: none; } + +pre, +code, +kbd, +samp { + font-family: var(--bs-font-monospace); + font-size: 1em; } + +pre { + display: block; + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + font-size: 0.875em; } + pre code { + font-size: inherit; + color: inherit; + word-break: normal; } + +code { + font-size: 0.875em; + color: var(--bs-code-color); + word-wrap: break-word; } + a > code { + color: inherit; } + +kbd { + padding: 0.1875rem 0.375rem; + font-size: 0.875em; + color: var(--bs-body-bg); + background-color: var(--bs-body-color); + border-radius: 0.25rem; } + kbd kbd { + padding: 0; + font-size: 1em; } + +figure { + margin: 0 0 1rem; } + +img, +svg { + vertical-align: middle; } + +table { + caption-side: bottom; + border-collapse: collapse; } + +caption { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + color: #8a8a8e; + text-align: left; } + +th { + text-align: inherit; + text-align: -webkit-match-parent; } + +thead, +tbody, +tfoot, +tr, +td, +th { + border-color: inherit; + border-style: solid; + border-width: 0; } + +label { + display: inline-block; } + +button { + border-radius: 0; } + +button:focus:not(:focus-visible) { + outline: 0; } + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; } + +button, +select { + text-transform: none; } + +[role="button"] { + cursor: pointer; } + +select { + word-wrap: normal; } + select:disabled { + opacity: 1; } + +[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator { + display: none !important; } + +button, +[type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; } + button:not(:disabled), + [type="button"]:not(:disabled), + [type="reset"]:not(:disabled), + [type="submit"]:not(:disabled) { + cursor: pointer; } + +::-moz-focus-inner { + padding: 0; + border-style: none; } + +textarea { + resize: vertical; } + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; } + +legend { + float: left; + width: 100%; + padding: 0; + margin-bottom: 0.5rem; + font-size: calc(1.275rem + 0.3vw); + line-height: inherit; } + @media (min-width: 1200px) { + legend { + font-size: 1.5rem; } } + legend + * { + clear: left; } + +::-webkit-datetime-edit-fields-wrapper, +::-webkit-datetime-edit-text, +::-webkit-datetime-edit-minute, +::-webkit-datetime-edit-hour-field, +::-webkit-datetime-edit-day-field, +::-webkit-datetime-edit-month-field, +::-webkit-datetime-edit-year-field { + padding: 0; } + +::-webkit-inner-spin-button { + height: auto; } + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: textfield; } + +/* rtl:raw: +[type="tel"], +[type="url"], +[type="email"], +[type="number"] { + direction: ltr; +} +*/ +::-webkit-search-decoration { + -webkit-appearance: none; } + +::-webkit-color-swatch-wrapper { + padding: 0; } + +::file-selector-button { + font: inherit; + -webkit-appearance: button; } + +output { + display: inline-block; } + +iframe { + border: 0; } + +summary { + display: list-item; + cursor: pointer; } + +progress { + vertical-align: baseline; } + +[hidden] { + display: none !important; } + +.lead { + font-size: calc(1.2846rem + 0.4152vw); + font-weight: 300; } + @media (min-width: 1200px) { + .lead { + font-size: 1.596rem; } } + +.display-1 { + font-size: calc(1.625rem + 4.5vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-1 { + font-size: 5rem; } } + +.display-2 { + font-size: calc(1.575rem + 3.9vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-2 { + font-size: 4.5rem; } } + +.display-3 { + font-size: calc(1.525rem + 3.3vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-3 { + font-size: 4rem; } } + +.display-4 { + font-size: calc(1.475rem + 2.7vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-4 { + font-size: 3.5rem; } } + +.display-5 { + font-size: calc(1.425rem + 2.1vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-5 { + font-size: 3rem; } } + +.display-6 { + font-size: calc(1.375rem + 1.5vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-6 { + font-size: 2.5rem; } } + +.list-unstyled { + padding-left: 0; + list-style: none; } + +.list-inline { + padding-left: 0; + list-style: none; } + +.list-inline-item { + display: inline-block; } + .list-inline-item:not(:last-child) { + margin-right: 0.5rem; } + +.initialism { + font-size: 0.875em; + text-transform: uppercase; } + +.blockquote { + margin-bottom: 1rem; + font-size: calc(1.275rem + 0.3vw); } + @media (min-width: 1200px) { + .blockquote { + font-size: 1.5rem; } } + .blockquote > :last-child { + margin-bottom: 0; } + +.blockquote-footer { + margin-top: -1rem; + margin-bottom: 1rem; + font-size: 0.875em; + color: #8a8a8e; } + .blockquote-footer::before { + content: "\2014\00A0"; } + +.img-fluid { + max-width: 100%; + height: auto; } + +.img-thumbnail { + padding: 0.25rem; + background-color: #fff; + border: 1px solid var(--bs-border-color); + border-radius: 0.375rem; + max-width: 100%; + height: auto; } + +.figure { + display: inline-block; } + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; } + +.figure-caption { + font-size: 0.875em; + color: #8a8a8e; } + +.container, +.container-fluid, +.container-sm, +.container-md, +.container-lg, +.container-xl, +.container-xxl { + --bs-gutter-x: 4vw; + --bs-gutter-y: 0; + width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-right: auto; + margin-left: auto; } + +@media (min-width: 576px) { + .container, .container-sm { + max-width: 540px; } } + +@media (min-width: 768px) { + .container, .container-sm, .container-md { + max-width: 720px; } } + +@media (min-width: 992px) { + .container, .container-sm, .container-md, .container-lg { + max-width: 960px; } } + +@media (min-width: 1200px) { + .container, .container-sm, .container-md, .container-lg, .container-xl { + max-width: 1140px; } } + +@media (min-width: 1680px) { + .container, .container-sm, .container-md, .container-lg, .container-xl, .container-xxl { + max-width: 1600px; } } + +.row { + --bs-gutter-x: 4vw; + --bs-gutter-y: 0; + display: flex; + flex-wrap: wrap; + margin-top: calc(-1 * var(--bs-gutter-y)); + margin-right: calc(-.5 * var(--bs-gutter-x)); + margin-left: calc(-.5 * var(--bs-gutter-x)); } + .row > * { + flex-shrink: 0; + width: 100%; + max-width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-top: var(--bs-gutter-y); } + +.col { + flex: 1 0 0%; } + +.row-cols-auto > * { + flex: 0 0 auto; + width: auto; } + +.row-cols-1 > * { + flex: 0 0 auto; + width: 100%; } + +.row-cols-2 > * { + flex: 0 0 auto; + width: 50%; } + +.row-cols-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + +.row-cols-4 > * { + flex: 0 0 auto; + width: 25%; } + +.row-cols-5 > * { + flex: 0 0 auto; + width: 20%; } + +.row-cols-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + +.col-auto { + flex: 0 0 auto; + width: auto; } + +.col-1 { + flex: 0 0 auto; + width: 8.33333%; } + +.col-2 { + flex: 0 0 auto; + width: 16.66667%; } + +.col-3 { + flex: 0 0 auto; + width: 25%; } + +.col-4 { + flex: 0 0 auto; + width: 33.33333%; } + +.col-5 { + flex: 0 0 auto; + width: 41.66667%; } + +.col-6 { + flex: 0 0 auto; + width: 50%; } + +.col-7 { + flex: 0 0 auto; + width: 58.33333%; } + +.col-8 { + flex: 0 0 auto; + width: 66.66667%; } + +.col-9 { + flex: 0 0 auto; + width: 75%; } + +.col-10 { + flex: 0 0 auto; + width: 83.33333%; } + +.col-11 { + flex: 0 0 auto; + width: 91.66667%; } + +.col-12 { + flex: 0 0 auto; + width: 100%; } + +.offset-1 { + margin-left: 8.33333%; } + +.offset-2 { + margin-left: 16.66667%; } + +.offset-3 { + margin-left: 25%; } + +.offset-4 { + margin-left: 33.33333%; } + +.offset-5 { + margin-left: 41.66667%; } + +.offset-6 { + margin-left: 50%; } + +.offset-7 { + margin-left: 58.33333%; } + +.offset-8 { + margin-left: 66.66667%; } + +.offset-9 { + margin-left: 75%; } + +.offset-10 { + margin-left: 83.33333%; } + +.offset-11 { + margin-left: 91.66667%; } + +.g-0, +.gx-0 { + --bs-gutter-x: 0; } + +.g-0, +.gy-0 { + --bs-gutter-y: 0; } + +.g-1, +.gx-1 { + --bs-gutter-x: 0.25rem; } + +.g-1, +.gy-1 { + --bs-gutter-y: 0.25rem; } + +.g-2, +.gx-2 { + --bs-gutter-x: 0.5rem; } + +.g-2, +.gy-2 { + --bs-gutter-y: 0.5rem; } + +.g-3, +.gx-3 { + --bs-gutter-x: 1rem; } + +.g-3, +.gy-3 { + --bs-gutter-y: 1rem; } + +.g-4, +.gx-4 { + --bs-gutter-x: 1.5rem; } + +.g-4, +.gy-4 { + --bs-gutter-y: 1.5rem; } + +.g-5, +.gx-5 { + --bs-gutter-x: 3rem; } + +.g-5, +.gy-5 { + --bs-gutter-y: 3rem; } + +@media (min-width: 576px) { + .col-sm { + flex: 1 0 0%; } + .row-cols-sm-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-sm-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-sm-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-sm-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + .row-cols-sm-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-sm-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-sm-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + .col-sm-auto { + flex: 0 0 auto; + width: auto; } + .col-sm-1 { + flex: 0 0 auto; + width: 8.33333%; } + .col-sm-2 { + flex: 0 0 auto; + width: 16.66667%; } + .col-sm-3 { + flex: 0 0 auto; + width: 25%; } + .col-sm-4 { + flex: 0 0 auto; + width: 33.33333%; } + .col-sm-5 { + flex: 0 0 auto; + width: 41.66667%; } + .col-sm-6 { + flex: 0 0 auto; + width: 50%; } + .col-sm-7 { + flex: 0 0 auto; + width: 58.33333%; } + .col-sm-8 { + flex: 0 0 auto; + width: 66.66667%; } + .col-sm-9 { + flex: 0 0 auto; + width: 75%; } + .col-sm-10 { + flex: 0 0 auto; + width: 83.33333%; } + .col-sm-11 { + flex: 0 0 auto; + width: 91.66667%; } + .col-sm-12 { + flex: 0 0 auto; + width: 100%; } + .offset-sm-0 { + margin-left: 0; } + .offset-sm-1 { + margin-left: 8.33333%; } + .offset-sm-2 { + margin-left: 16.66667%; } + .offset-sm-3 { + margin-left: 25%; } + .offset-sm-4 { + margin-left: 33.33333%; } + .offset-sm-5 { + margin-left: 41.66667%; } + .offset-sm-6 { + margin-left: 50%; } + .offset-sm-7 { + margin-left: 58.33333%; } + .offset-sm-8 { + margin-left: 66.66667%; } + .offset-sm-9 { + margin-left: 75%; } + .offset-sm-10 { + margin-left: 83.33333%; } + .offset-sm-11 { + margin-left: 91.66667%; } + .g-sm-0, + .gx-sm-0 { + --bs-gutter-x: 0; } + .g-sm-0, + .gy-sm-0 { + --bs-gutter-y: 0; } + .g-sm-1, + .gx-sm-1 { + --bs-gutter-x: 0.25rem; } + .g-sm-1, + .gy-sm-1 { + --bs-gutter-y: 0.25rem; } + .g-sm-2, + .gx-sm-2 { + --bs-gutter-x: 0.5rem; } + .g-sm-2, + .gy-sm-2 { + --bs-gutter-y: 0.5rem; } + .g-sm-3, + .gx-sm-3 { + --bs-gutter-x: 1rem; } + .g-sm-3, + .gy-sm-3 { + --bs-gutter-y: 1rem; } + .g-sm-4, + .gx-sm-4 { + --bs-gutter-x: 1.5rem; } + .g-sm-4, + .gy-sm-4 { + --bs-gutter-y: 1.5rem; } + .g-sm-5, + .gx-sm-5 { + --bs-gutter-x: 3rem; } + .g-sm-5, + .gy-sm-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 768px) { + .col-md { + flex: 1 0 0%; } + .row-cols-md-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-md-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-md-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-md-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + .row-cols-md-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-md-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-md-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + .col-md-auto { + flex: 0 0 auto; + width: auto; } + .col-md-1 { + flex: 0 0 auto; + width: 8.33333%; } + .col-md-2 { + flex: 0 0 auto; + width: 16.66667%; } + .col-md-3 { + flex: 0 0 auto; + width: 25%; } + .col-md-4 { + flex: 0 0 auto; + width: 33.33333%; } + .col-md-5 { + flex: 0 0 auto; + width: 41.66667%; } + .col-md-6 { + flex: 0 0 auto; + width: 50%; } + .col-md-7 { + flex: 0 0 auto; + width: 58.33333%; } + .col-md-8 { + flex: 0 0 auto; + width: 66.66667%; } + .col-md-9 { + flex: 0 0 auto; + width: 75%; } + .col-md-10 { + flex: 0 0 auto; + width: 83.33333%; } + .col-md-11 { + flex: 0 0 auto; + width: 91.66667%; } + .col-md-12 { + flex: 0 0 auto; + width: 100%; } + .offset-md-0 { + margin-left: 0; } + .offset-md-1 { + margin-left: 8.33333%; } + .offset-md-2 { + margin-left: 16.66667%; } + .offset-md-3 { + margin-left: 25%; } + .offset-md-4 { + margin-left: 33.33333%; } + .offset-md-5 { + margin-left: 41.66667%; } + .offset-md-6 { + margin-left: 50%; } + .offset-md-7 { + margin-left: 58.33333%; } + .offset-md-8 { + margin-left: 66.66667%; } + .offset-md-9 { + margin-left: 75%; } + .offset-md-10 { + margin-left: 83.33333%; } + .offset-md-11 { + margin-left: 91.66667%; } + .g-md-0, + .gx-md-0 { + --bs-gutter-x: 0; } + .g-md-0, + .gy-md-0 { + --bs-gutter-y: 0; } + .g-md-1, + .gx-md-1 { + --bs-gutter-x: 0.25rem; } + .g-md-1, + .gy-md-1 { + --bs-gutter-y: 0.25rem; } + .g-md-2, + .gx-md-2 { + --bs-gutter-x: 0.5rem; } + .g-md-2, + .gy-md-2 { + --bs-gutter-y: 0.5rem; } + .g-md-3, + .gx-md-3 { + --bs-gutter-x: 1rem; } + .g-md-3, + .gy-md-3 { + --bs-gutter-y: 1rem; } + .g-md-4, + .gx-md-4 { + --bs-gutter-x: 1.5rem; } + .g-md-4, + .gy-md-4 { + --bs-gutter-y: 1.5rem; } + .g-md-5, + .gx-md-5 { + --bs-gutter-x: 3rem; } + .g-md-5, + .gy-md-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 992px) { + .col-lg { + flex: 1 0 0%; } + .row-cols-lg-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-lg-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-lg-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-lg-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + .row-cols-lg-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-lg-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-lg-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + .col-lg-auto { + flex: 0 0 auto; + width: auto; } + .col-lg-1 { + flex: 0 0 auto; + width: 8.33333%; } + .col-lg-2 { + flex: 0 0 auto; + width: 16.66667%; } + .col-lg-3 { + flex: 0 0 auto; + width: 25%; } + .col-lg-4 { + flex: 0 0 auto; + width: 33.33333%; } + .col-lg-5 { + flex: 0 0 auto; + width: 41.66667%; } + .col-lg-6 { + flex: 0 0 auto; + width: 50%; } + .col-lg-7 { + flex: 0 0 auto; + width: 58.33333%; } + .col-lg-8 { + flex: 0 0 auto; + width: 66.66667%; } + .col-lg-9 { + flex: 0 0 auto; + width: 75%; } + .col-lg-10 { + flex: 0 0 auto; + width: 83.33333%; } + .col-lg-11 { + flex: 0 0 auto; + width: 91.66667%; } + .col-lg-12 { + flex: 0 0 auto; + width: 100%; } + .offset-lg-0 { + margin-left: 0; } + .offset-lg-1 { + margin-left: 8.33333%; } + .offset-lg-2 { + margin-left: 16.66667%; } + .offset-lg-3 { + margin-left: 25%; } + .offset-lg-4 { + margin-left: 33.33333%; } + .offset-lg-5 { + margin-left: 41.66667%; } + .offset-lg-6 { + margin-left: 50%; } + .offset-lg-7 { + margin-left: 58.33333%; } + .offset-lg-8 { + margin-left: 66.66667%; } + .offset-lg-9 { + margin-left: 75%; } + .offset-lg-10 { + margin-left: 83.33333%; } + .offset-lg-11 { + margin-left: 91.66667%; } + .g-lg-0, + .gx-lg-0 { + --bs-gutter-x: 0; } + .g-lg-0, + .gy-lg-0 { + --bs-gutter-y: 0; } + .g-lg-1, + .gx-lg-1 { + --bs-gutter-x: 0.25rem; } + .g-lg-1, + .gy-lg-1 { + --bs-gutter-y: 0.25rem; } + .g-lg-2, + .gx-lg-2 { + --bs-gutter-x: 0.5rem; } + .g-lg-2, + .gy-lg-2 { + --bs-gutter-y: 0.5rem; } + .g-lg-3, + .gx-lg-3 { + --bs-gutter-x: 1rem; } + .g-lg-3, + .gy-lg-3 { + --bs-gutter-y: 1rem; } + .g-lg-4, + .gx-lg-4 { + --bs-gutter-x: 1.5rem; } + .g-lg-4, + .gy-lg-4 { + --bs-gutter-y: 1.5rem; } + .g-lg-5, + .gx-lg-5 { + --bs-gutter-x: 3rem; } + .g-lg-5, + .gy-lg-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 1200px) { + .col-xl { + flex: 1 0 0%; } + .row-cols-xl-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-xl-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-xl-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-xl-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + .row-cols-xl-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-xl-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-xl-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + .col-xl-auto { + flex: 0 0 auto; + width: auto; } + .col-xl-1 { + flex: 0 0 auto; + width: 8.33333%; } + .col-xl-2 { + flex: 0 0 auto; + width: 16.66667%; } + .col-xl-3 { + flex: 0 0 auto; + width: 25%; } + .col-xl-4 { + flex: 0 0 auto; + width: 33.33333%; } + .col-xl-5 { + flex: 0 0 auto; + width: 41.66667%; } + .col-xl-6 { + flex: 0 0 auto; + width: 50%; } + .col-xl-7 { + flex: 0 0 auto; + width: 58.33333%; } + .col-xl-8 { + flex: 0 0 auto; + width: 66.66667%; } + .col-xl-9 { + flex: 0 0 auto; + width: 75%; } + .col-xl-10 { + flex: 0 0 auto; + width: 83.33333%; } + .col-xl-11 { + flex: 0 0 auto; + width: 91.66667%; } + .col-xl-12 { + flex: 0 0 auto; + width: 100%; } + .offset-xl-0 { + margin-left: 0; } + .offset-xl-1 { + margin-left: 8.33333%; } + .offset-xl-2 { + margin-left: 16.66667%; } + .offset-xl-3 { + margin-left: 25%; } + .offset-xl-4 { + margin-left: 33.33333%; } + .offset-xl-5 { + margin-left: 41.66667%; } + .offset-xl-6 { + margin-left: 50%; } + .offset-xl-7 { + margin-left: 58.33333%; } + .offset-xl-8 { + margin-left: 66.66667%; } + .offset-xl-9 { + margin-left: 75%; } + .offset-xl-10 { + margin-left: 83.33333%; } + .offset-xl-11 { + margin-left: 91.66667%; } + .g-xl-0, + .gx-xl-0 { + --bs-gutter-x: 0; } + .g-xl-0, + .gy-xl-0 { + --bs-gutter-y: 0; } + .g-xl-1, + .gx-xl-1 { + --bs-gutter-x: 0.25rem; } + .g-xl-1, + .gy-xl-1 { + --bs-gutter-y: 0.25rem; } + .g-xl-2, + .gx-xl-2 { + --bs-gutter-x: 0.5rem; } + .g-xl-2, + .gy-xl-2 { + --bs-gutter-y: 0.5rem; } + .g-xl-3, + .gx-xl-3 { + --bs-gutter-x: 1rem; } + .g-xl-3, + .gy-xl-3 { + --bs-gutter-y: 1rem; } + .g-xl-4, + .gx-xl-4 { + --bs-gutter-x: 1.5rem; } + .g-xl-4, + .gy-xl-4 { + --bs-gutter-y: 1.5rem; } + .g-xl-5, + .gx-xl-5 { + --bs-gutter-x: 3rem; } + .g-xl-5, + .gy-xl-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 1680px) { + .col-xxl { + flex: 1 0 0%; } + .row-cols-xxl-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-xxl-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-xxl-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-xxl-3 > * { + flex: 0 0 auto; + width: 33.33333%; } + .row-cols-xxl-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-xxl-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-xxl-6 > * { + flex: 0 0 auto; + width: 16.66667%; } + .col-xxl-auto { + flex: 0 0 auto; + width: auto; } + .col-xxl-1 { + flex: 0 0 auto; + width: 8.33333%; } + .col-xxl-2 { + flex: 0 0 auto; + width: 16.66667%; } + .col-xxl-3 { + flex: 0 0 auto; + width: 25%; } + .col-xxl-4 { + flex: 0 0 auto; + width: 33.33333%; } + .col-xxl-5 { + flex: 0 0 auto; + width: 41.66667%; } + .col-xxl-6 { + flex: 0 0 auto; + width: 50%; } + .col-xxl-7 { + flex: 0 0 auto; + width: 58.33333%; } + .col-xxl-8 { + flex: 0 0 auto; + width: 66.66667%; } + .col-xxl-9 { + flex: 0 0 auto; + width: 75%; } + .col-xxl-10 { + flex: 0 0 auto; + width: 83.33333%; } + .col-xxl-11 { + flex: 0 0 auto; + width: 91.66667%; } + .col-xxl-12 { + flex: 0 0 auto; + width: 100%; } + .offset-xxl-0 { + margin-left: 0; } + .offset-xxl-1 { + margin-left: 8.33333%; } + .offset-xxl-2 { + margin-left: 16.66667%; } + .offset-xxl-3 { + margin-left: 25%; } + .offset-xxl-4 { + margin-left: 33.33333%; } + .offset-xxl-5 { + margin-left: 41.66667%; } + .offset-xxl-6 { + margin-left: 50%; } + .offset-xxl-7 { + margin-left: 58.33333%; } + .offset-xxl-8 { + margin-left: 66.66667%; } + .offset-xxl-9 { + margin-left: 75%; } + .offset-xxl-10 { + margin-left: 83.33333%; } + .offset-xxl-11 { + margin-left: 91.66667%; } + .g-xxl-0, + .gx-xxl-0 { + --bs-gutter-x: 0; } + .g-xxl-0, + .gy-xxl-0 { + --bs-gutter-y: 0; } + .g-xxl-1, + .gx-xxl-1 { + --bs-gutter-x: 0.25rem; } + .g-xxl-1, + .gy-xxl-1 { + --bs-gutter-y: 0.25rem; } + .g-xxl-2, + .gx-xxl-2 { + --bs-gutter-x: 0.5rem; } + .g-xxl-2, + .gy-xxl-2 { + --bs-gutter-y: 0.5rem; } + .g-xxl-3, + .gx-xxl-3 { + --bs-gutter-x: 1rem; } + .g-xxl-3, + .gy-xxl-3 { + --bs-gutter-y: 1rem; } + .g-xxl-4, + .gx-xxl-4 { + --bs-gutter-x: 1.5rem; } + .g-xxl-4, + .gy-xxl-4 { + --bs-gutter-y: 1.5rem; } + .g-xxl-5, + .gx-xxl-5 { + --bs-gutter-x: 3rem; } + .g-xxl-5, + .gy-xxl-5 { + --bs-gutter-y: 3rem; } } + +.table { + --bs-table-color: var(--bs-body-color); + --bs-table-bg: transparent; + --bs-table-border-color: var(--bs-border-color); + --bs-table-accent-bg: transparent; + --bs-table-striped-color: var(--bs-body-color); + --bs-table-striped-bg: rgba(17, 17, 17, 0.05); + --bs-table-active-color: var(--bs-body-color); + --bs-table-active-bg: rgba(17, 17, 17, 0.1); + --bs-table-hover-color: var(--bs-body-color); + --bs-table-hover-bg: rgba(17, 17, 17, 0.075); + width: 100%; + margin-bottom: 1rem; + color: var(--bs-table-color); + vertical-align: top; + border-color: var(--bs-table-border-color); } + .table > :not(caption) > * > * { + padding: 0.5rem 0.5rem; + background-color: var(--bs-table-bg); + border-bottom-width: 1px; + box-shadow: inset 0 0 0 9999px var(--bs-table-accent-bg); } + .table > tbody { + vertical-align: inherit; } + .table > thead { + vertical-align: bottom; } + +.table-group-divider { + border-top: 2px solid currentcolor; } + +.caption-top { + caption-side: top; } + +.table-sm > :not(caption) > * > * { + padding: 0.25rem 0.25rem; } + +.table-bordered > :not(caption) > * { + border-width: 1px 0; } + .table-bordered > :not(caption) > * > * { + border-width: 0 1px; } + +.table-borderless > :not(caption) > * > * { + border-bottom-width: 0; } + +.table-borderless > :not(:first-child) { + border-top-width: 0; } + +.table-striped > tbody > tr:nth-of-type(odd) > * { + --bs-table-accent-bg: var(--bs-table-striped-bg); + color: var(--bs-table-striped-color); } + +.table-striped-columns > :not(caption) > tr > :nth-child(even) { + --bs-table-accent-bg: var(--bs-table-striped-bg); + color: var(--bs-table-striped-color); } + +.table-active { + --bs-table-accent-bg: var(--bs-table-active-bg); + color: var(--bs-table-active-color); } + +.table-hover > tbody > tr:hover > * { + --bs-table-accent-bg: var(--bs-table-hover-bg); + color: var(--bs-table-hover-color); } + +.table-primary { + --bs-table-color: #111; + --bs-table-bg: #d1d1fa; + --bs-table-border-color: #bebee3; + --bs-table-striped-bg: #c7c7ee; + --bs-table-striped-color: #111; + --bs-table-active-bg: #bebee3; + --bs-table-active-color: #111; + --bs-table-hover-bg: #c3c3e9; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-secondary { + --bs-table-color: #111; + --bs-table-bg: #e8e8e8; + --bs-table-border-color: lightgray; + --bs-table-striped-bg: #dddddd; + --bs-table-striped-color: #111; + --bs-table-active-bg: lightgray; + --bs-table-active-color: #111; + --bs-table-hover-bg: #d8d8d8; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-success { + --bs-table-color: #111; + --bs-table-bg: #d1e7dd; + --bs-table-border-color: #bed2c9; + --bs-table-striped-bg: #c7dcd3; + --bs-table-striped-color: #111; + --bs-table-active-bg: #bed2c9; + --bs-table-active-color: #111; + --bs-table-hover-bg: #c3d7ce; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-info { + --bs-table-color: #111; + --bs-table-bg: #cff4fc; + --bs-table-border-color: #bcdde5; + --bs-table-striped-bg: #c6e9f0; + --bs-table-striped-color: #111; + --bs-table-active-bg: #bcdde5; + --bs-table-active-color: #111; + --bs-table-hover-bg: #c1e3ea; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-warning { + --bs-table-color: #111; + --bs-table-bg: #fff3cd; + --bs-table-border-color: #e7dcba; + --bs-table-striped-bg: #f3e8c4; + --bs-table-striped-color: #111; + --bs-table-active-bg: #e7dcba; + --bs-table-active-color: #111; + --bs-table-hover-bg: #ede2bf; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-danger { + --bs-table-color: #111; + --bs-table-bg: #f8d7da; + --bs-table-border-color: #e1c3c6; + --bs-table-striped-bg: #eccdd0; + --bs-table-striped-color: #111; + --bs-table-active-bg: #e1c3c6; + --bs-table-active-color: #111; + --bs-table-hover-bg: #e7c8cb; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-light { + --bs-table-color: #111; + --bs-table-bg: #f8f9fa; + --bs-table-border-color: #e1e2e3; + --bs-table-striped-bg: #ecedee; + --bs-table-striped-color: #111; + --bs-table-active-bg: #e1e2e3; + --bs-table-active-color: #111; + --bs-table-hover-bg: #e7e8e9; + --bs-table-hover-color: #111; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-dark { + --bs-table-color: #fff; + --bs-table-bg: #202020; + --bs-table-border-color: #363636; + --bs-table-striped-bg: #2b2b2b; + --bs-table-striped-color: #fff; + --bs-table-active-bg: #363636; + --bs-table-active-color: #fff; + --bs-table-hover-bg: #313131; + --bs-table-hover-color: #fff; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-responsive { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } + +@media (max-width: 575.98px) { + .table-responsive-sm { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 767.98px) { + .table-responsive-md { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 991.98px) { + .table-responsive-lg { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 1199.98px) { + .table-responsive-xl { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 1679.98px) { + .table-responsive-xxl { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +.form-label { + margin-bottom: 0.5rem; } + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.5; } + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: calc(1.275rem + 0.3vw); } + @media (min-width: 1200px) { + .col-form-label-lg { + font-size: 1.5rem; } } + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 1.05rem; } + +.form-text { + margin-top: 0.25rem; + font-size: 0.875em; + color: #8a8a8e; } + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 1.2rem; + font-weight: 400; + line-height: 1.5; + color: #202020; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #ced4da; + appearance: none; + border-radius: 0.375rem; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-control { + transition: none; } } + .form-control[type="file"] { + overflow: hidden; } + .form-control[type="file"]:not(:disabled):not([readonly]) { + cursor: pointer; } + .form-control:focus { + color: #202020; + background-color: #fff; + border-color: #8b8bf2; + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); } + .form-control::-webkit-date-and-time-value { + height: 1.5em; } + .form-control::placeholder { + color: #8a8a8e; + opacity: 1; } + .form-control:disabled { + background-color: #e9ecef; + opacity: 1; } + .form-control::file-selector-button { + padding: 0.375rem 0.75rem; + margin: -0.375rem -0.75rem; + margin-inline-end: 0.75rem; + color: #202020; + background-color: #e9ecef; + pointer-events: none; + border-color: inherit; + border-style: solid; + border-width: 0; + border-inline-end-width: 1px; + border-radius: 0; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-control::file-selector-button { + transition: none; } } + .form-control:hover:not(:disabled):not([readonly])::file-selector-button { + background-color: #dde0e3; } + +.form-control-plaintext { + display: block; + width: 100%; + padding: 0.375rem 0; + margin-bottom: 0; + line-height: 1.5; + color: #202020; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; } + .form-control-plaintext:focus { + outline: 0; } + .form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg { + padding-right: 0; + padding-left: 0; } + +.form-control-sm { + min-height: calc(1.5em + 0.5rem + 2px); + padding: 0.25rem 0.5rem; + font-size: 1.05rem; + border-radius: 0.25rem; } + .form-control-sm::file-selector-button { + padding: 0.25rem 0.5rem; + margin: -0.25rem -0.5rem; + margin-inline-end: 0.5rem; } + +.form-control-lg { + min-height: calc(1.5em + 1rem + 2px); + padding: 0.5rem 1rem; + font-size: calc(1.275rem + 0.3vw); + border-radius: 0.5rem; } + @media (min-width: 1200px) { + .form-control-lg { + font-size: 1.5rem; } } + .form-control-lg::file-selector-button { + padding: 0.5rem 1rem; + margin: -0.5rem -1rem; + margin-inline-end: 1rem; } + +textarea.form-control { + min-height: calc(1.5em + 0.75rem + 2px); } + +textarea.form-control-sm { + min-height: calc(1.5em + 0.5rem + 2px); } + +textarea.form-control-lg { + min-height: calc(1.5em + 1rem + 2px); } + +.form-control-color { + width: 3rem; + height: calc(1.5em + 0.75rem + 2px); + padding: 0.375rem; } + .form-control-color:not(:disabled):not([readonly]) { + cursor: pointer; } + .form-control-color::-moz-color-swatch { + border: 0 !important; + border-radius: 0.375rem; } + .form-control-color::-webkit-color-swatch { + border-radius: 0.375rem; } + .form-control-color.form-control-sm { + height: calc(1.5em + 0.5rem + 2px); } + .form-control-color.form-control-lg { + height: calc(1.5em + 1rem + 2px); } + +.form-select { + display: block; + width: 100%; + padding: 0.375rem 2.25rem 0.375rem 0.75rem; + -moz-padding-start: calc(0.75rem - 3px); + font-size: 1.2rem; + font-weight: 400; + line-height: 1.5; + color: #202020; + background-color: #fff; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right 0.75rem center; + background-size: 16px 12px; + border: 1px solid #ced4da; + border-radius: 0.375rem; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; + appearance: none; } + @media (prefers-reduced-motion: reduce) { + .form-select { + transition: none; } } + .form-select:focus { + border-color: #8b8bf2; + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); } + .form-select[multiple], .form-select[size]:not([size="1"]) { + padding-right: 0.75rem; + background-image: none; } + .form-select:disabled { + background-color: #e9ecef; } + .form-select:-moz-focusring { + color: transparent; + text-shadow: 0 0 0 #202020; } + +.form-select-sm { + padding-top: 0.25rem; + padding-bottom: 0.25rem; + padding-left: 0.5rem; + font-size: 1.05rem; + border-radius: 0.25rem; } + +.form-select-lg { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + padding-left: 1rem; + font-size: calc(1.275rem + 0.3vw); + border-radius: 0.5rem; } + @media (min-width: 1200px) { + .form-select-lg { + font-size: 1.5rem; } } + +.form-check { + display: block; + min-height: 1.8rem; + padding-left: 1.5em; + margin-bottom: 0.125rem; } + .form-check .form-check-input { + float: left; + margin-left: -1.5em; } + +.form-check-reverse { + padding-right: 1.5em; + padding-left: 0; + text-align: right; } + .form-check-reverse .form-check-input { + float: right; + margin-right: -1.5em; + margin-left: 0; } + +.form-check-input { + width: 1em; + height: 1em; + margin-top: 0.25em; + vertical-align: top; + background-color: #fff; + background-repeat: no-repeat; + background-position: center; + background-size: contain; + border: 1px solid rgba(17, 17, 17, 0.25); + appearance: none; + print-color-adjust: exact; } + .form-check-input[type="checkbox"] { + border-radius: 0.25em; } + .form-check-input[type="radio"] { + border-radius: 50%; } + .form-check-input:active { + filter: brightness(90%); } + .form-check-input:focus { + border-color: #8b8bf2; + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); } + .form-check-input:checked { + background-color: #1717e5; + border-color: #1717e5; } + .form-check-input:checked[type="checkbox"] { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e"); } + .form-check-input:checked[type="radio"] { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e"); } + .form-check-input[type="checkbox"]:indeterminate { + background-color: #1717e5; + border-color: #1717e5; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e"); } + .form-check-input:disabled { + pointer-events: none; + filter: none; + opacity: 0.5; } + .form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label { + cursor: default; + opacity: 0.5; } + +.form-switch { + padding-left: 2.5em; } + .form-switch .form-check-input { + width: 2em; + margin-left: -2.5em; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%2817, 17, 17, 0.25%29'/%3e%3c/svg%3e"); + background-position: left center; + border-radius: 2em; + transition: background-position 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-switch .form-check-input { + transition: none; } } + .form-switch .form-check-input:focus { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%238b8bf2'/%3e%3c/svg%3e"); } + .form-switch .form-check-input:checked { + background-position: right center; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); } + .form-switch.form-check-reverse { + padding-right: 2.5em; + padding-left: 0; } + .form-switch.form-check-reverse .form-check-input { + margin-right: -2.5em; + margin-left: 0; } + +.form-check-inline { + display: inline-block; + margin-right: 1rem; } + +.btn-check { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; } + .btn-check[disabled] + .btn, .btn-check:disabled + .btn { + pointer-events: none; + filter: none; + opacity: 0.65; } + +.form-range { + width: 100%; + height: 1.5rem; + padding: 0; + background-color: transparent; + appearance: none; } + .form-range:focus { + outline: 0; } + .form-range:focus::-webkit-slider-thumb { + box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(23, 23, 229, 0.25); } + .form-range:focus::-moz-range-thumb { + box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(23, 23, 229, 0.25); } + .form-range::-moz-focus-outer { + border: 0; } + .form-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #1717e5; + border: 0; + border-radius: 1rem; + transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; + appearance: none; } + @media (prefers-reduced-motion: reduce) { + .form-range::-webkit-slider-thumb { + transition: none; } } + .form-range::-webkit-slider-thumb:active { + background-color: #b9b9f7; } + .form-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; } + .form-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #1717e5; + border: 0; + border-radius: 1rem; + transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; + appearance: none; } + @media (prefers-reduced-motion: reduce) { + .form-range::-moz-range-thumb { + transition: none; } } + .form-range::-moz-range-thumb:active { + background-color: #b9b9f7; } + .form-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: #dee2e6; + border-color: transparent; + border-radius: 1rem; } + .form-range:disabled { + pointer-events: none; } + .form-range:disabled::-webkit-slider-thumb { + background-color: #adb5bd; } + .form-range:disabled::-moz-range-thumb { + background-color: #adb5bd; } + +.form-floating { + position: relative; } + .form-floating > .form-control, + .form-floating > .form-control-plaintext, + .form-floating > .form-select { + height: calc(3.5rem + 2px); + line-height: 1.25; } + .form-floating > label { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + padding: 1rem 0.75rem; + overflow: hidden; + text-align: start; + text-overflow: ellipsis; + white-space: nowrap; + pointer-events: none; + border: 1px solid transparent; + transform-origin: 0 0; + transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-floating > label { + transition: none; } } + .form-floating > .form-control, + .form-floating > .form-control-plaintext { + padding: 1rem 0.75rem; } + .form-floating > .form-control::placeholder, + .form-floating > .form-control-plaintext::placeholder { + color: transparent; } + .form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown), + .form-floating > .form-control-plaintext:focus, + .form-floating > .form-control-plaintext:not(:placeholder-shown) { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-control:-webkit-autofill, + .form-floating > .form-control-plaintext:-webkit-autofill { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-select { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-control:focus ~ label, + .form-floating > .form-control:not(:placeholder-shown) ~ label, + .form-floating > .form-control-plaintext ~ label, + .form-floating > .form-select ~ label { + opacity: 0.65; + transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem); } + .form-floating > .form-control:-webkit-autofill ~ label { + opacity: 0.65; + transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem); } + .form-floating > .form-control-plaintext ~ label { + border-width: 1px 0; } + +.input-group { + position: relative; + display: flex; + flex-wrap: wrap; + align-items: stretch; + width: 100%; } + .input-group > .form-control, + .input-group > .form-select, + .input-group > .form-floating { + position: relative; + flex: 1 1 auto; + width: 1%; + min-width: 0; } + .input-group > .form-control:focus, + .input-group > .form-select:focus, + .input-group > .form-floating:focus-within { + z-index: 5; } + .input-group .btn { + position: relative; + z-index: 2; } + .input-group .btn:focus { + z-index: 5; } + +.input-group-text { + display: flex; + align-items: center; + padding: 0.375rem 0.75rem; + font-size: 1.2rem; + font-weight: 400; + line-height: 1.5; + color: #202020; + text-align: center; + white-space: nowrap; + background-color: #e9ecef; + border: 1px solid #ced4da; + border-radius: 0.375rem; } + +.input-group-lg > .form-control, +.input-group-lg > .form-select, +.input-group-lg > .input-group-text, +.input-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: calc(1.275rem + 0.3vw); + border-radius: 0.5rem; } + @media (min-width: 1200px) { + .input-group-lg > .form-control, + .input-group-lg > .form-select, + .input-group-lg > .input-group-text, + .input-group-lg > .btn { + font-size: 1.5rem; } } + +.input-group-sm > .form-control, +.input-group-sm > .form-select, +.input-group-sm > .input-group-text, +.input-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 1.05rem; + border-radius: 0.25rem; } + +.input-group-lg > .form-select, +.input-group-sm > .form-select { + padding-right: 3rem; } + +.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), +.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n + 3), +.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control, +.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + +.input-group.has-validation > :nth-last-child(n + 3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), +.input-group.has-validation > .dropdown-toggle:nth-last-child(n + 4), +.input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-control, +.input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + +.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) { + margin-left: -1px; + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.input-group > .form-floating:not(:first-child) > .form-control, +.input-group > .form-floating:not(:first-child) > .form-select { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 0.875em; + color: #198754; } + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: 0.25rem 0.5rem; + margin-top: .1rem; + font-size: 1.05rem; + color: #fff; + background-color: rgba(25, 135, 84, 0.9); + border-radius: 0.375rem; } + +.was-validated :valid ~ .valid-feedback, +.was-validated :valid ~ .valid-tooltip, +.is-valid ~ .valid-feedback, +.is-valid ~ .valid-tooltip { + display: block; } + +.was-validated .form-control:valid, .form-control.is-valid { + border-color: #198754; + padding-right: calc(1.5em + 0.75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-control:valid:focus, .form-control.is-valid:focus { + border-color: #198754; + box-shadow: 0 0 0 0.25rem rgba(25, 135, 84, 0.25); } + +.was-validated textarea.form-control:valid, textarea.form-control.is-valid { + padding-right: calc(1.5em + 0.75rem); + background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } + +.was-validated .form-select:valid, .form-select.is-valid { + border-color: #198754; } + .was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] { + padding-right: 4.125rem; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"), url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-position: right 0.75rem center, center right 2.25rem; + background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-select:valid:focus, .form-select.is-valid:focus { + border-color: #198754; + box-shadow: 0 0 0 0.25rem rgba(25, 135, 84, 0.25); } + +.was-validated .form-control-color:valid, .form-control-color.is-valid { + width: calc(3rem + calc(1.5em + 0.75rem)); } + +.was-validated .form-check-input:valid, .form-check-input.is-valid { + border-color: #198754; } + .was-validated .form-check-input:valid:checked, .form-check-input.is-valid:checked { + background-color: #198754; } + .was-validated .form-check-input:valid:focus, .form-check-input.is-valid:focus { + box-shadow: 0 0 0 0.25rem rgba(25, 135, 84, 0.25); } + .was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #198754; } + +.form-check-inline .form-check-input ~ .valid-feedback { + margin-left: .5em; } + +.was-validated .input-group > .form-control:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid, .was-validated +.input-group > .form-select:not(:focus):valid, +.input-group > .form-select:not(:focus).is-valid, .was-validated +.input-group > .form-floating:not(:focus-within):valid, +.input-group > .form-floating:not(:focus-within).is-valid { + z-index: 3; } + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 0.875em; + color: #dc3545; } + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: 0.25rem 0.5rem; + margin-top: .1rem; + font-size: 1.05rem; + color: #fff; + background-color: rgba(220, 53, 69, 0.9); + border-radius: 0.375rem; } + +.was-validated :invalid ~ .invalid-feedback, +.was-validated :invalid ~ .invalid-tooltip, +.is-invalid ~ .invalid-feedback, +.is-invalid ~ .invalid-tooltip { + display: block; } + +.was-validated .form-control:invalid, .form-control.is-invalid { + border-color: #dc3545; + padding-right: calc(1.5em + 0.75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-control:invalid:focus, .form-control.is-invalid:focus { + border-color: #dc3545; + box-shadow: 0 0 0 0.25rem rgba(220, 53, 69, 0.25); } + +.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid { + padding-right: calc(1.5em + 0.75rem); + background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } + +.was-validated .form-select:invalid, .form-select.is-invalid { + border-color: #dc3545; } + .was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] { + padding-right: 4.125rem; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"), url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); + background-position: right 0.75rem center, center right 2.25rem; + background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-select:invalid:focus, .form-select.is-invalid:focus { + border-color: #dc3545; + box-shadow: 0 0 0 0.25rem rgba(220, 53, 69, 0.25); } + +.was-validated .form-control-color:invalid, .form-control-color.is-invalid { + width: calc(3rem + calc(1.5em + 0.75rem)); } + +.was-validated .form-check-input:invalid, .form-check-input.is-invalid { + border-color: #dc3545; } + .was-validated .form-check-input:invalid:checked, .form-check-input.is-invalid:checked { + background-color: #dc3545; } + .was-validated .form-check-input:invalid:focus, .form-check-input.is-invalid:focus { + box-shadow: 0 0 0 0.25rem rgba(220, 53, 69, 0.25); } + .was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #dc3545; } + +.form-check-inline .form-check-input ~ .invalid-feedback { + margin-left: .5em; } + +.was-validated .input-group > .form-control:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid, .was-validated +.input-group > .form-select:not(:focus):invalid, +.input-group > .form-select:not(:focus).is-invalid, .was-validated +.input-group > .form-floating:not(:focus-within):invalid, +.input-group > .form-floating:not(:focus-within).is-invalid { + z-index: 4; } + +.btn { + --bs-btn-padding-x: 0.75rem; + --bs-btn-padding-y: 0.375rem; + --bs-btn-font-family: ; + --bs-btn-font-size: 1.2rem; + --bs-btn-font-weight: 400; + --bs-btn-line-height: 1.5; + --bs-btn-color: #202020; + --bs-btn-bg: transparent; + --bs-btn-border-width: 1px; + --bs-btn-border-color: transparent; + --bs-btn-border-radius: 99rem; + --bs-btn-hover-border-color: transparent; + --bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(17, 17, 17, 0.075); + --bs-btn-disabled-opacity: 0.65; + --bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5); + display: inline-block; + padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x); + font-family: var(--bs-btn-font-family); + font-size: var(--bs-btn-font-size); + font-weight: var(--bs-btn-font-weight); + line-height: var(--bs-btn-line-height); + color: var(--bs-btn-color); + text-align: center; + text-decoration: none; + vertical-align: middle; + cursor: pointer; + user-select: none; + border: var(--bs-btn-border-width) solid var(--bs-btn-border-color); + border-radius: var(--bs-btn-border-radius); + background-color: var(--bs-btn-bg); + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .btn { + transition: none; } } + :not(.btn-check) + .btn:hover, .btn:first-child:hover { + color: var(--bs-btn-hover-color); + background-color: var(--bs-btn-hover-bg); + border-color: var(--bs-btn-hover-border-color); } + .btn:focus-visible { + color: var(--bs-btn-hover-color); + background-color: var(--bs-btn-hover-bg); + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn-check:focus-visible + .btn { + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn-check:checked + .btn, + :not(.btn-check) + .btn:active, .btn:first-child:active, .btn.active, .btn.show { + color: var(--bs-btn-active-color); + background-color: var(--bs-btn-active-bg); + border-color: var(--bs-btn-active-border-color); } + .btn-check:checked + .btn:focus-visible, + :not(.btn-check) + .btn:active:focus-visible, .btn:first-child:active:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible { + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn:disabled, .btn.disabled, + fieldset:disabled .btn { + color: var(--bs-btn-disabled-color); + pointer-events: none; + background-color: var(--bs-btn-disabled-bg); + border-color: var(--bs-btn-disabled-border-color); + opacity: var(--bs-btn-disabled-opacity); } + +.btn-primary { + --bs-btn-color: #fff; + --bs-btn-bg: #1717e5; + --bs-btn-border-color: #1717e5; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #1414c3; + --bs-btn-hover-border-color: #1212b7; + --bs-btn-focus-shadow-rgb: 58, 58, 233; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #1212b7; + --bs-btn-active-border-color: #1111ac; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #1717e5; + --bs-btn-disabled-border-color: #1717e5; } + +.btn-secondary { + --bs-btn-color: #111; + --bs-btn-bg: #8a8a8e; + --bs-btn-border-color: #8a8a8e; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #9c9c9f; + --bs-btn-hover-border-color: #969699; + --bs-btn-focus-shadow-rgb: 120, 120, 123; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #a1a1a5; + --bs-btn-active-border-color: #969699; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #111; + --bs-btn-disabled-bg: #8a8a8e; + --bs-btn-disabled-border-color: #8a8a8e; } + +.btn-success { + --bs-btn-color: #fff; + --bs-btn-bg: #198754; + --bs-btn-border-color: #198754; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #157347; + --bs-btn-hover-border-color: #146c43; + --bs-btn-focus-shadow-rgb: 60, 153, 110; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #146c43; + --bs-btn-active-border-color: #13653f; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #198754; + --bs-btn-disabled-border-color: #198754; } + +.btn-info { + --bs-btn-color: #111; + --bs-btn-bg: #0dcaf0; + --bs-btn-border-color: #0dcaf0; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #31d2f2; + --bs-btn-hover-border-color: #25cff2; + --bs-btn-focus-shadow-rgb: 14, 174, 207; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #3dd5f3; + --bs-btn-active-border-color: #25cff2; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #111; + --bs-btn-disabled-bg: #0dcaf0; + --bs-btn-disabled-border-color: #0dcaf0; } + +.btn-warning { + --bs-btn-color: #111; + --bs-btn-bg: #ffc107; + --bs-btn-border-color: #ffc107; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #ffca2c; + --bs-btn-hover-border-color: #ffc720; + --bs-btn-focus-shadow-rgb: 219, 167, 9; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #ffcd39; + --bs-btn-active-border-color: #ffc720; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #111; + --bs-btn-disabled-bg: #ffc107; + --bs-btn-disabled-border-color: #ffc107; } + +.btn-danger { + --bs-btn-color: #fff; + --bs-btn-bg: #dc3545; + --bs-btn-border-color: #dc3545; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #bb2d3b; + --bs-btn-hover-border-color: #b02a37; + --bs-btn-focus-shadow-rgb: 225, 83, 97; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #b02a37; + --bs-btn-active-border-color: #a52834; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #dc3545; + --bs-btn-disabled-border-color: #dc3545; } + +.btn-light { + --bs-btn-color: #111; + --bs-btn-bg: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #d3d4d5; + --bs-btn-hover-border-color: #c6c7c8; + --bs-btn-focus-shadow-rgb: 213, 214, 215; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #c6c7c8; + --bs-btn-active-border-color: #babbbc; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #111; + --bs-btn-disabled-bg: #f8f9fa; + --bs-btn-disabled-border-color: #f8f9fa; } + +.btn-dark { + --bs-btn-color: #fff; + --bs-btn-bg: #202020; + --bs-btn-border-color: #202020; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #414141; + --bs-btn-hover-border-color: #363636; + --bs-btn-focus-shadow-rgb: 65, 65, 65; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #4d4d4d; + --bs-btn-active-border-color: #363636; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #202020; + --bs-btn-disabled-border-color: #202020; } + +.btn-outline-primary { + --bs-btn-color: #1717e5; + --bs-btn-border-color: #1717e5; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #1717e5; + --bs-btn-hover-border-color: #1717e5; + --bs-btn-focus-shadow-rgb: 23, 23, 229; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #1717e5; + --bs-btn-active-border-color: #1717e5; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #1717e5; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #1717e5; + --bs-gradient: none; } + +.btn-outline-secondary { + --bs-btn-color: #8a8a8e; + --bs-btn-border-color: #8a8a8e; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #8a8a8e; + --bs-btn-hover-border-color: #8a8a8e; + --bs-btn-focus-shadow-rgb: 138, 138, 142; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #8a8a8e; + --bs-btn-active-border-color: #8a8a8e; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #8a8a8e; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #8a8a8e; + --bs-gradient: none; } + +.btn-outline-success { + --bs-btn-color: #198754; + --bs-btn-border-color: #198754; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #198754; + --bs-btn-hover-border-color: #198754; + --bs-btn-focus-shadow-rgb: 25, 135, 84; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #198754; + --bs-btn-active-border-color: #198754; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #198754; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #198754; + --bs-gradient: none; } + +.btn-outline-info { + --bs-btn-color: #0dcaf0; + --bs-btn-border-color: #0dcaf0; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #0dcaf0; + --bs-btn-hover-border-color: #0dcaf0; + --bs-btn-focus-shadow-rgb: 13, 202, 240; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #0dcaf0; + --bs-btn-active-border-color: #0dcaf0; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #0dcaf0; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #0dcaf0; + --bs-gradient: none; } + +.btn-outline-warning { + --bs-btn-color: #ffc107; + --bs-btn-border-color: #ffc107; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #ffc107; + --bs-btn-hover-border-color: #ffc107; + --bs-btn-focus-shadow-rgb: 255, 193, 7; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #ffc107; + --bs-btn-active-border-color: #ffc107; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #ffc107; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #ffc107; + --bs-gradient: none; } + +.btn-outline-danger { + --bs-btn-color: #dc3545; + --bs-btn-border-color: #dc3545; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #dc3545; + --bs-btn-hover-border-color: #dc3545; + --bs-btn-focus-shadow-rgb: 220, 53, 69; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #dc3545; + --bs-btn-active-border-color: #dc3545; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #dc3545; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #dc3545; + --bs-gradient: none; } + +.btn-outline-light { + --bs-btn-color: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #111; + --bs-btn-hover-bg: #f8f9fa; + --bs-btn-hover-border-color: #f8f9fa; + --bs-btn-focus-shadow-rgb: 248, 249, 250; + --bs-btn-active-color: #111; + --bs-btn-active-bg: #f8f9fa; + --bs-btn-active-border-color: #f8f9fa; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #f8f9fa; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #f8f9fa; + --bs-gradient: none; } + +.btn-outline-dark { + --bs-btn-color: #202020; + --bs-btn-border-color: #202020; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #202020; + --bs-btn-hover-border-color: #202020; + --bs-btn-focus-shadow-rgb: 32, 32, 32; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #202020; + --bs-btn-active-border-color: #202020; + --bs-btn-active-shadow: inset 0 3px 5px rgba(17, 17, 17, 0.125); + --bs-btn-disabled-color: #202020; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #202020; + --bs-gradient: none; } + +.btn-link { + --bs-btn-font-weight: 400; + --bs-btn-color: var(--bs-link-color); + --bs-btn-bg: transparent; + --bs-btn-border-color: transparent; + --bs-btn-hover-color: var(--bs-link-hover-color); + --bs-btn-hover-border-color: transparent; + --bs-btn-active-color: var(--bs-link-hover-color); + --bs-btn-active-border-color: transparent; + --bs-btn-disabled-color: #8a8a8e; + --bs-btn-disabled-border-color: transparent; + --bs-btn-box-shadow: none; + --bs-btn-focus-shadow-rgb: 58, 58, 233; + text-decoration: underline; } + .btn-link:focus-visible { + color: var(--bs-btn-color); } + .btn-link:hover { + color: var(--bs-btn-hover-color); } + +.btn-lg, .btn-group-lg > .btn { + --bs-btn-padding-y: 0.5rem; + --bs-btn-padding-x: 1rem; + --bs-btn-font-size: calc(1.275rem + 0.3vw); + --bs-btn-border-radius: 99rem; } + @media (min-width: 1200px) { + .btn-lg, .btn-group-lg > .btn { + --bs-btn-font-size: 1.5rem; } } + +.btn-sm, .btn-group-sm > .btn { + --bs-btn-padding-y: 0.25rem; + --bs-btn-padding-x: 0.5rem; + --bs-btn-font-size: 1.05rem; + --bs-btn-border-radius: 99rem; } + +.fade { + transition: opacity 0.15s linear; } + @media (prefers-reduced-motion: reduce) { + .fade { + transition: none; } } + .fade:not(.show) { + opacity: 0; } + +.collapse:not(.show) { + display: none; } + +.collapsing { + height: 0; + overflow: hidden; + transition: height 0.35s ease; } + @media (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; } } + .collapsing.collapse-horizontal { + width: 0; + height: auto; + transition: width 0.35s ease; } + @media (prefers-reduced-motion: reduce) { + .collapsing.collapse-horizontal { + transition: none; } } + +.dropup, +.dropend, +.dropdown, +.dropstart, +.dropup-center, +.dropdown-center { + position: relative; } + +.dropdown-toggle { + white-space: nowrap; } + .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-right: 0.3em solid transparent; + border-bottom: 0; + border-left: 0.3em solid transparent; } + .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropdown-menu { + --bs-dropdown-zindex: 1000; + --bs-dropdown-min-width: 10rem; + --bs-dropdown-padding-x: 0; + --bs-dropdown-padding-y: 0.5rem; + --bs-dropdown-spacer: 0.125rem; + --bs-dropdown-font-size: 1.2rem; + --bs-dropdown-color: #202020; + --bs-dropdown-bg: #fff; + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-border-radius: 0.375rem; + --bs-dropdown-border-width: 1px; + --bs-dropdown-inner-border-radius: calc(0.375rem - 1px); + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-divider-margin-y: 0.5rem; + --bs-dropdown-box-shadow: 0 1rem 3rem rgba(17, 17, 17, 0.5); + --bs-dropdown-link-color: #202020; + --bs-dropdown-link-hover-color: #1d1d1d; + --bs-dropdown-link-hover-bg: #e9ecef; + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #1717e5; + --bs-dropdown-link-disabled-color: #adb5bd; + --bs-dropdown-item-padding-x: 1rem; + --bs-dropdown-item-padding-y: 0.25rem; + --bs-dropdown-header-color: #8a8a8e; + --bs-dropdown-header-padding-x: 1rem; + --bs-dropdown-header-padding-y: 0.5rem; + position: absolute; + z-index: var(--bs-dropdown-zindex); + display: none; + min-width: var(--bs-dropdown-min-width); + padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x); + margin: 0; + font-size: var(--bs-dropdown-font-size); + color: var(--bs-dropdown-color); + text-align: left; + list-style: none; + background-color: var(--bs-dropdown-bg); + background-clip: padding-box; + border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color); + border-radius: var(--bs-dropdown-border-radius); } + .dropdown-menu[data-bs-popper] { + top: 100%; + left: 0; + margin-top: var(--bs-dropdown-spacer); } + +.dropdown-menu-start { + --bs-position: start; } + .dropdown-menu-start[data-bs-popper] { + right: auto; + left: 0; } + +.dropdown-menu-end { + --bs-position: end; } + .dropdown-menu-end[data-bs-popper] { + right: 0; + left: auto; } + +@media (min-width: 576px) { + .dropdown-menu-sm-start { + --bs-position: start; } + .dropdown-menu-sm-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-sm-end { + --bs-position: end; } + .dropdown-menu-sm-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 768px) { + .dropdown-menu-md-start { + --bs-position: start; } + .dropdown-menu-md-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-md-end { + --bs-position: end; } + .dropdown-menu-md-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 992px) { + .dropdown-menu-lg-start { + --bs-position: start; } + .dropdown-menu-lg-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-lg-end { + --bs-position: end; } + .dropdown-menu-lg-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 1200px) { + .dropdown-menu-xl-start { + --bs-position: start; } + .dropdown-menu-xl-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-xl-end { + --bs-position: end; } + .dropdown-menu-xl-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 1680px) { + .dropdown-menu-xxl-start { + --bs-position: start; } + .dropdown-menu-xxl-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-xxl-end { + --bs-position: end; } + .dropdown-menu-xxl-end[data-bs-popper] { + right: 0; + left: auto; } } + +.dropup .dropdown-menu[data-bs-popper] { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: var(--bs-dropdown-spacer); } + +.dropup .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-right: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-left: 0.3em solid transparent; } + +.dropup .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropend .dropdown-menu[data-bs-popper] { + top: 0; + right: auto; + left: 100%; + margin-top: 0; + margin-left: var(--bs-dropdown-spacer); } + +.dropend .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0; + border-bottom: 0.3em solid transparent; + border-left: 0.3em solid; } + +.dropend .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropend .dropdown-toggle::after { + vertical-align: 0; } + +.dropstart .dropdown-menu[data-bs-popper] { + top: 0; + right: 100%; + left: auto; + margin-top: 0; + margin-right: var(--bs-dropdown-spacer); } + +.dropstart .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; } + +.dropstart .dropdown-toggle::after { + display: none; } + +.dropstart .dropdown-toggle::before { + display: inline-block; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0.3em solid; + border-bottom: 0.3em solid transparent; } + +.dropstart .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropstart .dropdown-toggle::before { + vertical-align: 0; } + +.dropdown-divider { + height: 0; + margin: var(--bs-dropdown-divider-margin-y) 0; + overflow: hidden; + border-top: 1px solid var(--bs-dropdown-divider-bg); + opacity: 1; } + +.dropdown-item { + display: block; + width: 100%; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + clear: both; + font-weight: 400; + color: var(--bs-dropdown-link-color); + text-align: inherit; + text-decoration: none; + white-space: nowrap; + background-color: transparent; + border: 0; } + .dropdown-item:hover, .dropdown-item:focus { + color: var(--bs-dropdown-link-hover-color); + background-color: var(--bs-dropdown-link-hover-bg); } + .dropdown-item.active, .dropdown-item:active { + color: var(--bs-dropdown-link-active-color); + text-decoration: none; + background-color: var(--bs-dropdown-link-active-bg); } + .dropdown-item.disabled, .dropdown-item:disabled { + color: var(--bs-dropdown-link-disabled-color); + pointer-events: none; + background-color: transparent; } + +.dropdown-menu.show { + display: block; } + +.dropdown-header { + display: block; + padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x); + margin-bottom: 0; + font-size: 1.05rem; + color: var(--bs-dropdown-header-color); + white-space: nowrap; } + +.dropdown-item-text { + display: block; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + color: var(--bs-dropdown-link-color); } + +.dropdown-menu-dark { + --bs-dropdown-color: #dee2e6; + --bs-dropdown-bg: #343a40; + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-box-shadow: ; + --bs-dropdown-link-color: #dee2e6; + --bs-dropdown-link-hover-color: #fff; + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15); + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #1717e5; + --bs-dropdown-link-disabled-color: #adb5bd; + --bs-dropdown-header-color: #adb5bd; } + +.btn-group, +.btn-group-vertical { + position: relative; + display: inline-flex; + vertical-align: middle; } + .btn-group > .btn, + .btn-group-vertical > .btn { + position: relative; + flex: 1 1 auto; } + .btn-group > .btn-check:checked + .btn, + .btn-group > .btn-check:focus + .btn, + .btn-group > .btn:hover, + .btn-group > .btn:focus, + .btn-group > .btn:active, + .btn-group > .btn.active, + .btn-group-vertical > .btn-check:checked + .btn, + .btn-group-vertical > .btn-check:focus + .btn, + .btn-group-vertical > .btn:hover, + .btn-group-vertical > .btn:focus, + .btn-group-vertical > .btn:active, + .btn-group-vertical > .btn.active { + z-index: 1; } + +.btn-toolbar { + display: flex; + flex-wrap: wrap; + justify-content: flex-start; } + .btn-toolbar .input-group { + width: auto; } + +.btn-group { + border-radius: 99rem; } + .btn-group > :not(.btn-check:first-child) + .btn, + .btn-group > .btn-group:not(:first-child) { + margin-left: -1px; } + .btn-group > .btn:not(:last-child):not(.dropdown-toggle), + .btn-group > .btn.dropdown-toggle-split:first-child, + .btn-group > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + .btn-group > .btn:nth-child(n + 3), + .btn-group > :not(.btn-check) + .btn, + .btn-group > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.dropdown-toggle-split { + padding-right: 0.5625rem; + padding-left: 0.5625rem; } + .dropdown-toggle-split::after, + .dropup .dropdown-toggle-split::after, + .dropend .dropdown-toggle-split::after { + margin-left: 0; } + .dropstart .dropdown-toggle-split::before { + margin-right: 0; } + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-right: 0.375rem; + padding-left: 0.375rem; } + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-right: 0.75rem; + padding-left: 0.75rem; } + +.btn-group-vertical { + flex-direction: column; + align-items: flex-start; + justify-content: center; } + .btn-group-vertical > .btn, + .btn-group-vertical > .btn-group { + width: 100%; } + .btn-group-vertical > .btn:not(:first-child), + .btn-group-vertical > .btn-group:not(:first-child) { + margin-top: -1px; } + .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), + .btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; } + .btn-group-vertical > .btn ~ .btn, + .btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.nav { + --bs-nav-link-padding-x: 1rem; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight: ; + --bs-nav-link-color: var(--bs-link-color); + --bs-nav-link-hover-color: var(--bs-link-hover-color); + --bs-nav-link-disabled-color: #8a8a8e; + display: flex; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style: none; } + +.nav-link { + display: block; + padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x); + font-size: var(--bs-nav-link-font-size); + font-weight: var(--bs-nav-link-font-weight); + color: var(--bs-nav-link-color); + text-decoration: none; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .nav-link { + transition: none; } } + .nav-link:hover, .nav-link:focus { + color: var(--bs-nav-link-hover-color); } + .nav-link.disabled { + color: var(--bs-nav-link-disabled-color); + pointer-events: none; + cursor: default; } + +.nav-tabs { + --bs-nav-tabs-border-width: 1px; + --bs-nav-tabs-border-color: #dee2e6; + --bs-nav-tabs-border-radius: 0.375rem; + --bs-nav-tabs-link-hover-border-color: #e9ecef #e9ecef #dee2e6; + --bs-nav-tabs-link-active-color: #495057; + --bs-nav-tabs-link-active-bg: #fff; + --bs-nav-tabs-link-active-border-color: #dee2e6 #dee2e6 #fff; + border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color); } + .nav-tabs .nav-link { + margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width)); + background: none; + border: var(--bs-nav-tabs-border-width) solid transparent; + border-top-left-radius: var(--bs-nav-tabs-border-radius); + border-top-right-radius: var(--bs-nav-tabs-border-radius); } + .nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + isolation: isolate; + border-color: var(--bs-nav-tabs-link-hover-border-color); } + .nav-tabs .nav-link.disabled, .nav-tabs .nav-link:disabled { + color: var(--bs-nav-link-disabled-color); + background-color: transparent; + border-color: transparent; } + .nav-tabs .nav-link.active, + .nav-tabs .nav-item.show .nav-link { + color: var(--bs-nav-tabs-link-active-color); + background-color: var(--bs-nav-tabs-link-active-bg); + border-color: var(--bs-nav-tabs-link-active-border-color); } + .nav-tabs .dropdown-menu { + margin-top: calc(-1 * var(--bs-nav-tabs-border-width)); + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.nav-pills { + --bs-nav-pills-border-radius: 0.375rem; + --bs-nav-pills-link-active-color: #fff; + --bs-nav-pills-link-active-bg: #1717e5; } + .nav-pills .nav-link { + background: none; + border: 0; + border-radius: var(--bs-nav-pills-border-radius); } + .nav-pills .nav-link:disabled { + color: var(--bs-nav-link-disabled-color); + background-color: transparent; + border-color: transparent; } + .nav-pills .nav-link.active, + .nav-pills .show > .nav-link { + color: var(--bs-nav-pills-link-active-color); + background-color: var(--bs-nav-pills-link-active-bg); } + +.nav-fill > .nav-link, +.nav-fill .nav-item { + flex: 1 1 auto; + text-align: center; } + +.nav-justified > .nav-link, +.nav-justified .nav-item { + flex-basis: 0; + flex-grow: 1; + text-align: center; } + +.nav-fill .nav-item .nav-link, +.nav-justified .nav-item .nav-link { + width: 100%; } + +.tab-content > .tab-pane { + display: none; } + +.tab-content > .active { + display: block; } + +.navbar { + --bs-navbar-padding-x: 0; + --bs-navbar-padding-y: 0.5rem; + --bs-navbar-color: rgba(17, 17, 17, 0.7); + --bs-navbar-hover-color: rgba(17, 17, 17, 0.8); + --bs-navbar-disabled-color: rgba(17, 17, 17, 0.3); + --bs-navbar-active-color: rgba(17, 17, 17, 0.9); + --bs-navbar-brand-padding-y: 0.275rem; + --bs-navbar-brand-margin-end: 1rem; + --bs-navbar-brand-font-size: 1.5rem; + --bs-navbar-brand-color: rgba(17, 17, 17, 0.9); + --bs-navbar-brand-hover-color: rgba(17, 17, 17, 0.9); + --bs-navbar-nav-link-padding-x: 0.5rem; + --bs-navbar-toggler-padding-y: 0.25rem; + --bs-navbar-toggler-padding-x: 0.75rem; + --bs-navbar-toggler-font-size: 1.5rem; + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2817, 17, 17, 0.7%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); + --bs-navbar-toggler-border-color: rgba(17, 17, 17, 0.1); + --bs-navbar-toggler-border-radius: 99rem; + --bs-navbar-toggler-focus-width: 0.25rem; + --bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out; + position: relative; + display: flex; + flex-wrap: wrap; + align-items: center; + justify-content: space-between; + padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x); } + .navbar > .container, + .navbar > .container-fluid, .navbar > .container-sm, .navbar > .container-md, .navbar > .container-lg, .navbar > .container-xl, .navbar > .container-xxl { + display: flex; + flex-wrap: inherit; + align-items: center; + justify-content: space-between; } + +.navbar-brand { + padding-top: var(--bs-navbar-brand-padding-y); + padding-bottom: var(--bs-navbar-brand-padding-y); + margin-right: var(--bs-navbar-brand-margin-end); + font-size: var(--bs-navbar-brand-font-size); + color: var(--bs-navbar-brand-color); + text-decoration: none; + white-space: nowrap; } + .navbar-brand:hover, .navbar-brand:focus { + color: var(--bs-navbar-brand-hover-color); } + +.navbar-nav { + --bs-nav-link-padding-x: 0; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight: ; + --bs-nav-link-color: var(--bs-navbar-color); + --bs-nav-link-hover-color: var(--bs-navbar-hover-color); + --bs-nav-link-disabled-color: var(--bs-navbar-disabled-color); + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style: none; } + .navbar-nav .show > .nav-link, + .navbar-nav .nav-link.active { + color: var(--bs-navbar-active-color); } + .navbar-nav .dropdown-menu { + position: static; } + +.navbar-text { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + color: var(--bs-navbar-color); } + .navbar-text a, + .navbar-text a:hover, + .navbar-text a:focus { + color: var(--bs-navbar-active-color); } + +.navbar-collapse { + flex-basis: 100%; + flex-grow: 1; + align-items: center; } + +.navbar-toggler { + padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x); + font-size: var(--bs-navbar-toggler-font-size); + line-height: 1; + color: var(--bs-navbar-color); + background-color: transparent; + border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color); + border-radius: var(--bs-navbar-toggler-border-radius); + transition: var(--bs-navbar-toggler-transition); } + @media (prefers-reduced-motion: reduce) { + .navbar-toggler { + transition: none; } } + .navbar-toggler:hover { + text-decoration: none; } + .navbar-toggler:focus { + text-decoration: none; + outline: 0; + box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width); } + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + background-image: var(--bs-navbar-toggler-icon-bg); + background-repeat: no-repeat; + background-position: center; + background-size: 100%; } + +.navbar-nav-scroll { + max-height: var(--bs-scroll-height, 75vh); + overflow-y: auto; } + +@media (min-width: 576px) { + .navbar-expand-sm { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-sm .navbar-nav { + flex-direction: row; } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-sm .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-sm .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-sm .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-sm .navbar-toggler { + display: none; } + .navbar-expand-sm .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-sm .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-sm .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 768px) { + .navbar-expand-md { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-md .navbar-nav { + flex-direction: row; } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-md .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-md .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-md .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-md .navbar-toggler { + display: none; } + .navbar-expand-md .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-md .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-md .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 992px) { + .navbar-expand-lg { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-lg .navbar-nav { + flex-direction: row; } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-lg .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-lg .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-lg .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-lg .navbar-toggler { + display: none; } + .navbar-expand-lg .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-lg .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-lg .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 1200px) { + .navbar-expand-xl { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-xl .navbar-nav { + flex-direction: row; } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-xl .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-xl .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-xl .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-xl .navbar-toggler { + display: none; } + .navbar-expand-xl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-xl .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-xl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 1680px) { + .navbar-expand-xxl { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-xxl .navbar-nav { + flex-direction: row; } + .navbar-expand-xxl .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-xxl .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-xxl .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-xxl .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-xxl .navbar-toggler { + display: none; } + .navbar-expand-xxl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-xxl .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-xxl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +.navbar-expand { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand .navbar-nav { + flex-direction: row; } + .navbar-expand .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand .navbar-nav-scroll { + overflow: visible; } + .navbar-expand .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand .navbar-toggler { + display: none; } + .navbar-expand .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand .offcanvas .offcanvas-header { + display: none; } + .navbar-expand .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } + +.navbar-dark { + --bs-navbar-color: rgba(255, 255, 255, 0.55); + --bs-navbar-hover-color: rgba(255, 255, 255, 0.75); + --bs-navbar-disabled-color: rgba(255, 255, 255, 0.25); + --bs-navbar-active-color: #fff; + --bs-navbar-brand-color: #fff; + --bs-navbar-brand-hover-color: #fff; + --bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1); + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); } + +.card { + --bs-card-spacer-y: 1rem; + --bs-card-spacer-x: 1rem; + --bs-card-title-spacer-y: 0.5rem; + --bs-card-border-width: 1px; + --bs-card-border-color: var(--bs-border-color-translucent); + --bs-card-border-radius: 0.375rem; + --bs-card-box-shadow: ; + --bs-card-inner-border-radius: calc(0.375rem - 1px); + --bs-card-cap-padding-y: 0.5rem; + --bs-card-cap-padding-x: 1rem; + --bs-card-cap-bg: rgba(17, 17, 17, 0.03); + --bs-card-cap-color: ; + --bs-card-height: ; + --bs-card-color: ; + --bs-card-bg: #fff; + --bs-card-img-overlay-padding: 1rem; + --bs-card-group-margin: 2vw; + position: relative; + display: flex; + flex-direction: column; + min-width: 0; + height: var(--bs-card-height); + word-wrap: break-word; + background-color: var(--bs-card-bg); + background-clip: border-box; + border: var(--bs-card-border-width) solid var(--bs-card-border-color); + border-radius: var(--bs-card-border-radius); } + .card > hr { + margin-right: 0; + margin-left: 0; } + .card > .list-group { + border-top: inherit; + border-bottom: inherit; } + .card > .list-group:first-child { + border-top-width: 0; + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius: var(--bs-card-inner-border-radius); } + .card > .list-group:last-child { + border-bottom-width: 0; + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius: var(--bs-card-inner-border-radius); } + .card > .card-header + .list-group, + .card > .list-group + .card-footer { + border-top: 0; } + +.card-body { + flex: 1 1 auto; + padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x); + color: var(--bs-card-color); } + +.card-title { + margin-bottom: var(--bs-card-title-spacer-y); } + +.card-subtitle { + margin-top: calc(-.5 * var(--bs-card-title-spacer-y)); + margin-bottom: 0; } + +.card-text:last-child { + margin-bottom: 0; } + +.card-link + .card-link { + margin-left: var(--bs-card-spacer-x); } + +.card-header { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + margin-bottom: 0; + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color); } + .card-header:first-child { + border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0; } + +.card-footer { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-top: var(--bs-card-border-width) solid var(--bs-card-border-color); } + .card-footer:last-child { + border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius); } + +.card-header-tabs { + margin-right: calc(-.5 * var(--bs-card-cap-padding-x)); + margin-bottom: calc(-1 * var(--bs-card-cap-padding-y)); + margin-left: calc(-.5 * var(--bs-card-cap-padding-x)); + border-bottom: 0; } + .card-header-tabs .nav-link.active { + background-color: var(--bs-card-bg); + border-bottom-color: var(--bs-card-bg); } + +.card-header-pills { + margin-right: calc(-.5 * var(--bs-card-cap-padding-x)); + margin-left: calc(-.5 * var(--bs-card-cap-padding-x)); } + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: var(--bs-card-img-overlay-padding); + border-radius: var(--bs-card-inner-border-radius); } + +.card-img, +.card-img-top, +.card-img-bottom { + width: 100%; } + +.card-img, +.card-img-top { + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius: var(--bs-card-inner-border-radius); } + +.card-img, +.card-img-bottom { + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius: var(--bs-card-inner-border-radius); } + +.card-group > .card { + margin-bottom: var(--bs-card-group-margin); } + +@media (min-width: 576px) { + .card-group { + display: flex; + flex-flow: row wrap; } + .card-group > .card { + flex: 1 0 0%; + margin-bottom: 0; } + .card-group > .card + .card { + margin-left: 0; + border-left: 0; } + .card-group > .card:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + .card-group > .card:not(:last-child) .card-img-top, + .card-group > .card:not(:last-child) .card-header { + border-top-right-radius: 0; } + .card-group > .card:not(:last-child) .card-img-bottom, + .card-group > .card:not(:last-child) .card-footer { + border-bottom-right-radius: 0; } + .card-group > .card:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + .card-group > .card:not(:first-child) .card-img-top, + .card-group > .card:not(:first-child) .card-header { + border-top-left-radius: 0; } + .card-group > .card:not(:first-child) .card-img-bottom, + .card-group > .card:not(:first-child) .card-footer { + border-bottom-left-radius: 0; } } + +.accordion { + --bs-accordion-color: var(--bs-body-color); + --bs-accordion-bg: #fff; + --bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease; + --bs-accordion-border-color: var(--bs-border-color); + --bs-accordion-border-width: 1px; + --bs-accordion-border-radius: 0.375rem; + --bs-accordion-inner-border-radius: calc(0.375rem - 1px); + --bs-accordion-btn-padding-x: 1.25rem; + --bs-accordion-btn-padding-y: 1rem; + --bs-accordion-btn-color: var(--bs-body-color); + --bs-accordion-btn-bg: var(--bs-accordion-bg); + --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); + --bs-accordion-btn-icon-width: 1.25rem; + --bs-accordion-btn-icon-transform: rotate(-180deg); + --bs-accordion-btn-icon-transition: transform 0.2s ease-in-out; + --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%231515ce'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); + --bs-accordion-btn-focus-border-color: #8b8bf2; + --bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); + --bs-accordion-body-padding-x: 1.25rem; + --bs-accordion-body-padding-y: 1rem; + --bs-accordion-active-color: #1515ce; + --bs-accordion-active-bg: #e8e8fc; } + +.accordion-button { + position: relative; + display: flex; + align-items: center; + width: 100%; + padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x); + font-size: 1.2rem; + color: var(--bs-accordion-btn-color); + text-align: left; + background-color: var(--bs-accordion-btn-bg); + border: 0; + border-radius: 0; + overflow-anchor: none; + transition: var(--bs-accordion-transition); } + @media (prefers-reduced-motion: reduce) { + .accordion-button { + transition: none; } } + .accordion-button:not(.collapsed) { + color: var(--bs-accordion-active-color); + background-color: var(--bs-accordion-active-bg); + box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color); } + .accordion-button:not(.collapsed)::after { + background-image: var(--bs-accordion-btn-active-icon); + transform: var(--bs-accordion-btn-icon-transform); } + .accordion-button::after { + flex-shrink: 0; + width: var(--bs-accordion-btn-icon-width); + height: var(--bs-accordion-btn-icon-width); + margin-left: auto; + content: ""; + background-image: var(--bs-accordion-btn-icon); + background-repeat: no-repeat; + background-size: var(--bs-accordion-btn-icon-width); + transition: var(--bs-accordion-btn-icon-transition); } + @media (prefers-reduced-motion: reduce) { + .accordion-button::after { + transition: none; } } + .accordion-button:hover { + z-index: 2; } + .accordion-button:focus { + z-index: 3; + border-color: var(--bs-accordion-btn-focus-border-color); + outline: 0; + box-shadow: var(--bs-accordion-btn-focus-box-shadow); } + +.accordion-header { + margin-bottom: 0; } + +.accordion-item { + color: var(--bs-accordion-color); + background-color: var(--bs-accordion-bg); + border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color); } + .accordion-item:first-of-type { + border-top-left-radius: var(--bs-accordion-border-radius); + border-top-right-radius: var(--bs-accordion-border-radius); } + .accordion-item:first-of-type .accordion-button { + border-top-left-radius: var(--bs-accordion-inner-border-radius); + border-top-right-radius: var(--bs-accordion-inner-border-radius); } + .accordion-item:not(:first-of-type) { + border-top: 0; } + .accordion-item:last-of-type { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius: var(--bs-accordion-border-radius); } + .accordion-item:last-of-type .accordion-button.collapsed { + border-bottom-right-radius: var(--bs-accordion-inner-border-radius); + border-bottom-left-radius: var(--bs-accordion-inner-border-radius); } + .accordion-item:last-of-type .accordion-collapse { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius: var(--bs-accordion-border-radius); } + +.accordion-body { + padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x); } + +.accordion-flush .accordion-collapse { + border-width: 0; } + +.accordion-flush .accordion-item { + border-right: 0; + border-left: 0; + border-radius: 0; } + .accordion-flush .accordion-item:first-child { + border-top: 0; } + .accordion-flush .accordion-item:last-child { + border-bottom: 0; } + .accordion-flush .accordion-item .accordion-button, .accordion-flush .accordion-item .accordion-button.collapsed { + border-radius: 0; } + +.breadcrumb { + --bs-breadcrumb-padding-x: 0; + --bs-breadcrumb-padding-y: 0; + --bs-breadcrumb-margin-bottom: 1rem; + --bs-breadcrumb-bg: ; + --bs-breadcrumb-border-radius: ; + --bs-breadcrumb-divider-color: #8a8a8e; + --bs-breadcrumb-item-padding-x: 0.5rem; + --bs-breadcrumb-item-active-color: #8a8a8e; + display: flex; + flex-wrap: wrap; + padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x); + margin-bottom: var(--bs-breadcrumb-margin-bottom); + font-size: var(--bs-breadcrumb-font-size); + list-style: none; + background-color: var(--bs-breadcrumb-bg); + border-radius: var(--bs-breadcrumb-border-radius); } + +.breadcrumb-item + .breadcrumb-item { + padding-left: var(--bs-breadcrumb-item-padding-x); } + .breadcrumb-item + .breadcrumb-item::before { + float: left; + padding-right: var(--bs-breadcrumb-item-padding-x); + color: var(--bs-breadcrumb-divider-color); + content: var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */; } + +.breadcrumb-item.active { + color: var(--bs-breadcrumb-item-active-color); } + +.pagination { + --bs-pagination-padding-x: 0.75rem; + --bs-pagination-padding-y: 0.375rem; + --bs-pagination-font-size: 1.2rem; + --bs-pagination-color: var(--bs-link-color); + --bs-pagination-bg: #fff; + --bs-pagination-border-width: 1px; + --bs-pagination-border-color: #dee2e6; + --bs-pagination-border-radius: 0.375rem; + --bs-pagination-hover-color: var(--bs-link-hover-color); + --bs-pagination-hover-bg: #e9ecef; + --bs-pagination-hover-border-color: #dee2e6; + --bs-pagination-focus-color: var(--bs-link-hover-color); + --bs-pagination-focus-bg: #e9ecef; + --bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); + --bs-pagination-active-color: #fff; + --bs-pagination-active-bg: #1717e5; + --bs-pagination-active-border-color: #1717e5; + --bs-pagination-disabled-color: #8a8a8e; + --bs-pagination-disabled-bg: #fff; + --bs-pagination-disabled-border-color: #dee2e6; + display: flex; + padding-left: 0; + list-style: none; } + +.page-link { + position: relative; + display: block; + padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x); + font-size: var(--bs-pagination-font-size); + color: var(--bs-pagination-color); + text-decoration: none; + background-color: var(--bs-pagination-bg); + border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color); + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .page-link { + transition: none; } } + .page-link:hover { + z-index: 2; + color: var(--bs-pagination-hover-color); + background-color: var(--bs-pagination-hover-bg); + border-color: var(--bs-pagination-hover-border-color); } + .page-link:focus { + z-index: 3; + color: var(--bs-pagination-focus-color); + background-color: var(--bs-pagination-focus-bg); + outline: 0; + box-shadow: var(--bs-pagination-focus-box-shadow); } + .page-link.active, + .active > .page-link { + z-index: 3; + color: var(--bs-pagination-active-color); + background-color: var(--bs-pagination-active-bg); + border-color: var(--bs-pagination-active-border-color); } + .page-link.disabled, + .disabled > .page-link { + color: var(--bs-pagination-disabled-color); + pointer-events: none; + background-color: var(--bs-pagination-disabled-bg); + border-color: var(--bs-pagination-disabled-border-color); } + +.page-item:not(:first-child) .page-link { + margin-left: -1px; } + +.page-item:first-child .page-link { + border-top-left-radius: var(--bs-pagination-border-radius); + border-bottom-left-radius: var(--bs-pagination-border-radius); } + +.page-item:last-child .page-link { + border-top-right-radius: var(--bs-pagination-border-radius); + border-bottom-right-radius: var(--bs-pagination-border-radius); } + +.pagination-lg { + --bs-pagination-padding-x: 1.5rem; + --bs-pagination-padding-y: 0.75rem; + --bs-pagination-font-size: calc(1.275rem + 0.3vw); + --bs-pagination-border-radius: 0.5rem; } + @media (min-width: 1200px) { + .pagination-lg { + --bs-pagination-font-size: 1.5rem; } } + +.pagination-sm { + --bs-pagination-padding-x: 0.5rem; + --bs-pagination-padding-y: 0.25rem; + --bs-pagination-font-size: 1.05rem; + --bs-pagination-border-radius: 0.25rem; } + +.badge { + --bs-badge-padding-x: 0.65em; + --bs-badge-padding-y: 0.35em; + --bs-badge-font-size: 0.75em; + --bs-badge-font-weight: 700; + --bs-badge-color: #fff; + --bs-badge-border-radius: 0.375rem; + display: inline-block; + padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x); + font-size: var(--bs-badge-font-size); + font-weight: var(--bs-badge-font-weight); + line-height: 1; + color: var(--bs-badge-color); + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: var(--bs-badge-border-radius); } + .badge:empty { + display: none; } + +.btn .badge { + position: relative; + top: -1px; } + +.alert { + --bs-alert-bg: transparent; + --bs-alert-padding-x: 1rem; + --bs-alert-padding-y: 1rem; + --bs-alert-margin-bottom: 1rem; + --bs-alert-color: inherit; + --bs-alert-border-color: transparent; + --bs-alert-border: 1px solid var(--bs-alert-border-color); + --bs-alert-border-radius: 0.375rem; + position: relative; + padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x); + margin-bottom: var(--bs-alert-margin-bottom); + color: var(--bs-alert-color); + background-color: var(--bs-alert-bg); + border: var(--bs-alert-border); + border-radius: var(--bs-alert-border-radius); } + +.alert-heading { + color: inherit; } + +.alert-link { + font-weight: 700; } + +.alert-dismissible { + padding-right: 3rem; } + .alert-dismissible .btn-close { + position: absolute; + top: 0; + right: 0; + z-index: 2; + padding: 1.25rem 1rem; } + +.alert-primary { + --bs-alert-color: #0e0e89; + --bs-alert-bg: #d1d1fa; + --bs-alert-border-color: #b9b9f7; } + .alert-primary .alert-link { + color: #0b0b6e; } + +.alert-secondary { + --bs-alert-color: #535355; + --bs-alert-bg: #e8e8e8; + --bs-alert-border-color: #dcdcdd; } + .alert-secondary .alert-link { + color: #424244; } + +.alert-success { + --bs-alert-color: #0f5132; + --bs-alert-bg: #d1e7dd; + --bs-alert-border-color: #badbcc; } + .alert-success .alert-link { + color: #0c4128; } + +.alert-info { + --bs-alert-color: #0f5b6a; + --bs-alert-bg: #cff4fc; + --bs-alert-border-color: #b6effb; } + .alert-info .alert-link { + color: #0c4955; } + +.alert-warning { + --bs-alert-color: #70570d; + --bs-alert-bg: #fff3cd; + --bs-alert-border-color: #ffecb5; } + .alert-warning .alert-link { + color: #5a460a; } + +.alert-danger { + --bs-alert-color: #842029; + --bs-alert-bg: #f8d7da; + --bs-alert-border-color: #f5c2c7; } + .alert-danger .alert-link { + color: #6a1a21; } + +.alert-light { + --bs-alert-color: #6d6e6e; + --bs-alert-bg: #fefefe; + --bs-alert-border-color: #fdfdfe; } + .alert-light .alert-link { + color: #575858; } + +.alert-dark { + --bs-alert-color: #131313; + --bs-alert-bg: #d2d2d2; + --bs-alert-border-color: #bcbcbc; } + .alert-dark .alert-link { + color: #0f0f0f; } + +@keyframes progress-bar-stripes { + 0% { + background-position-x: 1rem; } } + +.progress { + --bs-progress-height: 1rem; + --bs-progress-font-size: 0.9rem; + --bs-progress-bg: #e9ecef; + --bs-progress-border-radius: 0.375rem; + --bs-progress-box-shadow: inset 0 1px 2px rgba(17, 17, 17, 0.075); + --bs-progress-bar-color: #fff; + --bs-progress-bar-bg: #1717e5; + --bs-progress-bar-transition: width 0.6s ease; + display: flex; + height: var(--bs-progress-height); + overflow: hidden; + font-size: var(--bs-progress-font-size); + background-color: var(--bs-progress-bg); + border-radius: var(--bs-progress-border-radius); } + +.progress-bar { + display: flex; + flex-direction: column; + justify-content: center; + overflow: hidden; + color: var(--bs-progress-bar-color); + text-align: center; + white-space: nowrap; + background-color: var(--bs-progress-bar-bg); + transition: var(--bs-progress-bar-transition); } + @media (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; } } + +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: var(--bs-progress-height) var(--bs-progress-height); } + +.progress-bar-animated { + animation: 1s linear infinite progress-bar-stripes; } + @media (prefers-reduced-motion: reduce) { + .progress-bar-animated { + animation: none; } } + +.list-group { + --bs-list-group-color: #202020; + --bs-list-group-bg: #fff; + --bs-list-group-border-color: rgba(17, 17, 17, 0.125); + --bs-list-group-border-width: 1px; + --bs-list-group-border-radius: 0.375rem; + --bs-list-group-item-padding-x: 1rem; + --bs-list-group-item-padding-y: 0.5rem; + --bs-list-group-action-color: #495057; + --bs-list-group-action-hover-color: #495057; + --bs-list-group-action-hover-bg: #f8f9fa; + --bs-list-group-action-active-color: #202020; + --bs-list-group-action-active-bg: #e9ecef; + --bs-list-group-disabled-color: #8a8a8e; + --bs-list-group-disabled-bg: #fff; + --bs-list-group-active-color: #fff; + --bs-list-group-active-bg: #1717e5; + --bs-list-group-active-border-color: #1717e5; + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + border-radius: var(--bs-list-group-border-radius); } + +.list-group-numbered { + list-style-type: none; + counter-reset: section; } + .list-group-numbered > .list-group-item::before { + content: counters(section, ".") ". "; + counter-increment: section; } + +.list-group-item-action { + width: 100%; + color: var(--bs-list-group-action-color); + text-align: inherit; } + .list-group-item-action:hover, .list-group-item-action:focus { + z-index: 1; + color: var(--bs-list-group-action-hover-color); + text-decoration: none; + background-color: var(--bs-list-group-action-hover-bg); } + .list-group-item-action:active { + color: var(--bs-list-group-action-active-color); + background-color: var(--bs-list-group-action-active-bg); } + +.list-group-item { + position: relative; + display: block; + padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x); + color: var(--bs-list-group-color); + text-decoration: none; + background-color: var(--bs-list-group-bg); + border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color); } + .list-group-item:first-child { + border-top-left-radius: inherit; + border-top-right-radius: inherit; } + .list-group-item:last-child { + border-bottom-right-radius: inherit; + border-bottom-left-radius: inherit; } + .list-group-item.disabled, .list-group-item:disabled { + color: var(--bs-list-group-disabled-color); + pointer-events: none; + background-color: var(--bs-list-group-disabled-bg); } + .list-group-item.active { + z-index: 2; + color: var(--bs-list-group-active-color); + background-color: var(--bs-list-group-active-bg); + border-color: var(--bs-list-group-active-border-color); } + .list-group-item + .list-group-item { + border-top-width: 0; } + .list-group-item + .list-group-item.active { + margin-top: calc(-1 * var(--bs-list-group-border-width)); + border-top-width: var(--bs-list-group-border-width); } + +.list-group-horizontal { + flex-direction: row; } + .list-group-horizontal > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } + +@media (min-width: 576px) { + .list-group-horizontal-sm { + flex-direction: row; } + .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-sm > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-sm > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-sm > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 768px) { + .list-group-horizontal-md { + flex-direction: row; } + .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-md > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-md > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-md > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 992px) { + .list-group-horizontal-lg { + flex-direction: row; } + .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-lg > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-lg > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-lg > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 1200px) { + .list-group-horizontal-xl { + flex-direction: row; } + .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-xl > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-xl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-xl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 1680px) { + .list-group-horizontal-xxl { + flex-direction: row; } + .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-xxl > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-xxl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-xxl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +.list-group-flush { + border-radius: 0; } + .list-group-flush > .list-group-item { + border-width: 0 0 var(--bs-list-group-border-width); } + .list-group-flush > .list-group-item:last-child { + border-bottom-width: 0; } + +.list-group-item-primary { + color: #0e0e89; + background-color: #d1d1fa; } + .list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #0e0e89; + background-color: #bcbce1; } + .list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #0e0e89; + border-color: #0e0e89; } + +.list-group-item-secondary { + color: #535355; + background-color: #e8e8e8; } + .list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #535355; + background-color: #d1d1d1; } + .list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #535355; + border-color: #535355; } + +.list-group-item-success { + color: #0f5132; + background-color: #d1e7dd; } + .list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #0f5132; + background-color: #bcd0c7; } + .list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #0f5132; + border-color: #0f5132; } + +.list-group-item-info { + color: #0f5b6a; + background-color: #cff4fc; } + .list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #0f5b6a; + background-color: #badce3; } + .list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #0f5b6a; + border-color: #0f5b6a; } + +.list-group-item-warning { + color: #70570d; + background-color: #fff3cd; } + .list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #70570d; + background-color: #e6dbb9; } + .list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #70570d; + border-color: #70570d; } + +.list-group-item-danger { + color: #842029; + background-color: #f8d7da; } + .list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #842029; + background-color: #dfc2c4; } + .list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #842029; + border-color: #842029; } + +.list-group-item-light { + color: #6d6e6e; + background-color: #fefefe; } + .list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #6d6e6e; + background-color: #e5e5e5; } + .list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #6d6e6e; + border-color: #6d6e6e; } + +.list-group-item-dark { + color: #131313; + background-color: #d2d2d2; } + .list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #131313; + background-color: #bdbdbd; } + .list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #131313; + border-color: #131313; } + +.btn-close { + box-sizing: content-box; + width: 1em; + height: 1em; + padding: 0.25em 0.25em; + color: #111; + background: transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23111'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat; + border: 0; + border-radius: 0.375rem; + opacity: 0.5; } + .btn-close:hover { + color: #111; + text-decoration: none; + opacity: 0.75; } + .btn-close:focus { + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(23, 23, 229, 0.25); + opacity: 1; } + .btn-close:disabled, .btn-close.disabled { + pointer-events: none; + user-select: none; + opacity: 0.25; } + +.btn-close-white { + filter: invert(1) grayscale(100%) brightness(200%); } + +.toast { + --bs-toast-zindex: 1090; + --bs-toast-padding-x: 0.75rem; + --bs-toast-padding-y: 0.5rem; + --bs-toast-spacing: 4vw; + --bs-toast-max-width: 350px; + --bs-toast-font-size: 0.875rem; + --bs-toast-color: ; + --bs-toast-bg: rgba(255, 255, 255, 0.85); + --bs-toast-border-width: 1px; + --bs-toast-border-color: var(--bs-border-color-translucent); + --bs-toast-border-radius: 0.375rem; + --bs-toast-box-shadow: 0 1rem 3rem rgba(17, 17, 17, 0.5); + --bs-toast-header-color: #8a8a8e; + --bs-toast-header-bg: rgba(255, 255, 255, 0.85); + --bs-toast-header-border-color: rgba(17, 17, 17, 0.05); + width: var(--bs-toast-max-width); + max-width: 100%; + font-size: var(--bs-toast-font-size); + color: var(--bs-toast-color); + pointer-events: auto; + background-color: var(--bs-toast-bg); + background-clip: padding-box; + border: var(--bs-toast-border-width) solid var(--bs-toast-border-color); + box-shadow: var(--bs-toast-box-shadow); + border-radius: var(--bs-toast-border-radius); } + .toast.showing { + opacity: 0; } + .toast:not(.show) { + display: none; } + +.toast-container { + position: absolute; + z-index: var(--bs-toast-zindex); + width: max-content; + max-width: 100%; + pointer-events: none; } + .toast-container > :not(:last-child) { + margin-bottom: var(--bs-toast-spacing); } + +.toast-header { + display: flex; + align-items: center; + padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x); + color: var(--bs-toast-header-color); + background-color: var(--bs-toast-header-bg); + background-clip: padding-box; + border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color); + border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)); + border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)); } + .toast-header .btn-close { + margin-right: calc(-.5 * var(--bs-toast-padding-x)); + margin-left: var(--bs-toast-padding-x); } + +.toast-body { + padding: var(--bs-toast-padding-x); + word-wrap: break-word; } + +.modal { + --bs-modal-zindex: 1055; + --bs-modal-width: 500px; + --bs-modal-padding: 1rem; + --bs-modal-margin: 0.5rem; + --bs-modal-color: ; + --bs-modal-bg: #fff; + --bs-modal-border-color: var(--bs-border-color-translucent); + --bs-modal-border-width: 1px; + --bs-modal-border-radius: 0.5rem; + --bs-modal-box-shadow: 0 1rem 1.5rem rgba(17, 17, 17, 0.25); + --bs-modal-inner-border-radius: calc(0.5rem - 1px); + --bs-modal-header-padding-x: 1rem; + --bs-modal-header-padding-y: 1rem; + --bs-modal-header-padding: 1rem 1rem; + --bs-modal-header-border-color: var(--bs-border-color); + --bs-modal-header-border-width: 1px; + --bs-modal-title-line-height: 1.5; + --bs-modal-footer-gap: 0.5rem; + --bs-modal-footer-bg: ; + --bs-modal-footer-border-color: var(--bs-border-color); + --bs-modal-footer-border-width: 1px; + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-modal-zindex); + display: none; + width: 100%; + height: 100%; + overflow-x: hidden; + overflow-y: auto; + outline: 0; } + +.modal-dialog { + position: relative; + width: auto; + margin: var(--bs-modal-margin); + pointer-events: none; } + .modal.fade .modal-dialog { + transition: transform 0.3s ease-out; + transform: translate(0, -50px); } + @media (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; } } + .modal.show .modal-dialog { + transform: none; } + .modal.modal-static .modal-dialog { + transform: scale(1.02); } + +.modal-dialog-scrollable { + height: calc(100% - var(--bs-modal-margin) * 2); } + .modal-dialog-scrollable .modal-content { + max-height: 100%; + overflow: hidden; } + .modal-dialog-scrollable .modal-body { + overflow-y: auto; } + +.modal-dialog-centered { + display: flex; + align-items: center; + min-height: calc(100% - var(--bs-modal-margin) * 2); } + +.modal-content { + position: relative; + display: flex; + flex-direction: column; + width: 100%; + color: var(--bs-modal-color); + pointer-events: auto; + background-color: var(--bs-modal-bg); + background-clip: padding-box; + border: var(--bs-modal-border-width) solid var(--bs-modal-border-color); + border-radius: var(--bs-modal-border-radius); + outline: 0; } + +.modal-backdrop { + --bs-backdrop-zindex: 1050; + --bs-backdrop-bg: #111; + --bs-backdrop-opacity: 0.5; + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-backdrop-zindex); + width: 100vw; + height: 100vh; + background-color: var(--bs-backdrop-bg); } + .modal-backdrop.fade { + opacity: 0; } + .modal-backdrop.show { + opacity: var(--bs-backdrop-opacity); } + +.modal-header { + display: flex; + flex-shrink: 0; + align-items: center; + justify-content: space-between; + padding: var(--bs-modal-header-padding); + border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color); + border-top-left-radius: var(--bs-modal-inner-border-radius); + border-top-right-radius: var(--bs-modal-inner-border-radius); } + .modal-header .btn-close { + padding: calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5); + margin: calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto; } + +.modal-title { + margin-bottom: 0; + line-height: var(--bs-modal-title-line-height); } + +.modal-body { + position: relative; + flex: 1 1 auto; + padding: var(--bs-modal-padding); } + +.modal-footer { + display: flex; + flex-shrink: 0; + flex-wrap: wrap; + align-items: center; + justify-content: flex-end; + padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5); + background-color: var(--bs-modal-footer-bg); + border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color); + border-bottom-right-radius: var(--bs-modal-inner-border-radius); + border-bottom-left-radius: var(--bs-modal-inner-border-radius); } + .modal-footer > * { + margin: calc(var(--bs-modal-footer-gap) * .5); } + +@media (min-width: 576px) { + .modal { + --bs-modal-margin: 1.75rem; + --bs-modal-box-shadow: 0 1rem 3rem rgba(17, 17, 17, 0.5); } + .modal-dialog { + max-width: var(--bs-modal-width); + margin-right: auto; + margin-left: auto; } + .modal-sm { + --bs-modal-width: 300px; } } + +@media (min-width: 992px) { + .modal-lg, + .modal-xl { + --bs-modal-width: 800px; } } + +@media (min-width: 1200px) { + .modal-xl { + --bs-modal-width: 1140px; } } + +.modal-fullscreen { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen .modal-header, + .modal-fullscreen .modal-footer { + border-radius: 0; } + .modal-fullscreen .modal-body { + overflow-y: auto; } + +@media (max-width: 575.98px) { + .modal-fullscreen-sm-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-sm-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-sm-down .modal-header, + .modal-fullscreen-sm-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-sm-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 767.98px) { + .modal-fullscreen-md-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-md-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-md-down .modal-header, + .modal-fullscreen-md-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-md-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 991.98px) { + .modal-fullscreen-lg-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-lg-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-lg-down .modal-header, + .modal-fullscreen-lg-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-lg-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 1199.98px) { + .modal-fullscreen-xl-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-xl-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-xl-down .modal-header, + .modal-fullscreen-xl-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-xl-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 1679.98px) { + .modal-fullscreen-xxl-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-xxl-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-xxl-down .modal-header, + .modal-fullscreen-xxl-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-xxl-down .modal-body { + overflow-y: auto; } } + +.tooltip { + --bs-tooltip-zindex: 1080; + --bs-tooltip-max-width: 200px; + --bs-tooltip-padding-x: 0.5rem; + --bs-tooltip-padding-y: 0.25rem; + --bs-tooltip-margin: ; + --bs-tooltip-font-size: 1.05rem; + --bs-tooltip-color: #fff; + --bs-tooltip-bg: #111; + --bs-tooltip-border-radius: 0.375rem; + --bs-tooltip-opacity: 0.9; + --bs-tooltip-arrow-width: 0.8rem; + --bs-tooltip-arrow-height: 0.4rem; + z-index: var(--bs-tooltip-zindex); + display: block; + padding: var(--bs-tooltip-arrow-height); + margin: var(--bs-tooltip-margin); + font-family: var(--bs-font-sans-serif); + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-tooltip-font-size); + word-wrap: break-word; + opacity: 0; } + .tooltip.show { + opacity: var(--bs-tooltip-opacity); } + .tooltip .tooltip-arrow { + display: block; + width: var(--bs-tooltip-arrow-width); + height: var(--bs-tooltip-arrow-height); } + .tooltip .tooltip-arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; } + +.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow { + bottom: 0; } + .bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow::before { + top: -1px; + border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-top-color: var(--bs-tooltip-bg); } + +/* rtl:begin:ignore */ +.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow { + left: 0; + width: var(--bs-tooltip-arrow-height); + height: var(--bs-tooltip-arrow-width); } + .bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow::before { + right: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-right-color: var(--bs-tooltip-bg); } + +/* rtl:end:ignore */ +.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow { + top: 0; } + .bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow::before { + bottom: -1px; + border-width: 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-bottom-color: var(--bs-tooltip-bg); } + +/* rtl:begin:ignore */ +.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow { + right: 0; + width: var(--bs-tooltip-arrow-height); + height: var(--bs-tooltip-arrow-width); } + .bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow::before { + left: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-left-color: var(--bs-tooltip-bg); } + +/* rtl:end:ignore */ +.tooltip-inner { + max-width: var(--bs-tooltip-max-width); + padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x); + color: var(--bs-tooltip-color); + text-align: center; + background-color: var(--bs-tooltip-bg); + border-radius: var(--bs-tooltip-border-radius); } + +.popover { + --bs-popover-zindex: 1070; + --bs-popover-max-width: 276px; + --bs-popover-font-size: 1.05rem; + --bs-popover-bg: #fff; + --bs-popover-border-width: 1px; + --bs-popover-border-color: var(--bs-border-color-translucent); + --bs-popover-border-radius: 0.5rem; + --bs-popover-inner-border-radius: calc(0.5rem - 1px); + --bs-popover-box-shadow: 0 1rem 3rem rgba(17, 17, 17, 0.5); + --bs-popover-header-padding-x: 1rem; + --bs-popover-header-padding-y: 0.5rem; + --bs-popover-header-font-size: 1.2rem; + --bs-popover-header-color: ; + --bs-popover-header-bg: #f0f0f0; + --bs-popover-body-padding-x: 1rem; + --bs-popover-body-padding-y: 1rem; + --bs-popover-body-color: #202020; + --bs-popover-arrow-width: 1rem; + --bs-popover-arrow-height: 0.5rem; + --bs-popover-arrow-border: var(--bs-popover-border-color); + z-index: var(--bs-popover-zindex); + display: block; + max-width: var(--bs-popover-max-width); + font-family: var(--bs-font-sans-serif); + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-popover-font-size); + word-wrap: break-word; + background-color: var(--bs-popover-bg); + background-clip: padding-box; + border: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-radius: var(--bs-popover-border-radius); } + .popover .popover-arrow { + display: block; + width: var(--bs-popover-arrow-width); + height: var(--bs-popover-arrow-height); } + .popover .popover-arrow::before, .popover .popover-arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; + border-width: 0; } + +.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow { + bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); } + .bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::after { + border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0; } + .bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::before { + bottom: 0; + border-top-color: var(--bs-popover-arrow-border); } + .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::after { + bottom: var(--bs-popover-border-width); + border-top-color: var(--bs-popover-bg); } + +/* rtl:begin:ignore */ +.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow { + left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height: var(--bs-popover-arrow-width); } + .bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::after { + border-width: calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0; } + .bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::before { + left: 0; + border-right-color: var(--bs-popover-arrow-border); } + .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::after { + left: var(--bs-popover-border-width); + border-right-color: var(--bs-popover-bg); } + +/* rtl:end:ignore */ +.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow { + top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); } + .bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::after { + border-width: 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height); } + .bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::before { + top: 0; + border-bottom-color: var(--bs-popover-arrow-border); } + .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::after { + top: var(--bs-popover-border-width); + border-bottom-color: var(--bs-popover-bg); } + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: var(--bs-popover-arrow-width); + margin-left: calc(-.5 * var(--bs-popover-arrow-width)); + content: ""; + border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg); } + +/* rtl:begin:ignore */ +.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow { + right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height: var(--bs-popover-arrow-width); } + .bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::after { + border-width: calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height); } + .bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::before { + right: 0; + border-left-color: var(--bs-popover-arrow-border); } + .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::after { + right: var(--bs-popover-border-width); + border-left-color: var(--bs-popover-bg); } + +/* rtl:end:ignore */ +.popover-header { + padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x); + margin-bottom: 0; + font-size: var(--bs-popover-header-font-size); + color: var(--bs-popover-header-color); + background-color: var(--bs-popover-header-bg); + border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-top-left-radius: var(--bs-popover-inner-border-radius); + border-top-right-radius: var(--bs-popover-inner-border-radius); } + .popover-header:empty { + display: none; } + +.popover-body { + padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x); + color: var(--bs-popover-body-color); } + +.carousel { + position: relative; } + +.carousel.pointer-event { + touch-action: pan-y; } + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; } + .carousel-inner::after { + display: block; + clear: both; + content: ""; } + +.carousel-item { + position: relative; + display: none; + float: left; + width: 100%; + margin-right: -100%; + backface-visibility: hidden; + transition: transform 0.6s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; } } + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; } + +/* rtl:begin:ignore */ +.carousel-item-next:not(.carousel-item-start), +.active.carousel-item-end { + transform: translateX(100%); } + +.carousel-item-prev:not(.carousel-item-end), +.active.carousel-item-start { + transform: translateX(-100%); } + +/* rtl:end:ignore */ +.carousel-fade .carousel-item { + opacity: 0; + transition-property: opacity; + transform: none; } + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-start, +.carousel-fade .carousel-item-prev.carousel-item-end { + z-index: 1; + opacity: 1; } + +.carousel-fade .active.carousel-item-start, +.carousel-fade .active.carousel-item-end { + z-index: 0; + opacity: 0; + transition: opacity 0s 0.6s; } + @media (prefers-reduced-motion: reduce) { + .carousel-fade .active.carousel-item-start, + .carousel-fade .active.carousel-item-end { + transition: none; } } + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + z-index: 1; + display: flex; + align-items: center; + justify-content: center; + width: 15%; + padding: 0; + color: #fff; + text-align: center; + background: none; + border: 0; + opacity: 0.5; + transition: opacity 0.15s ease; } + @media (prefers-reduced-motion: reduce) { + .carousel-control-prev, + .carousel-control-next { + transition: none; } } + .carousel-control-prev:hover, .carousel-control-prev:focus, + .carousel-control-next:hover, + .carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: 0.9; } + +.carousel-control-prev { + left: 0; } + +.carousel-control-next { + right: 0; } + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 2rem; + height: 2rem; + background-repeat: no-repeat; + background-position: 50%; + background-size: 100% 100%; } + +/* rtl:options: { + "autoRename": true, + "stringMap":[ { + "name" : "prev-next", + "search" : "prev", + "replace" : "next" + } ] +} */ +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e"); } + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); } + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 0; + left: 0; + z-index: 2; + display: flex; + justify-content: center; + padding: 0; + margin-right: 15%; + margin-bottom: 1rem; + margin-left: 15%; + list-style: none; } + .carousel-indicators [data-bs-target] { + box-sizing: content-box; + flex: 0 1 auto; + width: 30px; + height: 3px; + padding: 0; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + cursor: pointer; + background-color: #fff; + background-clip: padding-box; + border: 0; + border-top: 10px solid transparent; + border-bottom: 10px solid transparent; + opacity: 0.5; + transition: opacity 0.6s ease; } + @media (prefers-reduced-motion: reduce) { + .carousel-indicators [data-bs-target] { + transition: none; } } + .carousel-indicators .active { + opacity: 1; } + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 1.25rem; + left: 15%; + padding-top: 1.25rem; + padding-bottom: 1.25rem; + color: #fff; + text-align: center; } + +.carousel-dark .carousel-control-prev-icon, +.carousel-dark .carousel-control-next-icon { + filter: invert(1) grayscale(100); } + +.carousel-dark .carousel-indicators [data-bs-target] { + background-color: #111; } + +.carousel-dark .carousel-caption { + color: #111; } + +.spinner-grow, +.spinner-border { + display: inline-block; + width: var(--bs-spinner-width); + height: var(--bs-spinner-height); + vertical-align: var(--bs-spinner-vertical-align); + border-radius: 50%; + animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name); } + +@keyframes spinner-border { + to { + transform: rotate(360deg) /* rtl:ignore */; } } + +.spinner-border { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-border-width: 0.25em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-border; + border: var(--bs-spinner-border-width) solid currentcolor; + border-right-color: transparent; } + +.spinner-border-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem; + --bs-spinner-border-width: 0.2em; } + +@keyframes spinner-grow { + 0% { + transform: scale(0); } + 50% { + opacity: 1; + transform: none; } } + +.spinner-grow { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-grow; + background-color: currentcolor; + opacity: 0; } + +.spinner-grow-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem; } + +@media (prefers-reduced-motion: reduce) { + .spinner-border, + .spinner-grow { + --bs-spinner-animation-speed: 1.5s; } } + +.offcanvas-sm, .offcanvas-md, .offcanvas-lg, .offcanvas-xl, .offcanvas-xxl, .offcanvas { + --bs-offcanvas-zindex: 1045; + --bs-offcanvas-width: 400px; + --bs-offcanvas-height: 30vh; + --bs-offcanvas-padding-x: 1rem; + --bs-offcanvas-padding-y: 1rem; + --bs-offcanvas-color: ; + --bs-offcanvas-bg: #fff; + --bs-offcanvas-border-width: 1px; + --bs-offcanvas-border-color: var(--bs-border-color-translucent); + --bs-offcanvas-box-shadow: 0 1rem 1.5rem rgba(17, 17, 17, 0.25); } + +@media (max-width: 575.98px) { + .offcanvas-sm { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } } + @media (max-width: 575.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-sm { + transition: none; } } + +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-sm.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-sm.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-sm.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) { + transform: none; } + .offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show { + visibility: visible; } } + +@media (min-width: 576px) { + .offcanvas-sm { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-sm .offcanvas-header { + display: none; } + .offcanvas-sm .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 767.98px) { + .offcanvas-md { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } } + @media (max-width: 767.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-md { + transition: none; } } + +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-md.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-md.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-md.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-md.showing, .offcanvas-md.show:not(.hiding) { + transform: none; } + .offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show { + visibility: visible; } } + +@media (min-width: 768px) { + .offcanvas-md { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-md .offcanvas-header { + display: none; } + .offcanvas-md .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 991.98px) { + .offcanvas-lg { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } } + @media (max-width: 991.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-lg { + transition: none; } } + +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-lg.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-lg.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-lg.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) { + transform: none; } + .offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show { + visibility: visible; } } + +@media (min-width: 992px) { + .offcanvas-lg { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-lg .offcanvas-header { + display: none; } + .offcanvas-lg .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 1199.98px) { + .offcanvas-xl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } } + @media (max-width: 1199.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-xl { + transition: none; } } + +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-xl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-xl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-xl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) { + transform: none; } + .offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show { + visibility: visible; } } + +@media (min-width: 1200px) { + .offcanvas-xl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-xl .offcanvas-header { + display: none; } + .offcanvas-xl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 1679.98px) { + .offcanvas-xxl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } } + @media (max-width: 1679.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-xxl { + transition: none; } } + +@media (max-width: 1679.98px) { + .offcanvas-xxl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-xxl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-xxl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-xxl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) { + transform: none; } + .offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show { + visibility: visible; } } + +@media (min-width: 1680px) { + .offcanvas-xxl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-xxl .offcanvas-header { + display: none; } + .offcanvas-xxl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +.offcanvas { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: transform 0.3s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .offcanvas { + transition: none; } } + .offcanvas.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas.showing, .offcanvas.show:not(.hiding) { + transform: none; } + .offcanvas.showing, .offcanvas.hiding, .offcanvas.show { + visibility: visible; } + +.offcanvas-backdrop { + position: fixed; + top: 0; + left: 0; + z-index: 1040; + width: 100vw; + height: 100vh; + background-color: #111; } + .offcanvas-backdrop.fade { + opacity: 0; } + .offcanvas-backdrop.show { + opacity: 0.5; } + +.offcanvas-header { + display: flex; + align-items: center; + justify-content: space-between; + padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x); } + .offcanvas-header .btn-close { + padding: calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5); + margin-top: calc(-.5 * var(--bs-offcanvas-padding-y)); + margin-right: calc(-.5 * var(--bs-offcanvas-padding-x)); + margin-bottom: calc(-.5 * var(--bs-offcanvas-padding-y)); } + +.offcanvas-title { + margin-bottom: 0; + line-height: 1.5; } + +.offcanvas-body { + flex-grow: 1; + padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x); + overflow-y: auto; } + +.placeholder { + display: inline-block; + min-height: 1em; + vertical-align: middle; + cursor: wait; + background-color: currentcolor; + opacity: 0.5; } + .placeholder.btn::before { + display: inline-block; + content: ""; } + +.placeholder-xs { + min-height: .6em; } + +.placeholder-sm { + min-height: .8em; } + +.placeholder-lg { + min-height: 1.2em; } + +.placeholder-glow .placeholder { + animation: placeholder-glow 2s ease-in-out infinite; } + +@keyframes placeholder-glow { + 50% { + opacity: 0.2; } } + +.placeholder-wave { + mask-image: linear-gradient(130deg, #111 55%, rgba(0, 0, 0, 0.8) 75%, #111 95%); + mask-size: 200% 100%; + animation: placeholder-wave 2s linear infinite; } + +@keyframes placeholder-wave { + 100% { + mask-position: -200% 0%; } } + +.clearfix::after { + display: block; + clear: both; + content: ""; } + +.text-bg-primary { + color: #fff !important; + background-color: RGBA(23, 23, 229, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-secondary { + color: #111 !important; + background-color: RGBA(138, 138, 142, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-success { + color: #fff !important; + background-color: RGBA(25, 135, 84, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-info { + color: #111 !important; + background-color: RGBA(13, 202, 240, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-warning { + color: #111 !important; + background-color: RGBA(255, 193, 7, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-danger { + color: #fff !important; + background-color: RGBA(220, 53, 69, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-light { + color: #111 !important; + background-color: RGBA(248, 249, 250, var(--bs-bg-opacity, 1)) !important; } + +.text-bg-dark { + color: #fff !important; + background-color: RGBA(32, 32, 32, var(--bs-bg-opacity, 1)) !important; } + +.link-primary { + color: #1717e5 !important; } + .link-primary:hover, .link-primary:focus { + color: #1212b7 !important; } + +.link-secondary { + color: #8a8a8e !important; } + .link-secondary:hover, .link-secondary:focus { + color: #a1a1a5 !important; } + +.link-success { + color: #198754 !important; } + .link-success:hover, .link-success:focus { + color: #146c43 !important; } + +.link-info { + color: #0dcaf0 !important; } + .link-info:hover, .link-info:focus { + color: #3dd5f3 !important; } + +.link-warning { + color: #ffc107 !important; } + .link-warning:hover, .link-warning:focus { + color: #ffcd39 !important; } + +.link-danger { + color: #dc3545 !important; } + .link-danger:hover, .link-danger:focus { + color: #b02a37 !important; } + +.link-light { + color: #f8f9fa !important; } + .link-light:hover, .link-light:focus { + color: #f9fafb !important; } + +.link-dark { + color: #202020 !important; } + .link-dark:hover, .link-dark:focus { + color: #1a1a1a !important; } + +.ratio { + position: relative; + width: 100%; } + .ratio::before { + display: block; + padding-top: var(--bs-aspect-ratio); + content: ""; } + .ratio > * { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; } + +.ratio-1x1 { + --bs-aspect-ratio: 100%; } + +.ratio-4x3 { + --bs-aspect-ratio: calc(3 / 4 * 100%); } + +.ratio-16x9 { + --bs-aspect-ratio: calc(9 / 16 * 100%); } + +.ratio-21x9 { + --bs-aspect-ratio: calc(9 / 21 * 100%); } + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; } + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index: 1030; } + +.sticky-top { + position: sticky; + top: 0; + z-index: 1020; } + +.sticky-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } + +@media (min-width: 576px) { + .sticky-sm-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-sm-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 768px) { + .sticky-md-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-md-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 992px) { + .sticky-lg-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-lg-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 1200px) { + .sticky-xl-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-xl-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 1680px) { + .sticky-xxl-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-xxl-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +.hstack { + display: flex; + flex-direction: row; + align-items: center; + align-self: stretch; } + +.vstack { + display: flex; + flex: 1 1 auto; + flex-direction: column; + align-self: stretch; } + +.visually-hidden, +.visually-hidden-focusable:not(:focus):not(:focus-within) { + position: absolute !important; + width: 1px !important; + height: 1px !important; + padding: 0 !important; + margin: -1px !important; + overflow: hidden !important; + clip: rect(0, 0, 0, 0) !important; + white-space: nowrap !important; + border: 0 !important; } + +.stretched-link::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1; + content: ""; } + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; } + +.vr { + display: inline-block; + align-self: stretch; + width: 1px; + min-height: 1em; + background-color: currentcolor; + opacity: 0.25; } + +.align-baseline { + vertical-align: baseline !important; } + +.align-top { + vertical-align: top !important; } + +.align-middle { + vertical-align: middle !important; } + +.align-bottom { + vertical-align: bottom !important; } + +.align-text-bottom { + vertical-align: text-bottom !important; } + +.align-text-top { + vertical-align: text-top !important; } + +.float-start { + float: left !important; } + +.float-end { + float: right !important; } + +.float-none { + float: none !important; } + +.opacity-0 { + opacity: 0 !important; } + +.opacity-25 { + opacity: 0.25 !important; } + +.opacity-50 { + opacity: 0.5 !important; } + +.opacity-75 { + opacity: 0.75 !important; } + +.opacity-100 { + opacity: 1 !important; } + +.overflow-auto { + overflow: auto !important; } + +.overflow-hidden { + overflow: hidden !important; } + +.overflow-visible { + overflow: visible !important; } + +.overflow-scroll { + overflow: scroll !important; } + +.d-inline { + display: inline !important; } + +.d-inline-block { + display: inline-block !important; } + +.d-block { + display: block !important; } + +.d-grid { + display: grid !important; } + +.d-table { + display: table !important; } + +.d-table-row { + display: table-row !important; } + +.d-table-cell { + display: table-cell !important; } + +.d-flex { + display: flex !important; } + +.d-inline-flex { + display: inline-flex !important; } + +.d-none { + display: none !important; } + +.shadow { + box-shadow: 0 1rem 3rem rgba(17, 17, 17, 0.5) !important; } + +.shadow-sm { + box-shadow: 0 1rem 1.5rem rgba(17, 17, 17, 0.25) !important; } + +.shadow-lg { + box-shadow: 0 4rem 6rem rgba(17, 17, 17, 0.25) !important; } + +.shadow-none { + box-shadow: none !important; } + +.position-static { + position: static !important; } + +.position-relative { + position: relative !important; } + +.position-absolute { + position: absolute !important; } + +.position-fixed { + position: fixed !important; } + +.position-sticky { + position: sticky !important; } + +.top-0 { + top: 0 !important; } + +.top-50 { + top: 50% !important; } + +.top-100 { + top: 100% !important; } + +.bottom-0 { + bottom: 0 !important; } + +.bottom-50 { + bottom: 50% !important; } + +.bottom-100 { + bottom: 100% !important; } + +.start-0 { + left: 0 !important; } + +.start-50 { + left: 50% !important; } + +.start-100 { + left: 100% !important; } + +.end-0 { + right: 0 !important; } + +.end-50 { + right: 50% !important; } + +.end-100 { + right: 100% !important; } + +.translate-middle { + transform: translate(-50%, -50%) !important; } + +.translate-middle-x { + transform: translateX(-50%) !important; } + +.translate-middle-y { + transform: translateY(-50%) !important; } + +.border { + border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-0 { + border: 0 !important; } + +.border-top { + border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-top-0 { + border-top: 0 !important; } + +.border-end { + border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-end-0 { + border-right: 0 !important; } + +.border-bottom { + border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-bottom-0 { + border-bottom: 0 !important; } + +.border-start { + border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-start-0 { + border-left: 0 !important; } + +.border-primary { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important; } + +.border-secondary { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important; } + +.border-success { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important; } + +.border-info { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important; } + +.border-warning { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important; } + +.border-danger { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important; } + +.border-light { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important; } + +.border-dark { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important; } + +.border-white { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important; } + +.border-1 { + --bs-border-width: 1px; } + +.border-2 { + --bs-border-width: 2px; } + +.border-3 { + --bs-border-width: 3px; } + +.border-4 { + --bs-border-width: 4px; } + +.border-5 { + --bs-border-width: 5px; } + +.border-opacity-10 { + --bs-border-opacity: 0.1; } + +.border-opacity-25 { + --bs-border-opacity: 0.25; } + +.border-opacity-50 { + --bs-border-opacity: 0.5; } + +.border-opacity-75 { + --bs-border-opacity: 0.75; } + +.border-opacity-100 { + --bs-border-opacity: 1; } + +.w-25 { + width: 25% !important; } + +.w-50 { + width: 50% !important; } + +.w-75 { + width: 75% !important; } + +.w-100 { + width: 100% !important; } + +.w-auto { + width: auto !important; } + +.mw-100 { + max-width: 100% !important; } + +.vw-100 { + width: 100vw !important; } + +.min-vw-100 { + min-width: 100vw !important; } + +.h-25 { + height: 25% !important; } + +.h-50 { + height: 50% !important; } + +.h-75 { + height: 75% !important; } + +.h-100 { + height: 100% !important; } + +.h-auto { + height: auto !important; } + +.mh-100 { + max-height: 100% !important; } + +.vh-100 { + height: 100vh !important; } + +.min-vh-100 { + min-height: 100vh !important; } + +.flex-fill { + flex: 1 1 auto !important; } + +.flex-row { + flex-direction: row !important; } + +.flex-column { + flex-direction: column !important; } + +.flex-row-reverse { + flex-direction: row-reverse !important; } + +.flex-column-reverse { + flex-direction: column-reverse !important; } + +.flex-grow-0 { + flex-grow: 0 !important; } + +.flex-grow-1 { + flex-grow: 1 !important; } + +.flex-shrink-0 { + flex-shrink: 0 !important; } + +.flex-shrink-1 { + flex-shrink: 1 !important; } + +.flex-wrap { + flex-wrap: wrap !important; } + +.flex-nowrap { + flex-wrap: nowrap !important; } + +.flex-wrap-reverse { + flex-wrap: wrap-reverse !important; } + +.justify-content-start { + justify-content: flex-start !important; } + +.justify-content-end { + justify-content: flex-end !important; } + +.justify-content-center { + justify-content: center !important; } + +.justify-content-between { + justify-content: space-between !important; } + +.justify-content-around { + justify-content: space-around !important; } + +.justify-content-evenly { + justify-content: space-evenly !important; } + +.align-items-start { + align-items: flex-start !important; } + +.align-items-end { + align-items: flex-end !important; } + +.align-items-center { + align-items: center !important; } + +.align-items-baseline { + align-items: baseline !important; } + +.align-items-stretch { + align-items: stretch !important; } + +.align-content-start { + align-content: flex-start !important; } + +.align-content-end { + align-content: flex-end !important; } + +.align-content-center { + align-content: center !important; } + +.align-content-between { + align-content: space-between !important; } + +.align-content-around { + align-content: space-around !important; } + +.align-content-stretch { + align-content: stretch !important; } + +.align-self-auto { + align-self: auto !important; } + +.align-self-start { + align-self: flex-start !important; } + +.align-self-end { + align-self: flex-end !important; } + +.align-self-center { + align-self: center !important; } + +.align-self-baseline { + align-self: baseline !important; } + +.align-self-stretch { + align-self: stretch !important; } + +.order-first { + order: -1 !important; } + +.order-0 { + order: 0 !important; } + +.order-1 { + order: 1 !important; } + +.order-2 { + order: 2 !important; } + +.order-3 { + order: 3 !important; } + +.order-4 { + order: 4 !important; } + +.order-5 { + order: 5 !important; } + +.order-last { + order: 6 !important; } + +.m-0 { + margin: 0 !important; } + +.m-1 { + margin: 0.25rem !important; } + +.m-2 { + margin: 0.5rem !important; } + +.m-3 { + margin: 1rem !important; } + +.m-4 { + margin: 1.5rem !important; } + +.m-5 { + margin: 3rem !important; } + +.m-auto { + margin: auto !important; } + +.mx-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + +.mx-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + +.mx-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + +.mx-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + +.mx-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + +.mx-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + +.mx-auto { + margin-right: auto !important; + margin-left: auto !important; } + +.my-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + +.my-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + +.my-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + +.my-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + +.my-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + +.my-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + +.my-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + +.mt-0 { + margin-top: 0 !important; } + +.mt-1 { + margin-top: 0.25rem !important; } + +.mt-2 { + margin-top: 0.5rem !important; } + +.mt-3 { + margin-top: 1rem !important; } + +.mt-4 { + margin-top: 1.5rem !important; } + +.mt-5 { + margin-top: 3rem !important; } + +.mt-auto { + margin-top: auto !important; } + +.me-0 { + margin-right: 0 !important; } + +.me-1 { + margin-right: 0.25rem !important; } + +.me-2 { + margin-right: 0.5rem !important; } + +.me-3 { + margin-right: 1rem !important; } + +.me-4 { + margin-right: 1.5rem !important; } + +.me-5 { + margin-right: 3rem !important; } + +.me-auto { + margin-right: auto !important; } + +.mb-0 { + margin-bottom: 0 !important; } + +.mb-1 { + margin-bottom: 0.25rem !important; } + +.mb-2 { + margin-bottom: 0.5rem !important; } + +.mb-3 { + margin-bottom: 1rem !important; } + +.mb-4 { + margin-bottom: 1.5rem !important; } + +.mb-5 { + margin-bottom: 3rem !important; } + +.mb-auto { + margin-bottom: auto !important; } + +.ms-0 { + margin-left: 0 !important; } + +.ms-1 { + margin-left: 0.25rem !important; } + +.ms-2 { + margin-left: 0.5rem !important; } + +.ms-3 { + margin-left: 1rem !important; } + +.ms-4 { + margin-left: 1.5rem !important; } + +.ms-5 { + margin-left: 3rem !important; } + +.ms-auto { + margin-left: auto !important; } + +.m-n1 { + margin: -0.25rem !important; } + +.m-n2 { + margin: -0.5rem !important; } + +.m-n3 { + margin: -1rem !important; } + +.m-n4 { + margin: -1.5rem !important; } + +.m-n5 { + margin: -3rem !important; } + +.mx-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + +.mx-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + +.mx-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + +.mx-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + +.mx-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + +.my-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + +.my-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + +.my-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + +.my-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + +.my-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + +.mt-n1 { + margin-top: -0.25rem !important; } + +.mt-n2 { + margin-top: -0.5rem !important; } + +.mt-n3 { + margin-top: -1rem !important; } + +.mt-n4 { + margin-top: -1.5rem !important; } + +.mt-n5 { + margin-top: -3rem !important; } + +.me-n1 { + margin-right: -0.25rem !important; } + +.me-n2 { + margin-right: -0.5rem !important; } + +.me-n3 { + margin-right: -1rem !important; } + +.me-n4 { + margin-right: -1.5rem !important; } + +.me-n5 { + margin-right: -3rem !important; } + +.mb-n1 { + margin-bottom: -0.25rem !important; } + +.mb-n2 { + margin-bottom: -0.5rem !important; } + +.mb-n3 { + margin-bottom: -1rem !important; } + +.mb-n4 { + margin-bottom: -1.5rem !important; } + +.mb-n5 { + margin-bottom: -3rem !important; } + +.ms-n1 { + margin-left: -0.25rem !important; } + +.ms-n2 { + margin-left: -0.5rem !important; } + +.ms-n3 { + margin-left: -1rem !important; } + +.ms-n4 { + margin-left: -1.5rem !important; } + +.ms-n5 { + margin-left: -3rem !important; } + +.p-0 { + padding: 0 !important; } + +.p-1 { + padding: 0.25rem !important; } + +.p-2 { + padding: 0.5rem !important; } + +.p-3 { + padding: 1rem !important; } + +.p-4 { + padding: 1.5rem !important; } + +.p-5 { + padding: 3rem !important; } + +.px-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + +.px-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + +.px-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + +.px-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + +.px-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + +.px-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + +.py-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + +.py-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + +.py-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + +.py-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + +.py-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + +.py-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + +.pt-0 { + padding-top: 0 !important; } + +.pt-1 { + padding-top: 0.25rem !important; } + +.pt-2 { + padding-top: 0.5rem !important; } + +.pt-3 { + padding-top: 1rem !important; } + +.pt-4 { + padding-top: 1.5rem !important; } + +.pt-5 { + padding-top: 3rem !important; } + +.pe-0 { + padding-right: 0 !important; } + +.pe-1 { + padding-right: 0.25rem !important; } + +.pe-2 { + padding-right: 0.5rem !important; } + +.pe-3 { + padding-right: 1rem !important; } + +.pe-4 { + padding-right: 1.5rem !important; } + +.pe-5 { + padding-right: 3rem !important; } + +.pb-0 { + padding-bottom: 0 !important; } + +.pb-1 { + padding-bottom: 0.25rem !important; } + +.pb-2 { + padding-bottom: 0.5rem !important; } + +.pb-3 { + padding-bottom: 1rem !important; } + +.pb-4 { + padding-bottom: 1.5rem !important; } + +.pb-5 { + padding-bottom: 3rem !important; } + +.ps-0 { + padding-left: 0 !important; } + +.ps-1 { + padding-left: 0.25rem !important; } + +.ps-2 { + padding-left: 0.5rem !important; } + +.ps-3 { + padding-left: 1rem !important; } + +.ps-4 { + padding-left: 1.5rem !important; } + +.ps-5 { + padding-left: 3rem !important; } + +.gap-0 { + gap: 0 !important; } + +.gap-1 { + gap: 0.25rem !important; } + +.gap-2 { + gap: 0.5rem !important; } + +.gap-3 { + gap: 1rem !important; } + +.gap-4 { + gap: 1.5rem !important; } + +.gap-5 { + gap: 3rem !important; } + +.font-monospace { + font-family: var(--bs-font-monospace) !important; } + +.fs-1 { + font-size: calc(1.425rem + 2.1vw) !important; } + +.fs-2 { + font-size: calc(1.365rem + 1.38vw) !important; } + +.fs-3 { + font-size: calc(1.335rem + 1.02vw) !important; } + +.fs-4 { + font-size: calc(1.305rem + 0.66vw) !important; } + +.fs-5 { + font-size: calc(1.275rem + 0.3vw) !important; } + +.fs-6 { + font-size: 1.2rem !important; } + +.fst-italic { + font-style: italic !important; } + +.fst-normal { + font-style: normal !important; } + +.fw-light { + font-weight: 300 !important; } + +.fw-lighter { + font-weight: lighter !important; } + +.fw-normal { + font-weight: 400 !important; } + +.fw-bold { + font-weight: 700 !important; } + +.fw-semibold { + font-weight: 600 !important; } + +.fw-bolder { + font-weight: bolder !important; } + +.lh-1 { + line-height: 1 !important; } + +.lh-sm { + line-height: 1.25 !important; } + +.lh-base { + line-height: 1.5 !important; } + +.lh-lg { + line-height: 2 !important; } + +.text-start { + text-align: left !important; } + +.text-end { + text-align: right !important; } + +.text-center { + text-align: center !important; } + +.text-decoration-none { + text-decoration: none !important; } + +.text-decoration-underline { + text-decoration: underline !important; } + +.text-decoration-line-through { + text-decoration: line-through !important; } + +.text-lowercase { + text-transform: lowercase !important; } + +.text-uppercase { + text-transform: uppercase !important; } + +.text-capitalize { + text-transform: capitalize !important; } + +.text-wrap { + white-space: normal !important; } + +.text-nowrap { + white-space: nowrap !important; } + +/* rtl:begin:remove */ +.text-break { + word-wrap: break-word !important; + word-break: break-word !important; } + +/* rtl:end:remove */ +.text-primary { + --bs-text-opacity: 1; + color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important; } + +.text-secondary { + --bs-text-opacity: 1; + color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important; } + +.text-success { + --bs-text-opacity: 1; + color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important; } + +.text-info { + --bs-text-opacity: 1; + color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important; } + +.text-warning { + --bs-text-opacity: 1; + color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important; } + +.text-danger { + --bs-text-opacity: 1; + color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important; } + +.text-light { + --bs-text-opacity: 1; + color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important; } + +.text-dark { + --bs-text-opacity: 1; + color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important; } + +.text-black { + --bs-text-opacity: 1; + color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important; } + +.text-white { + --bs-text-opacity: 1; + color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important; } + +.text-body { + --bs-text-opacity: 1; + color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important; } + +.text-muted { + --bs-text-opacity: 1; + color: #8a8a8e !important; } + +.text-black-50 { + --bs-text-opacity: 1; + color: rgba(17, 17, 17, 0.5) !important; } + +.text-white-50 { + --bs-text-opacity: 1; + color: rgba(255, 255, 255, 0.5) !important; } + +.text-reset { + --bs-text-opacity: 1; + color: inherit !important; } + +.text-opacity-25 { + --bs-text-opacity: 0.25; } + +.text-opacity-50 { + --bs-text-opacity: 0.5; } + +.text-opacity-75 { + --bs-text-opacity: 0.75; } + +.text-opacity-100 { + --bs-text-opacity: 1; } + +.bg-primary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important; } + +.bg-secondary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important; } + +.bg-success { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important; } + +.bg-info { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important; } + +.bg-warning { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important; } + +.bg-danger { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important; } + +.bg-light { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important; } + +.bg-dark { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important; } + +.bg-black { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important; } + +.bg-white { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important; } + +.bg-body { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important; } + +.bg-transparent { + --bs-bg-opacity: 1; + background-color: transparent !important; } + +.bg-opacity-10 { + --bs-bg-opacity: 0.1; } + +.bg-opacity-25 { + --bs-bg-opacity: 0.25; } + +.bg-opacity-50 { + --bs-bg-opacity: 0.5; } + +.bg-opacity-75 { + --bs-bg-opacity: 0.75; } + +.bg-opacity-100 { + --bs-bg-opacity: 1; } + +.bg-gradient { + background-image: var(--bs-gradient) !important; } + +.user-select-all { + user-select: all !important; } + +.user-select-auto { + user-select: auto !important; } + +.user-select-none { + user-select: none !important; } + +.pe-none { + pointer-events: none !important; } + +.pe-auto { + pointer-events: auto !important; } + +.rounded { + border-radius: var(--bs-border-radius) !important; } + +.rounded-0 { + border-radius: 0 !important; } + +.rounded-1 { + border-radius: var(--bs-border-radius-sm) !important; } + +.rounded-2 { + border-radius: var(--bs-border-radius) !important; } + +.rounded-3 { + border-radius: var(--bs-border-radius-lg) !important; } + +.rounded-4 { + border-radius: var(--bs-border-radius-xl) !important; } + +.rounded-5 { + border-radius: var(--bs-border-radius-2xl) !important; } + +.rounded-circle { + border-radius: 50% !important; } + +.rounded-pill { + border-radius: var(--bs-border-radius-pill) !important; } + +.rounded-top { + border-top-left-radius: var(--bs-border-radius) !important; + border-top-right-radius: var(--bs-border-radius) !important; } + +.rounded-end { + border-top-right-radius: var(--bs-border-radius) !important; + border-bottom-right-radius: var(--bs-border-radius) !important; } + +.rounded-bottom { + border-bottom-right-radius: var(--bs-border-radius) !important; + border-bottom-left-radius: var(--bs-border-radius) !important; } + +.rounded-start { + border-bottom-left-radius: var(--bs-border-radius) !important; + border-top-left-radius: var(--bs-border-radius) !important; } + +.visible { + visibility: visible !important; } + +.invisible { + visibility: hidden !important; } + +@media (min-width: 576px) { + .float-sm-start { + float: left !important; } + .float-sm-end { + float: right !important; } + .float-sm-none { + float: none !important; } + .d-sm-inline { + display: inline !important; } + .d-sm-inline-block { + display: inline-block !important; } + .d-sm-block { + display: block !important; } + .d-sm-grid { + display: grid !important; } + .d-sm-table { + display: table !important; } + .d-sm-table-row { + display: table-row !important; } + .d-sm-table-cell { + display: table-cell !important; } + .d-sm-flex { + display: flex !important; } + .d-sm-inline-flex { + display: inline-flex !important; } + .d-sm-none { + display: none !important; } + .flex-sm-fill { + flex: 1 1 auto !important; } + .flex-sm-row { + flex-direction: row !important; } + .flex-sm-column { + flex-direction: column !important; } + .flex-sm-row-reverse { + flex-direction: row-reverse !important; } + .flex-sm-column-reverse { + flex-direction: column-reverse !important; } + .flex-sm-grow-0 { + flex-grow: 0 !important; } + .flex-sm-grow-1 { + flex-grow: 1 !important; } + .flex-sm-shrink-0 { + flex-shrink: 0 !important; } + .flex-sm-shrink-1 { + flex-shrink: 1 !important; } + .flex-sm-wrap { + flex-wrap: wrap !important; } + .flex-sm-nowrap { + flex-wrap: nowrap !important; } + .flex-sm-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-sm-start { + justify-content: flex-start !important; } + .justify-content-sm-end { + justify-content: flex-end !important; } + .justify-content-sm-center { + justify-content: center !important; } + .justify-content-sm-between { + justify-content: space-between !important; } + .justify-content-sm-around { + justify-content: space-around !important; } + .justify-content-sm-evenly { + justify-content: space-evenly !important; } + .align-items-sm-start { + align-items: flex-start !important; } + .align-items-sm-end { + align-items: flex-end !important; } + .align-items-sm-center { + align-items: center !important; } + .align-items-sm-baseline { + align-items: baseline !important; } + .align-items-sm-stretch { + align-items: stretch !important; } + .align-content-sm-start { + align-content: flex-start !important; } + .align-content-sm-end { + align-content: flex-end !important; } + .align-content-sm-center { + align-content: center !important; } + .align-content-sm-between { + align-content: space-between !important; } + .align-content-sm-around { + align-content: space-around !important; } + .align-content-sm-stretch { + align-content: stretch !important; } + .align-self-sm-auto { + align-self: auto !important; } + .align-self-sm-start { + align-self: flex-start !important; } + .align-self-sm-end { + align-self: flex-end !important; } + .align-self-sm-center { + align-self: center !important; } + .align-self-sm-baseline { + align-self: baseline !important; } + .align-self-sm-stretch { + align-self: stretch !important; } + .order-sm-first { + order: -1 !important; } + .order-sm-0 { + order: 0 !important; } + .order-sm-1 { + order: 1 !important; } + .order-sm-2 { + order: 2 !important; } + .order-sm-3 { + order: 3 !important; } + .order-sm-4 { + order: 4 !important; } + .order-sm-5 { + order: 5 !important; } + .order-sm-last { + order: 6 !important; } + .m-sm-0 { + margin: 0 !important; } + .m-sm-1 { + margin: 0.25rem !important; } + .m-sm-2 { + margin: 0.5rem !important; } + .m-sm-3 { + margin: 1rem !important; } + .m-sm-4 { + margin: 1.5rem !important; } + .m-sm-5 { + margin: 3rem !important; } + .m-sm-auto { + margin: auto !important; } + .mx-sm-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-sm-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-sm-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-sm-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-sm-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-sm-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-sm-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-sm-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-sm-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-sm-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-sm-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-sm-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-sm-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-sm-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-sm-0 { + margin-top: 0 !important; } + .mt-sm-1 { + margin-top: 0.25rem !important; } + .mt-sm-2 { + margin-top: 0.5rem !important; } + .mt-sm-3 { + margin-top: 1rem !important; } + .mt-sm-4 { + margin-top: 1.5rem !important; } + .mt-sm-5 { + margin-top: 3rem !important; } + .mt-sm-auto { + margin-top: auto !important; } + .me-sm-0 { + margin-right: 0 !important; } + .me-sm-1 { + margin-right: 0.25rem !important; } + .me-sm-2 { + margin-right: 0.5rem !important; } + .me-sm-3 { + margin-right: 1rem !important; } + .me-sm-4 { + margin-right: 1.5rem !important; } + .me-sm-5 { + margin-right: 3rem !important; } + .me-sm-auto { + margin-right: auto !important; } + .mb-sm-0 { + margin-bottom: 0 !important; } + .mb-sm-1 { + margin-bottom: 0.25rem !important; } + .mb-sm-2 { + margin-bottom: 0.5rem !important; } + .mb-sm-3 { + margin-bottom: 1rem !important; } + .mb-sm-4 { + margin-bottom: 1.5rem !important; } + .mb-sm-5 { + margin-bottom: 3rem !important; } + .mb-sm-auto { + margin-bottom: auto !important; } + .ms-sm-0 { + margin-left: 0 !important; } + .ms-sm-1 { + margin-left: 0.25rem !important; } + .ms-sm-2 { + margin-left: 0.5rem !important; } + .ms-sm-3 { + margin-left: 1rem !important; } + .ms-sm-4 { + margin-left: 1.5rem !important; } + .ms-sm-5 { + margin-left: 3rem !important; } + .ms-sm-auto { + margin-left: auto !important; } + .m-sm-n1 { + margin: -0.25rem !important; } + .m-sm-n2 { + margin: -0.5rem !important; } + .m-sm-n3 { + margin: -1rem !important; } + .m-sm-n4 { + margin: -1.5rem !important; } + .m-sm-n5 { + margin: -3rem !important; } + .mx-sm-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-sm-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-sm-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-sm-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-sm-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-sm-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-sm-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-sm-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-sm-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-sm-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-sm-n1 { + margin-top: -0.25rem !important; } + .mt-sm-n2 { + margin-top: -0.5rem !important; } + .mt-sm-n3 { + margin-top: -1rem !important; } + .mt-sm-n4 { + margin-top: -1.5rem !important; } + .mt-sm-n5 { + margin-top: -3rem !important; } + .me-sm-n1 { + margin-right: -0.25rem !important; } + .me-sm-n2 { + margin-right: -0.5rem !important; } + .me-sm-n3 { + margin-right: -1rem !important; } + .me-sm-n4 { + margin-right: -1.5rem !important; } + .me-sm-n5 { + margin-right: -3rem !important; } + .mb-sm-n1 { + margin-bottom: -0.25rem !important; } + .mb-sm-n2 { + margin-bottom: -0.5rem !important; } + .mb-sm-n3 { + margin-bottom: -1rem !important; } + .mb-sm-n4 { + margin-bottom: -1.5rem !important; } + .mb-sm-n5 { + margin-bottom: -3rem !important; } + .ms-sm-n1 { + margin-left: -0.25rem !important; } + .ms-sm-n2 { + margin-left: -0.5rem !important; } + .ms-sm-n3 { + margin-left: -1rem !important; } + .ms-sm-n4 { + margin-left: -1.5rem !important; } + .ms-sm-n5 { + margin-left: -3rem !important; } + .p-sm-0 { + padding: 0 !important; } + .p-sm-1 { + padding: 0.25rem !important; } + .p-sm-2 { + padding: 0.5rem !important; } + .p-sm-3 { + padding: 1rem !important; } + .p-sm-4 { + padding: 1.5rem !important; } + .p-sm-5 { + padding: 3rem !important; } + .px-sm-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-sm-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-sm-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-sm-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-sm-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-sm-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-sm-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-sm-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-sm-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-sm-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-sm-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-sm-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-sm-0 { + padding-top: 0 !important; } + .pt-sm-1 { + padding-top: 0.25rem !important; } + .pt-sm-2 { + padding-top: 0.5rem !important; } + .pt-sm-3 { + padding-top: 1rem !important; } + .pt-sm-4 { + padding-top: 1.5rem !important; } + .pt-sm-5 { + padding-top: 3rem !important; } + .pe-sm-0 { + padding-right: 0 !important; } + .pe-sm-1 { + padding-right: 0.25rem !important; } + .pe-sm-2 { + padding-right: 0.5rem !important; } + .pe-sm-3 { + padding-right: 1rem !important; } + .pe-sm-4 { + padding-right: 1.5rem !important; } + .pe-sm-5 { + padding-right: 3rem !important; } + .pb-sm-0 { + padding-bottom: 0 !important; } + .pb-sm-1 { + padding-bottom: 0.25rem !important; } + .pb-sm-2 { + padding-bottom: 0.5rem !important; } + .pb-sm-3 { + padding-bottom: 1rem !important; } + .pb-sm-4 { + padding-bottom: 1.5rem !important; } + .pb-sm-5 { + padding-bottom: 3rem !important; } + .ps-sm-0 { + padding-left: 0 !important; } + .ps-sm-1 { + padding-left: 0.25rem !important; } + .ps-sm-2 { + padding-left: 0.5rem !important; } + .ps-sm-3 { + padding-left: 1rem !important; } + .ps-sm-4 { + padding-left: 1.5rem !important; } + .ps-sm-5 { + padding-left: 3rem !important; } + .gap-sm-0 { + gap: 0 !important; } + .gap-sm-1 { + gap: 0.25rem !important; } + .gap-sm-2 { + gap: 0.5rem !important; } + .gap-sm-3 { + gap: 1rem !important; } + .gap-sm-4 { + gap: 1.5rem !important; } + .gap-sm-5 { + gap: 3rem !important; } + .text-sm-start { + text-align: left !important; } + .text-sm-end { + text-align: right !important; } + .text-sm-center { + text-align: center !important; } } + +@media (min-width: 768px) { + .float-md-start { + float: left !important; } + .float-md-end { + float: right !important; } + .float-md-none { + float: none !important; } + .d-md-inline { + display: inline !important; } + .d-md-inline-block { + display: inline-block !important; } + .d-md-block { + display: block !important; } + .d-md-grid { + display: grid !important; } + .d-md-table { + display: table !important; } + .d-md-table-row { + display: table-row !important; } + .d-md-table-cell { + display: table-cell !important; } + .d-md-flex { + display: flex !important; } + .d-md-inline-flex { + display: inline-flex !important; } + .d-md-none { + display: none !important; } + .flex-md-fill { + flex: 1 1 auto !important; } + .flex-md-row { + flex-direction: row !important; } + .flex-md-column { + flex-direction: column !important; } + .flex-md-row-reverse { + flex-direction: row-reverse !important; } + .flex-md-column-reverse { + flex-direction: column-reverse !important; } + .flex-md-grow-0 { + flex-grow: 0 !important; } + .flex-md-grow-1 { + flex-grow: 1 !important; } + .flex-md-shrink-0 { + flex-shrink: 0 !important; } + .flex-md-shrink-1 { + flex-shrink: 1 !important; } + .flex-md-wrap { + flex-wrap: wrap !important; } + .flex-md-nowrap { + flex-wrap: nowrap !important; } + .flex-md-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-md-start { + justify-content: flex-start !important; } + .justify-content-md-end { + justify-content: flex-end !important; } + .justify-content-md-center { + justify-content: center !important; } + .justify-content-md-between { + justify-content: space-between !important; } + .justify-content-md-around { + justify-content: space-around !important; } + .justify-content-md-evenly { + justify-content: space-evenly !important; } + .align-items-md-start { + align-items: flex-start !important; } + .align-items-md-end { + align-items: flex-end !important; } + .align-items-md-center { + align-items: center !important; } + .align-items-md-baseline { + align-items: baseline !important; } + .align-items-md-stretch { + align-items: stretch !important; } + .align-content-md-start { + align-content: flex-start !important; } + .align-content-md-end { + align-content: flex-end !important; } + .align-content-md-center { + align-content: center !important; } + .align-content-md-between { + align-content: space-between !important; } + .align-content-md-around { + align-content: space-around !important; } + .align-content-md-stretch { + align-content: stretch !important; } + .align-self-md-auto { + align-self: auto !important; } + .align-self-md-start { + align-self: flex-start !important; } + .align-self-md-end { + align-self: flex-end !important; } + .align-self-md-center { + align-self: center !important; } + .align-self-md-baseline { + align-self: baseline !important; } + .align-self-md-stretch { + align-self: stretch !important; } + .order-md-first { + order: -1 !important; } + .order-md-0 { + order: 0 !important; } + .order-md-1 { + order: 1 !important; } + .order-md-2 { + order: 2 !important; } + .order-md-3 { + order: 3 !important; } + .order-md-4 { + order: 4 !important; } + .order-md-5 { + order: 5 !important; } + .order-md-last { + order: 6 !important; } + .m-md-0 { + margin: 0 !important; } + .m-md-1 { + margin: 0.25rem !important; } + .m-md-2 { + margin: 0.5rem !important; } + .m-md-3 { + margin: 1rem !important; } + .m-md-4 { + margin: 1.5rem !important; } + .m-md-5 { + margin: 3rem !important; } + .m-md-auto { + margin: auto !important; } + .mx-md-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-md-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-md-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-md-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-md-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-md-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-md-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-md-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-md-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-md-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-md-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-md-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-md-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-md-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-md-0 { + margin-top: 0 !important; } + .mt-md-1 { + margin-top: 0.25rem !important; } + .mt-md-2 { + margin-top: 0.5rem !important; } + .mt-md-3 { + margin-top: 1rem !important; } + .mt-md-4 { + margin-top: 1.5rem !important; } + .mt-md-5 { + margin-top: 3rem !important; } + .mt-md-auto { + margin-top: auto !important; } + .me-md-0 { + margin-right: 0 !important; } + .me-md-1 { + margin-right: 0.25rem !important; } + .me-md-2 { + margin-right: 0.5rem !important; } + .me-md-3 { + margin-right: 1rem !important; } + .me-md-4 { + margin-right: 1.5rem !important; } + .me-md-5 { + margin-right: 3rem !important; } + .me-md-auto { + margin-right: auto !important; } + .mb-md-0 { + margin-bottom: 0 !important; } + .mb-md-1 { + margin-bottom: 0.25rem !important; } + .mb-md-2 { + margin-bottom: 0.5rem !important; } + .mb-md-3 { + margin-bottom: 1rem !important; } + .mb-md-4 { + margin-bottom: 1.5rem !important; } + .mb-md-5 { + margin-bottom: 3rem !important; } + .mb-md-auto { + margin-bottom: auto !important; } + .ms-md-0 { + margin-left: 0 !important; } + .ms-md-1 { + margin-left: 0.25rem !important; } + .ms-md-2 { + margin-left: 0.5rem !important; } + .ms-md-3 { + margin-left: 1rem !important; } + .ms-md-4 { + margin-left: 1.5rem !important; } + .ms-md-5 { + margin-left: 3rem !important; } + .ms-md-auto { + margin-left: auto !important; } + .m-md-n1 { + margin: -0.25rem !important; } + .m-md-n2 { + margin: -0.5rem !important; } + .m-md-n3 { + margin: -1rem !important; } + .m-md-n4 { + margin: -1.5rem !important; } + .m-md-n5 { + margin: -3rem !important; } + .mx-md-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-md-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-md-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-md-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-md-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-md-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-md-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-md-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-md-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-md-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-md-n1 { + margin-top: -0.25rem !important; } + .mt-md-n2 { + margin-top: -0.5rem !important; } + .mt-md-n3 { + margin-top: -1rem !important; } + .mt-md-n4 { + margin-top: -1.5rem !important; } + .mt-md-n5 { + margin-top: -3rem !important; } + .me-md-n1 { + margin-right: -0.25rem !important; } + .me-md-n2 { + margin-right: -0.5rem !important; } + .me-md-n3 { + margin-right: -1rem !important; } + .me-md-n4 { + margin-right: -1.5rem !important; } + .me-md-n5 { + margin-right: -3rem !important; } + .mb-md-n1 { + margin-bottom: -0.25rem !important; } + .mb-md-n2 { + margin-bottom: -0.5rem !important; } + .mb-md-n3 { + margin-bottom: -1rem !important; } + .mb-md-n4 { + margin-bottom: -1.5rem !important; } + .mb-md-n5 { + margin-bottom: -3rem !important; } + .ms-md-n1 { + margin-left: -0.25rem !important; } + .ms-md-n2 { + margin-left: -0.5rem !important; } + .ms-md-n3 { + margin-left: -1rem !important; } + .ms-md-n4 { + margin-left: -1.5rem !important; } + .ms-md-n5 { + margin-left: -3rem !important; } + .p-md-0 { + padding: 0 !important; } + .p-md-1 { + padding: 0.25rem !important; } + .p-md-2 { + padding: 0.5rem !important; } + .p-md-3 { + padding: 1rem !important; } + .p-md-4 { + padding: 1.5rem !important; } + .p-md-5 { + padding: 3rem !important; } + .px-md-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-md-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-md-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-md-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-md-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-md-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-md-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-md-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-md-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-md-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-md-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-md-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-md-0 { + padding-top: 0 !important; } + .pt-md-1 { + padding-top: 0.25rem !important; } + .pt-md-2 { + padding-top: 0.5rem !important; } + .pt-md-3 { + padding-top: 1rem !important; } + .pt-md-4 { + padding-top: 1.5rem !important; } + .pt-md-5 { + padding-top: 3rem !important; } + .pe-md-0 { + padding-right: 0 !important; } + .pe-md-1 { + padding-right: 0.25rem !important; } + .pe-md-2 { + padding-right: 0.5rem !important; } + .pe-md-3 { + padding-right: 1rem !important; } + .pe-md-4 { + padding-right: 1.5rem !important; } + .pe-md-5 { + padding-right: 3rem !important; } + .pb-md-0 { + padding-bottom: 0 !important; } + .pb-md-1 { + padding-bottom: 0.25rem !important; } + .pb-md-2 { + padding-bottom: 0.5rem !important; } + .pb-md-3 { + padding-bottom: 1rem !important; } + .pb-md-4 { + padding-bottom: 1.5rem !important; } + .pb-md-5 { + padding-bottom: 3rem !important; } + .ps-md-0 { + padding-left: 0 !important; } + .ps-md-1 { + padding-left: 0.25rem !important; } + .ps-md-2 { + padding-left: 0.5rem !important; } + .ps-md-3 { + padding-left: 1rem !important; } + .ps-md-4 { + padding-left: 1.5rem !important; } + .ps-md-5 { + padding-left: 3rem !important; } + .gap-md-0 { + gap: 0 !important; } + .gap-md-1 { + gap: 0.25rem !important; } + .gap-md-2 { + gap: 0.5rem !important; } + .gap-md-3 { + gap: 1rem !important; } + .gap-md-4 { + gap: 1.5rem !important; } + .gap-md-5 { + gap: 3rem !important; } + .text-md-start { + text-align: left !important; } + .text-md-end { + text-align: right !important; } + .text-md-center { + text-align: center !important; } } + +@media (min-width: 992px) { + .float-lg-start { + float: left !important; } + .float-lg-end { + float: right !important; } + .float-lg-none { + float: none !important; } + .d-lg-inline { + display: inline !important; } + .d-lg-inline-block { + display: inline-block !important; } + .d-lg-block { + display: block !important; } + .d-lg-grid { + display: grid !important; } + .d-lg-table { + display: table !important; } + .d-lg-table-row { + display: table-row !important; } + .d-lg-table-cell { + display: table-cell !important; } + .d-lg-flex { + display: flex !important; } + .d-lg-inline-flex { + display: inline-flex !important; } + .d-lg-none { + display: none !important; } + .flex-lg-fill { + flex: 1 1 auto !important; } + .flex-lg-row { + flex-direction: row !important; } + .flex-lg-column { + flex-direction: column !important; } + .flex-lg-row-reverse { + flex-direction: row-reverse !important; } + .flex-lg-column-reverse { + flex-direction: column-reverse !important; } + .flex-lg-grow-0 { + flex-grow: 0 !important; } + .flex-lg-grow-1 { + flex-grow: 1 !important; } + .flex-lg-shrink-0 { + flex-shrink: 0 !important; } + .flex-lg-shrink-1 { + flex-shrink: 1 !important; } + .flex-lg-wrap { + flex-wrap: wrap !important; } + .flex-lg-nowrap { + flex-wrap: nowrap !important; } + .flex-lg-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-lg-start { + justify-content: flex-start !important; } + .justify-content-lg-end { + justify-content: flex-end !important; } + .justify-content-lg-center { + justify-content: center !important; } + .justify-content-lg-between { + justify-content: space-between !important; } + .justify-content-lg-around { + justify-content: space-around !important; } + .justify-content-lg-evenly { + justify-content: space-evenly !important; } + .align-items-lg-start { + align-items: flex-start !important; } + .align-items-lg-end { + align-items: flex-end !important; } + .align-items-lg-center { + align-items: center !important; } + .align-items-lg-baseline { + align-items: baseline !important; } + .align-items-lg-stretch { + align-items: stretch !important; } + .align-content-lg-start { + align-content: flex-start !important; } + .align-content-lg-end { + align-content: flex-end !important; } + .align-content-lg-center { + align-content: center !important; } + .align-content-lg-between { + align-content: space-between !important; } + .align-content-lg-around { + align-content: space-around !important; } + .align-content-lg-stretch { + align-content: stretch !important; } + .align-self-lg-auto { + align-self: auto !important; } + .align-self-lg-start { + align-self: flex-start !important; } + .align-self-lg-end { + align-self: flex-end !important; } + .align-self-lg-center { + align-self: center !important; } + .align-self-lg-baseline { + align-self: baseline !important; } + .align-self-lg-stretch { + align-self: stretch !important; } + .order-lg-first { + order: -1 !important; } + .order-lg-0 { + order: 0 !important; } + .order-lg-1 { + order: 1 !important; } + .order-lg-2 { + order: 2 !important; } + .order-lg-3 { + order: 3 !important; } + .order-lg-4 { + order: 4 !important; } + .order-lg-5 { + order: 5 !important; } + .order-lg-last { + order: 6 !important; } + .m-lg-0 { + margin: 0 !important; } + .m-lg-1 { + margin: 0.25rem !important; } + .m-lg-2 { + margin: 0.5rem !important; } + .m-lg-3 { + margin: 1rem !important; } + .m-lg-4 { + margin: 1.5rem !important; } + .m-lg-5 { + margin: 3rem !important; } + .m-lg-auto { + margin: auto !important; } + .mx-lg-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-lg-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-lg-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-lg-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-lg-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-lg-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-lg-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-lg-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-lg-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-lg-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-lg-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-lg-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-lg-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-lg-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-lg-0 { + margin-top: 0 !important; } + .mt-lg-1 { + margin-top: 0.25rem !important; } + .mt-lg-2 { + margin-top: 0.5rem !important; } + .mt-lg-3 { + margin-top: 1rem !important; } + .mt-lg-4 { + margin-top: 1.5rem !important; } + .mt-lg-5 { + margin-top: 3rem !important; } + .mt-lg-auto { + margin-top: auto !important; } + .me-lg-0 { + margin-right: 0 !important; } + .me-lg-1 { + margin-right: 0.25rem !important; } + .me-lg-2 { + margin-right: 0.5rem !important; } + .me-lg-3 { + margin-right: 1rem !important; } + .me-lg-4 { + margin-right: 1.5rem !important; } + .me-lg-5 { + margin-right: 3rem !important; } + .me-lg-auto { + margin-right: auto !important; } + .mb-lg-0 { + margin-bottom: 0 !important; } + .mb-lg-1 { + margin-bottom: 0.25rem !important; } + .mb-lg-2 { + margin-bottom: 0.5rem !important; } + .mb-lg-3 { + margin-bottom: 1rem !important; } + .mb-lg-4 { + margin-bottom: 1.5rem !important; } + .mb-lg-5 { + margin-bottom: 3rem !important; } + .mb-lg-auto { + margin-bottom: auto !important; } + .ms-lg-0 { + margin-left: 0 !important; } + .ms-lg-1 { + margin-left: 0.25rem !important; } + .ms-lg-2 { + margin-left: 0.5rem !important; } + .ms-lg-3 { + margin-left: 1rem !important; } + .ms-lg-4 { + margin-left: 1.5rem !important; } + .ms-lg-5 { + margin-left: 3rem !important; } + .ms-lg-auto { + margin-left: auto !important; } + .m-lg-n1 { + margin: -0.25rem !important; } + .m-lg-n2 { + margin: -0.5rem !important; } + .m-lg-n3 { + margin: -1rem !important; } + .m-lg-n4 { + margin: -1.5rem !important; } + .m-lg-n5 { + margin: -3rem !important; } + .mx-lg-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-lg-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-lg-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-lg-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-lg-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-lg-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-lg-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-lg-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-lg-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-lg-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-lg-n1 { + margin-top: -0.25rem !important; } + .mt-lg-n2 { + margin-top: -0.5rem !important; } + .mt-lg-n3 { + margin-top: -1rem !important; } + .mt-lg-n4 { + margin-top: -1.5rem !important; } + .mt-lg-n5 { + margin-top: -3rem !important; } + .me-lg-n1 { + margin-right: -0.25rem !important; } + .me-lg-n2 { + margin-right: -0.5rem !important; } + .me-lg-n3 { + margin-right: -1rem !important; } + .me-lg-n4 { + margin-right: -1.5rem !important; } + .me-lg-n5 { + margin-right: -3rem !important; } + .mb-lg-n1 { + margin-bottom: -0.25rem !important; } + .mb-lg-n2 { + margin-bottom: -0.5rem !important; } + .mb-lg-n3 { + margin-bottom: -1rem !important; } + .mb-lg-n4 { + margin-bottom: -1.5rem !important; } + .mb-lg-n5 { + margin-bottom: -3rem !important; } + .ms-lg-n1 { + margin-left: -0.25rem !important; } + .ms-lg-n2 { + margin-left: -0.5rem !important; } + .ms-lg-n3 { + margin-left: -1rem !important; } + .ms-lg-n4 { + margin-left: -1.5rem !important; } + .ms-lg-n5 { + margin-left: -3rem !important; } + .p-lg-0 { + padding: 0 !important; } + .p-lg-1 { + padding: 0.25rem !important; } + .p-lg-2 { + padding: 0.5rem !important; } + .p-lg-3 { + padding: 1rem !important; } + .p-lg-4 { + padding: 1.5rem !important; } + .p-lg-5 { + padding: 3rem !important; } + .px-lg-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-lg-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-lg-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-lg-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-lg-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-lg-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-lg-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-lg-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-lg-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-lg-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-lg-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-lg-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-lg-0 { + padding-top: 0 !important; } + .pt-lg-1 { + padding-top: 0.25rem !important; } + .pt-lg-2 { + padding-top: 0.5rem !important; } + .pt-lg-3 { + padding-top: 1rem !important; } + .pt-lg-4 { + padding-top: 1.5rem !important; } + .pt-lg-5 { + padding-top: 3rem !important; } + .pe-lg-0 { + padding-right: 0 !important; } + .pe-lg-1 { + padding-right: 0.25rem !important; } + .pe-lg-2 { + padding-right: 0.5rem !important; } + .pe-lg-3 { + padding-right: 1rem !important; } + .pe-lg-4 { + padding-right: 1.5rem !important; } + .pe-lg-5 { + padding-right: 3rem !important; } + .pb-lg-0 { + padding-bottom: 0 !important; } + .pb-lg-1 { + padding-bottom: 0.25rem !important; } + .pb-lg-2 { + padding-bottom: 0.5rem !important; } + .pb-lg-3 { + padding-bottom: 1rem !important; } + .pb-lg-4 { + padding-bottom: 1.5rem !important; } + .pb-lg-5 { + padding-bottom: 3rem !important; } + .ps-lg-0 { + padding-left: 0 !important; } + .ps-lg-1 { + padding-left: 0.25rem !important; } + .ps-lg-2 { + padding-left: 0.5rem !important; } + .ps-lg-3 { + padding-left: 1rem !important; } + .ps-lg-4 { + padding-left: 1.5rem !important; } + .ps-lg-5 { + padding-left: 3rem !important; } + .gap-lg-0 { + gap: 0 !important; } + .gap-lg-1 { + gap: 0.25rem !important; } + .gap-lg-2 { + gap: 0.5rem !important; } + .gap-lg-3 { + gap: 1rem !important; } + .gap-lg-4 { + gap: 1.5rem !important; } + .gap-lg-5 { + gap: 3rem !important; } + .text-lg-start { + text-align: left !important; } + .text-lg-end { + text-align: right !important; } + .text-lg-center { + text-align: center !important; } } + +@media (min-width: 1200px) { + .float-xl-start { + float: left !important; } + .float-xl-end { + float: right !important; } + .float-xl-none { + float: none !important; } + .d-xl-inline { + display: inline !important; } + .d-xl-inline-block { + display: inline-block !important; } + .d-xl-block { + display: block !important; } + .d-xl-grid { + display: grid !important; } + .d-xl-table { + display: table !important; } + .d-xl-table-row { + display: table-row !important; } + .d-xl-table-cell { + display: table-cell !important; } + .d-xl-flex { + display: flex !important; } + .d-xl-inline-flex { + display: inline-flex !important; } + .d-xl-none { + display: none !important; } + .flex-xl-fill { + flex: 1 1 auto !important; } + .flex-xl-row { + flex-direction: row !important; } + .flex-xl-column { + flex-direction: column !important; } + .flex-xl-row-reverse { + flex-direction: row-reverse !important; } + .flex-xl-column-reverse { + flex-direction: column-reverse !important; } + .flex-xl-grow-0 { + flex-grow: 0 !important; } + .flex-xl-grow-1 { + flex-grow: 1 !important; } + .flex-xl-shrink-0 { + flex-shrink: 0 !important; } + .flex-xl-shrink-1 { + flex-shrink: 1 !important; } + .flex-xl-wrap { + flex-wrap: wrap !important; } + .flex-xl-nowrap { + flex-wrap: nowrap !important; } + .flex-xl-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-xl-start { + justify-content: flex-start !important; } + .justify-content-xl-end { + justify-content: flex-end !important; } + .justify-content-xl-center { + justify-content: center !important; } + .justify-content-xl-between { + justify-content: space-between !important; } + .justify-content-xl-around { + justify-content: space-around !important; } + .justify-content-xl-evenly { + justify-content: space-evenly !important; } + .align-items-xl-start { + align-items: flex-start !important; } + .align-items-xl-end { + align-items: flex-end !important; } + .align-items-xl-center { + align-items: center !important; } + .align-items-xl-baseline { + align-items: baseline !important; } + .align-items-xl-stretch { + align-items: stretch !important; } + .align-content-xl-start { + align-content: flex-start !important; } + .align-content-xl-end { + align-content: flex-end !important; } + .align-content-xl-center { + align-content: center !important; } + .align-content-xl-between { + align-content: space-between !important; } + .align-content-xl-around { + align-content: space-around !important; } + .align-content-xl-stretch { + align-content: stretch !important; } + .align-self-xl-auto { + align-self: auto !important; } + .align-self-xl-start { + align-self: flex-start !important; } + .align-self-xl-end { + align-self: flex-end !important; } + .align-self-xl-center { + align-self: center !important; } + .align-self-xl-baseline { + align-self: baseline !important; } + .align-self-xl-stretch { + align-self: stretch !important; } + .order-xl-first { + order: -1 !important; } + .order-xl-0 { + order: 0 !important; } + .order-xl-1 { + order: 1 !important; } + .order-xl-2 { + order: 2 !important; } + .order-xl-3 { + order: 3 !important; } + .order-xl-4 { + order: 4 !important; } + .order-xl-5 { + order: 5 !important; } + .order-xl-last { + order: 6 !important; } + .m-xl-0 { + margin: 0 !important; } + .m-xl-1 { + margin: 0.25rem !important; } + .m-xl-2 { + margin: 0.5rem !important; } + .m-xl-3 { + margin: 1rem !important; } + .m-xl-4 { + margin: 1.5rem !important; } + .m-xl-5 { + margin: 3rem !important; } + .m-xl-auto { + margin: auto !important; } + .mx-xl-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-xl-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-xl-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-xl-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-xl-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-xl-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-xl-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-xl-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-xl-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-xl-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-xl-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-xl-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-xl-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-xl-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-xl-0 { + margin-top: 0 !important; } + .mt-xl-1 { + margin-top: 0.25rem !important; } + .mt-xl-2 { + margin-top: 0.5rem !important; } + .mt-xl-3 { + margin-top: 1rem !important; } + .mt-xl-4 { + margin-top: 1.5rem !important; } + .mt-xl-5 { + margin-top: 3rem !important; } + .mt-xl-auto { + margin-top: auto !important; } + .me-xl-0 { + margin-right: 0 !important; } + .me-xl-1 { + margin-right: 0.25rem !important; } + .me-xl-2 { + margin-right: 0.5rem !important; } + .me-xl-3 { + margin-right: 1rem !important; } + .me-xl-4 { + margin-right: 1.5rem !important; } + .me-xl-5 { + margin-right: 3rem !important; } + .me-xl-auto { + margin-right: auto !important; } + .mb-xl-0 { + margin-bottom: 0 !important; } + .mb-xl-1 { + margin-bottom: 0.25rem !important; } + .mb-xl-2 { + margin-bottom: 0.5rem !important; } + .mb-xl-3 { + margin-bottom: 1rem !important; } + .mb-xl-4 { + margin-bottom: 1.5rem !important; } + .mb-xl-5 { + margin-bottom: 3rem !important; } + .mb-xl-auto { + margin-bottom: auto !important; } + .ms-xl-0 { + margin-left: 0 !important; } + .ms-xl-1 { + margin-left: 0.25rem !important; } + .ms-xl-2 { + margin-left: 0.5rem !important; } + .ms-xl-3 { + margin-left: 1rem !important; } + .ms-xl-4 { + margin-left: 1.5rem !important; } + .ms-xl-5 { + margin-left: 3rem !important; } + .ms-xl-auto { + margin-left: auto !important; } + .m-xl-n1 { + margin: -0.25rem !important; } + .m-xl-n2 { + margin: -0.5rem !important; } + .m-xl-n3 { + margin: -1rem !important; } + .m-xl-n4 { + margin: -1.5rem !important; } + .m-xl-n5 { + margin: -3rem !important; } + .mx-xl-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-xl-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-xl-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-xl-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-xl-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-xl-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-xl-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-xl-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-xl-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-xl-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-xl-n1 { + margin-top: -0.25rem !important; } + .mt-xl-n2 { + margin-top: -0.5rem !important; } + .mt-xl-n3 { + margin-top: -1rem !important; } + .mt-xl-n4 { + margin-top: -1.5rem !important; } + .mt-xl-n5 { + margin-top: -3rem !important; } + .me-xl-n1 { + margin-right: -0.25rem !important; } + .me-xl-n2 { + margin-right: -0.5rem !important; } + .me-xl-n3 { + margin-right: -1rem !important; } + .me-xl-n4 { + margin-right: -1.5rem !important; } + .me-xl-n5 { + margin-right: -3rem !important; } + .mb-xl-n1 { + margin-bottom: -0.25rem !important; } + .mb-xl-n2 { + margin-bottom: -0.5rem !important; } + .mb-xl-n3 { + margin-bottom: -1rem !important; } + .mb-xl-n4 { + margin-bottom: -1.5rem !important; } + .mb-xl-n5 { + margin-bottom: -3rem !important; } + .ms-xl-n1 { + margin-left: -0.25rem !important; } + .ms-xl-n2 { + margin-left: -0.5rem !important; } + .ms-xl-n3 { + margin-left: -1rem !important; } + .ms-xl-n4 { + margin-left: -1.5rem !important; } + .ms-xl-n5 { + margin-left: -3rem !important; } + .p-xl-0 { + padding: 0 !important; } + .p-xl-1 { + padding: 0.25rem !important; } + .p-xl-2 { + padding: 0.5rem !important; } + .p-xl-3 { + padding: 1rem !important; } + .p-xl-4 { + padding: 1.5rem !important; } + .p-xl-5 { + padding: 3rem !important; } + .px-xl-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-xl-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-xl-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-xl-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-xl-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-xl-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-xl-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-xl-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-xl-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-xl-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-xl-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-xl-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-xl-0 { + padding-top: 0 !important; } + .pt-xl-1 { + padding-top: 0.25rem !important; } + .pt-xl-2 { + padding-top: 0.5rem !important; } + .pt-xl-3 { + padding-top: 1rem !important; } + .pt-xl-4 { + padding-top: 1.5rem !important; } + .pt-xl-5 { + padding-top: 3rem !important; } + .pe-xl-0 { + padding-right: 0 !important; } + .pe-xl-1 { + padding-right: 0.25rem !important; } + .pe-xl-2 { + padding-right: 0.5rem !important; } + .pe-xl-3 { + padding-right: 1rem !important; } + .pe-xl-4 { + padding-right: 1.5rem !important; } + .pe-xl-5 { + padding-right: 3rem !important; } + .pb-xl-0 { + padding-bottom: 0 !important; } + .pb-xl-1 { + padding-bottom: 0.25rem !important; } + .pb-xl-2 { + padding-bottom: 0.5rem !important; } + .pb-xl-3 { + padding-bottom: 1rem !important; } + .pb-xl-4 { + padding-bottom: 1.5rem !important; } + .pb-xl-5 { + padding-bottom: 3rem !important; } + .ps-xl-0 { + padding-left: 0 !important; } + .ps-xl-1 { + padding-left: 0.25rem !important; } + .ps-xl-2 { + padding-left: 0.5rem !important; } + .ps-xl-3 { + padding-left: 1rem !important; } + .ps-xl-4 { + padding-left: 1.5rem !important; } + .ps-xl-5 { + padding-left: 3rem !important; } + .gap-xl-0 { + gap: 0 !important; } + .gap-xl-1 { + gap: 0.25rem !important; } + .gap-xl-2 { + gap: 0.5rem !important; } + .gap-xl-3 { + gap: 1rem !important; } + .gap-xl-4 { + gap: 1.5rem !important; } + .gap-xl-5 { + gap: 3rem !important; } + .text-xl-start { + text-align: left !important; } + .text-xl-end { + text-align: right !important; } + .text-xl-center { + text-align: center !important; } } + +@media (min-width: 1680px) { + .float-xxl-start { + float: left !important; } + .float-xxl-end { + float: right !important; } + .float-xxl-none { + float: none !important; } + .d-xxl-inline { + display: inline !important; } + .d-xxl-inline-block { + display: inline-block !important; } + .d-xxl-block { + display: block !important; } + .d-xxl-grid { + display: grid !important; } + .d-xxl-table { + display: table !important; } + .d-xxl-table-row { + display: table-row !important; } + .d-xxl-table-cell { + display: table-cell !important; } + .d-xxl-flex { + display: flex !important; } + .d-xxl-inline-flex { + display: inline-flex !important; } + .d-xxl-none { + display: none !important; } + .flex-xxl-fill { + flex: 1 1 auto !important; } + .flex-xxl-row { + flex-direction: row !important; } + .flex-xxl-column { + flex-direction: column !important; } + .flex-xxl-row-reverse { + flex-direction: row-reverse !important; } + .flex-xxl-column-reverse { + flex-direction: column-reverse !important; } + .flex-xxl-grow-0 { + flex-grow: 0 !important; } + .flex-xxl-grow-1 { + flex-grow: 1 !important; } + .flex-xxl-shrink-0 { + flex-shrink: 0 !important; } + .flex-xxl-shrink-1 { + flex-shrink: 1 !important; } + .flex-xxl-wrap { + flex-wrap: wrap !important; } + .flex-xxl-nowrap { + flex-wrap: nowrap !important; } + .flex-xxl-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-xxl-start { + justify-content: flex-start !important; } + .justify-content-xxl-end { + justify-content: flex-end !important; } + .justify-content-xxl-center { + justify-content: center !important; } + .justify-content-xxl-between { + justify-content: space-between !important; } + .justify-content-xxl-around { + justify-content: space-around !important; } + .justify-content-xxl-evenly { + justify-content: space-evenly !important; } + .align-items-xxl-start { + align-items: flex-start !important; } + .align-items-xxl-end { + align-items: flex-end !important; } + .align-items-xxl-center { + align-items: center !important; } + .align-items-xxl-baseline { + align-items: baseline !important; } + .align-items-xxl-stretch { + align-items: stretch !important; } + .align-content-xxl-start { + align-content: flex-start !important; } + .align-content-xxl-end { + align-content: flex-end !important; } + .align-content-xxl-center { + align-content: center !important; } + .align-content-xxl-between { + align-content: space-between !important; } + .align-content-xxl-around { + align-content: space-around !important; } + .align-content-xxl-stretch { + align-content: stretch !important; } + .align-self-xxl-auto { + align-self: auto !important; } + .align-self-xxl-start { + align-self: flex-start !important; } + .align-self-xxl-end { + align-self: flex-end !important; } + .align-self-xxl-center { + align-self: center !important; } + .align-self-xxl-baseline { + align-self: baseline !important; } + .align-self-xxl-stretch { + align-self: stretch !important; } + .order-xxl-first { + order: -1 !important; } + .order-xxl-0 { + order: 0 !important; } + .order-xxl-1 { + order: 1 !important; } + .order-xxl-2 { + order: 2 !important; } + .order-xxl-3 { + order: 3 !important; } + .order-xxl-4 { + order: 4 !important; } + .order-xxl-5 { + order: 5 !important; } + .order-xxl-last { + order: 6 !important; } + .m-xxl-0 { + margin: 0 !important; } + .m-xxl-1 { + margin: 0.25rem !important; } + .m-xxl-2 { + margin: 0.5rem !important; } + .m-xxl-3 { + margin: 1rem !important; } + .m-xxl-4 { + margin: 1.5rem !important; } + .m-xxl-5 { + margin: 3rem !important; } + .m-xxl-auto { + margin: auto !important; } + .mx-xxl-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-xxl-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-xxl-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-xxl-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-xxl-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-xxl-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-xxl-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-xxl-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-xxl-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-xxl-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-xxl-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-xxl-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-xxl-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-xxl-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-xxl-0 { + margin-top: 0 !important; } + .mt-xxl-1 { + margin-top: 0.25rem !important; } + .mt-xxl-2 { + margin-top: 0.5rem !important; } + .mt-xxl-3 { + margin-top: 1rem !important; } + .mt-xxl-4 { + margin-top: 1.5rem !important; } + .mt-xxl-5 { + margin-top: 3rem !important; } + .mt-xxl-auto { + margin-top: auto !important; } + .me-xxl-0 { + margin-right: 0 !important; } + .me-xxl-1 { + margin-right: 0.25rem !important; } + .me-xxl-2 { + margin-right: 0.5rem !important; } + .me-xxl-3 { + margin-right: 1rem !important; } + .me-xxl-4 { + margin-right: 1.5rem !important; } + .me-xxl-5 { + margin-right: 3rem !important; } + .me-xxl-auto { + margin-right: auto !important; } + .mb-xxl-0 { + margin-bottom: 0 !important; } + .mb-xxl-1 { + margin-bottom: 0.25rem !important; } + .mb-xxl-2 { + margin-bottom: 0.5rem !important; } + .mb-xxl-3 { + margin-bottom: 1rem !important; } + .mb-xxl-4 { + margin-bottom: 1.5rem !important; } + .mb-xxl-5 { + margin-bottom: 3rem !important; } + .mb-xxl-auto { + margin-bottom: auto !important; } + .ms-xxl-0 { + margin-left: 0 !important; } + .ms-xxl-1 { + margin-left: 0.25rem !important; } + .ms-xxl-2 { + margin-left: 0.5rem !important; } + .ms-xxl-3 { + margin-left: 1rem !important; } + .ms-xxl-4 { + margin-left: 1.5rem !important; } + .ms-xxl-5 { + margin-left: 3rem !important; } + .ms-xxl-auto { + margin-left: auto !important; } + .m-xxl-n1 { + margin: -0.25rem !important; } + .m-xxl-n2 { + margin: -0.5rem !important; } + .m-xxl-n3 { + margin: -1rem !important; } + .m-xxl-n4 { + margin: -1.5rem !important; } + .m-xxl-n5 { + margin: -3rem !important; } + .mx-xxl-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-xxl-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-xxl-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-xxl-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-xxl-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-xxl-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-xxl-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-xxl-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-xxl-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-xxl-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-xxl-n1 { + margin-top: -0.25rem !important; } + .mt-xxl-n2 { + margin-top: -0.5rem !important; } + .mt-xxl-n3 { + margin-top: -1rem !important; } + .mt-xxl-n4 { + margin-top: -1.5rem !important; } + .mt-xxl-n5 { + margin-top: -3rem !important; } + .me-xxl-n1 { + margin-right: -0.25rem !important; } + .me-xxl-n2 { + margin-right: -0.5rem !important; } + .me-xxl-n3 { + margin-right: -1rem !important; } + .me-xxl-n4 { + margin-right: -1.5rem !important; } + .me-xxl-n5 { + margin-right: -3rem !important; } + .mb-xxl-n1 { + margin-bottom: -0.25rem !important; } + .mb-xxl-n2 { + margin-bottom: -0.5rem !important; } + .mb-xxl-n3 { + margin-bottom: -1rem !important; } + .mb-xxl-n4 { + margin-bottom: -1.5rem !important; } + .mb-xxl-n5 { + margin-bottom: -3rem !important; } + .ms-xxl-n1 { + margin-left: -0.25rem !important; } + .ms-xxl-n2 { + margin-left: -0.5rem !important; } + .ms-xxl-n3 { + margin-left: -1rem !important; } + .ms-xxl-n4 { + margin-left: -1.5rem !important; } + .ms-xxl-n5 { + margin-left: -3rem !important; } + .p-xxl-0 { + padding: 0 !important; } + .p-xxl-1 { + padding: 0.25rem !important; } + .p-xxl-2 { + padding: 0.5rem !important; } + .p-xxl-3 { + padding: 1rem !important; } + .p-xxl-4 { + padding: 1.5rem !important; } + .p-xxl-5 { + padding: 3rem !important; } + .px-xxl-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-xxl-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-xxl-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-xxl-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-xxl-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-xxl-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-xxl-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-xxl-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-xxl-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-xxl-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-xxl-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-xxl-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-xxl-0 { + padding-top: 0 !important; } + .pt-xxl-1 { + padding-top: 0.25rem !important; } + .pt-xxl-2 { + padding-top: 0.5rem !important; } + .pt-xxl-3 { + padding-top: 1rem !important; } + .pt-xxl-4 { + padding-top: 1.5rem !important; } + .pt-xxl-5 { + padding-top: 3rem !important; } + .pe-xxl-0 { + padding-right: 0 !important; } + .pe-xxl-1 { + padding-right: 0.25rem !important; } + .pe-xxl-2 { + padding-right: 0.5rem !important; } + .pe-xxl-3 { + padding-right: 1rem !important; } + .pe-xxl-4 { + padding-right: 1.5rem !important; } + .pe-xxl-5 { + padding-right: 3rem !important; } + .pb-xxl-0 { + padding-bottom: 0 !important; } + .pb-xxl-1 { + padding-bottom: 0.25rem !important; } + .pb-xxl-2 { + padding-bottom: 0.5rem !important; } + .pb-xxl-3 { + padding-bottom: 1rem !important; } + .pb-xxl-4 { + padding-bottom: 1.5rem !important; } + .pb-xxl-5 { + padding-bottom: 3rem !important; } + .ps-xxl-0 { + padding-left: 0 !important; } + .ps-xxl-1 { + padding-left: 0.25rem !important; } + .ps-xxl-2 { + padding-left: 0.5rem !important; } + .ps-xxl-3 { + padding-left: 1rem !important; } + .ps-xxl-4 { + padding-left: 1.5rem !important; } + .ps-xxl-5 { + padding-left: 3rem !important; } + .gap-xxl-0 { + gap: 0 !important; } + .gap-xxl-1 { + gap: 0.25rem !important; } + .gap-xxl-2 { + gap: 0.5rem !important; } + .gap-xxl-3 { + gap: 1rem !important; } + .gap-xxl-4 { + gap: 1.5rem !important; } + .gap-xxl-5 { + gap: 3rem !important; } + .text-xxl-start { + text-align: left !important; } + .text-xxl-end { + text-align: right !important; } + .text-xxl-center { + text-align: center !important; } } + +@media (min-width: 1200px) { + .fs-1 { + font-size: 3rem !important; } + .fs-2 { + font-size: 2.4rem !important; } + .fs-3 { + font-size: 2.1rem !important; } + .fs-4 { + font-size: 1.8rem !important; } + .fs-5 { + font-size: 1.5rem !important; } } + +@media print { + .d-print-inline { + display: inline !important; } + .d-print-inline-block { + display: inline-block !important; } + .d-print-block { + display: block !important; } + .d-print-grid { + display: grid !important; } + .d-print-table { + display: table !important; } + .d-print-table-row { + display: table-row !important; } + .d-print-table-cell { + display: table-cell !important; } + .d-print-flex { + display: flex !important; } + .d-print-inline-flex { + display: inline-flex !important; } + .d-print-none { + display: none !important; } } + +html { + scroll-behavior: smooth; } + +body.fixednav { + margin-top: 108px; } + +.btn, +.navbar-collapse.collapsing, +.megamenu.show, +.nav-link.collapsed, +.scrolled, +.shadow, +.shadow-light, +.preloader, +.navbar, +a, +a.link-line, +a.link-line:before, +a.hover-hide, +a.hover-content, +a.hover-hide::before, +a.hover-hide .hover-content, +.navbar-collapse.collapse.show, +.navbar-light a.nav-link, +img { + transition: all 0.5s ease-in-out 0s; } + +.transform-scale:hover { + transform: scale(1.5, 1.5); } + +.intro-content::first-letter { + float: left; + font-size: 4.5em; + padding: .15em .25em 0 0; + line-height: 4.5rem; } + +.bg-cover { + background-size: cover; + background-position: center center; } + +.navbar { + padding-top: 32px; + padding-bottom: 32px; } + +.navbar.scrolled { + padding-top: 12px; + padding-bottom: 12px; + background-color: #111; } + +.display-big { + font-size: 7rem; } + +.link-fancy { + color: #1717e5; + text-decoration: none; + display: inline-block; + position: relative; } + +.link-fancy-light { + color: #fff; } + +.link-fancy:hover { + color: #8a8a8e; } + +.link-fancy-light:hover { + color: #8a8a8e; } + +.link-fancy:before { + content: ''; + display: block; + height: 1px; + width: 100%; + transform-origin: left; + position: absolute; + left: 0; + bottom: 0; + background-image: linear-gradient(90deg, #1717e5 0, #1717e5 25%, transparent 0, transparent 50%, #1717e5 0, #1717e5 75%, transparent 0, transparent); + background-repeat: no-repeat; + background-position: 0; + background-size: 400% 1px; + transition: background-position 0.8s ease-in-out; } + +.link-fancy-light:before { + background-image: linear-gradient(90deg, #fff 0, #fff 25%, transparent 0, transparent 50%, #fff 0, #fff 75%, transparent 0, transparent); } + +.link-fancy:hover:before { + background-position: 100%; } + +.navbar-collapse.collapsing, .navbar-collapse.collapse.show { + background-color: #fff; + padding: 10px; } + +.blockquote-xl { + font-size: calc(1rem + 1vw); + font-style: italic; + font-weight: bolder; } + +.display-huge { + font-size: calc(2.5rem + 1.5vw); + font-weight: 600; + letter-spacing: -.02rem; } + +.navbar-dark a.nav-link { + color: #fff; + border-bottom: 2px solid transparent; + margin: 0 1rem; + font-size: 1.33rem; } + +.navbar-expand-lg .navbar-nav a.nav-link { + padding-left: 0rem; + padding-right: 0rem; } + +.navbar-dark a.nav-link:hover { + border-bottom: 2px solid #fff; } + +.gradient { + background-image: linear-gradient(24deg, #1717e5, transparent 21%), linear-gradient(198deg, rgba(255, 193, 7, 0.2) 11%, transparent 0%), linear-gradient(50deg, #6610f2 5%, #6f42c1 32%, #d63384 35%, #dc3545 65%, #fd7e14 83%, #ffc107 91%); } + +.display-4 { + font-weight: 500; } + +.no-bottom-radius { + border-bottom-left-radius: 0px !important; + border-bottom-right-radius: 0px !important; } + +.btn-xl { + --bs-btn-padding-y: calc(.75rem + .5vh); + --bs-btn-padding-x: calc(2rem + 2vw); + --bs-btn-font-size: 1.2rem; + --bs-btn-border-radius: 99rem; } + +.btn-soft-primary { + background-color: rgba(23, 23, 229, 0.2); + color: #1717e5; } + .btn-soft-primary:hover { + background-color: #1717e5; + color: #fff; } + +.btn-soft-secondary { + background-color: rgba(138, 138, 142, 0.2); + color: #8a8a8e; } + .btn-soft-secondary:hover { + background-color: #8a8a8e; + color: #fff; } + +.btn-soft-success { + background-color: rgba(25, 135, 84, 0.2); + color: #198754; } + .btn-soft-success:hover { + background-color: #198754; + color: #fff; } + +.btn-soft-danger { + background-color: rgba(220, 53, 69, 0.2); + color: #dc3545; } + .btn-soft-danger:hover { + background-color: #dc3545; + color: #fff; } + +.btn-soft-warning { + background-color: rgba(255, 193, 7, 0.2); + color: #ffc107; } + .btn-soft-warning:hover { + background-color: #ffc107; + color: #fff; } + +.btn-soft-info { + background-color: rgba(13, 202, 240, 0.2); + color: #0dcaf0; } + .btn-soft-info:hover { + background-color: #0dcaf0; + color: #fff; } + +.btn-soft-light { + background-color: rgba(248, 249, 250, 0.2); + color: #202020; } + .btn-soft-light:hover { + background-color: #f8f9fa; + color: #202020; } + +.btn-soft-dark { + background-color: rgba(32, 32, 32, 0.2); + color: #202020; } + .btn-soft-dark:hover { + background-color: #202020; + color: #fff; } + +.btn-gradient { + background-image: linear-gradient(to right, #6610f2, #1717e5); + color: #fff; } + .btn-gradient:hover { + background-image: linear-gradient(to right, #1717e5, #6610f2); + color: #fff; } + +.btn-accent { + background-color: #6610f2; + color: #fff; } + .btn-accent:hover { + background-color: #6610f2; + color: #fff; } + +.btn-white { + background-color: #fff; + color: #202020; } + .btn-white:hover { + background-color: #f8f9fa; + color: #202020; } + +.btn-black { + background-color: #111; + color: #fff; } + .btn-black:hover { + background-color: #202020; + color: #fff; } + +@media (min-width: 1200px) { + .scrollx { + transform: translateX(calc(max(1140px, 100vw)/2 - 570px)); } } + +@media (min-width: 1680px) { + .scrollx { + transform: translateX(calc(max(1320px, 100vw)/2 - 660px)); } } + +.bg-cover { + background-size: cover; } + +.bg-center { + background-position: center center; } + +.bg-gray-100 { + background-color: #f8f9fa; } + +.bg-gray-200 { + background-color: #e9ecef; } + +.bg-gray-300 { + background-color: #dee2e6; } + +.bg-gray-400 { + background-color: #ced4da; } + +.bg-gray-500 { + background-color: #adb5bd; } + +.bg-gray-600 { + background-color: #8a8a8e; } + +.bg-gray-700 { + background-color: #495057; } + +.bg-gray-800 { + background-color: #343a40; } + +.bg-gray-900 { + background-color: #202020; } + +.bg-black { + background-color: #111; } + +.bg-white-90 { + background-color: rgba(255, 255, 255, 0.9); } + +.bg-white-95 { + background-color: rgba(255, 255, 255, 0.95); } + +.bg-primary-soft { + background-color: rgba(23, 23, 229, 0.2); } + +.bg-secondary-soft { + background-color: rgba(138, 138, 142, 0.2); } + +.bg-success-soft { + background-color: rgba(25, 135, 84, 0.2); } + +.bg-warning-soft { + background-color: rgba(255, 193, 7, 0.2); } + +.bg-danger-soft { + background-color: rgba(220, 53, 69, 0.2); } + +.bg-light-soft { + background-color: rgba(248, 249, 250, 0.2); } + +.bg-dark-soft { + background-color: rgba(32, 32, 32, 0.2); } + +.o-50--hover:hover { + opacity: .5; } + +.py-vh-1 { + padding-top: 1.5vh; + padding-bottom: 1.5vh; } + +.py-vh-2 { + padding-top: 3vh; + padding-bottom: 3vh; } + +.py-vh-3 { + padding-top: 6vh; + padding-bottom: 6vh; } + +.py-vh-4 { + padding-top: 9vh; + padding-bottom: 9vh; } + +.py-vh-5 { + padding-top: 12vh; + padding-bottom: 12vh; } + +.py-vh-6 { + padding-top: 16vh; + padding-bottom: 16vh; } + +.transform-scale:hover { + transform: scale(1.5, 1.5); } + +.px-vw-5 { + padding-left: 5vw; + padding-right: 5vw; } + +.vh-5 { + height: 5vh; } + +.vh-10 { + height: 10vh; } + +.vh-20 { + height: 20vh; } + +.vh-25 { + height: 25vh; } + +.vh-33 { + height: 33vh; } + +.vh-50 { + height: 50vh; } + +.vh-66 { + height: 66vh; } + +.vh-75 { + height: 75vh; } + +.vh-100 { + height: 100vh; } + +.vw-5 { + height: 5vw; } + +.vw-10 { + height: 10vw; } + +.vw-20 { + height: 20vw; } + +.vw-25 { + height: 25vw; } + +.vw-33 { + height: 33vw; } + +.vw-50 { + height: 50vw; } + +.vw-66 { + height: 66vw; } + +.vw-75 { + height: 75vw; } + +.vw-100 { + height: 100vw; } + +@media (min-width: 1200px) { + .border-xl-0 { + border-top: none !important; + border-right: none !important; + border-bottom: none !important; + border-left: none !important; } } + +[data-aos][data-aos][data-aos-duration="50"], body[data-aos-duration="50"] [data-aos] { + transition-duration: 50ms; } + +[data-aos][data-aos][data-aos-delay="50"], body[data-aos-delay="50"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="50"].aos-animate, body[data-aos-delay="50"] [data-aos].aos-animate { + transition-delay: 50ms; } + +[data-aos][data-aos][data-aos-duration="100"], body[data-aos-duration="100"] [data-aos] { + transition-duration: .1s; } + +[data-aos][data-aos][data-aos-delay="100"], body[data-aos-delay="100"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="100"].aos-animate, body[data-aos-delay="100"] [data-aos].aos-animate { + transition-delay: .1s; } + +[data-aos][data-aos][data-aos-duration="150"], body[data-aos-duration="150"] [data-aos] { + transition-duration: .15s; } + +[data-aos][data-aos][data-aos-delay="150"], body[data-aos-delay="150"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="150"].aos-animate, body[data-aos-delay="150"] [data-aos].aos-animate { + transition-delay: .15s; } + +[data-aos][data-aos][data-aos-duration="200"], body[data-aos-duration="200"] [data-aos] { + transition-duration: .2s; } + +[data-aos][data-aos][data-aos-delay="200"], body[data-aos-delay="200"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="200"].aos-animate, body[data-aos-delay="200"] [data-aos].aos-animate { + transition-delay: .2s; } + +[data-aos][data-aos][data-aos-duration="250"], body[data-aos-duration="250"] [data-aos] { + transition-duration: .25s; } + +[data-aos][data-aos][data-aos-delay="250"], body[data-aos-delay="250"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="250"].aos-animate, body[data-aos-delay="250"] [data-aos].aos-animate { + transition-delay: .25s; } + +[data-aos][data-aos][data-aos-duration="300"], body[data-aos-duration="300"] [data-aos] { + transition-duration: .3s; } + +[data-aos][data-aos][data-aos-delay="300"], body[data-aos-delay="300"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="300"].aos-animate, body[data-aos-delay="300"] [data-aos].aos-animate { + transition-delay: .3s; } + +[data-aos][data-aos][data-aos-duration="350"], body[data-aos-duration="350"] [data-aos] { + transition-duration: .35s; } + +[data-aos][data-aos][data-aos-delay="350"], body[data-aos-delay="350"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="350"].aos-animate, body[data-aos-delay="350"] [data-aos].aos-animate { + transition-delay: .35s; } + +[data-aos][data-aos][data-aos-duration="400"], body[data-aos-duration="400"] [data-aos] { + transition-duration: .4s; } + +[data-aos][data-aos][data-aos-delay="400"], body[data-aos-delay="400"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="400"].aos-animate, body[data-aos-delay="400"] [data-aos].aos-animate { + transition-delay: .4s; } + +[data-aos][data-aos][data-aos-duration="450"], body[data-aos-duration="450"] [data-aos] { + transition-duration: .45s; } + +[data-aos][data-aos][data-aos-delay="450"], body[data-aos-delay="450"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="450"].aos-animate, body[data-aos-delay="450"] [data-aos].aos-animate { + transition-delay: .45s; } + +[data-aos][data-aos][data-aos-duration="500"], body[data-aos-duration="500"] [data-aos] { + transition-duration: .5s; } + +[data-aos][data-aos][data-aos-delay="500"], body[data-aos-delay="500"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="500"].aos-animate, body[data-aos-delay="500"] [data-aos].aos-animate { + transition-delay: .5s; } + +[data-aos][data-aos][data-aos-duration="550"], body[data-aos-duration="550"] [data-aos] { + transition-duration: .55s; } + +[data-aos][data-aos][data-aos-delay="550"], body[data-aos-delay="550"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="550"].aos-animate, body[data-aos-delay="550"] [data-aos].aos-animate { + transition-delay: .55s; } + +[data-aos][data-aos][data-aos-duration="600"], body[data-aos-duration="600"] [data-aos] { + transition-duration: .6s; } + +[data-aos][data-aos][data-aos-delay="600"], body[data-aos-delay="600"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="600"].aos-animate, body[data-aos-delay="600"] [data-aos].aos-animate { + transition-delay: .6s; } + +[data-aos][data-aos][data-aos-duration="650"], body[data-aos-duration="650"] [data-aos] { + transition-duration: .65s; } + +[data-aos][data-aos][data-aos-delay="650"], body[data-aos-delay="650"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="650"].aos-animate, body[data-aos-delay="650"] [data-aos].aos-animate { + transition-delay: .65s; } + +[data-aos][data-aos][data-aos-duration="700"], body[data-aos-duration="700"] [data-aos] { + transition-duration: .7s; } + +[data-aos][data-aos][data-aos-delay="700"], body[data-aos-delay="700"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="700"].aos-animate, body[data-aos-delay="700"] [data-aos].aos-animate { + transition-delay: .7s; } + +[data-aos][data-aos][data-aos-duration="750"], body[data-aos-duration="750"] [data-aos] { + transition-duration: .75s; } + +[data-aos][data-aos][data-aos-delay="750"], body[data-aos-delay="750"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="750"].aos-animate, body[data-aos-delay="750"] [data-aos].aos-animate { + transition-delay: .75s; } + +[data-aos][data-aos][data-aos-duration="800"], body[data-aos-duration="800"] [data-aos] { + transition-duration: .8s; } + +[data-aos][data-aos][data-aos-delay="800"], body[data-aos-delay="800"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="800"].aos-animate, body[data-aos-delay="800"] [data-aos].aos-animate { + transition-delay: .8s; } + +[data-aos][data-aos][data-aos-duration="850"], body[data-aos-duration="850"] [data-aos] { + transition-duration: .85s; } + +[data-aos][data-aos][data-aos-delay="850"], body[data-aos-delay="850"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="850"].aos-animate, body[data-aos-delay="850"] [data-aos].aos-animate { + transition-delay: .85s; } + +[data-aos][data-aos][data-aos-duration="900"], body[data-aos-duration="900"] [data-aos] { + transition-duration: .9s; } + +[data-aos][data-aos][data-aos-delay="900"], body[data-aos-delay="900"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="900"].aos-animate, body[data-aos-delay="900"] [data-aos].aos-animate { + transition-delay: .9s; } + +[data-aos][data-aos][data-aos-duration="950"], body[data-aos-duration="950"] [data-aos] { + transition-duration: .95s; } + +[data-aos][data-aos][data-aos-delay="950"], body[data-aos-delay="950"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="950"].aos-animate, body[data-aos-delay="950"] [data-aos].aos-animate { + transition-delay: .95s; } + +[data-aos][data-aos][data-aos-duration="1000"], body[data-aos-duration="1000"] [data-aos] { + transition-duration: 1s; } + +[data-aos][data-aos][data-aos-delay="1000"], body[data-aos-delay="1000"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1000"].aos-animate, body[data-aos-delay="1000"] [data-aos].aos-animate { + transition-delay: 1s; } + +[data-aos][data-aos][data-aos-duration="1050"], body[data-aos-duration="1050"] [data-aos] { + transition-duration: 1.05s; } + +[data-aos][data-aos][data-aos-delay="1050"], body[data-aos-delay="1050"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1050"].aos-animate, body[data-aos-delay="1050"] [data-aos].aos-animate { + transition-delay: 1.05s; } + +[data-aos][data-aos][data-aos-duration="1100"], body[data-aos-duration="1100"] [data-aos] { + transition-duration: 1.1s; } + +[data-aos][data-aos][data-aos-delay="1100"], body[data-aos-delay="1100"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1100"].aos-animate, body[data-aos-delay="1100"] [data-aos].aos-animate { + transition-delay: 1.1s; } + +[data-aos][data-aos][data-aos-duration="1150"], body[data-aos-duration="1150"] [data-aos] { + transition-duration: 1.15s; } + +[data-aos][data-aos][data-aos-delay="1150"], body[data-aos-delay="1150"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1150"].aos-animate, body[data-aos-delay="1150"] [data-aos].aos-animate { + transition-delay: 1.15s; } + +[data-aos][data-aos][data-aos-duration="1200"], body[data-aos-duration="1200"] [data-aos] { + transition-duration: 1.2s; } + +[data-aos][data-aos][data-aos-delay="1200"], body[data-aos-delay="1200"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1200"].aos-animate, body[data-aos-delay="1200"] [data-aos].aos-animate { + transition-delay: 1.2s; } + +[data-aos][data-aos][data-aos-duration="1250"], body[data-aos-duration="1250"] [data-aos] { + transition-duration: 1.25s; } + +[data-aos][data-aos][data-aos-delay="1250"], body[data-aos-delay="1250"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1250"].aos-animate, body[data-aos-delay="1250"] [data-aos].aos-animate { + transition-delay: 1.25s; } + +[data-aos][data-aos][data-aos-duration="1300"], body[data-aos-duration="1300"] [data-aos] { + transition-duration: 1.3s; } + +[data-aos][data-aos][data-aos-delay="1300"], body[data-aos-delay="1300"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1300"].aos-animate, body[data-aos-delay="1300"] [data-aos].aos-animate { + transition-delay: 1.3s; } + +[data-aos][data-aos][data-aos-duration="1350"], body[data-aos-duration="1350"] [data-aos] { + transition-duration: 1.35s; } + +[data-aos][data-aos][data-aos-delay="1350"], body[data-aos-delay="1350"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1350"].aos-animate, body[data-aos-delay="1350"] [data-aos].aos-animate { + transition-delay: 1.35s; } + +[data-aos][data-aos][data-aos-duration="1400"], body[data-aos-duration="1400"] [data-aos] { + transition-duration: 1.4s; } + +[data-aos][data-aos][data-aos-delay="1400"], body[data-aos-delay="1400"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1400"].aos-animate, body[data-aos-delay="1400"] [data-aos].aos-animate { + transition-delay: 1.4s; } + +[data-aos][data-aos][data-aos-duration="1450"], body[data-aos-duration="1450"] [data-aos] { + transition-duration: 1.45s; } + +[data-aos][data-aos][data-aos-delay="1450"], body[data-aos-delay="1450"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1450"].aos-animate, body[data-aos-delay="1450"] [data-aos].aos-animate { + transition-delay: 1.45s; } + +[data-aos][data-aos][data-aos-duration="1500"], body[data-aos-duration="1500"] [data-aos] { + transition-duration: 1.5s; } + +[data-aos][data-aos][data-aos-delay="1500"], body[data-aos-delay="1500"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1500"].aos-animate, body[data-aos-delay="1500"] [data-aos].aos-animate { + transition-delay: 1.5s; } + +[data-aos][data-aos][data-aos-duration="1550"], body[data-aos-duration="1550"] [data-aos] { + transition-duration: 1.55s; } + +[data-aos][data-aos][data-aos-delay="1550"], body[data-aos-delay="1550"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1550"].aos-animate, body[data-aos-delay="1550"] [data-aos].aos-animate { + transition-delay: 1.55s; } + +[data-aos][data-aos][data-aos-duration="1600"], body[data-aos-duration="1600"] [data-aos] { + transition-duration: 1.6s; } + +[data-aos][data-aos][data-aos-delay="1600"], body[data-aos-delay="1600"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1600"].aos-animate, body[data-aos-delay="1600"] [data-aos].aos-animate { + transition-delay: 1.6s; } + +[data-aos][data-aos][data-aos-duration="1650"], body[data-aos-duration="1650"] [data-aos] { + transition-duration: 1.65s; } + +[data-aos][data-aos][data-aos-delay="1650"], body[data-aos-delay="1650"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1650"].aos-animate, body[data-aos-delay="1650"] [data-aos].aos-animate { + transition-delay: 1.65s; } + +[data-aos][data-aos][data-aos-duration="1700"], body[data-aos-duration="1700"] [data-aos] { + transition-duration: 1.7s; } + +[data-aos][data-aos][data-aos-delay="1700"], body[data-aos-delay="1700"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1700"].aos-animate, body[data-aos-delay="1700"] [data-aos].aos-animate { + transition-delay: 1.7s; } + +[data-aos][data-aos][data-aos-duration="1750"], body[data-aos-duration="1750"] [data-aos] { + transition-duration: 1.75s; } + +[data-aos][data-aos][data-aos-delay="1750"], body[data-aos-delay="1750"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1750"].aos-animate, body[data-aos-delay="1750"] [data-aos].aos-animate { + transition-delay: 1.75s; } + +[data-aos][data-aos][data-aos-duration="1800"], body[data-aos-duration="1800"] [data-aos] { + transition-duration: 1.8s; } + +[data-aos][data-aos][data-aos-delay="1800"], body[data-aos-delay="1800"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1800"].aos-animate, body[data-aos-delay="1800"] [data-aos].aos-animate { + transition-delay: 1.8s; } + +[data-aos][data-aos][data-aos-duration="1850"], body[data-aos-duration="1850"] [data-aos] { + transition-duration: 1.85s; } + +[data-aos][data-aos][data-aos-delay="1850"], body[data-aos-delay="1850"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1850"].aos-animate, body[data-aos-delay="1850"] [data-aos].aos-animate { + transition-delay: 1.85s; } + +[data-aos][data-aos][data-aos-duration="1900"], body[data-aos-duration="1900"] [data-aos] { + transition-duration: 1.9s; } + +[data-aos][data-aos][data-aos-delay="1900"], body[data-aos-delay="1900"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1900"].aos-animate, body[data-aos-delay="1900"] [data-aos].aos-animate { + transition-delay: 1.9s; } + +[data-aos][data-aos][data-aos-duration="1950"], body[data-aos-duration="1950"] [data-aos] { + transition-duration: 1.95s; } + +[data-aos][data-aos][data-aos-delay="1950"], body[data-aos-delay="1950"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="1950"].aos-animate, body[data-aos-delay="1950"] [data-aos].aos-animate { + transition-delay: 1.95s; } + +[data-aos][data-aos][data-aos-duration="2000"], body[data-aos-duration="2000"] [data-aos] { + transition-duration: 2s; } + +[data-aos][data-aos][data-aos-delay="2000"], body[data-aos-delay="2000"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2000"].aos-animate, body[data-aos-delay="2000"] [data-aos].aos-animate { + transition-delay: 2s; } + +[data-aos][data-aos][data-aos-duration="2050"], body[data-aos-duration="2050"] [data-aos] { + transition-duration: 2.05s; } + +[data-aos][data-aos][data-aos-delay="2050"], body[data-aos-delay="2050"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2050"].aos-animate, body[data-aos-delay="2050"] [data-aos].aos-animate { + transition-delay: 2.05s; } + +[data-aos][data-aos][data-aos-duration="2100"], body[data-aos-duration="2100"] [data-aos] { + transition-duration: 2.1s; } + +[data-aos][data-aos][data-aos-delay="2100"], body[data-aos-delay="2100"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2100"].aos-animate, body[data-aos-delay="2100"] [data-aos].aos-animate { + transition-delay: 2.1s; } + +[data-aos][data-aos][data-aos-duration="2150"], body[data-aos-duration="2150"] [data-aos] { + transition-duration: 2.15s; } + +[data-aos][data-aos][data-aos-delay="2150"], body[data-aos-delay="2150"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2150"].aos-animate, body[data-aos-delay="2150"] [data-aos].aos-animate { + transition-delay: 2.15s; } + +[data-aos][data-aos][data-aos-duration="2200"], body[data-aos-duration="2200"] [data-aos] { + transition-duration: 2.2s; } + +[data-aos][data-aos][data-aos-delay="2200"], body[data-aos-delay="2200"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2200"].aos-animate, body[data-aos-delay="2200"] [data-aos].aos-animate { + transition-delay: 2.2s; } + +[data-aos][data-aos][data-aos-duration="2250"], body[data-aos-duration="2250"] [data-aos] { + transition-duration: 2.25s; } + +[data-aos][data-aos][data-aos-delay="2250"], body[data-aos-delay="2250"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2250"].aos-animate, body[data-aos-delay="2250"] [data-aos].aos-animate { + transition-delay: 2.25s; } + +[data-aos][data-aos][data-aos-duration="2300"], body[data-aos-duration="2300"] [data-aos] { + transition-duration: 2.3s; } + +[data-aos][data-aos][data-aos-delay="2300"], body[data-aos-delay="2300"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2300"].aos-animate, body[data-aos-delay="2300"] [data-aos].aos-animate { + transition-delay: 2.3s; } + +[data-aos][data-aos][data-aos-duration="2350"], body[data-aos-duration="2350"] [data-aos] { + transition-duration: 2.35s; } + +[data-aos][data-aos][data-aos-delay="2350"], body[data-aos-delay="2350"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2350"].aos-animate, body[data-aos-delay="2350"] [data-aos].aos-animate { + transition-delay: 2.35s; } + +[data-aos][data-aos][data-aos-duration="2400"], body[data-aos-duration="2400"] [data-aos] { + transition-duration: 2.4s; } + +[data-aos][data-aos][data-aos-delay="2400"], body[data-aos-delay="2400"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2400"].aos-animate, body[data-aos-delay="2400"] [data-aos].aos-animate { + transition-delay: 2.4s; } + +[data-aos][data-aos][data-aos-duration="2450"], body[data-aos-duration="2450"] [data-aos] { + transition-duration: 2.45s; } + +[data-aos][data-aos][data-aos-delay="2450"], body[data-aos-delay="2450"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2450"].aos-animate, body[data-aos-delay="2450"] [data-aos].aos-animate { + transition-delay: 2.45s; } + +[data-aos][data-aos][data-aos-duration="2500"], body[data-aos-duration="2500"] [data-aos] { + transition-duration: 2.5s; } + +[data-aos][data-aos][data-aos-delay="2500"], body[data-aos-delay="2500"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2500"].aos-animate, body[data-aos-delay="2500"] [data-aos].aos-animate { + transition-delay: 2.5s; } + +[data-aos][data-aos][data-aos-duration="2550"], body[data-aos-duration="2550"] [data-aos] { + transition-duration: 2.55s; } + +[data-aos][data-aos][data-aos-delay="2550"], body[data-aos-delay="2550"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2550"].aos-animate, body[data-aos-delay="2550"] [data-aos].aos-animate { + transition-delay: 2.55s; } + +[data-aos][data-aos][data-aos-duration="2600"], body[data-aos-duration="2600"] [data-aos] { + transition-duration: 2.6s; } + +[data-aos][data-aos][data-aos-delay="2600"], body[data-aos-delay="2600"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2600"].aos-animate, body[data-aos-delay="2600"] [data-aos].aos-animate { + transition-delay: 2.6s; } + +[data-aos][data-aos][data-aos-duration="2650"], body[data-aos-duration="2650"] [data-aos] { + transition-duration: 2.65s; } + +[data-aos][data-aos][data-aos-delay="2650"], body[data-aos-delay="2650"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2650"].aos-animate, body[data-aos-delay="2650"] [data-aos].aos-animate { + transition-delay: 2.65s; } + +[data-aos][data-aos][data-aos-duration="2700"], body[data-aos-duration="2700"] [data-aos] { + transition-duration: 2.7s; } + +[data-aos][data-aos][data-aos-delay="2700"], body[data-aos-delay="2700"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2700"].aos-animate, body[data-aos-delay="2700"] [data-aos].aos-animate { + transition-delay: 2.7s; } + +[data-aos][data-aos][data-aos-duration="2750"], body[data-aos-duration="2750"] [data-aos] { + transition-duration: 2.75s; } + +[data-aos][data-aos][data-aos-delay="2750"], body[data-aos-delay="2750"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2750"].aos-animate, body[data-aos-delay="2750"] [data-aos].aos-animate { + transition-delay: 2.75s; } + +[data-aos][data-aos][data-aos-duration="2800"], body[data-aos-duration="2800"] [data-aos] { + transition-duration: 2.8s; } + +[data-aos][data-aos][data-aos-delay="2800"], body[data-aos-delay="2800"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2800"].aos-animate, body[data-aos-delay="2800"] [data-aos].aos-animate { + transition-delay: 2.8s; } + +[data-aos][data-aos][data-aos-duration="2850"], body[data-aos-duration="2850"] [data-aos] { + transition-duration: 2.85s; } + +[data-aos][data-aos][data-aos-delay="2850"], body[data-aos-delay="2850"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2850"].aos-animate, body[data-aos-delay="2850"] [data-aos].aos-animate { + transition-delay: 2.85s; } + +[data-aos][data-aos][data-aos-duration="2900"], body[data-aos-duration="2900"] [data-aos] { + transition-duration: 2.9s; } + +[data-aos][data-aos][data-aos-delay="2900"], body[data-aos-delay="2900"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2900"].aos-animate, body[data-aos-delay="2900"] [data-aos].aos-animate { + transition-delay: 2.9s; } + +[data-aos][data-aos][data-aos-duration="2950"], body[data-aos-duration="2950"] [data-aos] { + transition-duration: 2.95s; } + +[data-aos][data-aos][data-aos-delay="2950"], body[data-aos-delay="2950"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="2950"].aos-animate, body[data-aos-delay="2950"] [data-aos].aos-animate { + transition-delay: 2.95s; } + +[data-aos][data-aos][data-aos-duration="3000"], body[data-aos-duration="3000"] [data-aos] { + transition-duration: 3s; } + +[data-aos][data-aos][data-aos-delay="3000"], body[data-aos-delay="3000"] [data-aos] { + transition-delay: 0s; } + +[data-aos][data-aos][data-aos-delay="3000"].aos-animate, body[data-aos-delay="3000"] [data-aos].aos-animate { + transition-delay: 3s; } + +[data-aos] { + pointer-events: none; } + +[data-aos].aos-animate { + pointer-events: auto; } + +[data-aos][data-aos][data-aos-easing=linear], body[data-aos-easing=linear] [data-aos] { + transition-timing-function: cubic-bezier(0.25, 0.25, 0.75, 0.75); } + +[data-aos][data-aos][data-aos-easing=ease], body[data-aos-easing=ease] [data-aos] { + transition-timing-function: ease; } + +[data-aos][data-aos][data-aos-easing=ease-in], body[data-aos-easing=ease-in] [data-aos] { + transition-timing-function: ease-in; } + +[data-aos][data-aos][data-aos-easing=ease-out], body[data-aos-easing=ease-out] [data-aos] { + transition-timing-function: ease-out; } + +[data-aos][data-aos][data-aos-easing=ease-in-out], body[data-aos-easing=ease-in-out] [data-aos] { + transition-timing-function: ease-in-out; } + +[data-aos][data-aos][data-aos-easing=ease-in-back], body[data-aos-easing=ease-in-back] [data-aos] { + transition-timing-function: cubic-bezier(0.6, -0.28, 0.735, 0.045); } + +[data-aos][data-aos][data-aos-easing=ease-out-back], body[data-aos-easing=ease-out-back] [data-aos] { + transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.275); } + +[data-aos][data-aos][data-aos-easing=ease-in-out-back], body[data-aos-easing=ease-in-out-back] [data-aos] { + transition-timing-function: cubic-bezier(0.68, -0.55, 0.265, 1.55); } + +[data-aos][data-aos][data-aos-easing=ease-in-sine], body[data-aos-easing=ease-in-sine] [data-aos] { + transition-timing-function: cubic-bezier(0.47, 0, 0.745, 0.715); } + +[data-aos][data-aos][data-aos-easing=ease-out-sine], body[data-aos-easing=ease-out-sine] [data-aos] { + transition-timing-function: cubic-bezier(0.39, 0.575, 0.565, 1); } + +[data-aos][data-aos][data-aos-easing=ease-in-out-sine], body[data-aos-easing=ease-in-out-sine] [data-aos] { + transition-timing-function: cubic-bezier(0.445, 0.05, 0.55, 0.95); } + +[data-aos][data-aos][data-aos-easing=ease-in-quad], body[data-aos-easing=ease-in-quad] [data-aos] { + transition-timing-function: cubic-bezier(0.55, 0.085, 0.68, 0.53); } + +[data-aos][data-aos][data-aos-easing=ease-out-quad], body[data-aos-easing=ease-out-quad] [data-aos] { + transition-timing-function: cubic-bezier(0.25, 0.46, 0.45, 0.94); } + +[data-aos][data-aos][data-aos-easing=ease-in-out-quad], body[data-aos-easing=ease-in-out-quad] [data-aos] { + transition-timing-function: cubic-bezier(0.455, 0.03, 0.515, 0.955); } + +[data-aos][data-aos][data-aos-easing=ease-in-cubic], body[data-aos-easing=ease-in-cubic] [data-aos] { + transition-timing-function: cubic-bezier(0.55, 0.085, 0.68, 0.53); } + +[data-aos][data-aos][data-aos-easing=ease-out-cubic], body[data-aos-easing=ease-out-cubic] [data-aos] { + transition-timing-function: cubic-bezier(0.25, 0.46, 0.45, 0.94); } + +[data-aos][data-aos][data-aos-easing=ease-in-out-cubic], body[data-aos-easing=ease-in-out-cubic] [data-aos] { + transition-timing-function: cubic-bezier(0.455, 0.03, 0.515, 0.955); } + +[data-aos][data-aos][data-aos-easing=ease-in-quart], body[data-aos-easing=ease-in-quart] [data-aos] { + transition-timing-function: cubic-bezier(0.55, 0.085, 0.68, 0.53); } + +[data-aos][data-aos][data-aos-easing=ease-out-quart], body[data-aos-easing=ease-out-quart] [data-aos] { + transition-timing-function: cubic-bezier(0.25, 0.46, 0.45, 0.94); } + +[data-aos][data-aos][data-aos-easing=ease-in-out-quart], body[data-aos-easing=ease-in-out-quart] [data-aos] { + transition-timing-function: cubic-bezier(0.455, 0.03, 0.515, 0.955); } + +@media screen { + html:not(.no-js) [data-aos^=fade][data-aos^=fade] { + opacity: 0; + transition-property: opacity,-webkit-transform; + transition-property: opacity,transform; + transition-property: opacity,transform,-webkit-transform; } + html:not(.no-js) [data-aos^=fade][data-aos^=fade].aos-animate { + opacity: 1; + -webkit-transform: none; + transform: none; } + html:not(.no-js) [data-aos=fade-up] { + -webkit-transform: translate3d(0, 100px, 0); + transform: translate3d(0, 100px, 0); } + html:not(.no-js) [data-aos=fade-down] { + -webkit-transform: translate3d(0, -100px, 0); + transform: translate3d(0, -100px, 0); } + html:not(.no-js) [data-aos=fade-right] { + -webkit-transform: translate3d(-100px, 0, 0); + transform: translate3d(-100px, 0, 0); } + html:not(.no-js) [data-aos=fade-left] { + -webkit-transform: translate3d(100px, 0, 0); + transform: translate3d(100px, 0, 0); } + html:not(.no-js) [data-aos=fade-up-right] { + -webkit-transform: translate3d(-100px, 100px, 0); + transform: translate3d(-100px, 100px, 0); } + html:not(.no-js) [data-aos=fade-up-left] { + -webkit-transform: translate3d(100px, 100px, 0); + transform: translate3d(100px, 100px, 0); } + html:not(.no-js) [data-aos=fade-down-right] { + -webkit-transform: translate3d(-100px, -100px, 0); + transform: translate3d(-100px, -100px, 0); } + html:not(.no-js) [data-aos=fade-down-left] { + -webkit-transform: translate3d(100px, -100px, 0); + transform: translate3d(100px, -100px, 0); } + html:not(.no-js) [data-aos^=zoom][data-aos^=zoom] { + opacity: 0; + transition-property: opacity,-webkit-transform; + transition-property: opacity,transform; + transition-property: opacity,transform,-webkit-transform; } + html:not(.no-js) [data-aos^=zoom][data-aos^=zoom].aos-animate { + opacity: 1; + -webkit-transform: translateZ(0) scale(1); + transform: translateZ(0) scale(1); } + html:not(.no-js) [data-aos=zoom-in] { + -webkit-transform: scale(0.6); + transform: scale(0.6); } + html:not(.no-js) [data-aos=zoom-in-up] { + -webkit-transform: translate3d(0, 100px, 0) scale(0.6); + transform: translate3d(0, 100px, 0) scale(0.6); } + html:not(.no-js) [data-aos=zoom-in-down] { + -webkit-transform: translate3d(0, -100px, 0) scale(0.6); + transform: translate3d(0, -100px, 0) scale(0.6); } + html:not(.no-js) [data-aos=zoom-in-right] { + -webkit-transform: translate3d(-100px, 0, 0) scale(0.6); + transform: translate3d(-100px, 0, 0) scale(0.6); } + html:not(.no-js) [data-aos=zoom-in-left] { + -webkit-transform: translate3d(100px, 0, 0) scale(0.6); + transform: translate3d(100px, 0, 0) scale(0.6); } + html:not(.no-js) [data-aos=zoom-out] { + -webkit-transform: scale(1.2); + transform: scale(1.2); } + html:not(.no-js) [data-aos=zoom-out-up] { + -webkit-transform: translate3d(0, 100px, 0) scale(1.2); + transform: translate3d(0, 100px, 0) scale(1.2); } + html:not(.no-js) [data-aos=zoom-out-down] { + -webkit-transform: translate3d(0, -100px, 0) scale(1.2); + transform: translate3d(0, -100px, 0) scale(1.2); } + html:not(.no-js) [data-aos=zoom-out-right] { + -webkit-transform: translate3d(-100px, 0, 0) scale(1.2); + transform: translate3d(-100px, 0, 0) scale(1.2); } + html:not(.no-js) [data-aos=zoom-out-left] { + -webkit-transform: translate3d(100px, 0, 0) scale(1.2); + transform: translate3d(100px, 0, 0) scale(1.2); } + html:not(.no-js) [data-aos^=slide][data-aos^=slide] { + transition-property: -webkit-transform; + transition-property: transform; + transition-property: transform,-webkit-transform; + visibility: hidden; } + html:not(.no-js) [data-aos^=slide][data-aos^=slide].aos-animate { + visibility: visible; + -webkit-transform: translateZ(0); + transform: translateZ(0); } + html:not(.no-js) [data-aos=slide-up] { + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); } + html:not(.no-js) [data-aos=slide-down] { + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); } + html:not(.no-js) [data-aos=slide-right] { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); } + html:not(.no-js) [data-aos=slide-left] { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); } + html:not(.no-js) [data-aos^=flip][data-aos^=flip] { + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + transition-property: -webkit-transform; + transition-property: transform; + transition-property: transform,-webkit-transform; } + html:not(.no-js) [data-aos=flip-left] { + -webkit-transform: perspective(2500px) rotateY(-100deg); + transform: perspective(2500px) rotateY(-100deg); } + html:not(.no-js) [data-aos=flip-left].aos-animate { + -webkit-transform: perspective(2500px) rotateY(0); + transform: perspective(2500px) rotateY(0); } + html:not(.no-js) [data-aos=flip-right] { + -webkit-transform: perspective(2500px) rotateY(100deg); + transform: perspective(2500px) rotateY(100deg); } + html:not(.no-js) [data-aos=flip-right].aos-animate { + -webkit-transform: perspective(2500px) rotateY(0); + transform: perspective(2500px) rotateY(0); } + html:not(.no-js) [data-aos=flip-up] { + -webkit-transform: perspective(2500px) rotateX(-100deg); + transform: perspective(2500px) rotateX(-100deg); } + html:not(.no-js) [data-aos=flip-up].aos-animate { + -webkit-transform: perspective(2500px) rotateX(0); + transform: perspective(2500px) rotateX(0); } + html:not(.no-js) [data-aos=flip-down] { + -webkit-transform: perspective(2500px) rotateX(100deg); + transform: perspective(2500px) rotateX(100deg); } + html:not(.no-js) [data-aos=flip-down].aos-animate { + -webkit-transform: perspective(2500px) rotateX(0); + transform: perspective(2500px) rotateX(0); } } diff --git a/css/theme.min.css b/css/theme.min.css new file mode 100644 index 0000000..90878fb --- /dev/null +++ b/css/theme.min.css @@ -0,0 +1,6 @@ +/*! + * Bootstrap v5.2.1 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root{--bs-blue:#1717e5;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-white:#fff;--bs-gray:#8a8a8e;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#8a8a8e;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#202020;--bs-primary:#1717e5;--bs-secondary:#8a8a8e;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#202020;--bs-primary-rgb:23,23,229;--bs-secondary-rgb:138,138,142;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:32,32,32;--bs-white-rgb:255,255,255;--bs-black-rgb:17,17,17;--bs-body-color-rgb:32,32,32;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:"Inter",system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1.2rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#202020;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(17, 17, 17, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-link-color:#1717e5;--bs-link-hover-color:#1212b7;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(17,17,17,0)}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:calc(1.425rem + 2.1vw)}@media (min-width:1200px){.h1,h1{font-size:3rem}}.h2,h2{font-size:calc(1.365rem + 1.38vw)}@media (min-width:1200px){.h2,h2{font-size:2.4rem}}.h3,h3{font-size:calc(1.335rem + 1.02vw)}@media (min-width:1200px){.h3,h3{font-size:2.1rem}}.h4,h4{font-size:calc(1.305rem + .66vw)}@media (min-width:1200px){.h4,h4{font-size:1.8rem}}.h5,h5{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h5,h5{font-size:1.5rem}}.h6,h6{font-size:1.2rem}p{margin-top:0;margin-bottom:1rem}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ul{padding-left:2rem}ul{margin-top:0;margin-bottom:1rem}ul ul{margin-bottom:0}strong{font-weight:bolder}.small,small{font-size:.875em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}img,svg{vertical-align:middle}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button{text-transform:none}[type=button],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}.lead{font-size:calc(1.2846rem + .4152vw);font-weight:300}@media (min-width:1200px){.lead{font-size:1.596rem}}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.img-fluid{max-width:100%;height:auto}.container,.container-fluid{--bs-gutter-x:4vw;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}@media (min-width:1680px){.container{max-width:1600px}}.row{--bs-gutter-x:4vw;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.col-5{flex:0 0 auto;width:41.66667%}.col-6{flex:0 0 auto;width:50%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333%}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5{--bs-gutter-y:3rem}@media (min-width:768px){.col-md-auto{flex:0 0 auto;width:auto}.col-md-5{flex:0 0 auto;width:41.66667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333%}}@media (min-width:992px){.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333%}.col-lg-5{flex:0 0 auto;width:41.66667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333%}.col-lg-10{flex:0 0 auto;width:83.33333%}.offset-lg-1{margin-left:8.33333%}}@media (min-width:1200px){.col-xl-5{flex:0 0 auto;width:41.66667%}.col-xl-7{flex:0 0 auto;width:58.33333%}.col-xl-8{flex:0 0 auto;width:66.66667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333%}}.form-label{margin-bottom:.5rem}.form-text{margin-top:.25rem;font-size:.875em;color:#8a8a8e}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1.2rem;font-weight:400;line-height:1.5;color:#202020;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control:focus{color:#202020;background-color:#fff;border-color:#8b8bf2;outline:0;box-shadow:0 0 0 .25rem rgba(23,23,229,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::placeholder{color:#8a8a8e;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;margin-inline-end:.75rem;color:#202020;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:calc(1.275rem + .3vw);border-radius:.5rem}@media (min-width:1200px){.form-control-lg{font-size:1.5rem}}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;margin-inline-end:1rem}.form-check{display:block;min-height:1.8rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(17,17,17,.25);appearance:none;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#8b8bf2;outline:0;box-shadow:0 0 0 .25rem rgba(23,23,229,.25)}.form-check-input:checked{background-color:#1717e5;border-color:#1717e5}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#1717e5;border-color:#1717e5;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label{cursor:default;opacity:.5}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-size:1.2rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#202020;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:99rem;--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(17, 17, 17, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:first-child:hover,:not(.btn-check)+.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-light{--bs-btn-color:#111;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#111;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:213,214,215;--bs-btn-active-color:#111;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(17, 17, 17, 0.125);--bs-btn-disabled-color:#111;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#111;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#111;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(17, 17, 17, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#8a8a8e;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(17, 17, 17, 0.7);--bs-navbar-hover-color:rgba(17, 17, 17, 0.8);--bs-navbar-disabled-color:rgba(17, 17, 17, 0.3);--bs-navbar-active-color:rgba(17, 17, 17, 0.9);--bs-navbar-brand-padding-y:0.275rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.5rem;--bs-navbar-brand-color:rgba(17, 17, 17, 0.9);--bs-navbar-brand-hover-color:rgba(17, 17, 17, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.5rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2817, 17, 17, 0.7%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(17, 17, 17, 0.1);--bs-navbar-toggler-border-radius:99rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(17, 17, 17, 0.03);--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:2vw;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.list-group{--bs-list-group-color:#202020;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(17, 17, 17, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#202020;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#8a8a8e;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#1717e5;--bs-list-group-active-border-color:#1717e5;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-horizontal{flex-direction:row}@keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-wave{100%{mask-position:-200% 0}}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.opacity-75{opacity:.75!important}.overflow-hidden{overflow:hidden!important}.d-flex{display:flex!important}.shadow{box-shadow:0 1rem 3rem rgba(17,17,17,.5)!important}.shadow-sm{box-shadow:0 1rem 1.5rem rgba(17,17,17,.25)!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.top-0{top:0!important}.bottom-0{bottom:0!important}.start-0{left:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-5{--bs-border-width:5px}.w-100{width:100%!important}.h-50{height:50%!important}.h-100{height:100%!important}.flex-column{flex-direction:column!important}.justify-content-start{justify-content:flex-start!important}.justify-content-center{justify-content:center!important}.align-items-start{align-items:flex-start!important}.align-items-center{align-items:center!important}.align-items-stretch{align-items:stretch!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-3{margin-top:1rem!important}.mt-5{margin-top:3rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-5{margin-left:3rem!important}.mb-n5{margin-bottom:-3rem!important}.p-0{padding:0!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-3{padding-top:1rem!important}.pt-5{padding-top:3rem!important}.pb-0{padding-bottom:0!important}.pb-4{padding-bottom:1.5rem!important}.fs-1{font-size:calc(1.425rem + 2.1vw)!important}.fs-4{font-size:calc(1.305rem + .66vw)!important}.fs-5{font-size:calc(1.275rem + .3vw)!important}.fs-6{font-size:1.2rem!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.text-center{text-align:center!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:#8a8a8e!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}@media (min-width:768px){.me-md-5{margin-right:3rem!important}.ms-md-1{margin-left:.25rem!important}.pe-md-4{padding-right:1.5rem!important}}@media (min-width:992px){.mb-lg-0{margin-bottom:0!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}}@media (min-width:1200px){.fs-1{font-size:3rem!important}.fs-4{font-size:1.8rem!important}.fs-5{font-size:1.5rem!important}}html{scroll-behavior:smooth}.btn,.nav-link.collapsed,.navbar,.scrolled,.shadow,a,img{transition:all .5s ease-in-out 0s}.bg-cover{background-size:cover;background-position:center center}.navbar{padding-top:32px;padding-bottom:32px}.navbar.scrolled{padding-top:12px;padding-bottom:12px;background-color:#111}.link-fancy{color:#1717e5;text-decoration:none;display:inline-block;position:relative}.link-fancy-light{color:#fff}.link-fancy:hover{color:#8a8a8e}.link-fancy-light:hover{color:#8a8a8e}.link-fancy:before{content:'';display:block;height:1px;width:100%;transform-origin:left;position:absolute;left:0;bottom:0;background-image:linear-gradient(90deg,#1717e5 0,#1717e5 25%,transparent 0,transparent 50%,#1717e5 0,#1717e5 75%,transparent 0,transparent);background-repeat:no-repeat;background-position:0;background-size:400% 1px;transition:background-position .8s ease-in-out}.link-fancy-light:before{background-image:linear-gradient(90deg,#fff 0,#fff 25%,transparent 0,transparent 50%,#fff 0,#fff 75%,transparent 0,transparent)}.link-fancy:hover:before{background-position:100%}.display-huge{font-size:calc(2.5rem + 1.5vw);font-weight:600;letter-spacing:-.02rem}.navbar-dark a.nav-link{color:#fff;border-bottom:2px solid transparent;margin:0 1rem;font-size:1.33rem}.navbar-dark a.nav-link:hover{border-bottom:2px solid #fff}.gradient{background-image:linear-gradient(24deg,#1717e5,transparent 21%),linear-gradient(198deg,rgba(255,193,7,.2) 11%,transparent 0),linear-gradient(50deg,#6610f2 5%,#6f42c1 32%,#d63384 35%,#dc3545 65%,#fd7e14 83%,#ffc107 91%)}.display-4{font-weight:500}.no-bottom-radius{border-bottom-left-radius:0!important;border-bottom-right-radius:0!important}.btn-xl{--bs-btn-padding-y:calc(.75rem + .5vh);--bs-btn-padding-x:calc(2rem + 2vw);--bs-btn-font-size:1.2rem;--bs-btn-border-radius:99rem}.btn-white{background-color:#fff;color:#202020}.btn-white:hover{background-color:#f8f9fa;color:#202020}.bg-cover{background-size:cover}.bg-center{background-position:center center}.bg-gray-800{background-color:#343a40}.bg-gray-900{background-color:#202020}.bg-black{background-color:#111}.py-vh-2{padding-top:3vh;padding-bottom:3vh}.py-vh-3{padding-top:6vh;padding-bottom:6vh}.py-vh-4{padding-top:9vh;padding-bottom:9vh}.py-vh-5{padding-top:12vh;padding-bottom:12vh}.px-vw-5{padding-left:5vw;padding-right:5vw}[data-aos][data-aos][data-aos-duration="300"],body[data-aos-duration="300"] [data-aos]{transition-duration:.3s}[data-aos][data-aos][data-aos-duration="400"],body[data-aos-duration="400"] [data-aos]{transition-duration:.4s}[data-aos][data-aos][data-aos-duration="500"],body[data-aos-duration="500"] [data-aos]{transition-duration:.5s}[data-aos][data-aos][data-aos-duration="700"],body[data-aos-duration="700"] [data-aos]{transition-duration:.7s}[data-aos][data-aos][data-aos-duration="800"],body[data-aos-duration="800"] [data-aos]{transition-duration:.8s}[data-aos][data-aos][data-aos-duration="2000"],body[data-aos-duration="2000"] [data-aos]{transition-duration:2s}[data-aos][data-aos][data-aos-duration="3000"],body[data-aos-duration="3000"] [data-aos]{transition-duration:3s}[data-aos]{pointer-events:none}[data-aos].aos-animate{pointer-events:auto}@media screen{html:not(.no-js) [data-aos^=fade][data-aos^=fade]{opacity:0;transition-property:opacity,-webkit-transform;transition-property:opacity,transform;transition-property:opacity,transform,-webkit-transform}html:not(.no-js) [data-aos^=fade][data-aos^=fade].aos-animate{opacity:1;-webkit-transform:none;transform:none}html:not(.no-js) [data-aos=fade-up]{-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}html:not(.no-js) [data-aos=fade-right]{-webkit-transform:translate3d(-100px,0,0);transform:translate3d(-100px,0,0)}html:not(.no-js) [data-aos=fade-left]{-webkit-transform:translate3d(100px,0,0);transform:translate3d(100px,0,0)}html:not(.no-js) [data-aos^=zoom][data-aos^=zoom]{opacity:0;transition-property:opacity,-webkit-transform;transition-property:opacity,transform;transition-property:opacity,transform,-webkit-transform}html:not(.no-js) [data-aos^=zoom][data-aos^=zoom].aos-animate{opacity:1;-webkit-transform:translateZ(0) scale(1);transform:translateZ(0) scale(1)}html:not(.no-js) [data-aos=zoom-in-up]{-webkit-transform:translate3d(0,100px,0) scale(.6);transform:translate3d(0,100px,0) scale(.6)}html:not(.no-js) [data-aos=zoom-in-right]{-webkit-transform:translate3d(-100px,0,0) scale(.6);transform:translate3d(-100px,0,0) scale(.6)}html:not(.no-js) [data-aos=zoom-in-left]{-webkit-transform:translate3d(100px,0,0) scale(.6);transform:translate3d(100px,0,0) scale(.6)}} \ No newline at end of file diff --git a/fonts/inter-v12-latin-300.woff b/fonts/inter-v12-latin-300.woff new file mode 100644 index 0000000..f3fe81e Binary files /dev/null and b/fonts/inter-v12-latin-300.woff differ diff --git a/fonts/inter-v12-latin-300.woff2 b/fonts/inter-v12-latin-300.woff2 new file mode 100644 index 0000000..e085aa8 Binary files /dev/null and b/fonts/inter-v12-latin-300.woff2 differ diff --git a/fonts/inter-v12-latin-500.woff b/fonts/inter-v12-latin-500.woff new file mode 100644 index 0000000..19c7bf8 Binary files /dev/null and b/fonts/inter-v12-latin-500.woff differ diff --git a/fonts/inter-v12-latin-500.woff2 b/fonts/inter-v12-latin-500.woff2 new file mode 100644 index 0000000..6fc94ad Binary files /dev/null and b/fonts/inter-v12-latin-500.woff2 differ diff --git a/fonts/inter-v12-latin-700.woff b/fonts/inter-v12-latin-700.woff new file mode 100644 index 0000000..097e23e Binary files /dev/null and b/fonts/inter-v12-latin-700.woff differ diff --git a/fonts/inter-v12-latin-700.woff2 b/fonts/inter-v12-latin-700.woff2 new file mode 100644 index 0000000..8fcc432 Binary files /dev/null and b/fonts/inter-v12-latin-700.woff2 differ diff --git a/fonts/inter-v12-latin-regular.woff b/fonts/inter-v12-latin-regular.woff new file mode 100644 index 0000000..1866261 Binary files /dev/null and b/fonts/inter-v12-latin-regular.woff differ diff --git a/fonts/inter-v12-latin-regular.woff2 b/fonts/inter-v12-latin-regular.woff2 new file mode 100644 index 0000000..c659f5e Binary files /dev/null and b/fonts/inter-v12-latin-regular.woff2 differ diff --git a/index.html b/index.html new file mode 100644 index 0000000..9e7386a --- /dev/null +++ b/index.html @@ -0,0 +1,634 @@ + + + + + + + + + + + + + + + Klar HTML Template - Frontpage one + + + + + + + + + + + +
+
+
+
+
+
+ Our Mission +

We do ordinary stuff for cool people

+
+
+

We are some sort of DAO working with AI, NFT´s, web 4.0 and the so called + blockchain...in the Metaverse. You don´t understand a word? No problem, we neither!

+
+
+ Join us + + + + +
+
+
+ +
+ +
+
+
+
+
+ abstract image +
+
+ abstract image +
+
+ abstract image +
+
+
+
+
+
+
+
+ What we do +

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor + invidunt ut labore et dolore magna aliquyam erat, sed diam voluptua.

+
+
+

Product Design & Strategy

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod + tempor invidunt ut labore et dolore magna aliquyam erat, sed diam voluptua.
+ Tell me more + + + +

+

Development & Engineering

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod + tempor invidunt ut labore et dolore magna aliquyam erat, sed diam voluptua.
+ Tell me more + + + +

+
+
+
+
+ +
+
+ +
+
+
+
+ abstract image +
+

Ipsum dolor est

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam + nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat.

+ Read more +
+
+
+ +
+
+ abstract image +
+

Ipsum dolor est

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam + nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat.

+ Read more +
+
+
+
+
+
+ What we don´t know +

There is a lot we don´t know. Here is a small sneak peek

+
+
+
+ abstract image +
+

Ipsum dolor est

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam + nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat.

+ Read more +
+
+
+ +
+
+ abstract image +
+

Ipsum dolor est

+

Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam + nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat.

+ Read more +
+
+
+
+
+ +
+ +
+
+
+
+ +
+ a nice person + another nice person +
+
+ Do you like faces? +

We constantly adding new images to our website. Does it make sense? No!

+
+
+
+
+ +
+
+
+
+ What we charge +

You get all our knowledge for one simple price

+
+
+

+ $499/day +

+

Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod + tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation + ullamco laboris nisi ut aliquip ex ea commodo consequat.

+ Sign up + + + + +
+
+
+ +
+
+
+
+
+
+ +
+
+
+ our CEO with some nice numbers +
+
+

"Lorem ipsum dolor sit amet, consetetur sadipscing + elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, sed diam + voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea + takimata sanctus est Lorem ipsum dolor sit amet."

+

Jane Doe, CEO

+
+
+
+
+ The numbers +

+400

+

+ Lorem ipsum dolor sit amet, consetetur sadipscing elitr. +

+ +

78.981 +

+

+ Lorem ipsum dolor sit amet, consetetur sadipscing elitr. +

+

98%

+

+ Lorem ipsum dolor sit amet, consetetur sadipscing elitr. +

+
+
+
+ +
+
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
+

"Lorem ipsum dolor sit amet, consectetur tempor incididunt ut labore et + dolore magna aliqua ullamco laboris nisi ut aliquip ex ea commodo consequat."

+
+ a nice person +
+ Jane Doemunsky
+ COO, The Boo Corp. +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+

"Lorem ipsum dolor sit amet, consectetur tempor incididunt ut labore et + dolore magna aliqua. Ut enim ad minim veniam. quis nostrud exercitation ullamco laboris nisi ut aliquip + ex ea commodo consequat."

+
+ a nice person +
+ Jane Doemunsky
+ COO, The Boo Corp. +
+
+
+ +
+
+
+ What others have to say +

Invidunt ut labore et dolore magna aliquyam erat.

+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
+

"Consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna + aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo + consequat."

+
+ a nice person +
+ Jane Doemunsky
+ COO, The Boo Corp. +
+
+
+
+
+
+ +
+ +
+ + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/js/aos.cjs.js b/js/aos.cjs.js new file mode 100644 index 0000000..86119ba --- /dev/null +++ b/js/aos.cjs.js @@ -0,0 +1,614 @@ +'use strict'; + +function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } + +var throttle = _interopDefault(require('lodash.throttle')); +var debounce = _interopDefault(require('lodash.debounce')); + +var callback = function callback() {}; + +function containsAOSNode(nodes) { + var i = void 0, + currentNode = void 0, + result = void 0; + + for (i = 0; i < nodes.length; i += 1) { + currentNode = nodes[i]; + + if (currentNode.dataset && currentNode.dataset.aos) { + return true; + } + + result = currentNode.children && containsAOSNode(currentNode.children); + + if (result) { + return true; + } + } + + return false; +} + +function check(mutations) { + if (!mutations) return; + + mutations.forEach(function (mutation) { + var addedNodes = Array.prototype.slice.call(mutation.addedNodes); + var removedNodes = Array.prototype.slice.call(mutation.removedNodes); + var allNodes = addedNodes.concat(removedNodes); + + if (containsAOSNode(allNodes)) { + return callback(); + } + }); +} + +function getMutationObserver() { + return window.MutationObserver || window.WebKitMutationObserver || window.MozMutationObserver; +} + +function isSupported() { + return !!getMutationObserver(); +} + +function ready(selector, fn) { + var doc = window.document; + var MutationObserver = getMutationObserver(); + + var observer = new MutationObserver(check); + callback = fn; + + observer.observe(doc.documentElement, { + childList: true, + subtree: true, + removedNodes: true + }); +} + +var observer = { isSupported: isSupported, ready: ready }; + +var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +}; + +var createClass = function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; +}(); + +var _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; +}; + +/** + * Device detector + */ + +var fullNameRe = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino/i; +var prefixRe = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i; +var fullNameMobileRe = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i; +var prefixMobileRe = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i; + +function ua() { + return navigator.userAgent || navigator.vendor || window.opera || ''; +} + +var Detector = function () { + function Detector() { + classCallCheck(this, Detector); + } + + createClass(Detector, [{ + key: 'phone', + value: function phone() { + var a = ua(); + return !!(fullNameRe.test(a) || prefixRe.test(a.substr(0, 4))); + } + }, { + key: 'mobile', + value: function mobile() { + var a = ua(); + return !!(fullNameMobileRe.test(a) || prefixMobileRe.test(a.substr(0, 4))); + } + }, { + key: 'tablet', + value: function tablet() { + return this.mobile() && !this.phone(); + } + + // http://browserhacks.com/#hack-acea075d0ac6954f275a70023906050c + + }, { + key: 'ie11', + value: function ie11() { + return '-ms-scroll-limit' in document.documentElement.style && '-ms-ime-align' in document.documentElement.style; + } + }]); + return Detector; +}(); + +var detect = new Detector(); + +/** + * Adds multiple classes on node + * @param {DOMNode} node + * @param {array} classes + */ +var addClasses = function addClasses(node, classes) { + return classes && classes.forEach(function (className) { + return node.classList.add(className); + }); +}; + +/** + * Removes multiple classes from node + * @param {DOMNode} node + * @param {array} classes + */ +var removeClasses = function removeClasses(node, classes) { + return classes && classes.forEach(function (className) { + return node.classList.remove(className); + }); +}; + +var fireEvent = function fireEvent(eventName, data) { + var customEvent = void 0; + + if (detect.ie11()) { + customEvent = document.createEvent('CustomEvent'); + customEvent.initCustomEvent(eventName, true, true, { detail: data }); + } else { + customEvent = new CustomEvent(eventName, { + detail: data + }); + } + + return document.dispatchEvent(customEvent); +}; + +/** + * Set or remove aos-animate class + * @param {node} el element + * @param {int} top scrolled distance + */ +var applyClasses = function applyClasses(el, top) { + var options = el.options, + position = el.position, + node = el.node, + data = el.data; + + + var hide = function hide() { + if (!el.animated) return; + + removeClasses(node, options.animatedClassNames); + fireEvent('aos:out', node); + + if (el.options.id) { + fireEvent('aos:in:' + el.options.id, node); + } + + el.animated = false; + }; + + var show = function show() { + if (el.animated) return; + + addClasses(node, options.animatedClassNames); + + fireEvent('aos:in', node); + if (el.options.id) { + fireEvent('aos:in:' + el.options.id, node); + } + + el.animated = true; + }; + + if (options.mirror && top >= position.out && !options.once) { + hide(); + } else if (top >= position.in) { + show(); + } else if (el.animated && !options.once) { + hide(); + } +}; + +/** + * Scroll logic - add or remove 'aos-animate' class on scroll + * + * @param {array} $elements array of elements nodes + * @return {void} + */ +var handleScroll = function handleScroll($elements) { + return $elements.forEach(function (el, i) { + return applyClasses(el, window.pageYOffset); + }); +}; + +/** + * Get offset of DOM element + * like there were no transforms applied on it + * + * @param {Node} el [DOM element] + * @return {Object} [top and left offset] + */ +var offset = function offset(el) { + var _x = 0; + var _y = 0; + + while (el && !isNaN(el.offsetLeft) && !isNaN(el.offsetTop)) { + _x += el.offsetLeft - (el.tagName != 'BODY' ? el.scrollLeft : 0); + _y += el.offsetTop - (el.tagName != 'BODY' ? el.scrollTop : 0); + el = el.offsetParent; + } + + return { + top: _y, + left: _x + }; +}; + +/** + * Get inline option with a fallback. + * + * @param {Node} el [Dom element] + * @param {String} key [Option key] + * @param {String} fallback [Default (fallback) value] + * @return {Mixed} [Option set with inline attributes or fallback value if not set] + */ + +var getInlineOption = (function (el, key, fallback) { + var attr = el.getAttribute('data-aos-' + key); + + if (typeof attr !== 'undefined') { + if (attr === 'true') { + return true; + } else if (attr === 'false') { + return false; + } + } + + return attr || fallback; +}); + +/** + * Calculate offset + * basing on element's settings like: + * - anchor + * - offset + * + * @param {Node} el [Dom element] + * @return {Integer} [Final offset that will be used to trigger animation in good position] + */ + +var getPositionIn = function getPositionIn(el, defaultOffset, defaultAnchorPlacement) { + var windowHeight = window.innerHeight; + var anchor = getInlineOption(el, 'anchor'); + var inlineAnchorPlacement = getInlineOption(el, 'anchor-placement'); + var additionalOffset = Number(getInlineOption(el, 'offset', inlineAnchorPlacement ? 0 : defaultOffset)); + var anchorPlacement = inlineAnchorPlacement || defaultAnchorPlacement; + var finalEl = el; + + if (anchor && document.querySelectorAll(anchor)) { + finalEl = document.querySelectorAll(anchor)[0]; + } + + var triggerPoint = offset(finalEl).top - windowHeight; + + switch (anchorPlacement) { + case 'top-bottom': + // Default offset + break; + case 'center-bottom': + triggerPoint += finalEl.offsetHeight / 2; + break; + case 'bottom-bottom': + triggerPoint += finalEl.offsetHeight; + break; + case 'top-center': + triggerPoint += windowHeight / 2; + break; + case 'center-center': + triggerPoint += windowHeight / 2 + finalEl.offsetHeight / 2; + break; + case 'bottom-center': + triggerPoint += windowHeight / 2 + finalEl.offsetHeight; + break; + case 'top-top': + triggerPoint += windowHeight; + break; + case 'bottom-top': + triggerPoint += windowHeight + finalEl.offsetHeight; + break; + case 'center-top': + triggerPoint += windowHeight + finalEl.offsetHeight / 2; + break; + } + + return triggerPoint + additionalOffset; +}; + +var getPositionOut = function getPositionOut(el, defaultOffset) { + var windowHeight = window.innerHeight; + var anchor = getInlineOption(el, 'anchor'); + var additionalOffset = getInlineOption(el, 'offset', defaultOffset); + var finalEl = el; + + if (anchor && document.querySelectorAll(anchor)) { + finalEl = document.querySelectorAll(anchor)[0]; + } + + var elementOffsetTop = offset(finalEl).top; + + return elementOffsetTop + finalEl.offsetHeight - additionalOffset; +}; + +/* Clearing variables */ + +var prepare = function prepare($elements, options) { + $elements.forEach(function (el, i) { + var mirror = getInlineOption(el.node, 'mirror', options.mirror); + var once = getInlineOption(el.node, 'once', options.once); + var id = getInlineOption(el.node, 'id'); + var customClassNames = options.useClassNames && el.node.getAttribute('data-aos'); + + var animatedClassNames = [options.animatedClassName].concat(customClassNames ? customClassNames.split(' ') : []).filter(function (className) { + return typeof className === 'string'; + }); + + if (options.initClassName) { + el.node.classList.add(options.initClassName); + } + + el.position = { + in: getPositionIn(el.node, options.offset, options.anchorPlacement), + out: mirror && getPositionOut(el.node, options.offset) + }; + + el.options = { + once: once, + mirror: mirror, + animatedClassNames: animatedClassNames, + id: id + }; + }); + + return $elements; +}; + +/** + * Generate initial array with elements as objects + * This array will be extended later with elements attributes values + * like 'position' + */ +var elements = (function () { + var elements = document.querySelectorAll('[data-aos]'); + return Array.prototype.map.call(elements, function (node) { + return { node: node }; + }); +}); + +/** + * ******************************************************* + * AOS (Animate on scroll) - wowjs alternative + * made to animate elements on scroll in both directions + * ******************************************************* + */ + +/** + * Private variables + */ +var $aosElements = []; +var initialized = false; + +/** + * Default options + */ +var options = { + offset: 120, + delay: 0, + easing: 'ease', + duration: 400, + disable: false, + once: false, + mirror: false, + anchorPlacement: 'top-bottom', + startEvent: 'DOMContentLoaded', + animatedClassName: 'aos-animate', + initClassName: 'aos-init', + useClassNames: false, + disableMutationObserver: false, + throttleDelay: 99, + debounceDelay: 50 +}; + +// Detect not supported browsers (<=IE9) +// http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805 +var isBrowserNotSupported = function isBrowserNotSupported() { + return document.all && !window.atob; +}; + +var initializeScroll = function initializeScroll() { + // Extend elements objects in $aosElements with their positions + $aosElements = prepare($aosElements, options); + // Perform scroll event, to refresh view and show/hide elements + handleScroll($aosElements); + + /** + * Handle scroll event to animate elements on scroll + */ + window.addEventListener('scroll', throttle(function () { + handleScroll($aosElements, options.once); + }, options.throttleDelay)); + + return $aosElements; +}; + +/** + * Refresh AOS + */ +var refresh = function refresh() { + var initialize = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + // Allow refresh only when it was first initialized on startEvent + if (initialize) initialized = true; + if (initialized) initializeScroll(); +}; + +/** + * Hard refresh + * create array with new elements and trigger refresh + */ +var refreshHard = function refreshHard() { + $aosElements = elements(); + + if (isDisabled(options.disable) || isBrowserNotSupported()) { + return disable(); + } + + refresh(); +}; + +/** + * Disable AOS + * Remove all attributes to reset applied styles + */ +var disable = function disable() { + $aosElements.forEach(function (el, i) { + el.node.removeAttribute('data-aos'); + el.node.removeAttribute('data-aos-easing'); + el.node.removeAttribute('data-aos-duration'); + el.node.removeAttribute('data-aos-delay'); + + if (options.initClassName) { + el.node.classList.remove(options.initClassName); + } + + if (options.animatedClassName) { + el.node.classList.remove(options.animatedClassName); + } + }); +}; + +/** + * Check if AOS should be disabled based on provided setting + */ +var isDisabled = function isDisabled(optionDisable) { + return optionDisable === true || optionDisable === 'mobile' && detect.mobile() || optionDisable === 'phone' && detect.phone() || optionDisable === 'tablet' && detect.tablet() || typeof optionDisable === 'function' && optionDisable() === true; +}; + +/** + * Initializing AOS + * - Create options merging defaults with user defined options + * - Set attributes on as global setting - css relies on it + * - Attach preparing elements to options.startEvent, + * window resize and orientation change + * - Attach function that handle scroll and everything connected to it + * to window scroll event and fire once document is ready to set initial state + */ +var init = function init(settings) { + options = _extends(options, settings); + + // Create initial array with elements -> to be fullfilled later with prepare() + $aosElements = elements(); + + /** + * Disable mutation observing if not supported + */ + if (!options.disableMutationObserver && !observer.isSupported()) { + console.info('\n aos: MutationObserver is not supported on this browser,\n code mutations observing has been disabled.\n You may have to call "refreshHard()" by yourself.\n '); + options.disableMutationObserver = true; + } + + /** + * Observe [aos] elements + * If something is loaded by AJAX + * it'll refresh plugin automatically + */ + if (!options.disableMutationObserver) { + observer.ready('[data-aos]', refreshHard); + } + + /** + * Don't init plugin if option `disable` is set + * or when browser is not supported + */ + if (isDisabled(options.disable) || isBrowserNotSupported()) { + return disable(); + } + + /** + * Set global settings on body, based on options + * so CSS can use it + */ + document.querySelector('body').setAttribute('data-aos-easing', options.easing); + + document.querySelector('body').setAttribute('data-aos-duration', options.duration); + + document.querySelector('body').setAttribute('data-aos-delay', options.delay); + + /** + * Handle initializing + */ + if (['DOMContentLoaded', 'load'].indexOf(options.startEvent) === -1) { + // Listen to options.startEvent and initialize AOS + document.addEventListener(options.startEvent, function () { + refresh(true); + }); + } else { + window.addEventListener('load', function () { + refresh(true); + }); + } + + if (options.startEvent === 'DOMContentLoaded' && ['complete', 'interactive'].indexOf(document.readyState) > -1) { + // Initialize AOS if default startEvent was already fired + refresh(true); + } + + /** + * Refresh plugin on window resize or orientation change + */ + window.addEventListener('resize', debounce(refresh, options.debounceDelay, true)); + + window.addEventListener('orientationchange', debounce(refresh, options.debounceDelay, true)); + + return $aosElements; +}; + +/** + * Export Public API + */ + +var aos = { + init: init, + refresh: refresh, + refreshHard: refreshHard +}; + +module.exports = aos; diff --git a/js/aos.esm.js b/js/aos.esm.js new file mode 100644 index 0000000..d5597d4 --- /dev/null +++ b/js/aos.esm.js @@ -0,0 +1,610 @@ +import throttle from 'lodash.throttle'; +import debounce from 'lodash.debounce'; + +var callback = function callback() {}; + +function containsAOSNode(nodes) { + var i = void 0, + currentNode = void 0, + result = void 0; + + for (i = 0; i < nodes.length; i += 1) { + currentNode = nodes[i]; + + if (currentNode.dataset && currentNode.dataset.aos) { + return true; + } + + result = currentNode.children && containsAOSNode(currentNode.children); + + if (result) { + return true; + } + } + + return false; +} + +function check(mutations) { + if (!mutations) return; + + mutations.forEach(function (mutation) { + var addedNodes = Array.prototype.slice.call(mutation.addedNodes); + var removedNodes = Array.prototype.slice.call(mutation.removedNodes); + var allNodes = addedNodes.concat(removedNodes); + + if (containsAOSNode(allNodes)) { + return callback(); + } + }); +} + +function getMutationObserver() { + return window.MutationObserver || window.WebKitMutationObserver || window.MozMutationObserver; +} + +function isSupported() { + return !!getMutationObserver(); +} + +function ready(selector, fn) { + var doc = window.document; + var MutationObserver = getMutationObserver(); + + var observer = new MutationObserver(check); + callback = fn; + + observer.observe(doc.documentElement, { + childList: true, + subtree: true, + removedNodes: true + }); +} + +var observer = { isSupported: isSupported, ready: ready }; + +var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +}; + +var createClass = function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; +}(); + +var _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; +}; + +/** + * Device detector + */ + +var fullNameRe = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino/i; +var prefixRe = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i; +var fullNameMobileRe = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i; +var prefixMobileRe = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i; + +function ua() { + return navigator.userAgent || navigator.vendor || window.opera || ''; +} + +var Detector = function () { + function Detector() { + classCallCheck(this, Detector); + } + + createClass(Detector, [{ + key: 'phone', + value: function phone() { + var a = ua(); + return !!(fullNameRe.test(a) || prefixRe.test(a.substr(0, 4))); + } + }, { + key: 'mobile', + value: function mobile() { + var a = ua(); + return !!(fullNameMobileRe.test(a) || prefixMobileRe.test(a.substr(0, 4))); + } + }, { + key: 'tablet', + value: function tablet() { + return this.mobile() && !this.phone(); + } + + // http://browserhacks.com/#hack-acea075d0ac6954f275a70023906050c + + }, { + key: 'ie11', + value: function ie11() { + return '-ms-scroll-limit' in document.documentElement.style && '-ms-ime-align' in document.documentElement.style; + } + }]); + return Detector; +}(); + +var detect = new Detector(); + +/** + * Adds multiple classes on node + * @param {DOMNode} node + * @param {array} classes + */ +var addClasses = function addClasses(node, classes) { + return classes && classes.forEach(function (className) { + return node.classList.add(className); + }); +}; + +/** + * Removes multiple classes from node + * @param {DOMNode} node + * @param {array} classes + */ +var removeClasses = function removeClasses(node, classes) { + return classes && classes.forEach(function (className) { + return node.classList.remove(className); + }); +}; + +var fireEvent = function fireEvent(eventName, data) { + var customEvent = void 0; + + if (detect.ie11()) { + customEvent = document.createEvent('CustomEvent'); + customEvent.initCustomEvent(eventName, true, true, { detail: data }); + } else { + customEvent = new CustomEvent(eventName, { + detail: data + }); + } + + return document.dispatchEvent(customEvent); +}; + +/** + * Set or remove aos-animate class + * @param {node} el element + * @param {int} top scrolled distance + */ +var applyClasses = function applyClasses(el, top) { + var options = el.options, + position = el.position, + node = el.node, + data = el.data; + + + var hide = function hide() { + if (!el.animated) return; + + removeClasses(node, options.animatedClassNames); + fireEvent('aos:out', node); + + if (el.options.id) { + fireEvent('aos:in:' + el.options.id, node); + } + + el.animated = false; + }; + + var show = function show() { + if (el.animated) return; + + addClasses(node, options.animatedClassNames); + + fireEvent('aos:in', node); + if (el.options.id) { + fireEvent('aos:in:' + el.options.id, node); + } + + el.animated = true; + }; + + if (options.mirror && top >= position.out && !options.once) { + hide(); + } else if (top >= position.in) { + show(); + } else if (el.animated && !options.once) { + hide(); + } +}; + +/** + * Scroll logic - add or remove 'aos-animate' class on scroll + * + * @param {array} $elements array of elements nodes + * @return {void} + */ +var handleScroll = function handleScroll($elements) { + return $elements.forEach(function (el, i) { + return applyClasses(el, window.pageYOffset); + }); +}; + +/** + * Get offset of DOM element + * like there were no transforms applied on it + * + * @param {Node} el [DOM element] + * @return {Object} [top and left offset] + */ +var offset = function offset(el) { + var _x = 0; + var _y = 0; + + while (el && !isNaN(el.offsetLeft) && !isNaN(el.offsetTop)) { + _x += el.offsetLeft - (el.tagName != 'BODY' ? el.scrollLeft : 0); + _y += el.offsetTop - (el.tagName != 'BODY' ? el.scrollTop : 0); + el = el.offsetParent; + } + + return { + top: _y, + left: _x + }; +}; + +/** + * Get inline option with a fallback. + * + * @param {Node} el [Dom element] + * @param {String} key [Option key] + * @param {String} fallback [Default (fallback) value] + * @return {Mixed} [Option set with inline attributes or fallback value if not set] + */ + +var getInlineOption = (function (el, key, fallback) { + var attr = el.getAttribute('data-aos-' + key); + + if (typeof attr !== 'undefined') { + if (attr === 'true') { + return true; + } else if (attr === 'false') { + return false; + } + } + + return attr || fallback; +}); + +/** + * Calculate offset + * basing on element's settings like: + * - anchor + * - offset + * + * @param {Node} el [Dom element] + * @return {Integer} [Final offset that will be used to trigger animation in good position] + */ + +var getPositionIn = function getPositionIn(el, defaultOffset, defaultAnchorPlacement) { + var windowHeight = window.innerHeight; + var anchor = getInlineOption(el, 'anchor'); + var inlineAnchorPlacement = getInlineOption(el, 'anchor-placement'); + var additionalOffset = Number(getInlineOption(el, 'offset', inlineAnchorPlacement ? 0 : defaultOffset)); + var anchorPlacement = inlineAnchorPlacement || defaultAnchorPlacement; + var finalEl = el; + + if (anchor && document.querySelectorAll(anchor)) { + finalEl = document.querySelectorAll(anchor)[0]; + } + + var triggerPoint = offset(finalEl).top - windowHeight; + + switch (anchorPlacement) { + case 'top-bottom': + // Default offset + break; + case 'center-bottom': + triggerPoint += finalEl.offsetHeight / 2; + break; + case 'bottom-bottom': + triggerPoint += finalEl.offsetHeight; + break; + case 'top-center': + triggerPoint += windowHeight / 2; + break; + case 'center-center': + triggerPoint += windowHeight / 2 + finalEl.offsetHeight / 2; + break; + case 'bottom-center': + triggerPoint += windowHeight / 2 + finalEl.offsetHeight; + break; + case 'top-top': + triggerPoint += windowHeight; + break; + case 'bottom-top': + triggerPoint += windowHeight + finalEl.offsetHeight; + break; + case 'center-top': + triggerPoint += windowHeight + finalEl.offsetHeight / 2; + break; + } + + return triggerPoint + additionalOffset; +}; + +var getPositionOut = function getPositionOut(el, defaultOffset) { + var windowHeight = window.innerHeight; + var anchor = getInlineOption(el, 'anchor'); + var additionalOffset = getInlineOption(el, 'offset', defaultOffset); + var finalEl = el; + + if (anchor && document.querySelectorAll(anchor)) { + finalEl = document.querySelectorAll(anchor)[0]; + } + + var elementOffsetTop = offset(finalEl).top; + + return elementOffsetTop + finalEl.offsetHeight - additionalOffset; +}; + +/* Clearing variables */ + +var prepare = function prepare($elements, options) { + $elements.forEach(function (el, i) { + var mirror = getInlineOption(el.node, 'mirror', options.mirror); + var once = getInlineOption(el.node, 'once', options.once); + var id = getInlineOption(el.node, 'id'); + var customClassNames = options.useClassNames && el.node.getAttribute('data-aos'); + + var animatedClassNames = [options.animatedClassName].concat(customClassNames ? customClassNames.split(' ') : []).filter(function (className) { + return typeof className === 'string'; + }); + + if (options.initClassName) { + el.node.classList.add(options.initClassName); + } + + el.position = { + in: getPositionIn(el.node, options.offset, options.anchorPlacement), + out: mirror && getPositionOut(el.node, options.offset) + }; + + el.options = { + once: once, + mirror: mirror, + animatedClassNames: animatedClassNames, + id: id + }; + }); + + return $elements; +}; + +/** + * Generate initial array with elements as objects + * This array will be extended later with elements attributes values + * like 'position' + */ +var elements = (function () { + var elements = document.querySelectorAll('[data-aos]'); + return Array.prototype.map.call(elements, function (node) { + return { node: node }; + }); +}); + +/** + * ******************************************************* + * AOS (Animate on scroll) - wowjs alternative + * made to animate elements on scroll in both directions + * ******************************************************* + */ + +/** + * Private variables + */ +var $aosElements = []; +var initialized = false; + +/** + * Default options + */ +var options = { + offset: 120, + delay: 0, + easing: 'ease', + duration: 400, + disable: false, + once: false, + mirror: false, + anchorPlacement: 'top-bottom', + startEvent: 'DOMContentLoaded', + animatedClassName: 'aos-animate', + initClassName: 'aos-init', + useClassNames: false, + disableMutationObserver: false, + throttleDelay: 99, + debounceDelay: 50 +}; + +// Detect not supported browsers (<=IE9) +// http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805 +var isBrowserNotSupported = function isBrowserNotSupported() { + return document.all && !window.atob; +}; + +var initializeScroll = function initializeScroll() { + // Extend elements objects in $aosElements with their positions + $aosElements = prepare($aosElements, options); + // Perform scroll event, to refresh view and show/hide elements + handleScroll($aosElements); + + /** + * Handle scroll event to animate elements on scroll + */ + window.addEventListener('scroll', throttle(function () { + handleScroll($aosElements, options.once); + }, options.throttleDelay)); + + return $aosElements; +}; + +/** + * Refresh AOS + */ +var refresh = function refresh() { + var initialize = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + // Allow refresh only when it was first initialized on startEvent + if (initialize) initialized = true; + if (initialized) initializeScroll(); +}; + +/** + * Hard refresh + * create array with new elements and trigger refresh + */ +var refreshHard = function refreshHard() { + $aosElements = elements(); + + if (isDisabled(options.disable) || isBrowserNotSupported()) { + return disable(); + } + + refresh(); +}; + +/** + * Disable AOS + * Remove all attributes to reset applied styles + */ +var disable = function disable() { + $aosElements.forEach(function (el, i) { + el.node.removeAttribute('data-aos'); + el.node.removeAttribute('data-aos-easing'); + el.node.removeAttribute('data-aos-duration'); + el.node.removeAttribute('data-aos-delay'); + + if (options.initClassName) { + el.node.classList.remove(options.initClassName); + } + + if (options.animatedClassName) { + el.node.classList.remove(options.animatedClassName); + } + }); +}; + +/** + * Check if AOS should be disabled based on provided setting + */ +var isDisabled = function isDisabled(optionDisable) { + return optionDisable === true || optionDisable === 'mobile' && detect.mobile() || optionDisable === 'phone' && detect.phone() || optionDisable === 'tablet' && detect.tablet() || typeof optionDisable === 'function' && optionDisable() === true; +}; + +/** + * Initializing AOS + * - Create options merging defaults with user defined options + * - Set attributes on as global setting - css relies on it + * - Attach preparing elements to options.startEvent, + * window resize and orientation change + * - Attach function that handle scroll and everything connected to it + * to window scroll event and fire once document is ready to set initial state + */ +var init = function init(settings) { + options = _extends(options, settings); + + // Create initial array with elements -> to be fullfilled later with prepare() + $aosElements = elements(); + + /** + * Disable mutation observing if not supported + */ + if (!options.disableMutationObserver && !observer.isSupported()) { + console.info('\n aos: MutationObserver is not supported on this browser,\n code mutations observing has been disabled.\n You may have to call "refreshHard()" by yourself.\n '); + options.disableMutationObserver = true; + } + + /** + * Observe [aos] elements + * If something is loaded by AJAX + * it'll refresh plugin automatically + */ + if (!options.disableMutationObserver) { + observer.ready('[data-aos]', refreshHard); + } + + /** + * Don't init plugin if option `disable` is set + * or when browser is not supported + */ + if (isDisabled(options.disable) || isBrowserNotSupported()) { + return disable(); + } + + /** + * Set global settings on body, based on options + * so CSS can use it + */ + document.querySelector('body').setAttribute('data-aos-easing', options.easing); + + document.querySelector('body').setAttribute('data-aos-duration', options.duration); + + document.querySelector('body').setAttribute('data-aos-delay', options.delay); + + /** + * Handle initializing + */ + if (['DOMContentLoaded', 'load'].indexOf(options.startEvent) === -1) { + // Listen to options.startEvent and initialize AOS + document.addEventListener(options.startEvent, function () { + refresh(true); + }); + } else { + window.addEventListener('load', function () { + refresh(true); + }); + } + + if (options.startEvent === 'DOMContentLoaded' && ['complete', 'interactive'].indexOf(document.readyState) > -1) { + // Initialize AOS if default startEvent was already fired + refresh(true); + } + + /** + * Refresh plugin on window resize or orientation change + */ + window.addEventListener('resize', debounce(refresh, options.debounceDelay, true)); + + window.addEventListener('orientationchange', debounce(refresh, options.debounceDelay, true)); + + return $aosElements; +}; + +/** + * Export Public API + */ + +var aos = { + init: init, + refresh: refresh, + refreshHard: refreshHard +}; + +export default aos; diff --git a/js/aos.js b/js/aos.js new file mode 100644 index 0000000..74d35d9 --- /dev/null +++ b/js/aos.js @@ -0,0 +1 @@ +!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?module.exports=t():"function"==typeof define&&define.amd?define(t):e.AOS=t()}(this,function(){"use strict";var e="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:{},t="Expected a function",n=NaN,o="[object Symbol]",i=/^\s+|\s+$/g,a=/^[-+]0x[0-9a-f]+$/i,r=/^0b[01]+$/i,c=/^0o[0-7]+$/i,s=parseInt,u="object"==typeof e&&e&&e.Object===Object&&e,d="object"==typeof self&&self&&self.Object===Object&&self,l=u||d||Function("return this")(),f=Object.prototype.toString,m=Math.max,p=Math.min,b=function(){return l.Date.now()};function v(e,n,o){var i,a,r,c,s,u,d=0,l=!1,f=!1,v=!0;if("function"!=typeof e)throw new TypeError(t);function y(t){var n=i,o=a;return i=a=void 0,d=t,c=e.apply(o,n)}function h(e){var t=e-u;return void 0===u||t>=n||t<0||f&&e-d>=r}function k(){var e=b();if(h(e))return x(e);s=setTimeout(k,function(e){var t=n-(e-u);return f?p(t,r-(e-d)):t}(e))}function x(e){return s=void 0,v&&i?y(e):(i=a=void 0,c)}function O(){var e=b(),t=h(e);if(i=arguments,a=this,u=e,t){if(void 0===s)return function(e){return d=e,s=setTimeout(k,n),l?y(e):c}(u);if(f)return s=setTimeout(k,n),y(u)}return void 0===s&&(s=setTimeout(k,n)),c}return n=w(n)||0,g(o)&&(l=!!o.leading,r=(f="maxWait"in o)?m(w(o.maxWait)||0,n):r,v="trailing"in o?!!o.trailing:v),O.cancel=function(){void 0!==s&&clearTimeout(s),d=0,i=u=a=s=void 0},O.flush=function(){return void 0===s?c:x(b())},O}function g(e){var t=typeof e;return!!e&&("object"==t||"function"==t)}function w(e){if("number"==typeof e)return e;if(function(e){return"symbol"==typeof e||function(e){return!!e&&"object"==typeof e}(e)&&f.call(e)==o}(e))return n;if(g(e)){var t="function"==typeof e.valueOf?e.valueOf():e;e=g(t)?t+"":t}if("string"!=typeof e)return 0===e?e:+e;e=e.replace(i,"");var u=r.test(e);return u||c.test(e)?s(e.slice(2),u?2:8):a.test(e)?n:+e}var y=function(e,n,o){var i=!0,a=!0;if("function"!=typeof e)throw new TypeError(t);return g(o)&&(i="leading"in o?!!o.leading:i,a="trailing"in o?!!o.trailing:a),v(e,n,{leading:i,maxWait:n,trailing:a})},h="Expected a function",k=NaN,x="[object Symbol]",O=/^\s+|\s+$/g,j=/^[-+]0x[0-9a-f]+$/i,E=/^0b[01]+$/i,N=/^0o[0-7]+$/i,z=parseInt,C="object"==typeof e&&e&&e.Object===Object&&e,A="object"==typeof self&&self&&self.Object===Object&&self,q=C||A||Function("return this")(),L=Object.prototype.toString,T=Math.max,M=Math.min,S=function(){return q.Date.now()};function D(e){var t=typeof e;return!!e&&("object"==t||"function"==t)}function H(e){if("number"==typeof e)return e;if(function(e){return"symbol"==typeof e||function(e){return!!e&&"object"==typeof e}(e)&&L.call(e)==x}(e))return k;if(D(e)){var t="function"==typeof e.valueOf?e.valueOf():e;e=D(t)?t+"":t}if("string"!=typeof e)return 0===e?e:+e;e=e.replace(O,"");var n=E.test(e);return n||N.test(e)?z(e.slice(2),n?2:8):j.test(e)?k:+e}var $=function(e,t,n){var o,i,a,r,c,s,u=0,d=!1,l=!1,f=!0;if("function"!=typeof e)throw new TypeError(h);function m(t){var n=o,a=i;return o=i=void 0,u=t,r=e.apply(a,n)}function p(e){var n=e-s;return void 0===s||n>=t||n<0||l&&e-u>=a}function b(){var e=S();if(p(e))return v(e);c=setTimeout(b,function(e){var n=t-(e-s);return l?M(n,a-(e-u)):n}(e))}function v(e){return c=void 0,f&&o?m(e):(o=i=void 0,r)}function g(){var e=S(),n=p(e);if(o=arguments,i=this,s=e,n){if(void 0===c)return function(e){return u=e,c=setTimeout(b,t),d?m(e):r}(s);if(l)return c=setTimeout(b,t),m(s)}return void 0===c&&(c=setTimeout(b,t)),r}return t=H(t)||0,D(n)&&(d=!!n.leading,a=(l="maxWait"in n)?T(H(n.maxWait)||0,t):a,f="trailing"in n?!!n.trailing:f),g.cancel=function(){void 0!==c&&clearTimeout(c),u=0,o=s=i=c=void 0},g.flush=function(){return void 0===c?r:v(S())},g},W=function(){};function P(e){e&&e.forEach(function(e){var t=Array.prototype.slice.call(e.addedNodes),n=Array.prototype.slice.call(e.removedNodes);if(function e(t){var n=void 0,o=void 0;for(n=0;n=o.out&&!n.once?a():t>=o.in?e.animated||(function(e,t){t&&t.forEach(function(t){return e.classList.add(t)})}(i,n.animatedClassNames),V("aos:in",i),e.options.id&&V("aos:in:"+e.options.id,i),e.animated=!0):e.animated&&!n.once&&a()}(e,window.pageYOffset)})},Z=function(e){for(var t=0,n=0;e&&!isNaN(e.offsetLeft)&&!isNaN(e.offsetTop);)t+=e.offsetLeft-("BODY"!=e.tagName?e.scrollLeft:0),n+=e.offsetTop-("BODY"!=e.tagName?e.scrollTop:0),e=e.offsetParent;return{top:n,left:t}},ee=function(e,t,n){var o=e.getAttribute("data-aos-"+t);if(void 0!==o){if("true"===o)return!0;if("false"===o)return!1}return o||n},te=function(e,t){return e.forEach(function(e,n){var o=ee(e.node,"mirror",t.mirror),i=ee(e.node,"once",t.once),a=ee(e.node,"id"),r=t.useClassNames&&e.node.getAttribute("data-aos"),c=[t.animatedClassName].concat(r?r.split(" "):[]).filter(function(e){return"string"==typeof e});t.initClassName&&e.node.classList.add(t.initClassName),e.position={in:function(e,t,n){var o=window.innerHeight,i=ee(e,"anchor"),a=ee(e,"anchor-placement"),r=Number(ee(e,"offset",a?0:t)),c=a||n,s=e;i&&document.querySelectorAll(i)&&(s=document.querySelectorAll(i)[0]);var u=Z(s).top-o;switch(c){case"top-bottom":break;case"center-bottom":u+=s.offsetHeight/2;break;case"bottom-bottom":u+=s.offsetHeight;break;case"top-center":u+=o/2;break;case"center-center":u+=o/2+s.offsetHeight/2;break;case"bottom-center":u+=o/2+s.offsetHeight;break;case"top-top":u+=o;break;case"bottom-top":u+=o+s.offsetHeight;break;case"center-top":u+=o+s.offsetHeight/2}return u+r}(e.node,t.offset,t.anchorPlacement),out:o&&function(e,t){window.innerHeight;var n=ee(e,"anchor"),o=ee(e,"offset",t),i=e;return n&&document.querySelectorAll(n)&&(i=document.querySelectorAll(n)[0]),Z(i).top+i.offsetHeight-o}(e.node,t.offset)},e.options={once:i,mirror:o,animatedClassNames:c,id:a}}),e},ne=function(){var e=document.querySelectorAll("[data-aos]");return Array.prototype.map.call(e,function(e){return{node:e}})},oe=[],ie=!1,ae={offset:120,delay:0,easing:"ease",duration:400,disable:!1,once:!1,mirror:!1,anchorPlacement:"top-bottom",startEvent:"DOMContentLoaded",animatedClassName:"aos-animate",initClassName:"aos-init",useClassNames:!1,disableMutationObserver:!1,throttleDelay:99,debounceDelay:50},re=function(){return document.all&&!window.atob},ce=function(){arguments.length>0&&void 0!==arguments[0]&&arguments[0]&&(ie=!0),ie&&(oe=te(oe,ae),X(oe),window.addEventListener("scroll",y(function(){X(oe,ae.once)},ae.throttleDelay)))},se=function(){if(oe=ne(),de(ae.disable)||re())return ue();ce()},ue=function(){oe.forEach(function(e,t){e.node.removeAttribute("data-aos"),e.node.removeAttribute("data-aos-easing"),e.node.removeAttribute("data-aos-duration"),e.node.removeAttribute("data-aos-delay"),ae.initClassName&&e.node.classList.remove(ae.initClassName),ae.animatedClassName&&e.node.classList.remove(ae.animatedClassName)})},de=function(e){return!0===e||"mobile"===e&&U.mobile()||"phone"===e&&U.phone()||"tablet"===e&&U.tablet()||"function"==typeof e&&!0===e()};return{init:function(e){return ae=I(ae,e),oe=ne(),ae.disableMutationObserver||_.isSupported()||(console.info('\n aos: MutationObserver is not supported on this browser,\n code mutations observing has been disabled.\n You may have to call "refreshHard()" by yourself.\n '),ae.disableMutationObserver=!0),ae.disableMutationObserver||_.ready("[data-aos]",se),de(ae.disable)||re()?ue():(document.querySelector("body").setAttribute("data-aos-easing",ae.easing),document.querySelector("body").setAttribute("data-aos-duration",ae.duration),document.querySelector("body").setAttribute("data-aos-delay",ae.delay),-1===["DOMContentLoaded","load"].indexOf(ae.startEvent)?document.addEventListener(ae.startEvent,function(){ce(!0)}):window.addEventListener("load",function(){ce(!0)}),"DOMContentLoaded"===ae.startEvent&&["complete","interactive"].indexOf(document.readyState)>-1&&ce(!0),window.addEventListener("resize",$(ce,ae.debounceDelay,!0)),window.addEventListener("orientationchange",$(ce,ae.debounceDelay,!0)),oe)},refresh:ce,refreshHard:se}}); diff --git a/js/bootstrap.bundle.js b/js/bootstrap.bundle.js new file mode 100644 index 0000000..3412717 --- /dev/null +++ b/js/bootstrap.bundle.js @@ -0,0 +1,7090 @@ +/*! + * Bootstrap v5.2.1 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() : + typeof define === 'function' && define.amd ? define(factory) : + (global = typeof globalThis !== 'undefined' ? globalThis : global || self, global.bootstrap = factory()); +})(this, (function () { 'use strict'; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/index.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + const MAX_UID = 1000000; + const MILLISECONDS_MULTIPLIER = 1000; + const TRANSITION_END = 'transitionend'; // Shout-out Angus Croll (https://goo.gl/pxwQGp) + + const toType = object => { + if (object === null || object === undefined) { + return `${object}`; + } + + return Object.prototype.toString.call(object).match(/\s([a-z]+)/i)[1].toLowerCase(); + }; + /** + * Public Util API + */ + + + const getUID = prefix => { + do { + prefix += Math.floor(Math.random() * MAX_UID); + } while (document.getElementById(prefix)); + + return prefix; + }; + + const getSelector = element => { + let selector = element.getAttribute('data-bs-target'); + + if (!selector || selector === '#') { + let hrefAttribute = element.getAttribute('href'); // The only valid content that could double as a selector are IDs or classes, + // so everything starting with `#` or `.`. If a "real" URL is used as the selector, + // `document.querySelector` will rightfully complain it is invalid. + // See https://github.com/twbs/bootstrap/issues/32273 + + if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) { + return null; + } // Just in case some CMS puts out a full URL with the anchor appended + + + if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) { + hrefAttribute = `#${hrefAttribute.split('#')[1]}`; + } + + selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null; + } + + return selector; + }; + + const getSelectorFromElement = element => { + const selector = getSelector(element); + + if (selector) { + return document.querySelector(selector) ? selector : null; + } + + return null; + }; + + const getElementFromSelector = element => { + const selector = getSelector(element); + return selector ? document.querySelector(selector) : null; + }; + + const getTransitionDurationFromElement = element => { + if (!element) { + return 0; + } // Get transition-duration of the element + + + let { + transitionDuration, + transitionDelay + } = window.getComputedStyle(element); + const floatTransitionDuration = Number.parseFloat(transitionDuration); + const floatTransitionDelay = Number.parseFloat(transitionDelay); // Return 0 if element or transition duration is not found + + if (!floatTransitionDuration && !floatTransitionDelay) { + return 0; + } // If multiple durations are defined, take the first + + + transitionDuration = transitionDuration.split(',')[0]; + transitionDelay = transitionDelay.split(',')[0]; + return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER; + }; + + const triggerTransitionEnd = element => { + element.dispatchEvent(new Event(TRANSITION_END)); + }; + + const isElement$1 = object => { + if (!object || typeof object !== 'object') { + return false; + } + + if (typeof object.jquery !== 'undefined') { + object = object[0]; + } + + return typeof object.nodeType !== 'undefined'; + }; + + const getElement = object => { + // it's a jQuery object or a node element + if (isElement$1(object)) { + return object.jquery ? object[0] : object; + } + + if (typeof object === 'string' && object.length > 0) { + return document.querySelector(object); + } + + return null; + }; + + const isVisible = element => { + if (!isElement$1(element) || element.getClientRects().length === 0) { + return false; + } + + const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible'; // Handle `details` element as its content may falsie appear visible when it is closed + + const closedDetails = element.closest('details:not([open])'); + + if (!closedDetails) { + return elementIsVisible; + } + + if (closedDetails !== element) { + const summary = element.closest('summary'); + + if (summary && summary.parentNode !== closedDetails) { + return false; + } + + if (summary === null) { + return false; + } + } + + return elementIsVisible; + }; + + const isDisabled = element => { + if (!element || element.nodeType !== Node.ELEMENT_NODE) { + return true; + } + + if (element.classList.contains('disabled')) { + return true; + } + + if (typeof element.disabled !== 'undefined') { + return element.disabled; + } + + return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false'; + }; + + const findShadowRoot = element => { + if (!document.documentElement.attachShadow) { + return null; + } // Can find the shadow root otherwise it'll return the document + + + if (typeof element.getRootNode === 'function') { + const root = element.getRootNode(); + return root instanceof ShadowRoot ? root : null; + } + + if (element instanceof ShadowRoot) { + return element; + } // when we don't find a shadow root + + + if (!element.parentNode) { + return null; + } + + return findShadowRoot(element.parentNode); + }; + + const noop = () => {}; + /** + * Trick to restart an element's animation + * + * @param {HTMLElement} element + * @return void + * + * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation + */ + + + const reflow = element => { + element.offsetHeight; // eslint-disable-line no-unused-expressions + }; + + const getjQuery = () => { + if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) { + return window.jQuery; + } + + return null; + }; + + const DOMContentLoadedCallbacks = []; + + const onDOMContentLoaded = callback => { + if (document.readyState === 'loading') { + // add listener on the first call when the document is in loading state + if (!DOMContentLoadedCallbacks.length) { + document.addEventListener('DOMContentLoaded', () => { + for (const callback of DOMContentLoadedCallbacks) { + callback(); + } + }); + } + + DOMContentLoadedCallbacks.push(callback); + } else { + callback(); + } + }; + + const isRTL = () => document.documentElement.dir === 'rtl'; + + const defineJQueryPlugin = plugin => { + onDOMContentLoaded(() => { + const $ = getjQuery(); + /* istanbul ignore if */ + + if ($) { + const name = plugin.NAME; + const JQUERY_NO_CONFLICT = $.fn[name]; + $.fn[name] = plugin.jQueryInterface; + $.fn[name].Constructor = plugin; + + $.fn[name].noConflict = () => { + $.fn[name] = JQUERY_NO_CONFLICT; + return plugin.jQueryInterface; + }; + } + }); + }; + + const execute = callback => { + if (typeof callback === 'function') { + callback(); + } + }; + + const executeAfterTransition = (callback, transitionElement, waitForTransition = true) => { + if (!waitForTransition) { + execute(callback); + return; + } + + const durationPadding = 5; + const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding; + let called = false; + + const handler = ({ + target + }) => { + if (target !== transitionElement) { + return; + } + + called = true; + transitionElement.removeEventListener(TRANSITION_END, handler); + execute(callback); + }; + + transitionElement.addEventListener(TRANSITION_END, handler); + setTimeout(() => { + if (!called) { + triggerTransitionEnd(transitionElement); + } + }, emulatedDuration); + }; + /** + * Return the previous/next element of a list. + * + * @param {array} list The list of elements + * @param activeElement The active element + * @param shouldGetNext Choose to get next or previous element + * @param isCycleAllowed + * @return {Element|elem} The proper element + */ + + + const getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => { + const listLength = list.length; + let index = list.indexOf(activeElement); // if the element does not exist in the list return an element + // depending on the direction and if cycle is allowed + + if (index === -1) { + return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0]; + } + + index += shouldGetNext ? 1 : -1; + + if (isCycleAllowed) { + index = (index + listLength) % listLength; + } + + return list[Math.max(0, Math.min(index, listLength - 1))]; + }; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): dom/event-handler.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const namespaceRegex = /[^.]*(?=\..*)\.|.*/; + const stripNameRegex = /\..*/; + const stripUidRegex = /::\d+$/; + const eventRegistry = {}; // Events storage + + let uidEvent = 1; + const customEvents = { + mouseenter: 'mouseover', + mouseleave: 'mouseout' + }; + const nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']); + /** + * Private methods + */ + + function makeEventUid(element, uid) { + return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++; + } + + function getElementEvents(element) { + const uid = makeEventUid(element); + element.uidEvent = uid; + eventRegistry[uid] = eventRegistry[uid] || {}; + return eventRegistry[uid]; + } + + function bootstrapHandler(element, fn) { + return function handler(event) { + hydrateObj(event, { + delegateTarget: element + }); + + if (handler.oneOff) { + EventHandler.off(element, event.type, fn); + } + + return fn.apply(element, [event]); + }; + } + + function bootstrapDelegationHandler(element, selector, fn) { + return function handler(event) { + const domElements = element.querySelectorAll(selector); + + for (let { + target + } = event; target && target !== this; target = target.parentNode) { + for (const domElement of domElements) { + if (domElement !== target) { + continue; + } + + hydrateObj(event, { + delegateTarget: target + }); + + if (handler.oneOff) { + EventHandler.off(element, event.type, selector, fn); + } + + return fn.apply(target, [event]); + } + } + }; + } + + function findHandler(events, callable, delegationSelector = null) { + return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector); + } + + function normalizeParameters(originalTypeEvent, handler, delegationFunction) { + const isDelegated = typeof handler === 'string'; // todo: tooltip passes `false` instead of selector, so we need to check + + const callable = isDelegated ? delegationFunction : handler || delegationFunction; + let typeEvent = getTypeEvent(originalTypeEvent); + + if (!nativeEvents.has(typeEvent)) { + typeEvent = originalTypeEvent; + } + + return [isDelegated, callable, typeEvent]; + } + + function addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) { + if (typeof originalTypeEvent !== 'string' || !element) { + return; + } + + let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction); // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position + // this prevents the handler from being dispatched the same way as mouseover or mouseout does + + if (originalTypeEvent in customEvents) { + const wrapFunction = fn => { + return function (event) { + if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) { + return fn.call(this, event); + } + }; + }; + + callable = wrapFunction(callable); + } + + const events = getElementEvents(element); + const handlers = events[typeEvent] || (events[typeEvent] = {}); + const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null); + + if (previousFunction) { + previousFunction.oneOff = previousFunction.oneOff && oneOff; + return; + } + + const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, '')); + const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable); + fn.delegationSelector = isDelegated ? handler : null; + fn.callable = callable; + fn.oneOff = oneOff; + fn.uidEvent = uid; + handlers[uid] = fn; + element.addEventListener(typeEvent, fn, isDelegated); + } + + function removeHandler(element, events, typeEvent, handler, delegationSelector) { + const fn = findHandler(events[typeEvent], handler, delegationSelector); + + if (!fn) { + return; + } + + element.removeEventListener(typeEvent, fn, Boolean(delegationSelector)); + delete events[typeEvent][fn.uidEvent]; + } + + function removeNamespacedHandlers(element, events, typeEvent, namespace) { + const storeElementEvent = events[typeEvent] || {}; + + for (const handlerKey of Object.keys(storeElementEvent)) { + if (handlerKey.includes(namespace)) { + const event = storeElementEvent[handlerKey]; + removeHandler(element, events, typeEvent, event.callable, event.delegationSelector); + } + } + } + + function getTypeEvent(event) { + // allow to get the native events from namespaced events ('click.bs.button' --> 'click') + event = event.replace(stripNameRegex, ''); + return customEvents[event] || event; + } + + const EventHandler = { + on(element, event, handler, delegationFunction) { + addHandler(element, event, handler, delegationFunction, false); + }, + + one(element, event, handler, delegationFunction) { + addHandler(element, event, handler, delegationFunction, true); + }, + + off(element, originalTypeEvent, handler, delegationFunction) { + if (typeof originalTypeEvent !== 'string' || !element) { + return; + } + + const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction); + const inNamespace = typeEvent !== originalTypeEvent; + const events = getElementEvents(element); + const storeElementEvent = events[typeEvent] || {}; + const isNamespace = originalTypeEvent.startsWith('.'); + + if (typeof callable !== 'undefined') { + // Simplest case: handler is passed, remove that listener ONLY. + if (!Object.keys(storeElementEvent).length) { + return; + } + + removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null); + return; + } + + if (isNamespace) { + for (const elementEvent of Object.keys(events)) { + removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1)); + } + } + + for (const keyHandlers of Object.keys(storeElementEvent)) { + const handlerKey = keyHandlers.replace(stripUidRegex, ''); + + if (!inNamespace || originalTypeEvent.includes(handlerKey)) { + const event = storeElementEvent[keyHandlers]; + removeHandler(element, events, typeEvent, event.callable, event.delegationSelector); + } + } + }, + + trigger(element, event, args) { + if (typeof event !== 'string' || !element) { + return null; + } + + const $ = getjQuery(); + const typeEvent = getTypeEvent(event); + const inNamespace = event !== typeEvent; + let jQueryEvent = null; + let bubbles = true; + let nativeDispatch = true; + let defaultPrevented = false; + + if (inNamespace && $) { + jQueryEvent = $.Event(event, args); + $(element).trigger(jQueryEvent); + bubbles = !jQueryEvent.isPropagationStopped(); + nativeDispatch = !jQueryEvent.isImmediatePropagationStopped(); + defaultPrevented = jQueryEvent.isDefaultPrevented(); + } + + let evt = new Event(event, { + bubbles, + cancelable: true + }); + evt = hydrateObj(evt, args); + + if (defaultPrevented) { + evt.preventDefault(); + } + + if (nativeDispatch) { + element.dispatchEvent(evt); + } + + if (evt.defaultPrevented && jQueryEvent) { + jQueryEvent.preventDefault(); + } + + return evt; + } + + }; + + function hydrateObj(obj, meta) { + for (const [key, value] of Object.entries(meta || {})) { + try { + obj[key] = value; + } catch (_unused) { + Object.defineProperty(obj, key, { + configurable: true, + + get() { + return value; + } + + }); + } + } + + return obj; + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): dom/data.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + + /** + * Constants + */ + const elementMap = new Map(); + const Data = { + set(element, key, instance) { + if (!elementMap.has(element)) { + elementMap.set(element, new Map()); + } + + const instanceMap = elementMap.get(element); // make it clear we only want one instance per element + // can be removed later when multiple key/instances are fine to be used + + if (!instanceMap.has(key) && instanceMap.size !== 0) { + // eslint-disable-next-line no-console + console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`); + return; + } + + instanceMap.set(key, instance); + }, + + get(element, key) { + if (elementMap.has(element)) { + return elementMap.get(element).get(key) || null; + } + + return null; + }, + + remove(element, key) { + if (!elementMap.has(element)) { + return; + } + + const instanceMap = elementMap.get(element); + instanceMap.delete(key); // free up element references if there are no instances left for an element + + if (instanceMap.size === 0) { + elementMap.delete(element); + } + } + + }; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): dom/manipulator.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + function normalizeData(value) { + if (value === 'true') { + return true; + } + + if (value === 'false') { + return false; + } + + if (value === Number(value).toString()) { + return Number(value); + } + + if (value === '' || value === 'null') { + return null; + } + + if (typeof value !== 'string') { + return value; + } + + try { + return JSON.parse(decodeURIComponent(value)); + } catch (_unused) { + return value; + } + } + + function normalizeDataKey(key) { + return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`); + } + + const Manipulator = { + setDataAttribute(element, key, value) { + element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value); + }, + + removeDataAttribute(element, key) { + element.removeAttribute(`data-bs-${normalizeDataKey(key)}`); + }, + + getDataAttributes(element) { + if (!element) { + return {}; + } + + const attributes = {}; + const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig')); + + for (const key of bsKeys) { + let pureKey = key.replace(/^bs/, ''); + pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length); + attributes[pureKey] = normalizeData(element.dataset[key]); + } + + return attributes; + }, + + getDataAttribute(element, key) { + return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`)); + } + + }; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/config.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Class definition + */ + + class Config { + // Getters + static get Default() { + return {}; + } + + static get DefaultType() { + return {}; + } + + static get NAME() { + throw new Error('You have to implement the static method "NAME", for each component!'); + } + + _getConfig(config) { + config = this._mergeConfigObj(config); + config = this._configAfterMerge(config); + + this._typeCheckConfig(config); + + return config; + } + + _configAfterMerge(config) { + return config; + } + + _mergeConfigObj(config, element) { + const jsonConfig = isElement$1(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse + + return { ...this.constructor.Default, + ...(typeof jsonConfig === 'object' ? jsonConfig : {}), + ...(isElement$1(element) ? Manipulator.getDataAttributes(element) : {}), + ...(typeof config === 'object' ? config : {}) + }; + } + + _typeCheckConfig(config, configTypes = this.constructor.DefaultType) { + for (const property of Object.keys(configTypes)) { + const expectedTypes = configTypes[property]; + const value = config[property]; + const valueType = isElement$1(value) ? 'element' : toType(value); + + if (!new RegExp(expectedTypes).test(valueType)) { + throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${property}" provided type "${valueType}" but expected type "${expectedTypes}".`); + } + } + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): base-component.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const VERSION = '5.2.1'; + /** + * Class definition + */ + + class BaseComponent extends Config { + constructor(element, config) { + super(); + element = getElement(element); + + if (!element) { + return; + } + + this._element = element; + this._config = this._getConfig(config); + Data.set(this._element, this.constructor.DATA_KEY, this); + } // Public + + + dispose() { + Data.remove(this._element, this.constructor.DATA_KEY); + EventHandler.off(this._element, this.constructor.EVENT_KEY); + + for (const propertyName of Object.getOwnPropertyNames(this)) { + this[propertyName] = null; + } + } + + _queueCallback(callback, element, isAnimated = true) { + executeAfterTransition(callback, element, isAnimated); + } + + _getConfig(config) { + config = this._mergeConfigObj(config, this._element); + config = this._configAfterMerge(config); + + this._typeCheckConfig(config); + + return config; + } // Static + + + static getInstance(element) { + return Data.get(getElement(element), this.DATA_KEY); + } + + static getOrCreateInstance(element, config = {}) { + return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null); + } + + static get VERSION() { + return VERSION; + } + + static get DATA_KEY() { + return `bs.${this.NAME}`; + } + + static get EVENT_KEY() { + return `.${this.DATA_KEY}`; + } + + static eventName(name) { + return `${name}${this.EVENT_KEY}`; + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/component-functions.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + + const enableDismissTrigger = (component, method = 'hide') => { + const clickEvent = `click.dismiss${component.EVENT_KEY}`; + const name = component.NAME; + EventHandler.on(document, clickEvent, `[data-bs-dismiss="${name}"]`, function (event) { + if (['A', 'AREA'].includes(this.tagName)) { + event.preventDefault(); + } + + if (isDisabled(this)) { + return; + } + + const target = getElementFromSelector(this) || this.closest(`.${name}`); + const instance = component.getOrCreateInstance(target); // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method + + instance[method](); + }); + }; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): alert.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$f = 'alert'; + const DATA_KEY$a = 'bs.alert'; + const EVENT_KEY$b = `.${DATA_KEY$a}`; + const EVENT_CLOSE = `close${EVENT_KEY$b}`; + const EVENT_CLOSED = `closed${EVENT_KEY$b}`; + const CLASS_NAME_FADE$5 = 'fade'; + const CLASS_NAME_SHOW$8 = 'show'; + /** + * Class definition + */ + + class Alert extends BaseComponent { + // Getters + static get NAME() { + return NAME$f; + } // Public + + + close() { + const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE); + + if (closeEvent.defaultPrevented) { + return; + } + + this._element.classList.remove(CLASS_NAME_SHOW$8); + + const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5); + + this._queueCallback(() => this._destroyElement(), this._element, isAnimated); + } // Private + + + _destroyElement() { + this._element.remove(); + + EventHandler.trigger(this._element, EVENT_CLOSED); + this.dispose(); + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Alert.getOrCreateInstance(this); + + if (typeof config !== 'string') { + return; + } + + if (data[config] === undefined || config.startsWith('_') || config === 'constructor') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](this); + }); + } + + } + /** + * Data API implementation + */ + + + enableDismissTrigger(Alert, 'close'); + /** + * jQuery + */ + + defineJQueryPlugin(Alert); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): button.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$e = 'button'; + const DATA_KEY$9 = 'bs.button'; + const EVENT_KEY$a = `.${DATA_KEY$9}`; + const DATA_API_KEY$6 = '.data-api'; + const CLASS_NAME_ACTIVE$3 = 'active'; + const SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle="button"]'; + const EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`; + /** + * Class definition + */ + + class Button extends BaseComponent { + // Getters + static get NAME() { + return NAME$e; + } // Public + + + toggle() { + // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method + this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3)); + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Button.getOrCreateInstance(this); + + if (config === 'toggle') { + data[config](); + } + }); + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => { + event.preventDefault(); + const button = event.target.closest(SELECTOR_DATA_TOGGLE$5); + const data = Button.getOrCreateInstance(button); + data.toggle(); + }); + /** + * jQuery + */ + + defineJQueryPlugin(Button); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): dom/selector-engine.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const SelectorEngine = { + find(selector, element = document.documentElement) { + return [].concat(...Element.prototype.querySelectorAll.call(element, selector)); + }, + + findOne(selector, element = document.documentElement) { + return Element.prototype.querySelector.call(element, selector); + }, + + children(element, selector) { + return [].concat(...element.children).filter(child => child.matches(selector)); + }, + + parents(element, selector) { + const parents = []; + let ancestor = element.parentNode.closest(selector); + + while (ancestor) { + parents.push(ancestor); + ancestor = ancestor.parentNode.closest(selector); + } + + return parents; + }, + + prev(element, selector) { + let previous = element.previousElementSibling; + + while (previous) { + if (previous.matches(selector)) { + return [previous]; + } + + previous = previous.previousElementSibling; + } + + return []; + }, + + // TODO: this is now unused; remove later along with prev() + next(element, selector) { + let next = element.nextElementSibling; + + while (next) { + if (next.matches(selector)) { + return [next]; + } + + next = next.nextElementSibling; + } + + return []; + }, + + focusableChildren(element) { + const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable="true"]'].map(selector => `${selector}:not([tabindex^="-"])`).join(','); + return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el)); + } + + }; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/swipe.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$d = 'swipe'; + const EVENT_KEY$9 = '.bs.swipe'; + const EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`; + const EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`; + const EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`; + const EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`; + const EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`; + const POINTER_TYPE_TOUCH = 'touch'; + const POINTER_TYPE_PEN = 'pen'; + const CLASS_NAME_POINTER_EVENT = 'pointer-event'; + const SWIPE_THRESHOLD = 40; + const Default$c = { + endCallback: null, + leftCallback: null, + rightCallback: null + }; + const DefaultType$c = { + endCallback: '(function|null)', + leftCallback: '(function|null)', + rightCallback: '(function|null)' + }; + /** + * Class definition + */ + + class Swipe extends Config { + constructor(element, config) { + super(); + this._element = element; + + if (!element || !Swipe.isSupported()) { + return; + } + + this._config = this._getConfig(config); + this._deltaX = 0; + this._supportPointerEvents = Boolean(window.PointerEvent); + + this._initEvents(); + } // Getters + + + static get Default() { + return Default$c; + } + + static get DefaultType() { + return DefaultType$c; + } + + static get NAME() { + return NAME$d; + } // Public + + + dispose() { + EventHandler.off(this._element, EVENT_KEY$9); + } // Private + + + _start(event) { + if (!this._supportPointerEvents) { + this._deltaX = event.touches[0].clientX; + return; + } + + if (this._eventIsPointerPenTouch(event)) { + this._deltaX = event.clientX; + } + } + + _end(event) { + if (this._eventIsPointerPenTouch(event)) { + this._deltaX = event.clientX - this._deltaX; + } + + this._handleSwipe(); + + execute(this._config.endCallback); + } + + _move(event) { + this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX; + } + + _handleSwipe() { + const absDeltaX = Math.abs(this._deltaX); + + if (absDeltaX <= SWIPE_THRESHOLD) { + return; + } + + const direction = absDeltaX / this._deltaX; + this._deltaX = 0; + + if (!direction) { + return; + } + + execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback); + } + + _initEvents() { + if (this._supportPointerEvents) { + EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event)); + EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event)); + + this._element.classList.add(CLASS_NAME_POINTER_EVENT); + } else { + EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event)); + EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event)); + EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event)); + } + } + + _eventIsPointerPenTouch(event) { + return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH); + } // Static + + + static isSupported() { + return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0; + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): carousel.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$c = 'carousel'; + const DATA_KEY$8 = 'bs.carousel'; + const EVENT_KEY$8 = `.${DATA_KEY$8}`; + const DATA_API_KEY$5 = '.data-api'; + const ARROW_LEFT_KEY$1 = 'ArrowLeft'; + const ARROW_RIGHT_KEY$1 = 'ArrowRight'; + const TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch + + const ORDER_NEXT = 'next'; + const ORDER_PREV = 'prev'; + const DIRECTION_LEFT = 'left'; + const DIRECTION_RIGHT = 'right'; + const EVENT_SLIDE = `slide${EVENT_KEY$8}`; + const EVENT_SLID = `slid${EVENT_KEY$8}`; + const EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`; + const EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`; + const EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`; + const EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`; + const EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`; + const EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`; + const CLASS_NAME_CAROUSEL = 'carousel'; + const CLASS_NAME_ACTIVE$2 = 'active'; + const CLASS_NAME_SLIDE = 'slide'; + const CLASS_NAME_END = 'carousel-item-end'; + const CLASS_NAME_START = 'carousel-item-start'; + const CLASS_NAME_NEXT = 'carousel-item-next'; + const CLASS_NAME_PREV = 'carousel-item-prev'; + const SELECTOR_ACTIVE = '.active'; + const SELECTOR_ITEM = '.carousel-item'; + const SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM; + const SELECTOR_ITEM_IMG = '.carousel-item img'; + const SELECTOR_INDICATORS = '.carousel-indicators'; + const SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]'; + const SELECTOR_DATA_RIDE = '[data-bs-ride="carousel"]'; + const KEY_TO_DIRECTION = { + [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT, + [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT + }; + const Default$b = { + interval: 5000, + keyboard: true, + pause: 'hover', + ride: false, + touch: true, + wrap: true + }; + const DefaultType$b = { + interval: '(number|boolean)', + // TODO:v6 remove boolean support + keyboard: 'boolean', + pause: '(string|boolean)', + ride: '(boolean|string)', + touch: 'boolean', + wrap: 'boolean' + }; + /** + * Class definition + */ + + class Carousel extends BaseComponent { + constructor(element, config) { + super(element, config); + this._interval = null; + this._activeElement = null; + this._isSliding = false; + this.touchTimeout = null; + this._swipeHelper = null; + this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element); + + this._addEventListeners(); + + if (this._config.ride === CLASS_NAME_CAROUSEL) { + this.cycle(); + } + } // Getters + + + static get Default() { + return Default$b; + } + + static get DefaultType() { + return DefaultType$b; + } + + static get NAME() { + return NAME$c; + } // Public + + + next() { + this._slide(ORDER_NEXT); + } + + nextWhenVisible() { + // FIXME TODO use `document.visibilityState` + // Don't call next when the page isn't visible + // or the carousel or its parent isn't visible + if (!document.hidden && isVisible(this._element)) { + this.next(); + } + } + + prev() { + this._slide(ORDER_PREV); + } + + pause() { + if (this._isSliding) { + triggerTransitionEnd(this._element); + } + + this._clearInterval(); + } + + cycle() { + this._clearInterval(); + + this._updateInterval(); + + this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval); + } + + _maybeEnableCycle() { + if (!this._config.ride) { + return; + } + + if (this._isSliding) { + EventHandler.one(this._element, EVENT_SLID, () => this.cycle()); + return; + } + + this.cycle(); + } + + to(index) { + const items = this._getItems(); + + if (index > items.length - 1 || index < 0) { + return; + } + + if (this._isSliding) { + EventHandler.one(this._element, EVENT_SLID, () => this.to(index)); + return; + } + + const activeIndex = this._getItemIndex(this._getActive()); + + if (activeIndex === index) { + return; + } + + const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV; + + this._slide(order, items[index]); + } + + dispose() { + if (this._swipeHelper) { + this._swipeHelper.dispose(); + } + + super.dispose(); + } // Private + + + _configAfterMerge(config) { + config.defaultInterval = config.interval; + return config; + } + + _addEventListeners() { + if (this._config.keyboard) { + EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event)); + } + + if (this._config.pause === 'hover') { + EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause()); + EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle()); + } + + if (this._config.touch && Swipe.isSupported()) { + this._addTouchEventListeners(); + } + } + + _addTouchEventListeners() { + for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) { + EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault()); + } + + const endCallBack = () => { + if (this._config.pause !== 'hover') { + return; + } // If it's a touch-enabled device, mouseenter/leave are fired as + // part of the mouse compatibility events on first tap - the carousel + // would stop cycling until user tapped out of it; + // here, we listen for touchend, explicitly pause the carousel + // (as if it's the second time we tap on it, mouseenter compat event + // is NOT fired) and after a timeout (to allow for mouse compatibility + // events to fire) we explicitly restart cycling + + + this.pause(); + + if (this.touchTimeout) { + clearTimeout(this.touchTimeout); + } + + this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval); + }; + + const swipeConfig = { + leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)), + rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)), + endCallback: endCallBack + }; + this._swipeHelper = new Swipe(this._element, swipeConfig); + } + + _keydown(event) { + if (/input|textarea/i.test(event.target.tagName)) { + return; + } + + const direction = KEY_TO_DIRECTION[event.key]; + + if (direction) { + event.preventDefault(); + + this._slide(this._directionToOrder(direction)); + } + } + + _getItemIndex(element) { + return this._getItems().indexOf(element); + } + + _setActiveIndicatorElement(index) { + if (!this._indicatorsElement) { + return; + } + + const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement); + activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2); + activeIndicator.removeAttribute('aria-current'); + const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to="${index}"]`, this._indicatorsElement); + + if (newActiveIndicator) { + newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2); + newActiveIndicator.setAttribute('aria-current', 'true'); + } + } + + _updateInterval() { + const element = this._activeElement || this._getActive(); + + if (!element) { + return; + } + + const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10); + this._config.interval = elementInterval || this._config.defaultInterval; + } + + _slide(order, element = null) { + if (this._isSliding) { + return; + } + + const activeElement = this._getActive(); + + const isNext = order === ORDER_NEXT; + const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap); + + if (nextElement === activeElement) { + return; + } + + const nextElementIndex = this._getItemIndex(nextElement); + + const triggerEvent = eventName => { + return EventHandler.trigger(this._element, eventName, { + relatedTarget: nextElement, + direction: this._orderToDirection(order), + from: this._getItemIndex(activeElement), + to: nextElementIndex + }); + }; + + const slideEvent = triggerEvent(EVENT_SLIDE); + + if (slideEvent.defaultPrevented) { + return; + } + + if (!activeElement || !nextElement) { + // Some weirdness is happening, so we bail + // todo: change tests that use empty divs to avoid this check + return; + } + + const isCycling = Boolean(this._interval); + this.pause(); + this._isSliding = true; + + this._setActiveIndicatorElement(nextElementIndex); + + this._activeElement = nextElement; + const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END; + const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV; + nextElement.classList.add(orderClassName); + reflow(nextElement); + activeElement.classList.add(directionalClassName); + nextElement.classList.add(directionalClassName); + + const completeCallBack = () => { + nextElement.classList.remove(directionalClassName, orderClassName); + nextElement.classList.add(CLASS_NAME_ACTIVE$2); + activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName); + this._isSliding = false; + triggerEvent(EVENT_SLID); + }; + + this._queueCallback(completeCallBack, activeElement, this._isAnimated()); + + if (isCycling) { + this.cycle(); + } + } + + _isAnimated() { + return this._element.classList.contains(CLASS_NAME_SLIDE); + } + + _getActive() { + return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element); + } + + _getItems() { + return SelectorEngine.find(SELECTOR_ITEM, this._element); + } + + _clearInterval() { + if (this._interval) { + clearInterval(this._interval); + this._interval = null; + } + } + + _directionToOrder(direction) { + if (isRTL()) { + return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT; + } + + return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV; + } + + _orderToDirection(order) { + if (isRTL()) { + return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT; + } + + return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT; + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Carousel.getOrCreateInstance(this, config); + + if (typeof config === 'number') { + data.to(config); + return; + } + + if (typeof config === 'string') { + if (data[config] === undefined || config.startsWith('_') || config === 'constructor') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](); + } + }); + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) { + const target = getElementFromSelector(this); + + if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) { + return; + } + + event.preventDefault(); + const carousel = Carousel.getOrCreateInstance(target); + const slideIndex = this.getAttribute('data-bs-slide-to'); + + if (slideIndex) { + carousel.to(slideIndex); + + carousel._maybeEnableCycle(); + + return; + } + + if (Manipulator.getDataAttribute(this, 'slide') === 'next') { + carousel.next(); + + carousel._maybeEnableCycle(); + + return; + } + + carousel.prev(); + + carousel._maybeEnableCycle(); + }); + EventHandler.on(window, EVENT_LOAD_DATA_API$3, () => { + const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE); + + for (const carousel of carousels) { + Carousel.getOrCreateInstance(carousel); + } + }); + /** + * jQuery + */ + + defineJQueryPlugin(Carousel); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): collapse.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$b = 'collapse'; + const DATA_KEY$7 = 'bs.collapse'; + const EVENT_KEY$7 = `.${DATA_KEY$7}`; + const DATA_API_KEY$4 = '.data-api'; + const EVENT_SHOW$6 = `show${EVENT_KEY$7}`; + const EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`; + const EVENT_HIDE$6 = `hide${EVENT_KEY$7}`; + const EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`; + const EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`; + const CLASS_NAME_SHOW$7 = 'show'; + const CLASS_NAME_COLLAPSE = 'collapse'; + const CLASS_NAME_COLLAPSING = 'collapsing'; + const CLASS_NAME_COLLAPSED = 'collapsed'; + const CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`; + const CLASS_NAME_HORIZONTAL = 'collapse-horizontal'; + const WIDTH = 'width'; + const HEIGHT = 'height'; + const SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing'; + const SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle="collapse"]'; + const Default$a = { + parent: null, + toggle: true + }; + const DefaultType$a = { + parent: '(null|element)', + toggle: 'boolean' + }; + /** + * Class definition + */ + + class Collapse extends BaseComponent { + constructor(element, config) { + super(element, config); + this._isTransitioning = false; + this._triggerArray = []; + const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4); + + for (const elem of toggleList) { + const selector = getSelectorFromElement(elem); + const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element); + + if (selector !== null && filterElement.length) { + this._triggerArray.push(elem); + } + } + + this._initializeChildren(); + + if (!this._config.parent) { + this._addAriaAndCollapsedClass(this._triggerArray, this._isShown()); + } + + if (this._config.toggle) { + this.toggle(); + } + } // Getters + + + static get Default() { + return Default$a; + } + + static get DefaultType() { + return DefaultType$a; + } + + static get NAME() { + return NAME$b; + } // Public + + + toggle() { + if (this._isShown()) { + this.hide(); + } else { + this.show(); + } + } + + show() { + if (this._isTransitioning || this._isShown()) { + return; + } + + let activeChildren = []; // find active children + + if (this._config.parent) { + activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, { + toggle: false + })); + } + + if (activeChildren.length && activeChildren[0]._isTransitioning) { + return; + } + + const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6); + + if (startEvent.defaultPrevented) { + return; + } + + for (const activeInstance of activeChildren) { + activeInstance.hide(); + } + + const dimension = this._getDimension(); + + this._element.classList.remove(CLASS_NAME_COLLAPSE); + + this._element.classList.add(CLASS_NAME_COLLAPSING); + + this._element.style[dimension] = 0; + + this._addAriaAndCollapsedClass(this._triggerArray, true); + + this._isTransitioning = true; + + const complete = () => { + this._isTransitioning = false; + + this._element.classList.remove(CLASS_NAME_COLLAPSING); + + this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7); + + this._element.style[dimension] = ''; + EventHandler.trigger(this._element, EVENT_SHOWN$6); + }; + + const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); + const scrollSize = `scroll${capitalizedDimension}`; + + this._queueCallback(complete, this._element, true); + + this._element.style[dimension] = `${this._element[scrollSize]}px`; + } + + hide() { + if (this._isTransitioning || !this._isShown()) { + return; + } + + const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6); + + if (startEvent.defaultPrevented) { + return; + } + + const dimension = this._getDimension(); + + this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`; + reflow(this._element); + + this._element.classList.add(CLASS_NAME_COLLAPSING); + + this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7); + + for (const trigger of this._triggerArray) { + const element = getElementFromSelector(trigger); + + if (element && !this._isShown(element)) { + this._addAriaAndCollapsedClass([trigger], false); + } + } + + this._isTransitioning = true; + + const complete = () => { + this._isTransitioning = false; + + this._element.classList.remove(CLASS_NAME_COLLAPSING); + + this._element.classList.add(CLASS_NAME_COLLAPSE); + + EventHandler.trigger(this._element, EVENT_HIDDEN$6); + }; + + this._element.style[dimension] = ''; + + this._queueCallback(complete, this._element, true); + } + + _isShown(element = this._element) { + return element.classList.contains(CLASS_NAME_SHOW$7); + } // Private + + + _configAfterMerge(config) { + config.toggle = Boolean(config.toggle); // Coerce string values + + config.parent = getElement(config.parent); + return config; + } + + _getDimension() { + return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT; + } + + _initializeChildren() { + if (!this._config.parent) { + return; + } + + const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4); + + for (const element of children) { + const selected = getElementFromSelector(element); + + if (selected) { + this._addAriaAndCollapsedClass([element], this._isShown(selected)); + } + } + } + + _getFirstLevelChildren(selector) { + const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent); // remove children if greater depth + + return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element)); + } + + _addAriaAndCollapsedClass(triggerArray, isOpen) { + if (!triggerArray.length) { + return; + } + + for (const element of triggerArray) { + element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen); + element.setAttribute('aria-expanded', isOpen); + } + } // Static + + + static jQueryInterface(config) { + const _config = {}; + + if (typeof config === 'string' && /show|hide/.test(config)) { + _config.toggle = false; + } + + return this.each(function () { + const data = Collapse.getOrCreateInstance(this, _config); + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](); + } + }); + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) { + // preventDefault only for elements (which change the URL) not inside the collapsible element + if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') { + event.preventDefault(); + } + + const selector = getSelectorFromElement(this); + const selectorElements = SelectorEngine.find(selector); + + for (const element of selectorElements) { + Collapse.getOrCreateInstance(element, { + toggle: false + }).toggle(); + } + }); + /** + * jQuery + */ + + defineJQueryPlugin(Collapse); + + var top = 'top'; + var bottom = 'bottom'; + var right = 'right'; + var left = 'left'; + var auto = 'auto'; + var basePlacements = [top, bottom, right, left]; + var start = 'start'; + var end = 'end'; + var clippingParents = 'clippingParents'; + var viewport = 'viewport'; + var popper = 'popper'; + var reference = 'reference'; + var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) { + return acc.concat([placement + "-" + start, placement + "-" + end]); + }, []); + var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) { + return acc.concat([placement, placement + "-" + start, placement + "-" + end]); + }, []); // modifiers that need to read the DOM + + var beforeRead = 'beforeRead'; + var read = 'read'; + var afterRead = 'afterRead'; // pure-logic modifiers + + var beforeMain = 'beforeMain'; + var main = 'main'; + var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state) + + var beforeWrite = 'beforeWrite'; + var write = 'write'; + var afterWrite = 'afterWrite'; + var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite]; + + function getNodeName(element) { + return element ? (element.nodeName || '').toLowerCase() : null; + } + + function getWindow(node) { + if (node == null) { + return window; + } + + if (node.toString() !== '[object Window]') { + var ownerDocument = node.ownerDocument; + return ownerDocument ? ownerDocument.defaultView || window : window; + } + + return node; + } + + function isElement(node) { + var OwnElement = getWindow(node).Element; + return node instanceof OwnElement || node instanceof Element; + } + + function isHTMLElement(node) { + var OwnElement = getWindow(node).HTMLElement; + return node instanceof OwnElement || node instanceof HTMLElement; + } + + function isShadowRoot(node) { + // IE 11 has no ShadowRoot + if (typeof ShadowRoot === 'undefined') { + return false; + } + + var OwnElement = getWindow(node).ShadowRoot; + return node instanceof OwnElement || node instanceof ShadowRoot; + } + + // and applies them to the HTMLElements such as popper and arrow + + function applyStyles(_ref) { + var state = _ref.state; + Object.keys(state.elements).forEach(function (name) { + var style = state.styles[name] || {}; + var attributes = state.attributes[name] || {}; + var element = state.elements[name]; // arrow is optional + virtual elements + + if (!isHTMLElement(element) || !getNodeName(element)) { + return; + } // Flow doesn't support to extend this property, but it's the most + // effective way to apply styles to an HTMLElement + // $FlowFixMe[cannot-write] + + + Object.assign(element.style, style); + Object.keys(attributes).forEach(function (name) { + var value = attributes[name]; + + if (value === false) { + element.removeAttribute(name); + } else { + element.setAttribute(name, value === true ? '' : value); + } + }); + }); + } + + function effect$2(_ref2) { + var state = _ref2.state; + var initialStyles = { + popper: { + position: state.options.strategy, + left: '0', + top: '0', + margin: '0' + }, + arrow: { + position: 'absolute' + }, + reference: {} + }; + Object.assign(state.elements.popper.style, initialStyles.popper); + state.styles = initialStyles; + + if (state.elements.arrow) { + Object.assign(state.elements.arrow.style, initialStyles.arrow); + } + + return function () { + Object.keys(state.elements).forEach(function (name) { + var element = state.elements[name]; + var attributes = state.attributes[name] || {}; + var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them + + var style = styleProperties.reduce(function (style, property) { + style[property] = ''; + return style; + }, {}); // arrow is optional + virtual elements + + if (!isHTMLElement(element) || !getNodeName(element)) { + return; + } + + Object.assign(element.style, style); + Object.keys(attributes).forEach(function (attribute) { + element.removeAttribute(attribute); + }); + }); + }; + } // eslint-disable-next-line import/no-unused-modules + + + const applyStyles$1 = { + name: 'applyStyles', + enabled: true, + phase: 'write', + fn: applyStyles, + effect: effect$2, + requires: ['computeStyles'] + }; + + function getBasePlacement(placement) { + return placement.split('-')[0]; + } + + var max = Math.max; + var min = Math.min; + var round = Math.round; + + function getUAString() { + var uaData = navigator.userAgentData; + + if (uaData != null && uaData.brands) { + return uaData.brands.map(function (item) { + return item.brand + "/" + item.version; + }).join(' '); + } + + return navigator.userAgent; + } + + function isLayoutViewport() { + return !/^((?!chrome|android).)*safari/i.test(getUAString()); + } + + function getBoundingClientRect(element, includeScale, isFixedStrategy) { + if (includeScale === void 0) { + includeScale = false; + } + + if (isFixedStrategy === void 0) { + isFixedStrategy = false; + } + + var clientRect = element.getBoundingClientRect(); + var scaleX = 1; + var scaleY = 1; + + if (includeScale && isHTMLElement(element)) { + scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1; + scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1; + } + + var _ref = isElement(element) ? getWindow(element) : window, + visualViewport = _ref.visualViewport; + + var addVisualOffsets = !isLayoutViewport() && isFixedStrategy; + var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX; + var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY; + var width = clientRect.width / scaleX; + var height = clientRect.height / scaleY; + return { + width: width, + height: height, + top: y, + right: x + width, + bottom: y + height, + left: x, + x: x, + y: y + }; + } + + // means it doesn't take into account transforms. + + function getLayoutRect(element) { + var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed. + // Fixes https://github.com/popperjs/popper-core/issues/1223 + + var width = element.offsetWidth; + var height = element.offsetHeight; + + if (Math.abs(clientRect.width - width) <= 1) { + width = clientRect.width; + } + + if (Math.abs(clientRect.height - height) <= 1) { + height = clientRect.height; + } + + return { + x: element.offsetLeft, + y: element.offsetTop, + width: width, + height: height + }; + } + + function contains(parent, child) { + var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method + + if (parent.contains(child)) { + return true; + } // then fallback to custom implementation with Shadow DOM support + else if (rootNode && isShadowRoot(rootNode)) { + var next = child; + + do { + if (next && parent.isSameNode(next)) { + return true; + } // $FlowFixMe[prop-missing]: need a better way to handle this... + + + next = next.parentNode || next.host; + } while (next); + } // Give up, the result is false + + + return false; + } + + function getComputedStyle$1(element) { + return getWindow(element).getComputedStyle(element); + } + + function isTableElement(element) { + return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0; + } + + function getDocumentElement(element) { + // $FlowFixMe[incompatible-return]: assume body is always available + return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing] + element.document) || window.document).documentElement; + } + + function getParentNode(element) { + if (getNodeName(element) === 'html') { + return element; + } + + return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle + // $FlowFixMe[incompatible-return] + // $FlowFixMe[prop-missing] + element.assignedSlot || // step into the shadow DOM of the parent of a slotted node + element.parentNode || ( // DOM Element detected + isShadowRoot(element) ? element.host : null) || // ShadowRoot detected + // $FlowFixMe[incompatible-call]: HTMLElement is a Node + getDocumentElement(element) // fallback + + ); + } + + function getTrueOffsetParent(element) { + if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837 + getComputedStyle$1(element).position === 'fixed') { + return null; + } + + return element.offsetParent; + } // `.offsetParent` reports `null` for fixed elements, while absolute elements + // return the containing block + + + function getContainingBlock(element) { + var isFirefox = /firefox/i.test(getUAString()); + var isIE = /Trident/i.test(getUAString()); + + if (isIE && isHTMLElement(element)) { + // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport + var elementCss = getComputedStyle$1(element); + + if (elementCss.position === 'fixed') { + return null; + } + } + + var currentNode = getParentNode(element); + + if (isShadowRoot(currentNode)) { + currentNode = currentNode.host; + } + + while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) { + var css = getComputedStyle$1(currentNode); // This is non-exhaustive but covers the most common CSS properties that + // create a containing block. + // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block + + if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') { + return currentNode; + } else { + currentNode = currentNode.parentNode; + } + } + + return null; + } // Gets the closest ancestor positioned element. Handles some edge cases, + // such as table ancestors and cross browser bugs. + + + function getOffsetParent(element) { + var window = getWindow(element); + var offsetParent = getTrueOffsetParent(element); + + while (offsetParent && isTableElement(offsetParent) && getComputedStyle$1(offsetParent).position === 'static') { + offsetParent = getTrueOffsetParent(offsetParent); + } + + if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle$1(offsetParent).position === 'static')) { + return window; + } + + return offsetParent || getContainingBlock(element) || window; + } + + function getMainAxisFromPlacement(placement) { + return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y'; + } + + function within(min$1, value, max$1) { + return max(min$1, min(value, max$1)); + } + function withinMaxClamp(min, value, max) { + var v = within(min, value, max); + return v > max ? max : v; + } + + function getFreshSideObject() { + return { + top: 0, + right: 0, + bottom: 0, + left: 0 + }; + } + + function mergePaddingObject(paddingObject) { + return Object.assign({}, getFreshSideObject(), paddingObject); + } + + function expandToHashMap(value, keys) { + return keys.reduce(function (hashMap, key) { + hashMap[key] = value; + return hashMap; + }, {}); + } + + var toPaddingObject = function toPaddingObject(padding, state) { + padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, { + placement: state.placement + })) : padding; + return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements)); + }; + + function arrow(_ref) { + var _state$modifiersData$; + + var state = _ref.state, + name = _ref.name, + options = _ref.options; + var arrowElement = state.elements.arrow; + var popperOffsets = state.modifiersData.popperOffsets; + var basePlacement = getBasePlacement(state.placement); + var axis = getMainAxisFromPlacement(basePlacement); + var isVertical = [left, right].indexOf(basePlacement) >= 0; + var len = isVertical ? 'height' : 'width'; + + if (!arrowElement || !popperOffsets) { + return; + } + + var paddingObject = toPaddingObject(options.padding, state); + var arrowRect = getLayoutRect(arrowElement); + var minProp = axis === 'y' ? top : left; + var maxProp = axis === 'y' ? bottom : right; + var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len]; + var startDiff = popperOffsets[axis] - state.rects.reference[axis]; + var arrowOffsetParent = getOffsetParent(arrowElement); + var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0; + var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is + // outside of the popper bounds + + var min = paddingObject[minProp]; + var max = clientSize - arrowRect[len] - paddingObject[maxProp]; + var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference; + var offset = within(min, center, max); // Prevents breaking syntax highlighting... + + var axisProp = axis; + state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$); + } + + function effect$1(_ref2) { + var state = _ref2.state, + options = _ref2.options; + var _options$element = options.element, + arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element; + + if (arrowElement == null) { + return; + } // CSS selector + + + if (typeof arrowElement === 'string') { + arrowElement = state.elements.popper.querySelector(arrowElement); + + if (!arrowElement) { + return; + } + } + + if (!contains(state.elements.popper, arrowElement)) { + + return; + } + + state.elements.arrow = arrowElement; + } // eslint-disable-next-line import/no-unused-modules + + + const arrow$1 = { + name: 'arrow', + enabled: true, + phase: 'main', + fn: arrow, + effect: effect$1, + requires: ['popperOffsets'], + requiresIfExists: ['preventOverflow'] + }; + + function getVariation(placement) { + return placement.split('-')[1]; + } + + var unsetSides = { + top: 'auto', + right: 'auto', + bottom: 'auto', + left: 'auto' + }; // Round the offsets to the nearest suitable subpixel based on the DPR. + // Zooming can change the DPR, but it seems to report a value that will + // cleanly divide the values into the appropriate subpixels. + + function roundOffsetsByDPR(_ref) { + var x = _ref.x, + y = _ref.y; + var win = window; + var dpr = win.devicePixelRatio || 1; + return { + x: round(x * dpr) / dpr || 0, + y: round(y * dpr) / dpr || 0 + }; + } + + function mapToStyles(_ref2) { + var _Object$assign2; + + var popper = _ref2.popper, + popperRect = _ref2.popperRect, + placement = _ref2.placement, + variation = _ref2.variation, + offsets = _ref2.offsets, + position = _ref2.position, + gpuAcceleration = _ref2.gpuAcceleration, + adaptive = _ref2.adaptive, + roundOffsets = _ref2.roundOffsets, + isFixed = _ref2.isFixed; + var _offsets$x = offsets.x, + x = _offsets$x === void 0 ? 0 : _offsets$x, + _offsets$y = offsets.y, + y = _offsets$y === void 0 ? 0 : _offsets$y; + + var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({ + x: x, + y: y + }) : { + x: x, + y: y + }; + + x = _ref3.x; + y = _ref3.y; + var hasX = offsets.hasOwnProperty('x'); + var hasY = offsets.hasOwnProperty('y'); + var sideX = left; + var sideY = top; + var win = window; + + if (adaptive) { + var offsetParent = getOffsetParent(popper); + var heightProp = 'clientHeight'; + var widthProp = 'clientWidth'; + + if (offsetParent === getWindow(popper)) { + offsetParent = getDocumentElement(popper); + + if (getComputedStyle$1(offsetParent).position !== 'static' && position === 'absolute') { + heightProp = 'scrollHeight'; + widthProp = 'scrollWidth'; + } + } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it + + + offsetParent = offsetParent; + + if (placement === top || (placement === left || placement === right) && variation === end) { + sideY = bottom; + var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing] + offsetParent[heightProp]; + y -= offsetY - popperRect.height; + y *= gpuAcceleration ? 1 : -1; + } + + if (placement === left || (placement === top || placement === bottom) && variation === end) { + sideX = right; + var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing] + offsetParent[widthProp]; + x -= offsetX - popperRect.width; + x *= gpuAcceleration ? 1 : -1; + } + } + + var commonStyles = Object.assign({ + position: position + }, adaptive && unsetSides); + + var _ref4 = roundOffsets === true ? roundOffsetsByDPR({ + x: x, + y: y + }) : { + x: x, + y: y + }; + + x = _ref4.x; + y = _ref4.y; + + if (gpuAcceleration) { + var _Object$assign; + + return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? "translate(" + x + "px, " + y + "px)" : "translate3d(" + x + "px, " + y + "px, 0)", _Object$assign)); + } + + return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + "px" : '', _Object$assign2[sideX] = hasX ? x + "px" : '', _Object$assign2.transform = '', _Object$assign2)); + } + + function computeStyles(_ref5) { + var state = _ref5.state, + options = _ref5.options; + var _options$gpuAccelerat = options.gpuAcceleration, + gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat, + _options$adaptive = options.adaptive, + adaptive = _options$adaptive === void 0 ? true : _options$adaptive, + _options$roundOffsets = options.roundOffsets, + roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets; + + var commonStyles = { + placement: getBasePlacement(state.placement), + variation: getVariation(state.placement), + popper: state.elements.popper, + popperRect: state.rects.popper, + gpuAcceleration: gpuAcceleration, + isFixed: state.options.strategy === 'fixed' + }; + + if (state.modifiersData.popperOffsets != null) { + state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, { + offsets: state.modifiersData.popperOffsets, + position: state.options.strategy, + adaptive: adaptive, + roundOffsets: roundOffsets + }))); + } + + if (state.modifiersData.arrow != null) { + state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, { + offsets: state.modifiersData.arrow, + position: 'absolute', + adaptive: false, + roundOffsets: roundOffsets + }))); + } + + state.attributes.popper = Object.assign({}, state.attributes.popper, { + 'data-popper-placement': state.placement + }); + } // eslint-disable-next-line import/no-unused-modules + + + const computeStyles$1 = { + name: 'computeStyles', + enabled: true, + phase: 'beforeWrite', + fn: computeStyles, + data: {} + }; + + var passive = { + passive: true + }; + + function effect(_ref) { + var state = _ref.state, + instance = _ref.instance, + options = _ref.options; + var _options$scroll = options.scroll, + scroll = _options$scroll === void 0 ? true : _options$scroll, + _options$resize = options.resize, + resize = _options$resize === void 0 ? true : _options$resize; + var window = getWindow(state.elements.popper); + var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper); + + if (scroll) { + scrollParents.forEach(function (scrollParent) { + scrollParent.addEventListener('scroll', instance.update, passive); + }); + } + + if (resize) { + window.addEventListener('resize', instance.update, passive); + } + + return function () { + if (scroll) { + scrollParents.forEach(function (scrollParent) { + scrollParent.removeEventListener('scroll', instance.update, passive); + }); + } + + if (resize) { + window.removeEventListener('resize', instance.update, passive); + } + }; + } // eslint-disable-next-line import/no-unused-modules + + + const eventListeners = { + name: 'eventListeners', + enabled: true, + phase: 'write', + fn: function fn() {}, + effect: effect, + data: {} + }; + + var hash$1 = { + left: 'right', + right: 'left', + bottom: 'top', + top: 'bottom' + }; + function getOppositePlacement(placement) { + return placement.replace(/left|right|bottom|top/g, function (matched) { + return hash$1[matched]; + }); + } + + var hash = { + start: 'end', + end: 'start' + }; + function getOppositeVariationPlacement(placement) { + return placement.replace(/start|end/g, function (matched) { + return hash[matched]; + }); + } + + function getWindowScroll(node) { + var win = getWindow(node); + var scrollLeft = win.pageXOffset; + var scrollTop = win.pageYOffset; + return { + scrollLeft: scrollLeft, + scrollTop: scrollTop + }; + } + + function getWindowScrollBarX(element) { + // If has a CSS width greater than the viewport, then this will be + // incorrect for RTL. + // Popper 1 is broken in this case and never had a bug report so let's assume + // it's not an issue. I don't think anyone ever specifies width on + // anyway. + // Browsers where the left scrollbar doesn't cause an issue report `0` for + // this (e.g. Edge 2019, IE11, Safari) + return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft; + } + + function getViewportRect(element, strategy) { + var win = getWindow(element); + var html = getDocumentElement(element); + var visualViewport = win.visualViewport; + var width = html.clientWidth; + var height = html.clientHeight; + var x = 0; + var y = 0; + + if (visualViewport) { + width = visualViewport.width; + height = visualViewport.height; + var layoutViewport = isLayoutViewport(); + + if (layoutViewport || !layoutViewport && strategy === 'fixed') { + x = visualViewport.offsetLeft; + y = visualViewport.offsetTop; + } + } + + return { + width: width, + height: height, + x: x + getWindowScrollBarX(element), + y: y + }; + } + + // of the `` and `` rect bounds if horizontally scrollable + + function getDocumentRect(element) { + var _element$ownerDocumen; + + var html = getDocumentElement(element); + var winScroll = getWindowScroll(element); + var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body; + var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0); + var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0); + var x = -winScroll.scrollLeft + getWindowScrollBarX(element); + var y = -winScroll.scrollTop; + + if (getComputedStyle$1(body || html).direction === 'rtl') { + x += max(html.clientWidth, body ? body.clientWidth : 0) - width; + } + + return { + width: width, + height: height, + x: x, + y: y + }; + } + + function isScrollParent(element) { + // Firefox wants us to check `-x` and `-y` variations as well + var _getComputedStyle = getComputedStyle$1(element), + overflow = _getComputedStyle.overflow, + overflowX = _getComputedStyle.overflowX, + overflowY = _getComputedStyle.overflowY; + + return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX); + } + + function getScrollParent(node) { + if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) { + // $FlowFixMe[incompatible-return]: assume body is always available + return node.ownerDocument.body; + } + + if (isHTMLElement(node) && isScrollParent(node)) { + return node; + } + + return getScrollParent(getParentNode(node)); + } + + /* + given a DOM element, return the list of all scroll parents, up the list of ancesors + until we get to the top window object. This list is what we attach scroll listeners + to, because if any of these parent elements scroll, we'll need to re-calculate the + reference element's position. + */ + + function listScrollParents(element, list) { + var _element$ownerDocumen; + + if (list === void 0) { + list = []; + } + + var scrollParent = getScrollParent(element); + var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body); + var win = getWindow(scrollParent); + var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent; + var updatedList = list.concat(target); + return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here + updatedList.concat(listScrollParents(getParentNode(target))); + } + + function rectToClientRect(rect) { + return Object.assign({}, rect, { + left: rect.x, + top: rect.y, + right: rect.x + rect.width, + bottom: rect.y + rect.height + }); + } + + function getInnerBoundingClientRect(element, strategy) { + var rect = getBoundingClientRect(element, false, strategy === 'fixed'); + rect.top = rect.top + element.clientTop; + rect.left = rect.left + element.clientLeft; + rect.bottom = rect.top + element.clientHeight; + rect.right = rect.left + element.clientWidth; + rect.width = element.clientWidth; + rect.height = element.clientHeight; + rect.x = rect.left; + rect.y = rect.top; + return rect; + } + + function getClientRectFromMixedType(element, clippingParent, strategy) { + return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element))); + } // A "clipping parent" is an overflowable container with the characteristic of + // clipping (or hiding) overflowing elements with a position different from + // `initial` + + + function getClippingParents(element) { + var clippingParents = listScrollParents(getParentNode(element)); + var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle$1(element).position) >= 0; + var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element; + + if (!isElement(clipperElement)) { + return []; + } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414 + + + return clippingParents.filter(function (clippingParent) { + return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body'; + }); + } // Gets the maximum area that the element is visible in due to any number of + // clipping parents + + + function getClippingRect(element, boundary, rootBoundary, strategy) { + var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary); + var clippingParents = [].concat(mainClippingParents, [rootBoundary]); + var firstClippingParent = clippingParents[0]; + var clippingRect = clippingParents.reduce(function (accRect, clippingParent) { + var rect = getClientRectFromMixedType(element, clippingParent, strategy); + accRect.top = max(rect.top, accRect.top); + accRect.right = min(rect.right, accRect.right); + accRect.bottom = min(rect.bottom, accRect.bottom); + accRect.left = max(rect.left, accRect.left); + return accRect; + }, getClientRectFromMixedType(element, firstClippingParent, strategy)); + clippingRect.width = clippingRect.right - clippingRect.left; + clippingRect.height = clippingRect.bottom - clippingRect.top; + clippingRect.x = clippingRect.left; + clippingRect.y = clippingRect.top; + return clippingRect; + } + + function computeOffsets(_ref) { + var reference = _ref.reference, + element = _ref.element, + placement = _ref.placement; + var basePlacement = placement ? getBasePlacement(placement) : null; + var variation = placement ? getVariation(placement) : null; + var commonX = reference.x + reference.width / 2 - element.width / 2; + var commonY = reference.y + reference.height / 2 - element.height / 2; + var offsets; + + switch (basePlacement) { + case top: + offsets = { + x: commonX, + y: reference.y - element.height + }; + break; + + case bottom: + offsets = { + x: commonX, + y: reference.y + reference.height + }; + break; + + case right: + offsets = { + x: reference.x + reference.width, + y: commonY + }; + break; + + case left: + offsets = { + x: reference.x - element.width, + y: commonY + }; + break; + + default: + offsets = { + x: reference.x, + y: reference.y + }; + } + + var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null; + + if (mainAxis != null) { + var len = mainAxis === 'y' ? 'height' : 'width'; + + switch (variation) { + case start: + offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2); + break; + + case end: + offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2); + break; + } + } + + return offsets; + } + + function detectOverflow(state, options) { + if (options === void 0) { + options = {}; + } + + var _options = options, + _options$placement = _options.placement, + placement = _options$placement === void 0 ? state.placement : _options$placement, + _options$strategy = _options.strategy, + strategy = _options$strategy === void 0 ? state.strategy : _options$strategy, + _options$boundary = _options.boundary, + boundary = _options$boundary === void 0 ? clippingParents : _options$boundary, + _options$rootBoundary = _options.rootBoundary, + rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary, + _options$elementConte = _options.elementContext, + elementContext = _options$elementConte === void 0 ? popper : _options$elementConte, + _options$altBoundary = _options.altBoundary, + altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary, + _options$padding = _options.padding, + padding = _options$padding === void 0 ? 0 : _options$padding; + var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements)); + var altContext = elementContext === popper ? reference : popper; + var popperRect = state.rects.popper; + var element = state.elements[altBoundary ? altContext : elementContext]; + var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy); + var referenceClientRect = getBoundingClientRect(state.elements.reference); + var popperOffsets = computeOffsets({ + reference: referenceClientRect, + element: popperRect, + strategy: 'absolute', + placement: placement + }); + var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets)); + var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect + // 0 or negative = within the clipping rect + + var overflowOffsets = { + top: clippingClientRect.top - elementClientRect.top + paddingObject.top, + bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom, + left: clippingClientRect.left - elementClientRect.left + paddingObject.left, + right: elementClientRect.right - clippingClientRect.right + paddingObject.right + }; + var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element + + if (elementContext === popper && offsetData) { + var offset = offsetData[placement]; + Object.keys(overflowOffsets).forEach(function (key) { + var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1; + var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x'; + overflowOffsets[key] += offset[axis] * multiply; + }); + } + + return overflowOffsets; + } + + function computeAutoPlacement(state, options) { + if (options === void 0) { + options = {}; + } + + var _options = options, + placement = _options.placement, + boundary = _options.boundary, + rootBoundary = _options.rootBoundary, + padding = _options.padding, + flipVariations = _options.flipVariations, + _options$allowedAutoP = _options.allowedAutoPlacements, + allowedAutoPlacements = _options$allowedAutoP === void 0 ? placements : _options$allowedAutoP; + var variation = getVariation(placement); + var placements$1 = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) { + return getVariation(placement) === variation; + }) : basePlacements; + var allowedPlacements = placements$1.filter(function (placement) { + return allowedAutoPlacements.indexOf(placement) >= 0; + }); + + if (allowedPlacements.length === 0) { + allowedPlacements = placements$1; + } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions... + + + var overflows = allowedPlacements.reduce(function (acc, placement) { + acc[placement] = detectOverflow(state, { + placement: placement, + boundary: boundary, + rootBoundary: rootBoundary, + padding: padding + })[getBasePlacement(placement)]; + return acc; + }, {}); + return Object.keys(overflows).sort(function (a, b) { + return overflows[a] - overflows[b]; + }); + } + + function getExpandedFallbackPlacements(placement) { + if (getBasePlacement(placement) === auto) { + return []; + } + + var oppositePlacement = getOppositePlacement(placement); + return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)]; + } + + function flip(_ref) { + var state = _ref.state, + options = _ref.options, + name = _ref.name; + + if (state.modifiersData[name]._skip) { + return; + } + + var _options$mainAxis = options.mainAxis, + checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis, + _options$altAxis = options.altAxis, + checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis, + specifiedFallbackPlacements = options.fallbackPlacements, + padding = options.padding, + boundary = options.boundary, + rootBoundary = options.rootBoundary, + altBoundary = options.altBoundary, + _options$flipVariatio = options.flipVariations, + flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio, + allowedAutoPlacements = options.allowedAutoPlacements; + var preferredPlacement = state.options.placement; + var basePlacement = getBasePlacement(preferredPlacement); + var isBasePlacement = basePlacement === preferredPlacement; + var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement)); + var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) { + return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, { + placement: placement, + boundary: boundary, + rootBoundary: rootBoundary, + padding: padding, + flipVariations: flipVariations, + allowedAutoPlacements: allowedAutoPlacements + }) : placement); + }, []); + var referenceRect = state.rects.reference; + var popperRect = state.rects.popper; + var checksMap = new Map(); + var makeFallbackChecks = true; + var firstFittingPlacement = placements[0]; + + for (var i = 0; i < placements.length; i++) { + var placement = placements[i]; + + var _basePlacement = getBasePlacement(placement); + + var isStartVariation = getVariation(placement) === start; + var isVertical = [top, bottom].indexOf(_basePlacement) >= 0; + var len = isVertical ? 'width' : 'height'; + var overflow = detectOverflow(state, { + placement: placement, + boundary: boundary, + rootBoundary: rootBoundary, + altBoundary: altBoundary, + padding: padding + }); + var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top; + + if (referenceRect[len] > popperRect[len]) { + mainVariationSide = getOppositePlacement(mainVariationSide); + } + + var altVariationSide = getOppositePlacement(mainVariationSide); + var checks = []; + + if (checkMainAxis) { + checks.push(overflow[_basePlacement] <= 0); + } + + if (checkAltAxis) { + checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0); + } + + if (checks.every(function (check) { + return check; + })) { + firstFittingPlacement = placement; + makeFallbackChecks = false; + break; + } + + checksMap.set(placement, checks); + } + + if (makeFallbackChecks) { + // `2` may be desired in some cases – research later + var numberOfChecks = flipVariations ? 3 : 1; + + var _loop = function _loop(_i) { + var fittingPlacement = placements.find(function (placement) { + var checks = checksMap.get(placement); + + if (checks) { + return checks.slice(0, _i).every(function (check) { + return check; + }); + } + }); + + if (fittingPlacement) { + firstFittingPlacement = fittingPlacement; + return "break"; + } + }; + + for (var _i = numberOfChecks; _i > 0; _i--) { + var _ret = _loop(_i); + + if (_ret === "break") break; + } + } + + if (state.placement !== firstFittingPlacement) { + state.modifiersData[name]._skip = true; + state.placement = firstFittingPlacement; + state.reset = true; + } + } // eslint-disable-next-line import/no-unused-modules + + + const flip$1 = { + name: 'flip', + enabled: true, + phase: 'main', + fn: flip, + requiresIfExists: ['offset'], + data: { + _skip: false + } + }; + + function getSideOffsets(overflow, rect, preventedOffsets) { + if (preventedOffsets === void 0) { + preventedOffsets = { + x: 0, + y: 0 + }; + } + + return { + top: overflow.top - rect.height - preventedOffsets.y, + right: overflow.right - rect.width + preventedOffsets.x, + bottom: overflow.bottom - rect.height + preventedOffsets.y, + left: overflow.left - rect.width - preventedOffsets.x + }; + } + + function isAnySideFullyClipped(overflow) { + return [top, right, bottom, left].some(function (side) { + return overflow[side] >= 0; + }); + } + + function hide(_ref) { + var state = _ref.state, + name = _ref.name; + var referenceRect = state.rects.reference; + var popperRect = state.rects.popper; + var preventedOffsets = state.modifiersData.preventOverflow; + var referenceOverflow = detectOverflow(state, { + elementContext: 'reference' + }); + var popperAltOverflow = detectOverflow(state, { + altBoundary: true + }); + var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect); + var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets); + var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets); + var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets); + state.modifiersData[name] = { + referenceClippingOffsets: referenceClippingOffsets, + popperEscapeOffsets: popperEscapeOffsets, + isReferenceHidden: isReferenceHidden, + hasPopperEscaped: hasPopperEscaped + }; + state.attributes.popper = Object.assign({}, state.attributes.popper, { + 'data-popper-reference-hidden': isReferenceHidden, + 'data-popper-escaped': hasPopperEscaped + }); + } // eslint-disable-next-line import/no-unused-modules + + + const hide$1 = { + name: 'hide', + enabled: true, + phase: 'main', + requiresIfExists: ['preventOverflow'], + fn: hide + }; + + function distanceAndSkiddingToXY(placement, rects, offset) { + var basePlacement = getBasePlacement(placement); + var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1; + + var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, { + placement: placement + })) : offset, + skidding = _ref[0], + distance = _ref[1]; + + skidding = skidding || 0; + distance = (distance || 0) * invertDistance; + return [left, right].indexOf(basePlacement) >= 0 ? { + x: distance, + y: skidding + } : { + x: skidding, + y: distance + }; + } + + function offset(_ref2) { + var state = _ref2.state, + options = _ref2.options, + name = _ref2.name; + var _options$offset = options.offset, + offset = _options$offset === void 0 ? [0, 0] : _options$offset; + var data = placements.reduce(function (acc, placement) { + acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset); + return acc; + }, {}); + var _data$state$placement = data[state.placement], + x = _data$state$placement.x, + y = _data$state$placement.y; + + if (state.modifiersData.popperOffsets != null) { + state.modifiersData.popperOffsets.x += x; + state.modifiersData.popperOffsets.y += y; + } + + state.modifiersData[name] = data; + } // eslint-disable-next-line import/no-unused-modules + + + const offset$1 = { + name: 'offset', + enabled: true, + phase: 'main', + requires: ['popperOffsets'], + fn: offset + }; + + function popperOffsets(_ref) { + var state = _ref.state, + name = _ref.name; + // Offsets are the actual position the popper needs to have to be + // properly positioned near its reference element + // This is the most basic placement, and will be adjusted by + // the modifiers in the next step + state.modifiersData[name] = computeOffsets({ + reference: state.rects.reference, + element: state.rects.popper, + strategy: 'absolute', + placement: state.placement + }); + } // eslint-disable-next-line import/no-unused-modules + + + const popperOffsets$1 = { + name: 'popperOffsets', + enabled: true, + phase: 'read', + fn: popperOffsets, + data: {} + }; + + function getAltAxis(axis) { + return axis === 'x' ? 'y' : 'x'; + } + + function preventOverflow(_ref) { + var state = _ref.state, + options = _ref.options, + name = _ref.name; + var _options$mainAxis = options.mainAxis, + checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis, + _options$altAxis = options.altAxis, + checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis, + boundary = options.boundary, + rootBoundary = options.rootBoundary, + altBoundary = options.altBoundary, + padding = options.padding, + _options$tether = options.tether, + tether = _options$tether === void 0 ? true : _options$tether, + _options$tetherOffset = options.tetherOffset, + tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset; + var overflow = detectOverflow(state, { + boundary: boundary, + rootBoundary: rootBoundary, + padding: padding, + altBoundary: altBoundary + }); + var basePlacement = getBasePlacement(state.placement); + var variation = getVariation(state.placement); + var isBasePlacement = !variation; + var mainAxis = getMainAxisFromPlacement(basePlacement); + var altAxis = getAltAxis(mainAxis); + var popperOffsets = state.modifiersData.popperOffsets; + var referenceRect = state.rects.reference; + var popperRect = state.rects.popper; + var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, { + placement: state.placement + })) : tetherOffset; + var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? { + mainAxis: tetherOffsetValue, + altAxis: tetherOffsetValue + } : Object.assign({ + mainAxis: 0, + altAxis: 0 + }, tetherOffsetValue); + var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null; + var data = { + x: 0, + y: 0 + }; + + if (!popperOffsets) { + return; + } + + if (checkMainAxis) { + var _offsetModifierState$; + + var mainSide = mainAxis === 'y' ? top : left; + var altSide = mainAxis === 'y' ? bottom : right; + var len = mainAxis === 'y' ? 'height' : 'width'; + var offset = popperOffsets[mainAxis]; + var min$1 = offset + overflow[mainSide]; + var max$1 = offset - overflow[altSide]; + var additive = tether ? -popperRect[len] / 2 : 0; + var minLen = variation === start ? referenceRect[len] : popperRect[len]; + var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go + // outside the reference bounds + + var arrowElement = state.elements.arrow; + var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : { + width: 0, + height: 0 + }; + var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject(); + var arrowPaddingMin = arrowPaddingObject[mainSide]; + var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want + // to include its full size in the calculation. If the reference is small + // and near the edge of a boundary, the popper can overflow even if the + // reference is not overflowing as well (e.g. virtual elements with no + // width or height) + + var arrowLen = within(0, referenceRect[len], arrowRect[len]); + var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis; + var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis; + var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow); + var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0; + var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0; + var tetherMin = offset + minOffset - offsetModifierValue - clientOffset; + var tetherMax = offset + maxOffset - offsetModifierValue; + var preventedOffset = within(tether ? min(min$1, tetherMin) : min$1, offset, tether ? max(max$1, tetherMax) : max$1); + popperOffsets[mainAxis] = preventedOffset; + data[mainAxis] = preventedOffset - offset; + } + + if (checkAltAxis) { + var _offsetModifierState$2; + + var _mainSide = mainAxis === 'x' ? top : left; + + var _altSide = mainAxis === 'x' ? bottom : right; + + var _offset = popperOffsets[altAxis]; + + var _len = altAxis === 'y' ? 'height' : 'width'; + + var _min = _offset + overflow[_mainSide]; + + var _max = _offset - overflow[_altSide]; + + var isOriginSide = [top, left].indexOf(basePlacement) !== -1; + + var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0; + + var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis; + + var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max; + + var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max); + + popperOffsets[altAxis] = _preventedOffset; + data[altAxis] = _preventedOffset - _offset; + } + + state.modifiersData[name] = data; + } // eslint-disable-next-line import/no-unused-modules + + + const preventOverflow$1 = { + name: 'preventOverflow', + enabled: true, + phase: 'main', + fn: preventOverflow, + requiresIfExists: ['offset'] + }; + + function getHTMLElementScroll(element) { + return { + scrollLeft: element.scrollLeft, + scrollTop: element.scrollTop + }; + } + + function getNodeScroll(node) { + if (node === getWindow(node) || !isHTMLElement(node)) { + return getWindowScroll(node); + } else { + return getHTMLElementScroll(node); + } + } + + function isElementScaled(element) { + var rect = element.getBoundingClientRect(); + var scaleX = round(rect.width) / element.offsetWidth || 1; + var scaleY = round(rect.height) / element.offsetHeight || 1; + return scaleX !== 1 || scaleY !== 1; + } // Returns the composite rect of an element relative to its offsetParent. + // Composite means it takes into account transforms as well as layout. + + + function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) { + if (isFixed === void 0) { + isFixed = false; + } + + var isOffsetParentAnElement = isHTMLElement(offsetParent); + var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent); + var documentElement = getDocumentElement(offsetParent); + var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed); + var scroll = { + scrollLeft: 0, + scrollTop: 0 + }; + var offsets = { + x: 0, + y: 0 + }; + + if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) { + if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078 + isScrollParent(documentElement)) { + scroll = getNodeScroll(offsetParent); + } + + if (isHTMLElement(offsetParent)) { + offsets = getBoundingClientRect(offsetParent, true); + offsets.x += offsetParent.clientLeft; + offsets.y += offsetParent.clientTop; + } else if (documentElement) { + offsets.x = getWindowScrollBarX(documentElement); + } + } + + return { + x: rect.left + scroll.scrollLeft - offsets.x, + y: rect.top + scroll.scrollTop - offsets.y, + width: rect.width, + height: rect.height + }; + } + + function order(modifiers) { + var map = new Map(); + var visited = new Set(); + var result = []; + modifiers.forEach(function (modifier) { + map.set(modifier.name, modifier); + }); // On visiting object, check for its dependencies and visit them recursively + + function sort(modifier) { + visited.add(modifier.name); + var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []); + requires.forEach(function (dep) { + if (!visited.has(dep)) { + var depModifier = map.get(dep); + + if (depModifier) { + sort(depModifier); + } + } + }); + result.push(modifier); + } + + modifiers.forEach(function (modifier) { + if (!visited.has(modifier.name)) { + // check for visited object + sort(modifier); + } + }); + return result; + } + + function orderModifiers(modifiers) { + // order based on dependencies + var orderedModifiers = order(modifiers); // order based on phase + + return modifierPhases.reduce(function (acc, phase) { + return acc.concat(orderedModifiers.filter(function (modifier) { + return modifier.phase === phase; + })); + }, []); + } + + function debounce(fn) { + var pending; + return function () { + if (!pending) { + pending = new Promise(function (resolve) { + Promise.resolve().then(function () { + pending = undefined; + resolve(fn()); + }); + }); + } + + return pending; + }; + } + + function mergeByName(modifiers) { + var merged = modifiers.reduce(function (merged, current) { + var existing = merged[current.name]; + merged[current.name] = existing ? Object.assign({}, existing, current, { + options: Object.assign({}, existing.options, current.options), + data: Object.assign({}, existing.data, current.data) + }) : current; + return merged; + }, {}); // IE11 does not support Object.values + + return Object.keys(merged).map(function (key) { + return merged[key]; + }); + } + + var DEFAULT_OPTIONS = { + placement: 'bottom', + modifiers: [], + strategy: 'absolute' + }; + + function areValidElements() { + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } + + return !args.some(function (element) { + return !(element && typeof element.getBoundingClientRect === 'function'); + }); + } + + function popperGenerator(generatorOptions) { + if (generatorOptions === void 0) { + generatorOptions = {}; + } + + var _generatorOptions = generatorOptions, + _generatorOptions$def = _generatorOptions.defaultModifiers, + defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def, + _generatorOptions$def2 = _generatorOptions.defaultOptions, + defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2; + return function createPopper(reference, popper, options) { + if (options === void 0) { + options = defaultOptions; + } + + var state = { + placement: 'bottom', + orderedModifiers: [], + options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions), + modifiersData: {}, + elements: { + reference: reference, + popper: popper + }, + attributes: {}, + styles: {} + }; + var effectCleanupFns = []; + var isDestroyed = false; + var instance = { + state: state, + setOptions: function setOptions(setOptionsAction) { + var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction; + cleanupModifierEffects(); + state.options = Object.assign({}, defaultOptions, state.options, options); + state.scrollParents = { + reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [], + popper: listScrollParents(popper) + }; // Orders the modifiers based on their dependencies and `phase` + // properties + + var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers + + state.orderedModifiers = orderedModifiers.filter(function (m) { + return m.enabled; + }); // Validate the provided modifiers so that the consumer will get warned + + runModifierEffects(); + return instance.update(); + }, + // Sync update – it will always be executed, even if not necessary. This + // is useful for low frequency updates where sync behavior simplifies the + // logic. + // For high frequency updates (e.g. `resize` and `scroll` events), always + // prefer the async Popper#update method + forceUpdate: function forceUpdate() { + if (isDestroyed) { + return; + } + + var _state$elements = state.elements, + reference = _state$elements.reference, + popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements + // anymore + + if (!areValidElements(reference, popper)) { + + return; + } // Store the reference and popper rects to be read by modifiers + + + state.rects = { + reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'), + popper: getLayoutRect(popper) + }; // Modifiers have the ability to reset the current update cycle. The + // most common use case for this is the `flip` modifier changing the + // placement, which then needs to re-run all the modifiers, because the + // logic was previously ran for the previous placement and is therefore + // stale/incorrect + + state.reset = false; + state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier + // is filled with the initial data specified by the modifier. This means + // it doesn't persist and is fresh on each update. + // To ensure persistent data, use `${name}#persistent` + + state.orderedModifiers.forEach(function (modifier) { + return state.modifiersData[modifier.name] = Object.assign({}, modifier.data); + }); + + for (var index = 0; index < state.orderedModifiers.length; index++) { + + if (state.reset === true) { + state.reset = false; + index = -1; + continue; + } + + var _state$orderedModifie = state.orderedModifiers[index], + fn = _state$orderedModifie.fn, + _state$orderedModifie2 = _state$orderedModifie.options, + _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2, + name = _state$orderedModifie.name; + + if (typeof fn === 'function') { + state = fn({ + state: state, + options: _options, + name: name, + instance: instance + }) || state; + } + } + }, + // Async and optimistically optimized update – it will not be executed if + // not necessary (debounced to run at most once-per-tick) + update: debounce(function () { + return new Promise(function (resolve) { + instance.forceUpdate(); + resolve(state); + }); + }), + destroy: function destroy() { + cleanupModifierEffects(); + isDestroyed = true; + } + }; + + if (!areValidElements(reference, popper)) { + + return instance; + } + + instance.setOptions(options).then(function (state) { + if (!isDestroyed && options.onFirstUpdate) { + options.onFirstUpdate(state); + } + }); // Modifiers have the ability to execute arbitrary code before the first + // update cycle runs. They will be executed in the same order as the update + // cycle. This is useful when a modifier adds some persistent data that + // other modifiers need to use, but the modifier is run after the dependent + // one. + + function runModifierEffects() { + state.orderedModifiers.forEach(function (_ref3) { + var name = _ref3.name, + _ref3$options = _ref3.options, + options = _ref3$options === void 0 ? {} : _ref3$options, + effect = _ref3.effect; + + if (typeof effect === 'function') { + var cleanupFn = effect({ + state: state, + name: name, + instance: instance, + options: options + }); + + var noopFn = function noopFn() {}; + + effectCleanupFns.push(cleanupFn || noopFn); + } + }); + } + + function cleanupModifierEffects() { + effectCleanupFns.forEach(function (fn) { + return fn(); + }); + effectCleanupFns = []; + } + + return instance; + }; + } + var createPopper$2 = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules + + var defaultModifiers$1 = [eventListeners, popperOffsets$1, computeStyles$1, applyStyles$1]; + var createPopper$1 = /*#__PURE__*/popperGenerator({ + defaultModifiers: defaultModifiers$1 + }); // eslint-disable-next-line import/no-unused-modules + + var defaultModifiers = [eventListeners, popperOffsets$1, computeStyles$1, applyStyles$1, offset$1, flip$1, preventOverflow$1, arrow$1, hide$1]; + var createPopper = /*#__PURE__*/popperGenerator({ + defaultModifiers: defaultModifiers + }); // eslint-disable-next-line import/no-unused-modules + + const Popper = /*#__PURE__*/Object.freeze(/*#__PURE__*/Object.defineProperty({ + __proto__: null, + popperGenerator, + detectOverflow, + createPopperBase: createPopper$2, + createPopper, + createPopperLite: createPopper$1, + top, + bottom, + right, + left, + auto, + basePlacements, + start, + end, + clippingParents, + viewport, + popper, + reference, + variationPlacements, + placements, + beforeRead, + read, + afterRead, + beforeMain, + main, + afterMain, + beforeWrite, + write, + afterWrite, + modifierPhases, + applyStyles: applyStyles$1, + arrow: arrow$1, + computeStyles: computeStyles$1, + eventListeners, + flip: flip$1, + hide: hide$1, + offset: offset$1, + popperOffsets: popperOffsets$1, + preventOverflow: preventOverflow$1 + }, Symbol.toStringTag, { value: 'Module' })); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): dropdown.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$a = 'dropdown'; + const DATA_KEY$6 = 'bs.dropdown'; + const EVENT_KEY$6 = `.${DATA_KEY$6}`; + const DATA_API_KEY$3 = '.data-api'; + const ESCAPE_KEY$2 = 'Escape'; + const TAB_KEY$1 = 'Tab'; + const ARROW_UP_KEY$1 = 'ArrowUp'; + const ARROW_DOWN_KEY$1 = 'ArrowDown'; + const RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button + + const EVENT_HIDE$5 = `hide${EVENT_KEY$6}`; + const EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`; + const EVENT_SHOW$5 = `show${EVENT_KEY$6}`; + const EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`; + const EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`; + const EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`; + const EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`; + const CLASS_NAME_SHOW$6 = 'show'; + const CLASS_NAME_DROPUP = 'dropup'; + const CLASS_NAME_DROPEND = 'dropend'; + const CLASS_NAME_DROPSTART = 'dropstart'; + const CLASS_NAME_DROPUP_CENTER = 'dropup-center'; + const CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center'; + const SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)'; + const SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`; + const SELECTOR_MENU = '.dropdown-menu'; + const SELECTOR_NAVBAR = '.navbar'; + const SELECTOR_NAVBAR_NAV = '.navbar-nav'; + const SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'; + const PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start'; + const PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end'; + const PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start'; + const PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end'; + const PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start'; + const PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start'; + const PLACEMENT_TOPCENTER = 'top'; + const PLACEMENT_BOTTOMCENTER = 'bottom'; + const Default$9 = { + autoClose: true, + boundary: 'clippingParents', + display: 'dynamic', + offset: [0, 2], + popperConfig: null, + reference: 'toggle' + }; + const DefaultType$9 = { + autoClose: '(boolean|string)', + boundary: '(string|element)', + display: 'string', + offset: '(array|string|function)', + popperConfig: '(null|object|function)', + reference: '(string|element|object)' + }; + /** + * Class definition + */ + + class Dropdown extends BaseComponent { + constructor(element, config) { + super(element, config); + this._popper = null; + this._parent = this._element.parentNode; // dropdown wrapper + // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/ + + this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0]; + this._inNavbar = this._detectNavbar(); + } // Getters + + + static get Default() { + return Default$9; + } + + static get DefaultType() { + return DefaultType$9; + } + + static get NAME() { + return NAME$a; + } // Public + + + toggle() { + return this._isShown() ? this.hide() : this.show(); + } + + show() { + if (isDisabled(this._element) || this._isShown()) { + return; + } + + const relatedTarget = { + relatedTarget: this._element + }; + const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget); + + if (showEvent.defaultPrevented) { + return; + } + + this._createPopper(); // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + + if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) { + for (const element of [].concat(...document.body.children)) { + EventHandler.on(element, 'mouseover', noop); + } + } + + this._element.focus(); + + this._element.setAttribute('aria-expanded', true); + + this._menu.classList.add(CLASS_NAME_SHOW$6); + + this._element.classList.add(CLASS_NAME_SHOW$6); + + EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget); + } + + hide() { + if (isDisabled(this._element) || !this._isShown()) { + return; + } + + const relatedTarget = { + relatedTarget: this._element + }; + + this._completeHide(relatedTarget); + } + + dispose() { + if (this._popper) { + this._popper.destroy(); + } + + super.dispose(); + } + + update() { + this._inNavbar = this._detectNavbar(); + + if (this._popper) { + this._popper.update(); + } + } // Private + + + _completeHide(relatedTarget) { + const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget); + + if (hideEvent.defaultPrevented) { + return; + } // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + + if ('ontouchstart' in document.documentElement) { + for (const element of [].concat(...document.body.children)) { + EventHandler.off(element, 'mouseover', noop); + } + } + + if (this._popper) { + this._popper.destroy(); + } + + this._menu.classList.remove(CLASS_NAME_SHOW$6); + + this._element.classList.remove(CLASS_NAME_SHOW$6); + + this._element.setAttribute('aria-expanded', 'false'); + + Manipulator.removeDataAttribute(this._menu, 'popper'); + EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget); + } + + _getConfig(config) { + config = super._getConfig(config); + + if (typeof config.reference === 'object' && !isElement$1(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') { + // Popper virtual elements require a getBoundingClientRect method + throw new TypeError(`${NAME$a.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`); + } + + return config; + } + + _createPopper() { + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap\'s dropdowns require Popper (https://popper.js.org)'); + } + + let referenceElement = this._element; + + if (this._config.reference === 'parent') { + referenceElement = this._parent; + } else if (isElement$1(this._config.reference)) { + referenceElement = getElement(this._config.reference); + } else if (typeof this._config.reference === 'object') { + referenceElement = this._config.reference; + } + + const popperConfig = this._getPopperConfig(); + + this._popper = createPopper(referenceElement, this._menu, popperConfig); + } + + _isShown() { + return this._menu.classList.contains(CLASS_NAME_SHOW$6); + } + + _getPlacement() { + const parentDropdown = this._parent; + + if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) { + return PLACEMENT_RIGHT; + } + + if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) { + return PLACEMENT_LEFT; + } + + if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) { + return PLACEMENT_TOPCENTER; + } + + if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) { + return PLACEMENT_BOTTOMCENTER; + } // We need to trim the value because custom properties can also include spaces + + + const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end'; + + if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) { + return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP; + } + + return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM; + } + + _detectNavbar() { + return this._element.closest(SELECTOR_NAVBAR) !== null; + } + + _getOffset() { + const { + offset + } = this._config; + + if (typeof offset === 'string') { + return offset.split(',').map(value => Number.parseInt(value, 10)); + } + + if (typeof offset === 'function') { + return popperData => offset(popperData, this._element); + } + + return offset; + } + + _getPopperConfig() { + const defaultBsPopperConfig = { + placement: this._getPlacement(), + modifiers: [{ + name: 'preventOverflow', + options: { + boundary: this._config.boundary + } + }, { + name: 'offset', + options: { + offset: this._getOffset() + } + }] + }; // Disable Popper if we have a static display or Dropdown is in Navbar + + if (this._inNavbar || this._config.display === 'static') { + Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // todo:v6 remove + + defaultBsPopperConfig.modifiers = [{ + name: 'applyStyles', + enabled: false + }]; + } + + return { ...defaultBsPopperConfig, + ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig) + }; + } + + _selectMenuItem({ + key, + target + }) { + const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element)); + + if (!items.length) { + return; + } // if target isn't included in items (e.g. when expanding the dropdown) + // allow cycling to get the last item in case key equals ARROW_UP_KEY + + + getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus(); + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Dropdown.getOrCreateInstance(this, config); + + if (typeof config !== 'string') { + return; + } + + if (typeof data[config] === 'undefined') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](); + }); + } + + static clearMenus(event) { + if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) { + return; + } + + const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN); + + for (const toggle of openToggles) { + const context = Dropdown.getInstance(toggle); + + if (!context || context._config.autoClose === false) { + continue; + } + + const composedPath = event.composedPath(); + const isMenuTarget = composedPath.includes(context._menu); + + if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) { + continue; + } // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu + + + if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) { + continue; + } + + const relatedTarget = { + relatedTarget: context._element + }; + + if (event.type === 'click') { + relatedTarget.clickEvent = event; + } + + context._completeHide(relatedTarget); + } + } + + static dataApiKeydownHandler(event) { + // If not an UP | DOWN | ESCAPE key => not a dropdown command + // If input/textarea && if key is other than ESCAPE => not a dropdown command + const isInput = /input|textarea/i.test(event.target.tagName); + const isEscapeEvent = event.key === ESCAPE_KEY$2; + const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key); + + if (!isUpOrDownEvent && !isEscapeEvent) { + return; + } + + if (isInput && !isEscapeEvent) { + return; + } + + event.preventDefault(); // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/ + + const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0]; + const instance = Dropdown.getOrCreateInstance(getToggleButton); + + if (isUpOrDownEvent) { + event.stopPropagation(); + instance.show(); + + instance._selectMenuItem(event); + + return; + } + + if (instance._isShown()) { + // else is escape and we check if it is shown + event.stopPropagation(); + instance.hide(); + getToggleButton.focus(); + } + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler); + EventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler); + EventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus); + EventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus); + EventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) { + event.preventDefault(); + Dropdown.getOrCreateInstance(this).toggle(); + }); + /** + * jQuery + */ + + defineJQueryPlugin(Dropdown); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/scrollBar.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top'; + const SELECTOR_STICKY_CONTENT = '.sticky-top'; + const PROPERTY_PADDING = 'padding-right'; + const PROPERTY_MARGIN = 'margin-right'; + /** + * Class definition + */ + + class ScrollBarHelper { + constructor() { + this._element = document.body; + } // Public + + + getWidth() { + // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes + const documentWidth = document.documentElement.clientWidth; + return Math.abs(window.innerWidth - documentWidth); + } + + hide() { + const width = this.getWidth(); + + this._disableOverFlow(); // give padding to element to balance the hidden scrollbar width + + + this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width); // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth + + + this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width); + + this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width); + } + + reset() { + this._resetElementAttributes(this._element, 'overflow'); + + this._resetElementAttributes(this._element, PROPERTY_PADDING); + + this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING); + + this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN); + } + + isOverflowing() { + return this.getWidth() > 0; + } // Private + + + _disableOverFlow() { + this._saveInitialAttribute(this._element, 'overflow'); + + this._element.style.overflow = 'hidden'; + } + + _setElementAttributes(selector, styleProperty, callback) { + const scrollbarWidth = this.getWidth(); + + const manipulationCallBack = element => { + if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) { + return; + } + + this._saveInitialAttribute(element, styleProperty); + + const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty); + element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`); + }; + + this._applyManipulationCallback(selector, manipulationCallBack); + } + + _saveInitialAttribute(element, styleProperty) { + const actualValue = element.style.getPropertyValue(styleProperty); + + if (actualValue) { + Manipulator.setDataAttribute(element, styleProperty, actualValue); + } + } + + _resetElementAttributes(selector, styleProperty) { + const manipulationCallBack = element => { + const value = Manipulator.getDataAttribute(element, styleProperty); // We only want to remove the property if the value is `null`; the value can also be zero + + if (value === null) { + element.style.removeProperty(styleProperty); + return; + } + + Manipulator.removeDataAttribute(element, styleProperty); + element.style.setProperty(styleProperty, value); + }; + + this._applyManipulationCallback(selector, manipulationCallBack); + } + + _applyManipulationCallback(selector, callBack) { + if (isElement$1(selector)) { + callBack(selector); + return; + } + + for (const sel of SelectorEngine.find(selector, this._element)) { + callBack(sel); + } + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/backdrop.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$9 = 'backdrop'; + const CLASS_NAME_FADE$4 = 'fade'; + const CLASS_NAME_SHOW$5 = 'show'; + const EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`; + const Default$8 = { + className: 'modal-backdrop', + clickCallback: null, + isAnimated: false, + isVisible: true, + // if false, we use the backdrop helper without adding any element to the dom + rootElement: 'body' // give the choice to place backdrop under different elements + + }; + const DefaultType$8 = { + className: 'string', + clickCallback: '(function|null)', + isAnimated: 'boolean', + isVisible: 'boolean', + rootElement: '(element|string)' + }; + /** + * Class definition + */ + + class Backdrop extends Config { + constructor(config) { + super(); + this._config = this._getConfig(config); + this._isAppended = false; + this._element = null; + } // Getters + + + static get Default() { + return Default$8; + } + + static get DefaultType() { + return DefaultType$8; + } + + static get NAME() { + return NAME$9; + } // Public + + + show(callback) { + if (!this._config.isVisible) { + execute(callback); + return; + } + + this._append(); + + const element = this._getElement(); + + if (this._config.isAnimated) { + reflow(element); + } + + element.classList.add(CLASS_NAME_SHOW$5); + + this._emulateAnimation(() => { + execute(callback); + }); + } + + hide(callback) { + if (!this._config.isVisible) { + execute(callback); + return; + } + + this._getElement().classList.remove(CLASS_NAME_SHOW$5); + + this._emulateAnimation(() => { + this.dispose(); + execute(callback); + }); + } + + dispose() { + if (!this._isAppended) { + return; + } + + EventHandler.off(this._element, EVENT_MOUSEDOWN); + + this._element.remove(); + + this._isAppended = false; + } // Private + + + _getElement() { + if (!this._element) { + const backdrop = document.createElement('div'); + backdrop.className = this._config.className; + + if (this._config.isAnimated) { + backdrop.classList.add(CLASS_NAME_FADE$4); + } + + this._element = backdrop; + } + + return this._element; + } + + _configAfterMerge(config) { + // use getElement() with the default "body" to get a fresh Element on each instantiation + config.rootElement = getElement(config.rootElement); + return config; + } + + _append() { + if (this._isAppended) { + return; + } + + const element = this._getElement(); + + this._config.rootElement.append(element); + + EventHandler.on(element, EVENT_MOUSEDOWN, () => { + execute(this._config.clickCallback); + }); + this._isAppended = true; + } + + _emulateAnimation(callback) { + executeAfterTransition(callback, this._getElement(), this._config.isAnimated); + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/focustrap.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$8 = 'focustrap'; + const DATA_KEY$5 = 'bs.focustrap'; + const EVENT_KEY$5 = `.${DATA_KEY$5}`; + const EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`; + const EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`; + const TAB_KEY = 'Tab'; + const TAB_NAV_FORWARD = 'forward'; + const TAB_NAV_BACKWARD = 'backward'; + const Default$7 = { + autofocus: true, + trapElement: null // The element to trap focus inside of + + }; + const DefaultType$7 = { + autofocus: 'boolean', + trapElement: 'element' + }; + /** + * Class definition + */ + + class FocusTrap extends Config { + constructor(config) { + super(); + this._config = this._getConfig(config); + this._isActive = false; + this._lastTabNavDirection = null; + } // Getters + + + static get Default() { + return Default$7; + } + + static get DefaultType() { + return DefaultType$7; + } + + static get NAME() { + return NAME$8; + } // Public + + + activate() { + if (this._isActive) { + return; + } + + if (this._config.autofocus) { + this._config.trapElement.focus(); + } + + EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop + + EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event)); + EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event)); + this._isActive = true; + } + + deactivate() { + if (!this._isActive) { + return; + } + + this._isActive = false; + EventHandler.off(document, EVENT_KEY$5); + } // Private + + + _handleFocusin(event) { + const { + trapElement + } = this._config; + + if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) { + return; + } + + const elements = SelectorEngine.focusableChildren(trapElement); + + if (elements.length === 0) { + trapElement.focus(); + } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) { + elements[elements.length - 1].focus(); + } else { + elements[0].focus(); + } + } + + _handleKeydown(event) { + if (event.key !== TAB_KEY) { + return; + } + + this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD; + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): modal.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$7 = 'modal'; + const DATA_KEY$4 = 'bs.modal'; + const EVENT_KEY$4 = `.${DATA_KEY$4}`; + const DATA_API_KEY$2 = '.data-api'; + const ESCAPE_KEY$1 = 'Escape'; + const EVENT_HIDE$4 = `hide${EVENT_KEY$4}`; + const EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`; + const EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`; + const EVENT_SHOW$4 = `show${EVENT_KEY$4}`; + const EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`; + const EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`; + const EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`; + const EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`; + const EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`; + const EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`; + const CLASS_NAME_OPEN = 'modal-open'; + const CLASS_NAME_FADE$3 = 'fade'; + const CLASS_NAME_SHOW$4 = 'show'; + const CLASS_NAME_STATIC = 'modal-static'; + const OPEN_SELECTOR$1 = '.modal.show'; + const SELECTOR_DIALOG = '.modal-dialog'; + const SELECTOR_MODAL_BODY = '.modal-body'; + const SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle="modal"]'; + const Default$6 = { + backdrop: true, + focus: true, + keyboard: true + }; + const DefaultType$6 = { + backdrop: '(boolean|string)', + focus: 'boolean', + keyboard: 'boolean' + }; + /** + * Class definition + */ + + class Modal extends BaseComponent { + constructor(element, config) { + super(element, config); + this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element); + this._backdrop = this._initializeBackDrop(); + this._focustrap = this._initializeFocusTrap(); + this._isShown = false; + this._isTransitioning = false; + this._scrollBar = new ScrollBarHelper(); + + this._addEventListeners(); + } // Getters + + + static get Default() { + return Default$6; + } + + static get DefaultType() { + return DefaultType$6; + } + + static get NAME() { + return NAME$7; + } // Public + + + toggle(relatedTarget) { + return this._isShown ? this.hide() : this.show(relatedTarget); + } + + show(relatedTarget) { + if (this._isShown || this._isTransitioning) { + return; + } + + const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, { + relatedTarget + }); + + if (showEvent.defaultPrevented) { + return; + } + + this._isShown = true; + this._isTransitioning = true; + + this._scrollBar.hide(); + + document.body.classList.add(CLASS_NAME_OPEN); + + this._adjustDialog(); + + this._backdrop.show(() => this._showElement(relatedTarget)); + } + + hide() { + if (!this._isShown || this._isTransitioning) { + return; + } + + const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4); + + if (hideEvent.defaultPrevented) { + return; + } + + this._isShown = false; + this._isTransitioning = true; + + this._focustrap.deactivate(); + + this._element.classList.remove(CLASS_NAME_SHOW$4); + + this._queueCallback(() => this._hideModal(), this._element, this._isAnimated()); + } + + dispose() { + for (const htmlElement of [window, this._dialog]) { + EventHandler.off(htmlElement, EVENT_KEY$4); + } + + this._backdrop.dispose(); + + this._focustrap.deactivate(); + + super.dispose(); + } + + handleUpdate() { + this._adjustDialog(); + } // Private + + + _initializeBackDrop() { + return new Backdrop({ + isVisible: Boolean(this._config.backdrop), + // 'static' option will be translated to true, and booleans will keep their value, + isAnimated: this._isAnimated() + }); + } + + _initializeFocusTrap() { + return new FocusTrap({ + trapElement: this._element + }); + } + + _showElement(relatedTarget) { + // try to append dynamic modal + if (!document.body.contains(this._element)) { + document.body.append(this._element); + } + + this._element.style.display = 'block'; + + this._element.removeAttribute('aria-hidden'); + + this._element.setAttribute('aria-modal', true); + + this._element.setAttribute('role', 'dialog'); + + this._element.scrollTop = 0; + const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog); + + if (modalBody) { + modalBody.scrollTop = 0; + } + + reflow(this._element); + + this._element.classList.add(CLASS_NAME_SHOW$4); + + const transitionComplete = () => { + if (this._config.focus) { + this._focustrap.activate(); + } + + this._isTransitioning = false; + EventHandler.trigger(this._element, EVENT_SHOWN$4, { + relatedTarget + }); + }; + + this._queueCallback(transitionComplete, this._dialog, this._isAnimated()); + } + + _addEventListeners() { + EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => { + if (event.key !== ESCAPE_KEY$1) { + return; + } + + if (this._config.keyboard) { + event.preventDefault(); + this.hide(); + return; + } + + this._triggerBackdropTransition(); + }); + EventHandler.on(window, EVENT_RESIZE$1, () => { + if (this._isShown && !this._isTransitioning) { + this._adjustDialog(); + } + }); + EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => { + EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => { + // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks + if (this._dialog.contains(event.target) || this._dialog.contains(event2.target)) { + return; + } + + if (this._config.backdrop === 'static') { + this._triggerBackdropTransition(); + + return; + } + + if (this._config.backdrop) { + this.hide(); + } + }); + }); + } + + _hideModal() { + this._element.style.display = 'none'; + + this._element.setAttribute('aria-hidden', true); + + this._element.removeAttribute('aria-modal'); + + this._element.removeAttribute('role'); + + this._isTransitioning = false; + + this._backdrop.hide(() => { + document.body.classList.remove(CLASS_NAME_OPEN); + + this._resetAdjustments(); + + this._scrollBar.reset(); + + EventHandler.trigger(this._element, EVENT_HIDDEN$4); + }); + } + + _isAnimated() { + return this._element.classList.contains(CLASS_NAME_FADE$3); + } + + _triggerBackdropTransition() { + const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1); + + if (hideEvent.defaultPrevented) { + return; + } + + const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; + const initialOverflowY = this._element.style.overflowY; // return if the following background transition hasn't yet completed + + if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) { + return; + } + + if (!isModalOverflowing) { + this._element.style.overflowY = 'hidden'; + } + + this._element.classList.add(CLASS_NAME_STATIC); + + this._queueCallback(() => { + this._element.classList.remove(CLASS_NAME_STATIC); + + this._queueCallback(() => { + this._element.style.overflowY = initialOverflowY; + }, this._dialog); + }, this._dialog); + + this._element.focus(); + } + /** + * The following methods are used to handle overflowing modals + */ + + + _adjustDialog() { + const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; + + const scrollbarWidth = this._scrollBar.getWidth(); + + const isBodyOverflowing = scrollbarWidth > 0; + + if (isBodyOverflowing && !isModalOverflowing) { + const property = isRTL() ? 'paddingLeft' : 'paddingRight'; + this._element.style[property] = `${scrollbarWidth}px`; + } + + if (!isBodyOverflowing && isModalOverflowing) { + const property = isRTL() ? 'paddingRight' : 'paddingLeft'; + this._element.style[property] = `${scrollbarWidth}px`; + } + } + + _resetAdjustments() { + this._element.style.paddingLeft = ''; + this._element.style.paddingRight = ''; + } // Static + + + static jQueryInterface(config, relatedTarget) { + return this.each(function () { + const data = Modal.getOrCreateInstance(this, config); + + if (typeof config !== 'string') { + return; + } + + if (typeof data[config] === 'undefined') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](relatedTarget); + }); + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) { + const target = getElementFromSelector(this); + + if (['A', 'AREA'].includes(this.tagName)) { + event.preventDefault(); + } + + EventHandler.one(target, EVENT_SHOW$4, showEvent => { + if (showEvent.defaultPrevented) { + // only register focus restorer if modal will actually get shown + return; + } + + EventHandler.one(target, EVENT_HIDDEN$4, () => { + if (isVisible(this)) { + this.focus(); + } + }); + }); // avoid conflict when clicking modal toggler while another one is open + + const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1); + + if (alreadyOpen) { + Modal.getInstance(alreadyOpen).hide(); + } + + const data = Modal.getOrCreateInstance(target); + data.toggle(this); + }); + enableDismissTrigger(Modal); + /** + * jQuery + */ + + defineJQueryPlugin(Modal); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): offcanvas.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$6 = 'offcanvas'; + const DATA_KEY$3 = 'bs.offcanvas'; + const EVENT_KEY$3 = `.${DATA_KEY$3}`; + const DATA_API_KEY$1 = '.data-api'; + const EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`; + const ESCAPE_KEY = 'Escape'; + const CLASS_NAME_SHOW$3 = 'show'; + const CLASS_NAME_SHOWING$1 = 'showing'; + const CLASS_NAME_HIDING = 'hiding'; + const CLASS_NAME_BACKDROP = 'offcanvas-backdrop'; + const OPEN_SELECTOR = '.offcanvas.show'; + const EVENT_SHOW$3 = `show${EVENT_KEY$3}`; + const EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`; + const EVENT_HIDE$3 = `hide${EVENT_KEY$3}`; + const EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`; + const EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`; + const EVENT_RESIZE = `resize${EVENT_KEY$3}`; + const EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`; + const EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`; + const SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle="offcanvas"]'; + const Default$5 = { + backdrop: true, + keyboard: true, + scroll: false + }; + const DefaultType$5 = { + backdrop: '(boolean|string)', + keyboard: 'boolean', + scroll: 'boolean' + }; + /** + * Class definition + */ + + class Offcanvas extends BaseComponent { + constructor(element, config) { + super(element, config); + this._isShown = false; + this._backdrop = this._initializeBackDrop(); + this._focustrap = this._initializeFocusTrap(); + + this._addEventListeners(); + } // Getters + + + static get Default() { + return Default$5; + } + + static get DefaultType() { + return DefaultType$5; + } + + static get NAME() { + return NAME$6; + } // Public + + + toggle(relatedTarget) { + return this._isShown ? this.hide() : this.show(relatedTarget); + } + + show(relatedTarget) { + if (this._isShown) { + return; + } + + const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, { + relatedTarget + }); + + if (showEvent.defaultPrevented) { + return; + } + + this._isShown = true; + + this._backdrop.show(); + + if (!this._config.scroll) { + new ScrollBarHelper().hide(); + } + + this._element.setAttribute('aria-modal', true); + + this._element.setAttribute('role', 'dialog'); + + this._element.classList.add(CLASS_NAME_SHOWING$1); + + const completeCallBack = () => { + if (!this._config.scroll || this._config.backdrop) { + this._focustrap.activate(); + } + + this._element.classList.add(CLASS_NAME_SHOW$3); + + this._element.classList.remove(CLASS_NAME_SHOWING$1); + + EventHandler.trigger(this._element, EVENT_SHOWN$3, { + relatedTarget + }); + }; + + this._queueCallback(completeCallBack, this._element, true); + } + + hide() { + if (!this._isShown) { + return; + } + + const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3); + + if (hideEvent.defaultPrevented) { + return; + } + + this._focustrap.deactivate(); + + this._element.blur(); + + this._isShown = false; + + this._element.classList.add(CLASS_NAME_HIDING); + + this._backdrop.hide(); + + const completeCallback = () => { + this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING); + + this._element.removeAttribute('aria-modal'); + + this._element.removeAttribute('role'); + + if (!this._config.scroll) { + new ScrollBarHelper().reset(); + } + + EventHandler.trigger(this._element, EVENT_HIDDEN$3); + }; + + this._queueCallback(completeCallback, this._element, true); + } + + dispose() { + this._backdrop.dispose(); + + this._focustrap.deactivate(); + + super.dispose(); + } // Private + + + _initializeBackDrop() { + const clickCallback = () => { + if (this._config.backdrop === 'static') { + EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED); + return; + } + + this.hide(); + }; // 'static' option will be translated to true, and booleans will keep their value + + + const isVisible = Boolean(this._config.backdrop); + return new Backdrop({ + className: CLASS_NAME_BACKDROP, + isVisible, + isAnimated: true, + rootElement: this._element.parentNode, + clickCallback: isVisible ? clickCallback : null + }); + } + + _initializeFocusTrap() { + return new FocusTrap({ + trapElement: this._element + }); + } + + _addEventListeners() { + EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => { + if (event.key !== ESCAPE_KEY) { + return; + } + + if (!this._config.keyboard) { + EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED); + return; + } + + this.hide(); + }); + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Offcanvas.getOrCreateInstance(this, config); + + if (typeof config !== 'string') { + return; + } + + if (data[config] === undefined || config.startsWith('_') || config === 'constructor') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](this); + }); + } + + } + /** + * Data API implementation + */ + + + EventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) { + const target = getElementFromSelector(this); + + if (['A', 'AREA'].includes(this.tagName)) { + event.preventDefault(); + } + + if (isDisabled(this)) { + return; + } + + EventHandler.one(target, EVENT_HIDDEN$3, () => { + // focus on trigger when it is closed + if (isVisible(this)) { + this.focus(); + } + }); // avoid conflict when clicking a toggler of an offcanvas, while another is open + + const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR); + + if (alreadyOpen && alreadyOpen !== target) { + Offcanvas.getInstance(alreadyOpen).hide(); + } + + const data = Offcanvas.getOrCreateInstance(target); + data.toggle(this); + }); + EventHandler.on(window, EVENT_LOAD_DATA_API$2, () => { + for (const selector of SelectorEngine.find(OPEN_SELECTOR)) { + Offcanvas.getOrCreateInstance(selector).show(); + } + }); + EventHandler.on(window, EVENT_RESIZE, () => { + for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) { + if (getComputedStyle(element).position !== 'fixed') { + Offcanvas.getOrCreateInstance(element).hide(); + } + } + }); + enableDismissTrigger(Offcanvas); + /** + * jQuery + */ + + defineJQueryPlugin(Offcanvas); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/sanitizer.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + const uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']); + const ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i; + /** + * A pattern that recognizes a commonly useful subset of URLs that are safe. + * + * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts + */ + + const SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i; + /** + * A pattern that matches safe data URLs. Only matches image, video and audio types. + * + * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts + */ + + const DATA_URL_PATTERN = /^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[\d+/a-z]+=*$/i; + + const allowedAttribute = (attribute, allowedAttributeList) => { + const attributeName = attribute.nodeName.toLowerCase(); + + if (allowedAttributeList.includes(attributeName)) { + if (uriAttributes.has(attributeName)) { + return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue) || DATA_URL_PATTERN.test(attribute.nodeValue)); + } + + return true; + } // Check if a regular expression validates the attribute. + + + return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName)); + }; + + const DefaultAllowlist = { + // Global attributes allowed on any supplied element below. + '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN], + a: ['target', 'href', 'title', 'rel'], + area: [], + b: [], + br: [], + col: [], + code: [], + div: [], + em: [], + hr: [], + h1: [], + h2: [], + h3: [], + h4: [], + h5: [], + h6: [], + i: [], + img: ['src', 'srcset', 'alt', 'title', 'width', 'height'], + li: [], + ol: [], + p: [], + pre: [], + s: [], + small: [], + span: [], + sub: [], + sup: [], + strong: [], + u: [], + ul: [] + }; + function sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) { + if (!unsafeHtml.length) { + return unsafeHtml; + } + + if (sanitizeFunction && typeof sanitizeFunction === 'function') { + return sanitizeFunction(unsafeHtml); + } + + const domParser = new window.DOMParser(); + const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html'); + const elements = [].concat(...createdDocument.body.querySelectorAll('*')); + + for (const element of elements) { + const elementName = element.nodeName.toLowerCase(); + + if (!Object.keys(allowList).includes(elementName)) { + element.remove(); + continue; + } + + const attributeList = [].concat(...element.attributes); + const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []); + + for (const attribute of attributeList) { + if (!allowedAttribute(attribute, allowedAttributes)) { + element.removeAttribute(attribute.nodeName); + } + } + } + + return createdDocument.body.innerHTML; + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): util/template-factory.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$5 = 'TemplateFactory'; + const Default$4 = { + allowList: DefaultAllowlist, + content: {}, + // { selector : text , selector2 : text2 , } + extraClass: '', + html: false, + sanitize: true, + sanitizeFn: null, + template: '
' + }; + const DefaultType$4 = { + allowList: 'object', + content: 'object', + extraClass: '(string|function)', + html: 'boolean', + sanitize: 'boolean', + sanitizeFn: '(null|function)', + template: 'string' + }; + const DefaultContentType = { + entry: '(string|element|function|null)', + selector: '(string|element)' + }; + /** + * Class definition + */ + + class TemplateFactory extends Config { + constructor(config) { + super(); + this._config = this._getConfig(config); + } // Getters + + + static get Default() { + return Default$4; + } + + static get DefaultType() { + return DefaultType$4; + } + + static get NAME() { + return NAME$5; + } // Public + + + getContent() { + return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean); + } + + hasContent() { + return this.getContent().length > 0; + } + + changeContent(content) { + this._checkContent(content); + + this._config.content = { ...this._config.content, + ...content + }; + return this; + } + + toHtml() { + const templateWrapper = document.createElement('div'); + templateWrapper.innerHTML = this._maybeSanitize(this._config.template); + + for (const [selector, text] of Object.entries(this._config.content)) { + this._setContent(templateWrapper, text, selector); + } + + const template = templateWrapper.children[0]; + + const extraClass = this._resolvePossibleFunction(this._config.extraClass); + + if (extraClass) { + template.classList.add(...extraClass.split(' ')); + } + + return template; + } // Private + + + _typeCheckConfig(config) { + super._typeCheckConfig(config); + + this._checkContent(config.content); + } + + _checkContent(arg) { + for (const [selector, content] of Object.entries(arg)) { + super._typeCheckConfig({ + selector, + entry: content + }, DefaultContentType); + } + } + + _setContent(template, content, selector) { + const templateElement = SelectorEngine.findOne(selector, template); + + if (!templateElement) { + return; + } + + content = this._resolvePossibleFunction(content); + + if (!content) { + templateElement.remove(); + return; + } + + if (isElement$1(content)) { + this._putElementInTemplate(getElement(content), templateElement); + + return; + } + + if (this._config.html) { + templateElement.innerHTML = this._maybeSanitize(content); + return; + } + + templateElement.textContent = content; + } + + _maybeSanitize(arg) { + return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg; + } + + _resolvePossibleFunction(arg) { + return typeof arg === 'function' ? arg(this) : arg; + } + + _putElementInTemplate(element, templateElement) { + if (this._config.html) { + templateElement.innerHTML = ''; + templateElement.append(element); + return; + } + + templateElement.textContent = element.textContent; + } + + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): tooltip.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$4 = 'tooltip'; + const DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']); + const CLASS_NAME_FADE$2 = 'fade'; + const CLASS_NAME_MODAL = 'modal'; + const CLASS_NAME_SHOW$2 = 'show'; + const SELECTOR_TOOLTIP_INNER = '.tooltip-inner'; + const SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`; + const EVENT_MODAL_HIDE = 'hide.bs.modal'; + const TRIGGER_HOVER = 'hover'; + const TRIGGER_FOCUS = 'focus'; + const TRIGGER_CLICK = 'click'; + const TRIGGER_MANUAL = 'manual'; + const EVENT_HIDE$2 = 'hide'; + const EVENT_HIDDEN$2 = 'hidden'; + const EVENT_SHOW$2 = 'show'; + const EVENT_SHOWN$2 = 'shown'; + const EVENT_INSERTED = 'inserted'; + const EVENT_CLICK$1 = 'click'; + const EVENT_FOCUSIN$1 = 'focusin'; + const EVENT_FOCUSOUT$1 = 'focusout'; + const EVENT_MOUSEENTER = 'mouseenter'; + const EVENT_MOUSELEAVE = 'mouseleave'; + const AttachmentMap = { + AUTO: 'auto', + TOP: 'top', + RIGHT: isRTL() ? 'left' : 'right', + BOTTOM: 'bottom', + LEFT: isRTL() ? 'right' : 'left' + }; + const Default$3 = { + allowList: DefaultAllowlist, + animation: true, + boundary: 'clippingParents', + container: false, + customClass: '', + delay: 0, + fallbackPlacements: ['top', 'right', 'bottom', 'left'], + html: false, + offset: [0, 0], + placement: 'top', + popperConfig: null, + sanitize: true, + sanitizeFn: null, + selector: false, + template: '', + title: '', + trigger: 'hover focus' + }; + const DefaultType$3 = { + allowList: 'object', + animation: 'boolean', + boundary: '(string|element)', + container: '(string|element|boolean)', + customClass: '(string|function)', + delay: '(number|object)', + fallbackPlacements: 'array', + html: 'boolean', + offset: '(array|string|function)', + placement: '(string|function)', + popperConfig: '(null|object|function)', + sanitize: 'boolean', + sanitizeFn: '(null|function)', + selector: '(string|boolean)', + template: 'string', + title: '(string|element|function)', + trigger: 'string' + }; + /** + * Class definition + */ + + class Tooltip extends BaseComponent { + constructor(element, config) { + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap\'s tooltips require Popper (https://popper.js.org)'); + } + + super(element, config); // Private + + this._isEnabled = true; + this._timeout = 0; + this._isHovered = null; + this._activeTrigger = {}; + this._popper = null; + this._templateFactory = null; + this._newContent = null; // Protected + + this.tip = null; + + this._setListeners(); + } // Getters + + + static get Default() { + return Default$3; + } + + static get DefaultType() { + return DefaultType$3; + } + + static get NAME() { + return NAME$4; + } // Public + + + enable() { + this._isEnabled = true; + } + + disable() { + this._isEnabled = false; + } + + toggleEnabled() { + this._isEnabled = !this._isEnabled; + } + + toggle(event) { + if (!this._isEnabled) { + return; + } + + if (event) { + const context = this._initializeOnDelegatedTarget(event); + + context._activeTrigger.click = !context._activeTrigger.click; + + if (context._isWithActiveTrigger()) { + context._enter(); + } else { + context._leave(); + } + + return; + } + + if (this._isShown()) { + this._leave(); + + return; + } + + this._enter(); + } + + dispose() { + clearTimeout(this._timeout); + EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler); + + if (this.tip) { + this.tip.remove(); + } + + if (this._config.originalTitle) { + this._element.setAttribute('title', this._config.originalTitle); + } + + this._disposePopper(); + + super.dispose(); + } + + show() { + if (this._element.style.display === 'none') { + throw new Error('Please use show on visible elements'); + } + + if (!(this._isWithContent() && this._isEnabled)) { + return; + } + + const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2)); + const shadowRoot = findShadowRoot(this._element); + + const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element); + + if (showEvent.defaultPrevented || !isInTheDom) { + return; + } // todo v6 remove this OR make it optional + + + if (this.tip) { + this.tip.remove(); + this.tip = null; + } + + const tip = this._getTipElement(); + + this._element.setAttribute('aria-describedby', tip.getAttribute('id')); + + const { + container + } = this._config; + + if (!this._element.ownerDocument.documentElement.contains(this.tip)) { + container.append(tip); + EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED)); + } + + if (this._popper) { + this._popper.update(); + } else { + this._popper = this._createPopper(tip); + } + + tip.classList.add(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + if ('ontouchstart' in document.documentElement) { + for (const element of [].concat(...document.body.children)) { + EventHandler.on(element, 'mouseover', noop); + } + } + + const complete = () => { + EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2)); + + if (this._isHovered === false) { + this._leave(); + } + + this._isHovered = false; + }; + + this._queueCallback(complete, this.tip, this._isAnimated()); + } + + hide() { + if (!this._isShown()) { + return; + } + + const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2)); + + if (hideEvent.defaultPrevented) { + return; + } + + const tip = this._getTipElement(); + + tip.classList.remove(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + if ('ontouchstart' in document.documentElement) { + for (const element of [].concat(...document.body.children)) { + EventHandler.off(element, 'mouseover', noop); + } + } + + this._activeTrigger[TRIGGER_CLICK] = false; + this._activeTrigger[TRIGGER_FOCUS] = false; + this._activeTrigger[TRIGGER_HOVER] = false; + this._isHovered = null; // it is a trick to support manual triggering + + const complete = () => { + if (this._isWithActiveTrigger()) { + return; + } + + if (!this._isHovered) { + tip.remove(); + } + + this._element.removeAttribute('aria-describedby'); + + EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2)); + + this._disposePopper(); + }; + + this._queueCallback(complete, this.tip, this._isAnimated()); + } + + update() { + if (this._popper) { + this._popper.update(); + } + } // Protected + + + _isWithContent() { + return Boolean(this._getTitle()); + } + + _getTipElement() { + if (!this.tip) { + this.tip = this._createTipElement(this._newContent || this._getContentForTemplate()); + } + + return this.tip; + } + + _createTipElement(content) { + const tip = this._getTemplateFactory(content).toHtml(); // todo: remove this check on v6 + + + if (!tip) { + return null; + } + + tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2); // todo: on v6 the following can be achieved with CSS only + + tip.classList.add(`bs-${this.constructor.NAME}-auto`); + const tipId = getUID(this.constructor.NAME).toString(); + tip.setAttribute('id', tipId); + + if (this._isAnimated()) { + tip.classList.add(CLASS_NAME_FADE$2); + } + + return tip; + } + + setContent(content) { + this._newContent = content; + + if (this._isShown()) { + this._disposePopper(); + + this.show(); + } + } + + _getTemplateFactory(content) { + if (this._templateFactory) { + this._templateFactory.changeContent(content); + } else { + this._templateFactory = new TemplateFactory({ ...this._config, + // the `content` var has to be after `this._config` + // to override config.content in case of popover + content, + extraClass: this._resolvePossibleFunction(this._config.customClass) + }); + } + + return this._templateFactory; + } + + _getContentForTemplate() { + return { + [SELECTOR_TOOLTIP_INNER]: this._getTitle() + }; + } + + _getTitle() { + return this._resolvePossibleFunction(this._config.title) || this._config.originalTitle; + } // Private + + + _initializeOnDelegatedTarget(event) { + return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig()); + } + + _isAnimated() { + return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2); + } + + _isShown() { + return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2); + } + + _createPopper(tip) { + const placement = typeof this._config.placement === 'function' ? this._config.placement.call(this, tip, this._element) : this._config.placement; + const attachment = AttachmentMap[placement.toUpperCase()]; + return createPopper(this._element, tip, this._getPopperConfig(attachment)); + } + + _getOffset() { + const { + offset + } = this._config; + + if (typeof offset === 'string') { + return offset.split(',').map(value => Number.parseInt(value, 10)); + } + + if (typeof offset === 'function') { + return popperData => offset(popperData, this._element); + } + + return offset; + } + + _resolvePossibleFunction(arg) { + return typeof arg === 'function' ? arg.call(this._element) : arg; + } + + _getPopperConfig(attachment) { + const defaultBsPopperConfig = { + placement: attachment, + modifiers: [{ + name: 'flip', + options: { + fallbackPlacements: this._config.fallbackPlacements + } + }, { + name: 'offset', + options: { + offset: this._getOffset() + } + }, { + name: 'preventOverflow', + options: { + boundary: this._config.boundary + } + }, { + name: 'arrow', + options: { + element: `.${this.constructor.NAME}-arrow` + } + }, { + name: 'preSetPlacement', + enabled: true, + phase: 'beforeMain', + fn: data => { + // Pre-set Popper's placement attribute in order to read the arrow sizes properly. + // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement + this._getTipElement().setAttribute('data-popper-placement', data.state.placement); + } + }] + }; + return { ...defaultBsPopperConfig, + ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig) + }; + } + + _setListeners() { + const triggers = this._config.trigger.split(' '); + + for (const trigger of triggers) { + if (trigger === 'click') { + EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => this.toggle(event)); + } else if (trigger !== TRIGGER_MANUAL) { + const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1); + const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1); + EventHandler.on(this._element, eventIn, this._config.selector, event => { + const context = this._initializeOnDelegatedTarget(event); + + context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true; + + context._enter(); + }); + EventHandler.on(this._element, eventOut, this._config.selector, event => { + const context = this._initializeOnDelegatedTarget(event); + + context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget); + + context._leave(); + }); + } + } + + this._hideModalHandler = () => { + if (this._element) { + this.hide(); + } + }; + + EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler); + + if (this._config.selector) { + this._config = { ...this._config, + trigger: 'manual', + selector: '' + }; + } else { + this._fixTitle(); + } + } + + _fixTitle() { + const title = this._config.originalTitle; + + if (!title) { + return; + } + + if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) { + this._element.setAttribute('aria-label', title); + } + + this._element.removeAttribute('title'); + } + + _enter() { + if (this._isShown() || this._isHovered) { + this._isHovered = true; + return; + } + + this._isHovered = true; + + this._setTimeout(() => { + if (this._isHovered) { + this.show(); + } + }, this._config.delay.show); + } + + _leave() { + if (this._isWithActiveTrigger()) { + return; + } + + this._isHovered = false; + + this._setTimeout(() => { + if (!this._isHovered) { + this.hide(); + } + }, this._config.delay.hide); + } + + _setTimeout(handler, timeout) { + clearTimeout(this._timeout); + this._timeout = setTimeout(handler, timeout); + } + + _isWithActiveTrigger() { + return Object.values(this._activeTrigger).includes(true); + } + + _getConfig(config) { + const dataAttributes = Manipulator.getDataAttributes(this._element); + + for (const dataAttribute of Object.keys(dataAttributes)) { + if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) { + delete dataAttributes[dataAttribute]; + } + } + + config = { ...dataAttributes, + ...(typeof config === 'object' && config ? config : {}) + }; + config = this._mergeConfigObj(config); + config = this._configAfterMerge(config); + + this._typeCheckConfig(config); + + return config; + } + + _configAfterMerge(config) { + config.container = config.container === false ? document.body : getElement(config.container); + + if (typeof config.delay === 'number') { + config.delay = { + show: config.delay, + hide: config.delay + }; + } + + config.originalTitle = this._element.getAttribute('title') || ''; + + if (typeof config.title === 'number') { + config.title = config.title.toString(); + } + + if (typeof config.content === 'number') { + config.content = config.content.toString(); + } + + return config; + } + + _getDelegateConfig() { + const config = {}; + + for (const key in this._config) { + if (this.constructor.Default[key] !== this._config[key]) { + config[key] = this._config[key]; + } + } // In the future can be replaced with: + // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]]) + // `Object.fromEntries(keysWithDifferentValues)` + + + return config; + } + + _disposePopper() { + if (this._popper) { + this._popper.destroy(); + + this._popper = null; + } + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Tooltip.getOrCreateInstance(this, config); + + if (typeof config !== 'string') { + return; + } + + if (typeof data[config] === 'undefined') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](); + }); + } + + } + /** + * jQuery + */ + + + defineJQueryPlugin(Tooltip); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): popover.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$3 = 'popover'; + const SELECTOR_TITLE = '.popover-header'; + const SELECTOR_CONTENT = '.popover-body'; + const Default$2 = { ...Tooltip.Default, + content: '', + offset: [0, 8], + placement: 'right', + template: '', + trigger: 'click' + }; + const DefaultType$2 = { ...Tooltip.DefaultType, + content: '(null|string|element|function)' + }; + /** + * Class definition + */ + + class Popover extends Tooltip { + // Getters + static get Default() { + return Default$2; + } + + static get DefaultType() { + return DefaultType$2; + } + + static get NAME() { + return NAME$3; + } // Overrides + + + _isWithContent() { + return this._getTitle() || this._getContent(); + } // Private + + + _getContentForTemplate() { + return { + [SELECTOR_TITLE]: this._getTitle(), + [SELECTOR_CONTENT]: this._getContent() + }; + } + + _getContent() { + return this._resolvePossibleFunction(this._config.content); + } // Static + + + static jQueryInterface(config) { + return this.each(function () { + const data = Popover.getOrCreateInstance(this, config); + + if (typeof config !== 'string') { + return; + } + + if (typeof data[config] === 'undefined') { + throw new TypeError(`No method named "${config}"`); + } + + data[config](); + }); + } + + } + /** + * jQuery + */ + + + defineJQueryPlugin(Popover); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v5.2.1): scrollspy.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + * -------------------------------------------------------------------------- + */ + /** + * Constants + */ + + const NAME$2 = 'scrollspy'; + const DATA_KEY$2 = 'bs.scrollspy'; + const EVENT_KEY$2 = `.${DATA_KEY$2}`; + const DATA_API_KEY = '.data-api'; + const EVENT_ACTIVATE = `activate${EVENT_KEY$2}`; + const EVENT_CLICK = `click${EVENT_KEY$2}`; + const EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`; + const CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item'; + const CLASS_NAME_ACTIVE$1 = 'active'; + const SELECTOR_DATA_SPY = '[data-bs-spy="scroll"]'; + const SELECTOR_TARGET_LINKS = '[href]'; + const SELECTOR_NAV_LIST_GROUP = '.nav, .list-group'; + const SELECTOR_NAV_LINKS = '.nav-link'; + const SELECTOR_NAV_ITEMS = '.nav-item'; + const SELECTOR_LIST_ITEMS = '.list-group-item'; + const SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`; + const SELECTOR_DROPDOWN = '.dropdown'; + const SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle'; + const Default$1 = { + offset: null, + // TODO: v6 @deprecated, keep it for backwards compatibility reasons + rootMargin: '0px 0px -25%', + smoothScroll: false, + target: null, + threshold: [0.1, 0.5, 1] + }; + const DefaultType$1 = { + offset: '(number|null)', + // TODO v6 @deprecated, keep it for backwards compatibility reasons + rootMargin: 'string', + smoothScroll: 'boolean', + target: 'element', + threshold: 'array' + }; + /** + * Class definition + */ + + class ScrollSpy extends BaseComponent { + constructor(element, config) { + super(element, config); // this._element is the observablesContainer and config.target the menu links wrapper + + this._targetLinks = new Map(); + this._observableSections = new Map(); + this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element; + this._activeTarget = null; + this._observer = null; + this._previousScrollData = { + visibleEntryTop: 0, + parentScrollTop: 0 + }; + this.refresh(); // initialize + } // Getters + + + static get Default() { + return Default$1; + } + + static get DefaultType() { + return DefaultType$1; + } + + static get NAME() { + return NAME$2; + } // Public + + + refresh() { + this._initializeTargetsAndObservables(); + + this._maybeEnableSmoothScroll(); + + if (this._observer) { + this._observer.disconnect(); + } else { + this._observer = this._getNewObserver(); + } + + for (const section of this._observableSections.values()) { + this._observer.observe(section); + } + } + + dispose() { + this._observer.disconnect(); + + super.dispose(); + } // Private + + + _configAfterMerge(config) { + // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case + config.target = getElement(config.target) || document.body; // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only + + config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin; + + if (typeof config.threshold === 'string') { + config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value)); + } + + return config; + } + + _maybeEnableSmoothScroll() { + if (!this._config.smoothScroll) { + return; + } // unregister any previous listeners + + + EventHandler.off(this._config.target, EVENT_CLICK); + EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => { + const observableSection = this._observableSections.get(event.target.hash); + + if (observableSection) { + event.preventDefault(); + const root = this._rootElement || window; + const height = observableSection.offsetTop - this._element.offsetTop; + + if (root.scrollTo) { + root.scrollTo({ + top: height, + behavior: 'smooth' + }); + return; + } // Chrome 60 doesn't support `scrollTo` + + + root.scrollTop = height; + } + }); + } + + _getNewObserver() { + const options = { + root: this._rootElement, + threshold: this._config.threshold, + rootMargin: this._config.rootMargin + }; + return new IntersectionObserver(entries => this._observerCallback(entries), options); + } // The logic of selection + + + _observerCallback(entries) { + const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`); + + const activate = entry => { + this._previousScrollData.visibleEntryTop = entry.target.offsetTop; + + this._process(targetElement(entry)); + }; + + const parentScrollTop = (this._rootElement || document.documentElement).scrollTop; + const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop; + this._previousScrollData.parentScrollTop = parentScrollTop; + + for (const entry of entries) { + if (!entry.isIntersecting) { + this._activeTarget = null; + + this._clearActiveClass(targetElement(entry)); + + continue; + } + + const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop; // if we are scrolling down, pick the bigger offsetTop + + if (userScrollsDown && entryIsLowerThanPrevious) { + activate(entry); // if parent isn't scrolled, let's keep the first visible item, breaking the iteration + + if (!parentScrollTop) { + return; + } + + continue; + } // if we are scrolling up, pick the smallest offsetTop + + + if (!userScrollsDown && !entryIsLowerThanPrevious) { + activate(entry); + } + } + } + + _initializeTargetsAndObservables() { + this._targetLinks = new Map(); + this._observableSections = new Map(); + const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target); + + for (const anchor of targetLinks) { + // ensure that the anchor has an id and is not disabled + if (!anchor.hash || isDisabled(anchor)) { + continue; + } + + const observableSection = SelectorEngine.findOne(anchor.hash, this._element); // ensure that the observableSection exists & is visible + + if (isVisible(observableSection)) { + this._targetLinks.set(anchor.hash, anchor); + + this._observableSections.set(anchor.hash, observableSection); + } + } + } + + _process(target) { + if (this._activeTarget === target) { + return; + } + + this._clearActiveClass(this._config.target); + + this._activeTarget = target; + target.classList.add(CLASS_NAME_ACTIVE$1); + + this._activateParents(target); + + EventHandler.trigger(this._element, EVENT_ACTIVATE, { + relatedTarget: target + }); + } + + _activateParents(target) { + // Activate dropdown parents + if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) { + SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1); + return; + } + + for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) { + // Set triggered links parents as active + // With both